Alfa Chemistry. 2 - Products
Alfa Chemistry is an ISO 9001:2015 Certified Supplier of various building blocks, reagents, catalysts, nanomaterials, reference materials, and research chemicals. In-stock products can be shipped quickly.
| Product | Description | |
|---|---|---|
| Methyl 2-[2-(4-chlorophenyl)ethyl]-6-hydroxybenzoate | Heterocyclic Organic Compound. CAS No. 1171924-95-0. Molecular formula: C16H15ClO3. Mole weight: 290.742. Purity: 0.96. Catalog: ACM1171924950. |  |
| Methyl 2-[2-(4-chlorophenyl)ethyl]-6-methoxybenzoate | Heterocyclic Organic Compound. CAS No. 1171924-62-1. Molecular formula: C17H17ClO3. Mole weight: 304.768. Purity: 0.96. Catalog: ACM1171924621. | |
| Methyl 2-{[(2,4-dichlorophenyl)methoxy]methyl}-6-methoxybenzoate | Heterocyclic Organic Compound. CAS No. 1171923-92-4. Molecular formula: C17H16Cl2O4. Mole weight: 355.213. Purity: 0.96. Catalog: ACM1171923924. | |
| Methyl 2-{[(2,4-dimethylphenyl)methoxy]methyl}-6-methoxybenzoate | Heterocyclic Organic Compound. CAS No. 1171923-89-9. Molecular formula: C19H22O4. Mole weight: 314.3756. Purity: 0.96. Catalog: ACM1171923899. | |
| Methyl 2-[2-(5-iodothiophen-2-yl)ethyl]-6-methoxybenzoate | Heterocyclic Organic Compound. CAS No. 1171924-34-7. Molecular formula: C15H15IO3S. Mole weight: 402.247. Purity: 0.96. Catalog: ACM1171924347. | |
| Methyl 2-[(2,6-dichlorobenzyl)thio]acetate | Heterocyclic Organic Compound. Alternative Names: METHYL 2-[(2,6-DICHLOROBENZYL)THIO]ACETATE. CAS No. 118608-90-5. Molecular formula: C10H10Cl2O2S. Mole weight: 265.16. Catalog: ACM118608905. | |
| Methyl 2-[2-(anthracen-9-yl)ethyl]-6-hydroxybenzoate | Heterocyclic Organic Compound. CAS No. 1171924-98-3. Molecular formula: C24H20O3. Mole weight: 356.4138. Purity: 0.96. Catalog: ACM1171924983. | |
| Methyl 2-{[(2-chlorophenyl)methoxy]methyl}-6-methoxybenzoate | Heterocyclic Organic Compound. CAS No. 1171923-79-7. Molecular formula: C17H17ClO4. Mole weight: 320.767. Purity: 0.96. Catalog: ACM1171923797. | |
| Methyl 2-{[(2-chlorophenyl)methoxy]methyl}benzoate | Heterocyclic Organic Compound. CAS No. 1171923-29-7. Molecular formula: C16H15ClO3. Mole weight: 290.742. Purity: 0.96. IUPACName: N-(1,3-benzodioxol-5-yl)-2-(6,7-dimethoxy-3-methylquinolin-2-yl)sulfanylacetamide. Canonical SMILES: CC1=C (N=C2C=C (C (=CC2=C1)OC)OC)SCC (=O)NC3=CC4=C (C=C3)OCO4. Catalog: ACM1171923297. | |
| Methyl 2-{[(2-methylphenyl)methoxy]methyl}benzoate | Heterocyclic Organic Compound. CAS No. 1171923-18-4. Molecular formula: C17H18O3. Mole weight: 270.323. Purity: 0.96. Catalog: ACM1171923184. | |
| Methyl 2-[2-(naphthalen-2-yl)ethyl]-6-(propan-2-yloxy)benzoate | Heterocyclic Organic Compound. CAS No. 1171921-44-0. Molecular formula: C23H24O3. Mole weight: 348.4349. Purity: 0.96. Catalog: ACM1171921440. | |
| Methyl 2-[3-(2,4-dichlorophenyl)propyl]-6-methoxybenzoate | Heterocyclic Organic Compound. CAS No. 1171923-45-7. Molecular formula: C18H18Cl2O3. Mole weight: 353.24. Purity: 0.96. Catalog: ACM1171923457. | |
