Alfa Chemistry. 4 - Products
Alfa Chemistry offers an extensive catalog of building blocks, reagents, catalysts, reference materials, and research chemicals in a wide range of applications. In stock products can be shipped quickly.
| Product | Description | |
|---|---|---|
| Glyceryl glycyrrhetinate | Heterocyclic Organic Compound. CAS No. 108916-85-4. Catalog: ACM108916854. |  |
| Glyceryl trinonylate | Heterocyclic Organic Compound. CAS No. 126-53-4. Molecular formula: C30H56O6. Mole weight: 512.78. Catalog: ACM126534. | |
| Glyceryl tri(octadecanoate-d35) | Heterocyclic Organic Compound. Alternative Names: 1,2,3-Tristearoyl glycerol-d105. CAS No. 125941-88-0. Molecular formula: C57H5D105O6. Mole weight: 997.13. Purity: 98 atom % D. IUPACName: 2, 3-bis (2, 2, 3, 3, 4, 4, 5, 5, 6, 6, 7, 7, 8, 8, 9, 9, 10, 10, 11, 11, 12, 12, 13, 13, 14, 14, 15, 15, 16, 16, 17, 17, 18, 18, 18-pentatri acontadeuteriooctadecanoyloxy) propyl 2, 2, 3, 3, 4, 4, 5, 5, 6, 6, 7, 7, 8, 8, 9, 9, 10, 10, 11, 11, 12, 12, 13, 13, 14, 14, 15, 15, 16, 16, 17, 17, 18, 18, 18-pentatriacontadeuteriooctadecanoate. Catalog: ACM125941880. | |
| Glycidyl linolenate-d5 | Fatty Acids and Fatty Acid Esters2H Labeled Compounds. CAS No. 1287393-54-7. Molecular formula: C21H29D5O3. Mole weight: 339.52. Catalog: ACM1287393547. | |
| Glycine,l-arginyl-,dihydrochloride(9ci) | Heterocyclic Organic Compound. Alternative Names: L-ARGINYL GLYCINE;H-ARG-GLY-OH;arg-gly hydrochloride;L-arginyl-glycine hydrochloride. CAS No. 108347-93-9. Molecular formula: C8H17N5O3.2ClH. Mole weight: 231.25. Purity: 0.96. IUPACName: 2-[[ (2S) -2-amino-5- (diaminomethylideneamino) pentanoyl]amino]aceticacid. Canonical SMILES: C(CC(C(=O)NCC(=O)O)N)CN=C(N)N. Catalog: ACM108347939. | |
| Glycine,N-methyl-N-(1-thioxohexyl)- | Heterocyclic Organic Compound. CAS No. 107648-72-6. Catalog: ACM107648726. | |
| Glycine, N, N'-[1, 2-ethanediylbis[oxy (4-nitro-2, 1-phenylene)]]bis[n- (carboxymethyl)- (9ci) | Heterocyclic Organic Compound. Alternative Names: 5,5'-DINITRO BAPTA. CAS No. 125367-32-0. Molecular formula: C22H22N4O14. Mole weight: 566.43. Purity: 0.96. IUPACName: 2-[2-[2-[2-[bis (carboxymethyl)amino]-4-nitrophenoxy]ethoxy]-N- (carboxymethyl)-5-nitroanilino]aceticacid. Canonical SMILES: C1=CC (=C (C=C1[N+] (=O)[O-])N (CC (=O)O)CC (=O)O)OCCOC2=C (C=C (C=C2)[N+] (=O)[O-])N (CC (=O)O)CC (=O)O. Density: 1.653g/cm³. Catalog: ACM125367320. | |
| Glycine,N-[s-[2-(2-amino-1,6-dihydro-6-oxo-7H-purin-7-yl)ethyl]-N-L-g-glutamyl-L-cysteinyl]-,dimethylester(9ci) | Heterocyclic Organic Compound. CAS No. 129570-25-8. Molecular formula: C19H28N8O7S. Mole weight: 512.54. Density: 1.59g/cm³. Catalog: ACM129570258. | |
