Alfa Chemistry. 4 - Products
Alfa Chemistry offers an extensive catalog of building blocks, reagents, catalysts, reference materials, and research chemicals in a wide range of applications. In stock products can be shipped quickly.
| Product | Description | |
|---|---|---|
| B-NICOTINAMIDE ADENINE DINUCLEOTIDE,*PER IODATE OXID | Heterocyclic Organic Compound. CAS No. 108321-75-1. Purity: 0.96. Catalog: ACM108321751. |  |
| Boc-[15n]gly-oh | Heterocyclic Organic Compound. CAS No. 106665-75-2. Molecular formula: C7H13NO4. Mole weight: 176.19. Catalog: ACM106665752. | |
| Boc-2,4-dimethylaniline | Heterocyclic Organic Compound. Alternative Names: tert-butyl (2,4-dimethylphenyl)carbamate, 129822-43-1, BOC-2,4-DIMETHYLANILINE, tert-butyl N-(2,4-dimethylphenyl)carbamate, AN-329/43386030, (tert-butoxy)-N-(2,4-dimethylphenyl)carboxamide, ZINC07610487, AC1NKBMY, SureCN8297312, ARONIS011581, CTK4B6417, MolPort-002-778-651, BBL023027, SBB080522, STL065425, AKOS000501296, tert-butyl 2,4-dimethylphenylcarbamate, AG-D-60544, MCULE-2380244605, KB-200655. CAS No. 129822-43-1. Molecular formula: C13H19NO2. Mole weight: 221.3. Purity: 0.96. IUPACName: tert-butyl N-(2,4-dimethylphenyl)carbamate. Canonical SMILES: CC1=CC(=C(C=C1)NC(=O)OC(C)(C)C)C. Catalog: ACM129822431. | |
| Boc-2-aminopyridine-3-boronic acid pinacol ester | Boronic Esters. CAS No. 1072944-99-0. Catalog: ACM1072944990. | |
| Boc-2-Aminopyridine-4-boronicacidpinacolester | Boronic Esters. CAS No. 1095708-32-9. Catalog: ACM1095708329. | |
| Boc-3-(1-pyrenyl)-D-alanine | Heterocyclic Organic Compound. Alternative Names: N-ALPHA-T-BUTOXYCARBONYL-3-(1-PYRENYL)-D-ALANINE;BOC-3-(1-PYRENYL)-D-ALANINE;BOC-D-ALA(1-PYN)-OH;BOC-D-ALA(1-PYRENYL)-OH. CAS No. 126613-96-5. Molecular formula: C24H23NO4. Mole weight: 389.44. Catalog: ACM126613965. | |
| Boc-3-iodo-D-alanine benzyl ester | Heterocyclic Organic Compound. Alternative Names: Boc-beta-iodo-D-Ala-OBzl, Boc-3-iodo-D-alanine benzyl ester, N-(tert-Butoxycarbonyl)-3-iodo-D-alanine benzyl ester, Boc-|A-iodo-D-Ala-OBzl, SureCN5356265, 15122_ALDRICH, 15122_FLUKA, ZINC02556973, AKOS015889533, I01-19708, 125942-79-2. CAS No. 125942-79-2. Molecular formula: C15H20INO4. Mole weight: 405.23. Purity: 0.96. IUPACName: benzyl (2S)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. Canonical SMILES: CC (C) (C)OC (=O)NC (CI)C (=O)OCC1=CC=CC=C1. Catalog: ACM125942792. | |
| Boc-(3S,4S)-4-amino-3-hydroxy-5-(3-indolyl)-pentanoic acid | Heterocyclic Organic Compound. CAS No. 109579-23-9. Molecular formula: C18H24N2O5. Mole weight: 348.39. Catalog: ACM109579239. | |