| Methyl 2-[3-(2,5-dimethylphenyl)propyl]-6-methoxybenzoate | Heterocyclic Organic Compound. CAS No. 1171923-73-1. Molecular formula: C20H24O3. Mole weight: 312.4028. Purity: 0.96. Catalog: ACM1171923731. | |
| Methyl 2-[3-(2-chlorophenyl)propyl]-6-methoxybenzoate | Heterocyclic Organic Compound. CAS No. 1171923-84-4. Molecular formula: C18H19ClO3. Mole weight: 318.795. Purity: 0.96. Catalog: ACM1171923844. | |
| Methyl 2-[3-(3,4-dichlorophenyl)propyl]-6-methoxybenzoate | Heterocyclic Organic Compound. CAS No. 1171923-70-8. Molecular formula: C18H18Cl2O3. Mole weight: 353.24. Purity: 0.96. Catalog: ACM1171923708. | |
| Methyl 2-[3-(3-chlorophenyl)propyl]-6-methoxybenzoate | Heterocyclic Organic Compound. CAS No. 1171923-22-0. Molecular formula: C18H19ClO3. Mole weight: 318.795. Purity: 0.96. Catalog: ACM1171923220. | |
| Methyl 2-[3-(4-chlorophenyl)propyl]-6-methoxybenzoate | Heterocyclic Organic Compound. CAS No. 1171923-75-3. Molecular formula: C18H19ClO3. Mole weight: 318.795. Purity: 0.96. Catalog: ACM1171923753. | |
| Methyl 2-{[(3,4-dichlorophenyl)methoxy]methyl}-6-methoxybenzoate | Heterocyclic Organic Compound. CAS No. 1171923-68-4. Molecular formula: C17H16Cl2O4. Mole weight: 355.213. Purity: 0.96. Catalog: ACM1171923684. | |
| Methyl 2,3,4-tri-O-benzoyl-α-D-glucopyranoside | Non-ionic Detergents. CAS No. 52621-71-3. Molecular formula: C28H26O9. Mole weight: 506.5. Purity: ≥95%. | |
| Methyl 2-[3-(5-tert-butyl-2-methylphenyl)propyl]-6-methoxybenzoate | Heterocyclic Organic Compound. CAS No. 1171923-88-8. Molecular formula: C23H30O3. Mole weight: 354.4825. Purity: 0.96. Catalog: ACM1171923888. | |
| Methyl 2-(4-bromophenyl)-2,2-di-(methyl-d3)acetate | Heterocyclic Organic Compound. Alternative Names: METHYL 2-(4-BROMOPHENYL)-2,2-DI-(METHYL-D3)ACETATE. CAS No. 1185004-76-5. Molecular formula: C11H7BrD6O2. Mole weight: 263.16. Appearance: Colourless Oil. Catalog: ACM1185004765. | |
| Methyl 2-{[(4-chlorophenyl)methoxy]methyl}-6-methoxybenzoate | Heterocyclic Organic Compound. CAS No. 1171923-96-8. Molecular formula: C17H17ClO4. Mole weight: 320.767. Purity: 0.96. Catalog: ACM1171923968. | |
| Methyl 2,4-dihydroxybenzoate | Use as antioxidant. Use as intermediate in organic synthesis. Group: Non-ionic surfactants. Alternative Names: Benzoic acid, 2,4-dihydroxy-, methyl ester. CAS No. 2150-47-2. Molecular formula: C8H8O4. Mole weight: 168.15. Catalog: ACM2150472. | |
| Methyl 2-(5,9-dimethyldecyl)-6-hydroxybenzoate | Heterocyclic Organic Compound. CAS No. 1171921-46-2. Molecular formula: C20H32O3. Mole weight: 320.4663. Purity: 0.96. Catalog: ACM1171921462. | |
| Methyl 2-{[(5-tert-butyl-2-methylphenyl)methoxy]methyl}-6-methoxybenzoate | Heterocyclic Organic Compound. CAS No. 1171923-83-3. Molecular formula: C22H28O4. Mole weight: 356.4553. Purity: 0.96. Catalog: ACM1171923833. | |
| Methyl 2,6-difluoronicotinate | Heterocyclic Organic Compound. Alternative Names: METHYL 2,6-DIFLUORONICOTINATE. CAS No. 117671-02-0. Molecular formula: C7H5F2NO2. Mole weight: 173.1169064. Catalog: ACM117671020. | |