| Glycinyl-argininyl-glycinyl-aspartyl-serinyl-prolinyl-cysteine | Heterocyclic Organic Compound. Alternative Names: H-GLY-ARG-GLY-ASP-SER-PRO-CYS-OH (COUPLED TO BSA);GLY-ARG-GLY-ASP-SER-PRO-CYS;GRGDSPC;Glycinyl-argininyl-glycinyl-aspartyl-serinyl-prolinyl-cysteine. CAS No. 126646-79-5. Molecular formula: C25H42N10O11S. Mole weight: 690.73. Catalog: ACM126646795. | |
| Glycodeoxycholic-2,2,4,4-d4acid | Heterocyclic Organic Compound. CAS No. 1069132-37-1. Molecular formula: 453.65. Purity: 98 atom % D. Catalog: ACM1069132371. | |
| Glycyroside | Flavonoids. CAS No. 125310-04-5. Molecular formula: C27H30O13. Mole weight: 562.52. Purity: 0.98. Catalog: ACM125310045. | |
| Glycyrrhizic acid monosodium salt | Heterocyclic Organic Compound. CAS No. 11052-19-0. Catalog: ACM11052190. | |
| Glyoxal 40% | Biocide and Algicide. Alternative Names: Glyoxylaldehyd. CAS No. 107-22-2. Molecular formula: C2H2O2. Mole weight: 58.04. Catalog: ACM107222-3. | |
| Glyoxal dithiosemicarbazone | Heterocyclic Organic Compound. Alternative Names: GLYOXAL DITHIOSEMICARBAZONE;GLYOXAL BIS(THIOSEMICARBAZONE);1,2-Ethanedione bis (aminomercaptomethylenehydrazone); 1, 2-Ethanedione bis(thiosemicarbazone);1,2-Ethanedione bisthiosemicarbazone;3,3'-(1,4-Diaza-1,3-butadiene-1,4-diyl)bis(isothiourea);Nsc22181. CAS No. 1072-12-4. Molecular formula: C4H8N6S2. Mole weight: 204.28. Catalog: ACM1072124. | |
| Gold platinum palladium powder,aps 2-5 micron | Heterocyclic Organic Compound. CAS No. 127330-90-9. Molecular formula: Au:Pt:Pd;40:40:20wt%. Catalog: ACM127330909. | |
| Goniopypyrone | Phenols. CAS No. 129578-07-0. Molecular formula: C13H14O5. Mole weight: 250.3. Appearance: Cryst. Purity: 0.98. IUPACName: (1S,3S,4R,5R)-4,9-dihydroxy-3-phenyl-2,6-dioxabicyclo[3.3.1]nonan-7-one. Canonical SMILES: C1C2C(C(C(C(O2)C3=CC=CC=C3)O)OC1=O)O. Catalog: ACM129578070. | |
| Gossypol acetic acid | Heterocyclic Organic Compound. CAS No. 5453-4-3. Molecular formula: C32H34O10. Catalog: ACM1297801. | |
| Gossypol-acetic acid | Gossypol-acetic acid. Alternative Names: aceticacidgossypol;GOSSYPOL ACETATE;GOSSYPOL-ACETIC ACID;1,1,6,6,7,7-hexahydroxy-3,3-dimethyl-5,5-bis(1-methylethyl)[2,2-binaphthalene]-8,8-dicarboxaldehyde-acetic acid; Gossypolaceticacidcomplex; GOSSYPOL ACETATE 98%;GOSSYPOLMONOACETICACID;1, 1, 6, 6, 7, 7-Hexahydroxy-3, 3-dimethyl-5, 5-bis(1-methylethyl)[2, 2-binaphthalene]-8, 8-dicarboxaldehyde-acetic acid. CAS No. 12542-36-8. Molecular formula: C32H34O10. Mole weight: 578.61. Appearance: Yellow crystal powder. Purity: 0.99. IUPACName: aceticacid;7-(8-formyl-1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl)-2,3,8-trihydroxy-6-methyl-4-propan-2-ylnaphthalene-1-carbaldehyde. Canonical SMILES: CC1=C (C (=C2C (=C1)C (=C (C (=C2C=O)O)O)C (C)C)O)C3=C (C=C4C (=C3O)C (=C (C (=C4C (C)C)O)O)C=O)C. CC (=O)O. Catalog: ACM12542368. | |