| Boc-alpha-allyl-L-alanine | Heterocyclic Organic Compound. Alternative Names: Boc-alpha-allyl-D-Ala, 129786-68-1, (R)-2-((tert-Butoxycarbonyl)amino)-2-methylpent-4-enoic acid, Boc-alpha-allyl-L-alanine, CTK5J3302, MolPort-021-802-444, ANW-73505, AKOS015836573, AKOS015907797, AB43500, AG-B-16830, AK-57258, KB-209672, FT-0679737, BOC-(R)-2-AMINO-2-METHYL-4-PENTENOIC ACID, I14-26433, (R)-2-(TERT-BUTOXYCARBONYLAMINO)-2-METHYLPENT-4-ENOIC ACID, (2R)-2-[(TERT-BUTOXYCARBONYL)AMINO]-2-METHYLPENT-4-ENOIC ACID. CAS No. 129786-68-1. Molecular formula: C11H19NO4. Mole weight: 229.28. Purity: 0.96. IUPACName: (2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid. Canonical SMILES: CC(C)(C)OC(=O)NC(C)(CC=C)C(=O)O. Catalog: ACM129786681. | |
| Boc-alpha-aminomethyl-4-hydroxybenzyl alcohol | Heterocyclic Organic Compound. Alternative Names: BOC-ALPHA-AMINOMETHYL-4-HYDROXYBENZYL ALCOHOL;BOC-OCTOPAMINE;[2-HYDROXY-2-(4-HYDROXYPHENYL)ETHYL]CARBAMIC ACID TERT-BUTYL ESTER. CAS No. 126395-31-1. Molecular formula: C13H19NO4. Mole weight: 253.29. Catalog: ACM126395311. | |
| Boc-beta,beta-Dimethyl-d-cys(mob)-oh | Heterocyclic Organic Compound. Alternative Names: BOC-BETA,BETA-DIMETHYL-D-CYS(MOB)-OH;BOC-BETA,BETA-DIMETHYL-D-CYS(PMEOBZL)-OH;BOC-D-PEN(4-MEOBZL)-OH;BOC-D-PEN(PMEOBZL)-OH;BOC-D-PEN(MEOBZL)-OH;BOC-D-PEN(MOB)-OH;BOC-D-PENICILLAMINE(MOB)-OH;BOC-D-CYS(ME 2)(MEOBZL)-OH. CAS No. 106306-57-4. Molecular formula: C18H27NO5S. Mole weight: 369.48. Catalog: ACM106306574. | |
| Boc-Chg-OH H2O | Heterocyclic Organic Compound. CAS No. 109183-7-3. Catalog: ACM10918373. | |
| Boc-D-2-aminoadipic acid | Heterocyclic Organic Compound. CAS No. 110544-97-3. Molecular formula: C11H19NO6. Mole weight: 261.272. Catalog: ACM110544973. | |
| Boc-dakli | Heterocyclic Organic Compound. Alternative Names: N-T-BOC-TYR-GLY-GLY-PHE-LEU-ARG-ARG-ILE-ARG-PRO-ARG-LEU-ARG-GLY 5-AMINOPENTYLAMIDE;BOC-TYR-GLY-GLY-PHE-LEU-ARG-ARG-ILE-ARG-PRO-ARG-LEU-ARG-GLY-NH-(CH2)5-NH2;BOC-DAKLI;[ARG11,13]-BOC-DYNORPHIN A (1-13)-GLY-NH-(CH2)5-NH2;N-T-boc-tyr-gly-gly-phe-leu-arg-arg. CAS No. 128551-38-2. Molecular formula: C87H149N31O17. Mole weight: 1901.31. Purity: 0.96. IUPACName: (2S,4R)-N-[(2S)-2-chloro-1-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide. Canonical SMILES: CCCC1CC (N (C1)C)C (=O)NC (C2C (C (C (C (O2)SC)O)O)O)C (C)Cl. ECNumber: 242-209-1. Catalog: ACM128551382. | |