| Methyl 2-acetamido-1,3-thiazole-5-carboxylate 97% | Heterocyclic Organic Compound. Alternative Names: Methyl 2-(acetylamino)-1,3-thiazole-5-carboxylate, 2-Acetamido-5-(methoxycarbonyl)-1,3-thiazole. CAS No. 1174534-36-1. Molecular formula: C7H8N2O3S. Mole weight: 200.2172. Purity: 0.96. IUPACName: methyl 2-acetamido-1,3-thiazole-5-carboxylate. Canonical SMILES: CC(=O)NC1=NC=C(S1)C(=O)OC. Catalog: ACM1174534361. | |
| Methyl 2-amino-3,6-dimethoxybenzoate | Heterocyclic Organic Compound. Alternative Names: 3,6-dimethoxy-2-methylbenzoic acid, 116324-66-4, AC1MBK9Y, SureCN11906262, MolPort-003-661-226, ANW-68062, AKOS004907079, AK-80793, KB-234348. CAS No. 116324-66-4. Molecular formula: C10H12O4. Mole weight: 196.199880 [g/mol]. Purity: 0.96. IUPACName: 3,6-dimethoxy-2-methylbenzoic acid. Canonical SMILES: CC1=C(C=CC(=C1C(=O)O)OC)OC. Catalog: ACM116324664. | |
| Methyl 2-amino-4-(3-methoxyphenyl)pyrimidine-5-carboxylate | Heterocyclic Organic Compound. Alternative Names: 1187385-80-3, METHYL 2-AMINO-4-(3-METHOXYPHENYL)PYRIMIDINE-5-CARBOXYLATE, ACMC-2099yn, CTK4B0830, ANW-17181, AKOS015854846, AG-L-20561, AK-91169, BD229586, KB-53794, A-5268, I03-857, Methyl 2-amino-4-(3-methoxyphenyl)pyrimidine-5-carboxylate. CAS No. 1187385-80-3. Molecular formula: C13H13N3O3. Mole weight: 259.3. Purity: 0.96. IUPACName: methyl 2-amino-4-(3-methoxyphenyl)pyrimidine-5-carboxylate. Canonical SMILES: COC1=CC=CC(=C1)C2=NC(=NC=C2C(=O)OC)N. Catalog: ACM1187385803. | |
| Methyl 2-{[benzyl(methyl)amino]methyl}-6-methoxybenzoate | Heterocyclic Organic Compound. CAS No. 1171923-14-0. Molecular formula: C18H21NO3. Mole weight: 299.3642. Purity: 0.96. Catalog: ACM1171923140. | |
| Methyl 2-bromo-3-(4'-fluorophenyl)-3-oxopropanoate | Heterocyclic Organic Compound. Alternative Names: Methyl 2-bromo-3-(4-fluorophenyl)-3-oxopropanoate, 1001922-15-1, CTK8B8423, ANW-60312, AKOS015891262, AK101298, KB-204828, I01-8774, methyl 2-bromo-3-(4-fluorophenyl)-3-oxopropanoate. CAS No. 1001922-15-1. Molecular formula: C10H8BrFO3. Mole weight: 275.071123 [g/mol]. Purity: 0.96. IUPACName: methyl 2-bromo-3-(4-fluorophenyl)-3-oxopropanoate. Canonical SMILES: COC(=O)C(C(=O)C1=CC=C(C=C1)F)Br. Catalog: ACM1001922151. | |
| Methyl 2-bromo-3-methyl-3H-imidazo[4,5-b]pyridine-6-carboxylate | Heterocyclic Organic Compound. Alternative Names: Methyl 2-bromo-3-methyl-3H-imidazo[4,5-b]pyridine-6-carboxylate, 1187830-49-4, CTK8B5373, ANW-48535, SC2691, AKOS015851555, RP09531, AK-77871, BD224361, BR-77871, KB-255673, FT-0685722, X9279, methyl 2-bromo-3-methylimidazo[4,5-b]pyridine-6-carboxylate. CAS No. 1187830-49-4. Molecular formula: C9H8BrN3O2. Mole weight: 270.08. Purity: 0.96. IUPACName: methyl 2-bromo-3-methylimidazo[4,5-b]pyridine-6-carboxylate. Catalog: ACM1187830494. | |