| Gp 7 | Heterocyclic Organic Compound. Alternative Names: GP 7. CAS No. 125670-69-1. Molecular formula: C22H22O8. Mole weight: 414.408. Purity: 0.96. IUPACName: (5R,5aR,8aS,9S)-9-(4-hydroxy-3,5-dimethoxyphenyl)-5-[(1-$l^{1}-oxidanyl-2,2,6,6-tetramethylpiperidin-4-yl)amino]-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one. Catalog: ACM125670691. | |
| Gpsgfygvr-nh2 | Heterocyclic Organic Compound. Alternative Names: Locustatachykinin I, Lom-TK-I, Tachykinin I (locusta migratoria), CID195503, Gly-pro-ser-gly-phe-tyr-gly-val-arg-NH2, Locustatachykinin I Protein, Locusta Migratoria, 126985-97-5. CAS No. 126985-97-5. Molecular formula: C43H63N13O11. Mole weight: 938.04. Purity: >95%. IUPACName: (2S)-1-(2-aminoacetyl)-N-[(2S)-1-[[2-[[(2S)-1-[[(2S)-1-[[2-[[(2S)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]. Canonical SMILES: CC (C)C (C (=O)NC (CCCN=C (N)N)C (=O)N)NC (=O)CNC (=O)C (CC1=CC=C (C=C1)O)NC (=O)C (CC2=CC=CC=C2)NC (=O)CNC (=O)C (CO)NC (=O)C3CCCN3C (=O)CN. Density: 1.46g/cm³. Catalog: ACM126985975. | |
| Gr 89696 fumarate | Heterocyclic Organic Compound. Alternative Names: GR-89696 fumarate, GR 89696 fumarate salt, G133_SIGMA, MLS000758305, MLS001424140, MolPort-003-941-452, GR 89696, HMS2051L20, 4-[(3,4-Dichlorophenyl)acetyl]-3-, CID6442840, NCGC00093956-01, CPD000466287, GR 85571, GR-89696, SAM001247087, SMR000466287, GR 103545, EU-0100572, G-133, (1-pyrrolidinylmethyl)-1-piperazinecarboxylic acid methyl ester fumarate. CAS No. 126766-32-3. Molecular formula: C23H29Cl2N3O7. Mole weight: 530.4. Purity: >99 %. IUPACName: (E)-but-2-enedioic acid; methyl 4-[2-(3,4-dichlorophenyl)acetyl]-3-(pyrrolidin-1-ylmethyl)piperazine-1-carboxylate. Canonical SMILES: COC (=O)N1CCN (C (C1)CN2CCCC2)C (=O)CC3=CC (=C (C=C3)Cl)Cl. C (=CC (=O)O)C (=O)O. Catalog: ACM126766323. | |
| GRAMICIDIN A | Heterocyclic Organic Compound. CAS No. 11029-61-1. Molecular formula: C99H140N20O17. Mole weight: 1882.29. Catalog: ACM11029611. | |
| Granisetron hydrochlorid | Heterocyclic Organic Compound. CAS No. 107007-99-8. Molecular formula: C18H25ClN4O. Catalog: ACM107007998. | |
| granisetron Related Comp | Heterocyclic Organic Compound. CAS No. 5454-3-18. Catalog: ACM1298150. | |
| Gratioside | Heterocyclic Organic Compound. Alternative Names: Gratioside, EINECS 234-256-1, CID160951, 11024-39-8. CAS No. 11024-39-8. Molecular formula: C36H58O9. Mole weight: 796.980920 [g/mol]. Purity: 0.96. IUPACName: (3S,8S,9R,10R,13R,14S,17S)-4,4,9,13,14-pentamethyl-17-[(2S,5S)-2-methyl-5-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]oxolan-2-yl]-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,7,8,10,12,15,1. Catalog: ACM11024398. | |