| Boc-D-cha-ol | Heterocyclic Organic Compound. Alternative Names: BOC-D-CHA-OL;BOC-D-CYCLOHEXYLALANINOL;NALPHA-tert-Butoxycarbonyl-3-cyclohexyl-D-alaninol. CAS No. 129593-17-5. Molecular formula: C14H27NO3. Mole weight: 257.37. Purity: 0.96. IUPACName: tert-butyl N-[(2S)-1-cyclohexyl-1-hydroxypropan-2-yl]carbamate. Canonical SMILES: CC(C(C1CCCCC1)O)NC(=O)OC(C)(C)C. Catalog: ACM129593175. | |
| Boc-D-homoarg(et)2-oh(symmetrical) | Heterocyclic Organic Compound. CAS No. 110761-76-7. Molecular formula: C16H32N4O4. Mole weight: 344.46. Catalog: ACM110761767. | |
| Boc-dl-3-thienylalanine | Heterocyclic Organic Compound. CAS No. 109007-59-2. Catalog: ACM109007592. | |
| Boc-dl-7-azatryptophan | Heterocyclic Organic Compound. Alternative Names: BOC-DL-7-AZATRYPTOPHAN. CAS No. 129423-33-2. Molecular formula: C15H19N3O4. Mole weight: 305.33. Catalog: ACM129423332. | |
| Boc-D-leucinol | Heterocyclic Organic Compound. CAS No. 106930-51-2. Molecular formula: C11H23NO3. Mole weight: 217.31. Purity: 0.98. Catalog: ACM106930512. | |
| Boc-dl-proline ethyl ester | Heterocyclic Organic Compound. CAS No. 125347-83-3. Molecular formula: C12H21NO4. Mole weight: 243.3. Catalog: ACM125347833. | |
| Boc-D-valine methyl ester | Heterocyclic Organic Compound. Alternative Names: BOC-D-VALINE METHYL ESTER;N-BOC-D-VALINE METHYL ESTER;N-tert-Butoxycarbonyl-D-valine methyl ester. CAS No. 106391-85-9. Molecular formula: C11H21NO4. Mole weight: 231.29. Purity: 0.96. IUPACName: methyl (2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. Canonical SMILES: CC(C)C(C(=O)OC)NC(=O)OC(C)(C)C. Catalog: ACM106391859. | |
| Boc-gln-arg-arg-amc acetate salt | Heterocyclic Organic Compound. Alternative Names: BOC-GLN-ARG-ARG-AMC ACETATE SALT;BOC-GLN-ARG-ARG-AMC ACOH;BOC-GLN-ARG-ARG-MCA;T-BUTYLOXYCARBONYL-L-GLUTAMINYL-L-ARGINYL-L-ARGININE 4-METHYLCOUMARYL-7-AMIDE;Boc-Gln-Arg-Arg-AMC;N-T-boc-gln-arg-arg 7-amido-4-*methylcoumarin ace;N-T-BOC-GLN-ARG-ARG 7-AMIDO-. CAS No. 109376-05-8. Molecular formula: C34H53N11O10. Mole weight: 775.85. Catalog: ACM109376058. | |
| Boc-gly-lys-arg-mca | Heterocyclic Organic Compound. Alternative Names: T-BUTYLOXYCARBONYLGLYCYL-L-LYSYL-L-ARGININE 4-METHYLCOUMARYL-7-AMIDE;BOC-GLY-LYS-ARG-MCA. CAS No. 109358-48-7. Molecular formula: C29H44N8O7. Mole weight: 616.71. Catalog: ACM109358487. | |
| Boc-his(π-bom)-osu | Heterocyclic Organic Compound. CAS No. 129672-10-2. Molecular formula: C23H28N4O7. Mole weight: 427.5. Catalog: ACM129672102. | |