| Methyl 2-(bromomethyl)acrylate | Methyl (2-bromomethyl)acrylate (MBrMA) may be used as chain transfer agents in the emulsion polymerization of methyl methacrylate (MMA) and styrene. MBrMA can undergo nucleophilic substitution of carboxylic acid to form methyl 2-(acyloxymethyl)acrylates. Group: Bromine series. Alternative Names: 2- (bromomethyl)-2-propenoicacimethylester; 2- (bromomethyl)-acrylicacimethylester; methyl2- (bromomethyl)-2-propenoate; 2-BROMOMETHYL METHYL ACRYLATE;METHYL 2-(BROMOMETHYL)ACRYLATE; alpha-(Bromomethyl)-acrylic acid methyl ester;2-Propenoic acid, 2-(bromomethyl). CAS No. 4224-69-5. Molecular formula: H2C=C(CH2Br)CO2CH3. Mole weight: 179.01. Canonical SMILES: COC(=O)C(=C)CBr. Density: 1.489 g/mL at 25 °C (lit.). Catalog: ACM4224695-1. | |
| Methyl 2-cyano-3-(dimethylamino)acrylate | Heterocyclic Organic Compound. CAS No. 1187-27-5. Molecular formula: C7H10N2O2. Mole weight: 154.17. Catalog: ACM1187275. | |
| Methyl 2-[(E)-2-(1H-indol-3-yl)ethenyl]-6-methoxybenzoate | Heterocyclic Organic Compound. CAS No. 1171924-38-1. Molecular formula: C19H17NO3. Mole weight: 307.3432. Purity: 0.96. Catalog: ACM1171924381. | |
| Methyl 2-[(E)-2-(2,4-dichlorophenyl)ethenyl]-6-hydroxybenzoate | Heterocyclic Organic Compound. CAS No. 1171921-77-9. Molecular formula: C16H12Cl2O3. Mole weight: 323.171. Purity: 0.96. Catalog: ACM1171921779. | |
| Methyl 2-[(E)-2-(3,4-dichlorophenyl)ethenyl]-6-hydroxybenzoate | Heterocyclic Organic Compound. CAS No. 1171921-85-9. Molecular formula: C16H12Cl2O3. Mole weight: 323.171. Purity: 0.96. Catalog: ACM1171921859. | |
| Methyl 2-[(E)-2-(4-chlorophenyl)ethenyl]-6-hydroxybenzoate | Heterocyclic Organic Compound. CAS No. 1171924-99-4. Molecular formula: C16H13ClO3. Mole weight: 288.726. Purity: 0.96. Catalog: ACM1171924994. | |
| Methyl 2-[(E)-2-{5-[4-(benzyloxy)phenyl]thiophen-2-yl}ethenyl]-6-methoxybenzoate | Heterocyclic Organic Compound. CAS No. 1171924-12-1. Molecular formula: C28H24O4S. Mole weight: 456.553. Purity: 0.96. IUPACName: 5,6-dimethyl-4-(1-methyltetrazol-5-yl)sulfanylthieno[2,3-d]pyrimidine. Canonical SMILES: CC1=C(SC2=C1C(=NC=N2)SC3=NN=NN3C)C. Catalog: ACM1171924121. | |
| Methyl 2-[(E)-2-(anthracen-9-yl)ethenyl]-6-hydroxybenzoate | Heterocyclic Organic Compound. CAS No. 1171921-75-7. Molecular formula: C24H18O3. Mole weight: 354.3979. Purity: 0.96. Catalog: ACM1171921757. | |
| Methyl 2-[(E)-2-(furan-2-yl)ethenyl]-6-methoxybenzoate | Heterocyclic Organic Compound. CAS No. 1171924-20-1. Molecular formula: C15H14O4. Mole weight: 258.2693. Purity: 0.96. Catalog: ACM1171924201. | |
| Methyl 2-hydroxy-2-(trifluoromethyl)-4-pentenoate | Heterocyclic Organic Compound. Alternative Names: METHYL 2-HYDROXY-2-(TRIFLUOROMETHYL)-4-PENTENOATE;2-HYDROXY-2-TRIFLUOROMETHYL-PENT-4-ENOIC ACID METHYL ESTER;Methly 2-hydroxy-2-(trifluoromethyl)-4-pentenoate. CAS No. 117015-45-9. Molecular formula: C7H9F3O3. Mole weight: 198.14. Catalog: ACM117015459. | |
| Methyl 2-hydroxy-4-methyl-2-(trifluoromethyl)pent-4-enoate 98% | Heterocyclic Organic Compound. Alternative Names: 2-(Methoxycarbonyl)-4-methyl-1,1,1-trifluoropent-4-en-2-ol. CAS No. 117015-42-6. Molecular formula: C8H11F3O3. Mole weight: 212.17. Purity: 0.96. IUPACName: methyl 2-hydroxy-4-methyl-2-(trifluoromethyl)pent-4-enoate. Canonical SMILES: CC(=C)CC(C(=O)OC)(C(F)(F)F)O. Catalog: ACM117015426. | |