| Grgdtp | Heterocyclic Organic Compound. CAS No. 108682-58-2. Molecular formula: C23H39N9O10. Mole weight: 601.61. Catalog: ACM108682582. | |
| Griseofulvin-d3 | 2H Labeled Compounds. CAS No. 1279033-22-5. Molecular formula: C17H14D3ClO6. Mole weight: 355.78. Catalog: ACM1279033225. | |
| Growth hormone,human | Heterocyclic Organic Compound. Alternative Names: cb311; crecormon; humatrope; ly137998; norditropin; sj0011; OVINE SOMATOTROPIN;SOMATOTROPIN. CAS No. 12629-01-5. Molecular formula: C990H1529N263O299S7. Mole weight: 22124.12. Appearance: lyophilized powder. Catalog: ACM12629015. | |
| Gsk1904529a | Heterocyclic Organic Compound. Alternative Names: GSK1904529A;GSK1904529A : IGF-IR, IGF-IIR inhibitor;N-(2,6-Difluorophenyl)-5-[3-[2-[[5-ethyl-2-(methyloxy)-4-[4-[4-(methylsulfonyl)-1-piperazinyl]-1-piperidinyl]phenyl]amino]-4-pyrimidinyl]imidazo[1,2-a]pyridin-2-yl]-2-(methyloxy)benzamide;GSK 4529;N-(2,6-difluorophenyl)-5-(3-(2-(5-ethyl-2-methoxy-4-(4-(4-(methylsulfonyl)piperazin-1-yl)piperidin-1-yl)phenylamino)pyrimidin-4-yl)H-imidazo[1,2-a]pyridin-2-yl)-2-methoxybenzamide;N-(2,6-Difluorophenyl)-5-[3-[2-[[5-ethyl-2-(methyloxy)-4-[4-[4-(methylsulfonyl)-1-piperazinyl]-1-piperidinyl]phenyl]amino]-4-pyrimidinyl]imidazo[1,2-a]pyridin-2-yl]-2-(methyloxy)benzamideGSK 1904529A;GSK1904529A, >=98%;IGF-IR, IGF-IIR inhibitor. CAS No. 1089283-49-7. Molecular formula: C44H47F2N9O5S. Density: 1.39. Catalog: ACM1089283497. | |
| Guanfacine-13C, 15N3 hydrochloride | 13C Labeled Compounds. CAS No. 1261393-21-8. Molecular formula: C813CH10Cl315N3O. Mole weight: 286.53. Catalog: ACM1261393218. | |
| Guanidine,compound with nitrosopropanedinitrile(1:1) | Heterocyclic Organic Compound. Alternative Names: guanidine, compound with nitrosopropanedinitrile (1:1). CAS No. 1069-57-4. Molecular formula: C3HN3O.CH5N3. Catalog: ACM1069574. | |
| Guanidine:DCl (D6) | Others Isotope-labeled Nucleic Acid Related Products2H Labeled Compounds. Alternative Names: Guanidine-D5 deuteriochloride; Guanidine-D5 hydrochloride-D. CAS No. 108694-93-5. Molecular formula: CClD6N3. Mole weight: 101.57. Appearance: White crystal. IUPACName: (2H)chlorane;1,1,2,3,3-pentadeuterioguanidine. Density: 1.345 g/cm3 at 20 °C (68 °F). Catalog: ACM108694935. | |
| guanidine hydrochloride | Heterocyclic Organic Compound. CAS No. 106946-18-3. Molecular formula: CH6ClN3. Mole weight: 95.5314 g/mol. Purity: 0.96. IUPACName: guanidine;hydrochloride. Canonical SMILES: C(=N)(N)N.Cl. ECNumber: 200-002-3. Catalog: ACM106946183. | |