| Boc-L-Alanine-NCA | Heterocyclic Organic Compound. Alternative Names: Boc-L-Alanine-NCA;Boc-L-Alanine N-carboxyanhydride. CAS No. 125814-30-4. Molecular formula: C9H13NO5. Mole weight: 215.203220 [g/mol]. Purity: 0.96. IUPACName: tert-butyl (4S)-4-methyl-2,5-dioxo-1,3-oxazolidine-3-carboxylate. Canonical SMILES: CC1C(=O)OC(=O)N1C(=O)OC(C)(C)C. Catalog: ACM125814304. | |
| Boc-L-ala-nitrile | Heterocyclic Organic Compound. Alternative Names: (S)-N-BOC-ALANINE-NITRILE;N-[(1S)-1-Cyanoethyl]-carbamic acid 1,1-dimethylethyl ester;BOC-L-ALA-NITRILE;Boc-Ala-Nitrile;Carbamic acid, [(1S)-1-cyanoethyl]-, 1,1-dimethylethyl ester (9CI). CAS No. 130013-83-1. Molecular formula: C8H14N2O2. Mole weight: 170.21. Purity: 0.98. Density: 1.021. Catalog: ACM130013831. | |
| Boc-Leu-Arg-Arg-AMC. 2 HCl | Heterocyclic Organic Compound. Alternative Names: Boc-Leu-Arg-Arg-AMC. 2 HCl. CAS No. 109358-46-5. Catalog: ACM109358465. | |
| Boc-leu-leu-oh | Heterocyclic Organic Compound. CAS No. 127370-77-8. Molecular formula: C17H34N2O4. Mole weight: 330.47. Purity: 0.96. Catalog: ACM127370778. | |
| Boc-leu-lys-arg-amc hydrochloride salt | Heterocyclic Organic Compound. Alternative Names: T-BUTYLOXYCARBONYL-L-LEUCYL-L-LYSYL-L-ARGININE 4-METHYLCOUMARYL-7-AMIDE;BOC-LEU-LYS-ARG-AMC HYDROCHLORIDE SALT;BOC-LEU-LYS-ARG-MCA;Boc-Leu-Lys-Arg-AMC;N-T-boc-leu-lys-arg 7-amido-4-*methylcoumarin hyd. CAS No. 109358-47-6. Molecular formula: C33H52N8O7. Mole weight: 672.82. Catalog: ACM109358476. | |
| Boc-L-pyroglutamic acid methyl ester | Heterocyclic Organic Compound. CAS No. 108963-96-8. Molecular formula: C11H17NO5. Mole weight: 243.26. Purity: 0.98. Catalog: ACM108963968. | |
| Boc-O-benzyl-L-serine N-carboxy anhydride | Heterocyclic Organic Compound. CAS No. 125814-31-5. Molecular formula: C16H19NO6. Mole weight: 321.33. Catalog: ACM125814315. | |
| Boc-O-benzyl-L-serinol | Heterocyclic Organic Compound. CAS No. 127559-33-5. Molecular formula: C15H23NO4. Mole weight: 281.35. Catalog: ACM127559335. | |
| Boc-(S)-3-amino-4-(4-nitrophenyl)butanoic acid | Heterocyclic Organic Compound. CAS No. 127106-71-2. Molecular formula: C15H20N2O6. Mole weight: 324.33. Purity: 0.95. Catalog: ACM127106712. | |
| Boc-ser(po3me2)-oh | Heterocyclic Organic Compound. Alternative Names: N ALPHA-BOC-O-(DIMETHYLPHOSPHO)-L-SERINE;N-ALPHA-T-BUTOXYCARBONYL-O-DIMETHYLPHOSPHENE-L-SERINE;N-ALPHA-T-BUTOXYCARBONYL-O-DIMETHYLPHOSPHONO-L-SERINE;BOC-SER(PO3ME2)-OH;BOC-O-DIMETHYLPHOSPHO-L-SERINE;N(ALPHA)-BOC-O-(DIMETHYLPHOSPHO)- &;nα-boc-o-(dime. CAS No. 109539-01-7. Molecular formula: C10H20NO8P. Mole weight: 313.24. Purity: 0.96. IUPACName: (2S)-3-dimethoxyphosphoryloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoicacid. Canonical SMILES: CC (C) (C)OC (=O)NC (COP (=O) (OC)OC)C (=O)O. Catalog: ACM109539017. | |