| Methyl 2-hydroxy-5-iodonicotinate | Heterocyclic Organic Compound. CAS No. 116387-40-7. Molecular formula: C7H6INO3. Mole weight: 279.03. Catalog: ACM116387407. | |
| Methyl 2-hydroxy-6-[(1E,3E,5E,7E,9E,11E)-12-[3-hydroxy-2-(methoxycarbonyl)phenyl]dodeca-1,3,5,7,9,11-hexaen-1-yl]benzoate | Heterocyclic Organic Compound. CAS No. 1171924-03-0. Molecular formula: C28H26O6. Mole weight: 458.5024. Purity: 0.96. Catalog: ACM1171924030. | |
| Methyl 2-hydroxy-6-[2-(4-phenylphenyl)ethyl]benzoate | Heterocyclic Organic Compound. CAS No. 1171924-93-8. Molecular formula: C22H20O3. Mole weight: 332.3924. Purity: 0.96. Catalog: ACM1171924938. | |
| Methyl 2-hydroxy-6-[2-(naphthalen-1-yl)ethyl]benzoate | Heterocyclic Organic Compound. CAS No. 1171921-82-6. Molecular formula: C20H18O3. Mole weight: 306.3551. Purity: 0.96. Catalog: ACM1171921826. | |
| Methyl 2-hydroxy-6-[2-(naphthalen-2-yl)ethyl]benzoate | Heterocyclic Organic Compound. CAS No. 1171921-63-3. Molecular formula: C20H18O3. Mole weight: 306.3551. Purity: 0.96. Catalog: ACM1171921633. | |
| Methyl 2-hydroxy-6-[2-(pyridin-2-yl)ethyl]benzoate | Heterocyclic Organic Compound. CAS No. 1171924-09-6. Molecular formula: C15H15NO3. Mole weight: 257.2845. Purity: 0.96. Catalog: ACM1171924096. | |
| Methyl 2-hydroxy-6-[2-(pyridin-4-yl)ethyl]benzoate | Heterocyclic Organic Compound. CAS No. 1171924-11-0. Molecular formula: C15H15NO3. Mole weight: 257.2845. Purity: 0.96. IUPACName: N-benzyl-2-[2-(3,4-dimethoxyphenyl)-6,8-dimethyl-4-oxochromen-3-yl]oxyacetamide. Canonical SMILES: CC1=CC (=C2C (=C1)C (=O)C (=C (O2)C3=CC (=C (C=C3)OC)OC)OCC (=O)NCC4=CC=CC=C4)C. Catalog: ACM1171924110. | |
| Methyl 2-hydroxy-6-[(E)-2-(4-phenylphenyl)ethenyl]benzoate | Heterocyclic Organic Compound. CAS No. 1171924-89-2. Molecular formula: C22H18O3. Mole weight: 330.3765. Purity: 0.96. Catalog: ACM1171924892. | |
| Methyl 2-hydroxy-6-[(E)-2-(pyridin-4-yl)ethenyl]benzoate | Heterocyclic Organic Compound. CAS No. 1171924-29-0. Molecular formula: C15H13NO3. Mole weight: 255.2686. Purity: 0.96. Catalog: ACM1171924290. | |
| Methyl 2-hydroxy-6-nonylbenzoate | Heterocyclic Organic Compound. CAS No. 1171921-71-3. Molecular formula: C17H26O3. Mole weight: 278.3865. Purity: 0.96. Catalog: ACM1171921713. | |
| Methyl 2-Hydroxytricosanoate | Heterocyclic Organic Compound. Alternative Names: 2-Hydroxytricosanoic acid Methyl ester. CAS No. 118745-41-8. Molecular formula: C24H48O3. Mole weight: 384.64. Purity: 98%+. Catalog: ACM118745418. | |
| Methyl 2-methoxy-6-[(1E)-3-phenoxyprop-1-en-1-yl]benzoate | Heterocyclic Organic Compound. CAS No. 1171921-84-8. Molecular formula: C18H18O4. Mole weight: 298.3331. Purity: 0.96. Catalog: ACM1171921848. | |
| Methyl 2-methoxy-6-[(1E)-6-phenylhex-1-en-1-yl]benzoate | Heterocyclic Organic Compound. CAS No. 1171924-73-4. Molecular formula: C21H24O3. Mole weight: 324.4135. Purity: 0.96. Catalog: ACM1171924734. | |