| Guanidinoethyl disulfide | Heterocyclic Organic Compound. Alternative Names: 1, 1'-(dithiodiethylene)di-guanidin; 2-guanidinoethyldisulfide; bis(2-guanidinoethyl)disulfide; bis(2-guanidoethyl)disulphide; guanidinoethyldisulfide; guanidoethyldisulfide; guanylcystamine; n, n'-(dithiodi-2, 1-ethanediyl)bis-guanidin. CAS No. 1072-13-5. Molecular formula: C3H7N3S2-2. Mole weight: 149.23778. Catalog: ACM1072135. | |
| GW833972A | Heterocyclic Organic Compound. Alternative Names: GW833972A, 1092502-33-4, 2-[(3-chlorophenyl)amino]-N-(4-pyridinylmethyl)-4-(trifluoromethyl)-5-Pyrimidinecarboxamide hydrochloride. CAS No. 1092502-33-4. Molecular formula: C18H14Cl2F3N5O. Mole weight: 444.24. Purity: 0.96. IUPACName: 2-(3-chloroanilino)-N-(pyridin-4-ylmethyl)-4-(trifluoromethyl)pyrimidine-5-carboxamide;hydrochloride. Canonical SMILES: C1=CC (=CC (=C1)Cl)NC2=NC=C (C (=N2)C (F) (F)F)C (=O)NCC3=CC=NC=C3. Cl. Catalog: ACM1092502334. | |
| Gypenoside Lxxv | Terpenoids. CAS No. 110261-98-8. Molecular formula: C42H72O13. Mole weight: 785.01. Purity: 0.98. Catalog: ACM110261988. | |
| Gyy 4137 | Heterocyclic Organic Compound. CAS No. 106740-09-4. Molecular formula: C11H16NO2PS2.C4H10NO. Mole weight: C11H16NO2PS2.C4H9NO. Purity: ≥95%. Catalog: ACM106740094. | |
| H-4-Nitro-D-phe-oet · hcl | Heterocyclic Organic Compound. Alternative Names: H-4-NITRO-D-PHE-OET HCL;4-Nitro-D-phenylalanine ethyl ester hydrochloride;H-D-Phe(4-NO2)-OEt.HCl. CAS No. 127641-82-1. Molecular formula: C11H14N2O4·HCl. Mole weight: 274.7. Catalog: ACM127641821. | |
| H-7 Dihydrochloride | Heterocyclic Organic Compound. Alternative Names: H-7 DIHYDROCHLORIDE; 1-(5-Isoquinolinesulfonyl)-2-methylpiperazine Dihydrochloride; H-7 dihydrochloride. CAS No. 108930-17-2. Molecular formula: C14H19Cl2N3O2S. Mole weight: 364.29. Appearance: White Crystalline Solid. Purity: ≥98%. IUPACName: 5-(2-methylpiperazin-1-yl)sulfonylisoquinoline dihydrochloride. Canonical SMILES: CC1CNCCN1S (=O) (=O)C2=CC=CC3=C2C=CN=C3. Cl. Cl. Catalog: ACM108930172. | |
| H-Acid | Heterocyclic Organic Compound. Alternative Names: H-Acid;H-Acid sodium salt;4-Amino-5-hydroxynaphthalene-2,7-disulfonic acid monosodium salt;1-Amino-8-naphthol-3,6-disulfonic acid monosodium salt;8-Amino-1-naphthol-3,6-disulfonic acid monosodium salt;8-Amino-1-naphthol-3,6-disulfonic acid monosodium salt. CAS No. 5460-9-3. Molecular formula: C10H8NNaO7S2.H2O. Catalog: ACM1300511. | |
| Hafnium hydride | Heterocyclic Organic Compound. CAS No. 12656-74-5. Catalog: ACM12656745. | |