| Boc-(+/-)-trans-4-(4-pyridinyl)-pyrrolidine-3-carboxylic acid | Heterocyclic Organic Compound. CAS No. 1255935-12-6. Molecular formula: C15H20N2O4. Mole weight: 292.3. Purity: 0.95. IUPACName: (3R,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-pyridin-4-ylpyrrolidine-3-carboxylicacid. Canonical SMILES: CC (C) (C)OC (=O)N1CC (C (C1)C (=O)O)C2=CC=NC=C2. Catalog: ACM1255935126. | |
| BODIPY FL acid | Other Fluorophores. CAS No. 126250-45-1. Molecular formula: C14H15BF2N2O2. Mole weight: 292.09. Catalog: ACM126250451. | |
| Bomin-2 | Heterocyclic Organic Compound. Alternative Names: BOMIN-2;2-Propoxy-2-oxo-3H-1,4,2-benzodioxaphosphorine. CAS No. 110606-96-7. Molecular formula: C10H13O4P1. Mole weight: 228.18. Purity: 95 % (TLC, NMR). Catalog: ACM110606967. | |
| Bomin-3 | Heterocyclic Organic Compound. Alternative Names: BOMIN-3;2-Butoxy-2-oxo-3H-1,4,2-benzodioxaphosphorine. CAS No. 110606-97-8. Molecular formula: C11H15O4P. Purity: 95 % (TLC, NMR). Catalog: ACM110606978. | |
| Bongkrekic acid | Heterocyclic Organic Compound. CAS No. 11076-19-0. Molecular formula: C28H38O7. Mole weight: 486.6. Purity: ≥98%. Catalog: ACM11076190. | |
| Borane,2-propen-1-ylbis[(1S,2R,3S,5S)-2,6,6-trimethylbicyclo[3.1.1]hept-3-yl]- | Heterocyclic Organic Compound. CAS No. 106356-53-0. Molecular formula: C23H39B. Mole weight: 326.37. Catalog: ACM106356530. | |
| Borane-dicyclohexylphosphine complex | Heterocyclic Organic Compound. Alternative Names: DICYCLOHEXYLPHOSPHINE BORANE COMPLEX;BORANE-DICYCLOHEXYLPHOSPHINE COMPLEX;Borane-dicyclohexylphosphine complex,95%. CAS No. 108756-88-3. Molecular formula: C12H26BP. Mole weight: 212.12. Appearance: white powder. Catalog: ACM108756883. | |
| Borane-di(tert-butyl)phosphine complex | Heterocyclic Organic Compound. Alternative Names: Di-tert-butylphosphine compound with borane (1:1); Di-tert-butylphosphine borane; (Di-tert-butylphosphine)trihydroboron. CAS No. 128363-76-8. Molecular formula: C8H22PBH. Mole weight: 160.05. Appearance: Solid. Purity: 0.98. Catalog: ACM128363768-1. | |
| Borane-pyridine complex | Heterocyclic Organic Compound. Alternative Names: Pyridine borane, Borane pyridine complex, 179752_ALDRICH, PYRIDINE-2-AZO-P-DIMETHYL ANILINE, 110-51-0. CAS No. 110-51-0. Molecular formula: C5H8BN. Mole weight: 92.93. Appearance: Clear to amber liquid. Purity: >80.0%(T). IUPACName: boron; pyridine. Canonical SMILES: [B].C1=CC=NC=C1. Density: 0.92. ECNumber: 203-773-4. Catalog: ACM110510. | |