| Methyl 2-methoxy-6-[2-(4-phenylphenyl)ethyl]benzoate | Heterocyclic Organic Compound. CAS No. 1171921-39-3. Molecular formula: C23H22O3. Mole weight: 346.419. Purity: 0.96. Catalog: ACM1171921393. | |
| Methyl 2-methoxy-6-[2-(naphthalen-1-yl)ethyl]benzoate | Heterocyclic Organic Compound. CAS No. 1171921-51-9. Molecular formula: C21H20O3. Mole weight: 320.3817. Purity: 0.96. Catalog: ACM1171921519. | |
| Methyl 2-methoxy-6-[2-(naphthalen-2-yl)ethyl]benzoate | Heterocyclic Organic Compound. CAS No. 1171924-79-0. Molecular formula: C21H20O3. Mole weight: 320.3817. Purity: 0.96. Catalog: ACM1171924790. | |
| Methyl 2-methoxy-6-(2-phenylethoxy)benzoate | Heterocyclic Organic Compound. CAS No. 1171923-27-5. Molecular formula: C17H18O4. Mole weight: 286.3224. Purity: 0.96. Catalog: ACM1171923275. | |
| Methyl 2-methoxy-6-(3-phenoxypropyl)benzoate | Heterocyclic Organic Compound. CAS No. 1171921-65-5. Molecular formula: C18H20O4. Mole weight: 300.349. Purity: 0.96. Catalog: ACM1171921655. | |
| Methyl 2-methoxy-6-(6-phenylhexyl)benzoate | Heterocyclic Organic Compound. CAS No. 1171921-59-7. Molecular formula: C21H26O3. Mole weight: 326.4293. Purity: 0.96. Catalog: ACM1171921597. | |
| Methyl 2-methoxy-6-[(E)-2-(naphthalen-1-yl)ethenyl]benzoate | Heterocyclic Organic Compound. CAS No. 1171921-69-9. Molecular formula: C21H18O3. Mole weight: 318.3658. Purity: 0.96. Catalog: ACM1171921699. | |
| Methyl 2-methoxy-6-[(E)-2-(thiophen-2-yl)ethenyl]benzoate | Heterocyclic Organic Compound. CAS No. 1171924-45-0. Molecular formula: C15H14O3S. Mole weight: 274.335. Purity: 0.96. Catalog: ACM1171924450. | |
| Methyl 2-methoxy-6-[(naphthalen-1-ylmethoxy)methyl]benzoate | Heterocyclic Organic Compound. CAS No. 1171923-66-2. Molecular formula: C21H20O4. Mole weight: 336.3811. Purity: 0.96. Catalog: ACM1171923662. | |
| Methyl 2-methoxy-6-[(naphthalen-1-yloxy)methyl]benzoate | Heterocyclic Organic Compound. CAS No. 1171924-19-8. Molecular formula: C20H18O4. Mole weight: 322.3545. Purity: 0.96. Catalog: ACM1171924198. | |
| Methyl 2-methoxy-6-[(naphthalen-2-ylmethoxy)methyl]benzoate | Heterocyclic Organic Compound. CAS No. 1171923-82-2. Molecular formula: C21H20O4. Mole weight: 336.3811. Purity: 0.96. Catalog: ACM1171923822. | |
| Methyl 2-methoxy-6-nonylbenzoate | Heterocyclic Organic Compound. CAS No. 1171921-43-9. Molecular formula: C18H28O3. Mole weight: 292.4131. Purity: 0.96. Catalog: ACM1171921439. | |
| Methyl 2-methoxy-6-[(pyridin-3-ylmethoxy)methyl]benzoate | Heterocyclic Organic Compound. CAS No. 1171923-31-1. Molecular formula: C16H17NO4. Mole weight: 287.3105. Purity: 0.96. Catalog: ACM1171923311. | |
| Methyl 2-methoxy-6-[(pyridin-4-ylmethoxy)methyl]benzoate | Heterocyclic Organic Compound. CAS No. 1171923-34-4. Molecular formula: C16H17NO4. Mole weight: 287.3105. Purity: 0.96. Catalog: ACM1171923344. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.