| Hafnium hydride (HfH2) | Heterocyclic Organic Compound. Alternative Names: hafniumdihydride;HAFNIUM HYDRIDE;HAFNIUM HYDRIDE 99%;Dihydridehafnium. CAS No. 12770-26-2. Molecular formula: H2Hf. Mole weight: 180.51. Purity: 0.96. IUPACName: hafnium; hydride. Canonical SMILES: [Hf]. Density: g/cm³. ECNumber: 231-166-4. Catalog: ACM12770262. | |
| Hafnium N-butoxide | Heterocyclic Organic Compound. Alternative Names: HAFNIUM N-BUTOXIDE. CAS No. 125211-21-4. Molecular formula: C16H36HfO4. Mole weight: 470.94. Density: 1,32 g/cm3. Catalog: ACM125211214. | |
| H-Ala-afc | Heterocyclic Organic Compound. CAS No. 126910-31-4. Molecular formula: C13H11F3N2O3. Mole weight: 300.24. Purity: 0.96. Catalog: ACM126910314. | |
| H-Ala-ala-ala-tyr-ala-ala-oh | Heterocyclic Organic Compound. Alternative Names: H-ALA-ALA-ALA-TYR-ALA-ALA-OH. CAS No. 107865-42-9. Molecular formula: C24H36N6O8. Mole weight: 536.58. Catalog: ACM107865429. | |
| H-Ala-ala-ala-tyr-ala-oh | Heterocyclic Organic Compound. Alternative Names: L-ALA-ALA-ALA-L-TYR-L-ALA;H-ALA-ALA-ALA-TYR-ALA-OH. CAS No. 107865-40-7. Molecular formula: C21H31N5O7. Mole weight: 465.5. Catalog: ACM107865407. | |
| H-Ala-glu(otbu)-nh2. hcl | Heterocyclic Organic Compound. Alternative Names: H-ALA-ISOGLN-OTBU HCL;H-ALA-GLU(OTBU)-NH2 HCL. CAS No. 108607-07-4. Molecular formula: C12H23N3O4.HCl. Mole weight: 309.79. Catalog: ACM108607074. | |
| H-Ala-his-lys-oh | Heterocyclic Organic Compound. Alternative Names: H-Ala-His-Lys-OH. CAS No. 126828-32-8. Molecular formula: C15H26N6O4. Catalog: ACM126828328. | |
| H-Ala-lys-leu-arg-glu-arg-leu-lys-gln-arg-gln-gln-leu-gln-asn-arg-arg-gly-leu-asp-ile-leu-phe-leu-gln-glu-gly-gly-leu-oh | Heterocyclic Organic Compound. Alternative Names: H-ALA-LYS-LEU-ARG-GLU-ARG-LEU-LYS-GLN-ARG-GLN-GLN-LEU-GLN-ASN-ARG-ARG-GLY-LEU-ASP-ILE-LEU-PHE-LEU-GLN-GLU-GLY-GLY-LEU-OH;Ala-Lys-Leu-Arg-Glu-Arg-Leu-Lys-Gln-Arg-Gln-Gln-Leu-Gln-Asn-Arg-Arg-Gly-Leu-Asp-Ile-Leu-Phe-Leu-Gln-Glu-Gly-Gly-Leu;H-Ala-Lys-Leu-Arg. CAS No. 126947-95-3. Molecular formula: C151H262N52O42. Mole weight: 3478.02. Catalog: ACM126947953. | |
| H-Ala-pro-afc | Heterocyclic Organic Compound. Alternative Names: ALA-PRO-7-AMINO-4-TRIFLUORO-METHYLCOUMARIN;ALA-PRO-AFC;AP-AFC;H-ALA-PRO-AFC. CAS No. 125791-92-6. Molecular formula: C18H18F3N3O4. Mole weight: 397.35. Catalog: ACM125791926. | |
| H-Ala-trp-ala-oh | Heterocyclic Organic Compound. Alternative Names: H-ALA-TRP-ALA-OH. CAS No. 126310-63-2. Molecular formula: C17H22N4O4. Mole weight: 346.38. Purity: 0.96. IUPACName: 2-[[2-(2-aminopropanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]propanoic acid. Canonical SMILES: CC (C (=O)NC (CC1=CNC2=CC=CC=C21)C (=O)NC (C)C (=O)O)N. Catalog: ACM126310632. | |