| Boric acid, potassiumsalt | Heterocyclic Organic Compound. Alternative Names: potassium borate - K2B4O7. CAS No. 12712-38-8. Catalog: ACM12712388. | |
| Boronic acid,b-[1-(phenylsulfonyl)-1H-indol-3-yl]- | Heterocyclic Organic Compound. Alternative Names: 563870_ALDRICH, 1-(Phenylsulfonyl)-3-indoleboronic acid, CC 03112, 129271-98-3. CAS No. 129271-98-3. Molecular formula: C14H12BNO4S. Mole weight: 301.13. Purity: 0.95. IUPACName: (1-phenylsulfonylindol-3-yl)boronic acid. Canonical SMILES: B (C1=CN (C2=CC=CC=C12)S (=O) (=O)C3=CC=CC=C3) (O)O. Density: 1.35g/cm³. Catalog: ACM129271983. | |
| Boronicacid, b-[2-[ (diethylamino)carbonyl]phenyl]- | Heterocyclic Organic Compound. Alternative Names: 129112-21-6, 2-(N,N-Diethylaminocarbonyl)phenylboronic acid, (2-(Diethylcarbamoyl)phenyl)boronic acid, 2-(Diethylcarbamoyl)benzeneboronic acid, [2-(diethylcarbamoyl)phenyl]boronic Acid, ACMC-1BWVF, SureCN521053, AC1N57EX, N,N-Diethyl 2-boronobenzamide, CTK0H3987, MolPort-001-770-071, ANW-19104, OR7197, 2-(diethylcarbamoyl)phenylboronic acid, AKOS015838653, AB08799, AG-D-59489, AK-84164, KB-15796, X0510. CAS No. 129112-21-6. Molecular formula: C11H16BNO3. Mole weight: 221.06. Purity: 0.95. IUPACName: [2-(diethylcarbamoyl)phenyl]boronic acid. Canonical SMILES: B(C1=CC=CC=C1C(=O)N(CC)CC)(O)O. Catalog: ACM129112216. | |
| Boronic acid, B, B'-[5''-(4'-borono[1, 1'-biphenyl]-4-yl)[1, 1':4', 1'':3'', 1''':4''', 1''''-quinquephenyl]-4, 4''''-diyl]bis- | Boric & Borate COFs Ligands. Alternative Names: 1,3,5-Tris[4'-(dihydroxyboryl)-4-biphenylyl]benzene; [4-[4-[3, 5-Bis[4- (4-boronophenyl) phenyl]phenyl]phenyl]phenyl]boronic acid. CAS No. 1290630-80-6. Molecular formula: C42H33B3O6. Mole weight: 666.1408. Purity: 0.98. Catalog: ACM1290630806. | |
| Boscialin | Terpenoids. CAS No. 129277-03-8. Molecular formula: C13H22O3. Mole weight: 226.31. Appearance: Powder. Purity: 0.98. IUPACName: (E)-4-[(1S,4S,6R)-1,4-dihydroxy-2,2,6-trimethylcyclohexyl]but-3-en-2-one. Canonical SMILES: CC1CC(CC(C1(C=CC(=O)C)O)(C)C)O. Catalog: ACM129277038. | |
| Botulin F | Heterocyclic Organic Compound. Alternative Names: BOTULINUS TOXIN F;Botulinum toxin F. CAS No. 107231-15-2. Catalog: ACM107231152. | |