| HALOWAX1013 | Heterocyclic Organic Compound. CAS No. 12616-35-2. Purity: 0.96. Catalog: ACM12616352. | |
| HALOWAX1014 | Heterocyclic Organic Compound. CAS No. 12616-36-3. Purity: 0.96. Catalog: ACM12616363. | |
| H-Arg-gly-asp-cys-oh | Heterocyclic Organic Compound. Alternative Names: RGDC;ARG-GLY-ASP-CYS;H-ARG-GLY-ASP-CYS-OH;REF DUPL: H-Arg-Gly-Asp-Cys-OH. CAS No. 109292-46-8. Molecular formula: C15H27N7O7S. Mole weight: 449.48. Catalog: ACM109292468. | |
| Harmalidine | Heterocyclic Organic Compound. CAS No. 109794-97-0. Mole weight: 254.33. Purity: 95%+. Catalog: ACM109794970. | |
| Harzianopyridone | Heterocyclic Organic Compound. Alternative Names: Harzianopyridone, CTK8E6800, 126637-69-2. CAS No. 126637-69-2. Molecular formula: C14H19NO5. Mole weight: 281.31. Appearance: White to off-white solid. Purity: 0.96. IUPACName: 4-hydroxy-5,6-dimethoxy-3-[(2R)-2-methylhex-4-enoyl]-1H-pyridin-2-one. Canonical SMILES: CC=CCC (C)C (=O)C1=C (C (=C (NC1=O)OC)OC)O. Catalog: ACM126637692. | |
| H-Asp-asp-asp-oh | Heterocyclic Organic Compound. Alternative Names: H-ASP-ASP-ASP-OH;triaspartic acid. CAS No. 107208-63-9. Molecular formula: C12H17N3O10. Mole weight: 363.28. Catalog: ACM107208639. | |
| H-Cys-asp-pro-gly-tyr-ile-gly-ser-arg-nh2 | Heterocyclic Organic Compound. Alternative Names: CDPGYIGSR-NH2;CYS-ASP-PRO-GLY-TYR-ILE-GLY-SER-ARG-NH2;H-CYS-ASP-PRO-GLY-TYR-ILE-GLY-SER-ARG-NH2;cys-asp-pro-gly-tyr-ile-gly-ser-arg*amide;cystinyl-aspartyl-prolyl-glycyl-tyrosyl-isoleucyl-glycyl-seryl-arginyl-NH2;Cys-Asp-Pro-Gly-Tyr-Ile-Gly-Ser-Arg-NH2 (. CAS No. 110590-61-9. Molecular formula: C40H63N13O13S. Mole weight: 966.0725. Density: 1.54 g/cm³. Catalog: ACM110590619. | |
| H-Cys-ser-cys-lys-asp-met-thr-asp-lys-glu-cys-leu-asn-phe-cys-his-gln-asp-val-ile-trp-oh | Heterocyclic Organic Compound. Alternative Names: SARAFOTOXIN A;SARAFOTOXIN A (ATRACTASPIS ENGADDENSIS);SARAFOTOXIN S6A;SARAFOTOXIN S6A1;SARAFOTOXIN S6A (ATRACTASPIS ENGADDENSIS);H-CYS-SER-CYS-LYS-ASP-MET-THR-ASP-LYS-GLU-CYS-LEU-ASN-PHE-CYS-HIS-GLN-ASP-VAL-ILE-TRP-OH;CYS-SER-CYS-LYS-ASP-MET-THR-ASP-LYS-. CAS No. 126738-34-9. Molecular formula: C105H156N28O34S5. Mole weight: 2514.85. Purity: 0.96. IUPACName: Sarafotoxin S6a. Catalog: ACM126738349. | |
| H-D-Cys(mbzl)-oh | Heterocyclic Organic Compound. Alternative Names: SureCN919742, AC1OJ5U1, S-4-Methylbenzyl-D-cysteine, CTK8E6393, (2S)-2-amino-3-[(4-methylphenyl)methylsulfanyl]propanoic acid, 127348-02-1. CAS No. 127348-02-1. Molecular formula: C11H15NO2S. Mole weight: 225.31. Purity: 0.96. IUPACName: (2S)-2-amino-3-[(4-methylphenyl)methylsulfanyl]propanoic acid. Canonical SMILES: CC1=CC=C(C=C1)CSCC(C(=O)O)N. Catalog: ACM127348021. | |
| H-D-Phg-leu-oh | Heterocyclic Organic Compound. Alternative Names: H-D-PHG-LEU-OH;Aminophenylacetylleucine. CAS No. 110207-44-8. Molecular formula: C14H20N2O3. Mole weight: 264.32. Catalog: ACM110207448. | |
| Hederacolchiside A1 | Terpenoids. CAS No. 106577-39-3. Molecular formula: C47H76O16. Mole weight: 897.1. Appearance: White powder. Purity: 0.98. IUPACName: (4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-[(2S,3R,4S,5S)-4-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid. Canonical SMILES: CC1C (C (C (C (O1)OC2C (C (COC2OC3CCC4 (C (C3 (C)C)CCC5 (C4CC=C6C5 (CCC7 (C6CC (CC7) (C)C)C (=O)O)C)C)C)OC8C (C (C (C (O8)CO)O)O)O)O)O)O)O. Catalog: ACM106577393. | |
| Henricine | Phenylpropanoids. CAS No. 107783-46-0. Molecular formula: C22H26O6. Mole weight: 386.4. Appearance: Powder. Purity: 0.98. IUPACName: 5-[(2S,3R,4S,5S)-3,4-dimethyl-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]-1,3-benzodioxole. Canonical SMILES: CC1C (C (OC1C2=CC3=C (C=C2)OCO3)C4=CC (=C (C (=C4)OC)OC)OC)C. Catalog: ACM107783460. | |
| HEPPS, Biological Buffer | Heterocyclic Organic Compound. CAS No. 10652-06-5. Molecular formula: C9H20O4N2S. Mole weight: 252.33. Purity: 0.96. Catalog: ACM10652065. | |
| Heptadecane, 3-methylene- | Heterocyclic Organic Compound. Alternative Names: Heptadecane, 3-methylene-. CAS No. 128057-44-3. Catalog: ACM128057443. | |
| Heptafluoro-1-(1,2,2,2-tetrafluoro-1-iodoethoxy)propane | Heterocyclic Organic Compound. Alternative Names: HEPTAFLUORO-1-(1, 2, 2, 2-TETRAFLUORO-1-IODOETHOXY)PROPANE; Heptafluoro-1-(1-iodo-1, 2, 2, 2-tetrafluoroethoxy)propane; 1-(HEPTAFLUOROPROPOXY)-1, 2, 2, 2-TETRAFLUORO-1-IODOETHANE. CAS No. 107432-46-2. Molecular formula: C5F11IO. Mole weight: 411.94. Catalog: ACM107432462. | |
| Heptanoicacid,5-methyl- | Heterocyclic Organic Compound. Alternative Names: 5-METHYLHEPTANOIC ACID. CAS No. 1070-68-4. Molecular formula: C8H16O2. Mole weight: 144.21. Catalog: ACM1070684. | |
| Heptaprenyl-MPDA | Others. Alternative Names: Pren C35-MPDA; Pren 7-P. CAS No. 108045-15-4. Molecular formula: C35H59O4P.2NH3. Mole weight: 608.9. Purity: 95%+. Catalog: ACM108045154. | |
| Hexadecanoic acid, 1,4-dioxan-2-yl ester | Hexadecanoic acid, 1,4-dioxan-2-yl ester. CAS No. 1284251-58-6. Molecular formula: C20H38O4. Mole weight: 342.51332. Catalog: ACM1284251586. | |
| Hexadecanoic acid, 2-(dimethylamino)ethyl ester, (Z)-2-butenedioate (1 :1) | Hexadecanoic acid, 2-(dimethylamino)ethyl ester, (Z)-2-butenedioate (1 :1). CAS No. 129320-10-1. Molecular formula: C20H41NO2.C4H4O4. Mole weight: 443.621. Catalog: ACM129320101. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.