| Bradykinin,5-(4-chloro-L-phenylalanine)-8-(4-chloro-L-phenylalanine)-(9ci) | Heterocyclic Organic Compound. Alternative Names: (P-CHLORO-PHE5,8)-BRADYKININ;[(PCL)PHE5,8] BRADYKININ;ARG-PRO-PRO-GLY-P-CHLORO-PHE-SER-PRO-P-CHLORO-PHE-ARG;ARG-PRO-PRO-GLY-P-CHLORO-PHE-SER-PRO-P-CHLORO-PHE-ARG-ACETATE;ARG-PRO-PRO-GLY-(PCL)PHE-SER-PRO-(PCL)PHE-ARG;BRADYKININ (P-CHLORO-PHE5,8);(H-PHE(4-. CAS No. 125229-63-2. Molecular formula: C50H71Cl2N15O11. Mole weight: 1129.1. Purity: 0.96. IUPACName: (2S) -2-[[ (2S) -2-[[ (2S) -1-[ (2S) -2-[[ (2S) -2-[[2-[[ (2S) -1-[ (2S) -1-[ (2S) -2-amino-5- (diaminomethylideneamino) pentanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]acetyl]amino]-3- (4-chlorophenyl) propanoyl]amino]-3-hydroxypropanoyl]pyrrolidine-2-carbony. Canonical SMILES: C1CC (N (C1)C (=O)C2CCCN2C (=O)C (CCCN=C (N)N)N)C (=O)NCC (=O)NC (CC3=CC=C (C=C3)Cl)C (=O)NC (CO)C (=O)N4CCCC4C (=O)NC (CC5=CC=C (C=C5)Cl)C (=O)NC (CCCN=C (N)N)C (=O)O. Catalog: ACM125229632. | |
| Bromoacetamido-PEG5-NHS ester | NHS Ester PEG Linkers. CAS No. 1260139-70-5. Molecular formula: C17H27BrN2O9. Mole weight: 483.31. Purity: 95%+. Catalog: ACM1260139705. | |
| Bromobenzene | Environmental Standards. Alternative Names: Benzene, bromo-. CAS No. 108-86-1. Molecular formula: C6H5Br. Mole weight: 157.01. Catalog: ACM108861. | |
| Bromocarbonyl[ (1S, 2S)-2, 3-diphenylethylenediamine-N, N'-bis (2-diphenylphosphinoethyllidene)]iron (II) tetraphenylborate, FeATHer-II Catalyst | Iron Catalysts. CAS No. 1257252-03-1. Molecular formula: C67H65BBrFeN2OP2. Mole weight: 1122.75. Catalog: ACM1257252031. | |
| BROMOCHLORODIMETHYLHYDANTOIN | Heterocyclic Organic Compound. CAS No. 107846-11-7. Catalog: ACM107846117. | |
| Bromotriethylgermane | Organic Germanium. Alternative Names: TRIETHYLGERMANIUM BROMIDE; TRIETHYLBROMOGERMane ; BROMOTRIETHYLGERMane ; Bromotriethylgermane Triethylgermanium bromide. CAS No. 1067-10-3. Molecular formula: C6H15BrGe. Mole weight: 239.73. Density: 1.4. Catalog: ACM1067103. | |
| Bromperidol Decanoate | Heterocyclic Organic Compound. CAS No. 4851-2-24. Catalog: ACM1077887. | |
| Bronze, powder | Heterocyclic Organic Compound. CAS No. 12597-70-5. Molecular formula: Cu:Sn; 90:10 wt%. Catalog: ACM12597705. | |
| Bulleyaconitine a | Bulleyaconitine a. Alternative Names: METHANONE,[(1,6,14,16)-8-(ACETYLOXY)-20-ETHYL-13-HYDROXY-1,6,16-TRIMETHOXY-4-(METHOXYMETHYL)ACONITAN-14-YL](4-METHOXYPHENYL); 16-trimethoxy-4-(methoxymethyl)aconitan-14-yl)(4-methoxyphenyl)-y-6; BULLEYACONITINE A(P); BULLEYACONITINE A: METHANONE,[(1,6,14,16)-8-(ACETYLOXY)-20-ETHYL-13-HYDROXY-1,6,16-TRIMETHOXY-4-(METHOXYMETHYL)ACONITAN-14-YL](4-METHOXYPHENYL); BulleyaconicineA; 20-ethyl-13-hydroxy-1,6,16-trimethoxy-4-(methoxymethyl)aconitan-14-yl](4-methoxyphenyl); BULLEYACONITINE A(RG). CAS No. 107668-79-1. Molecular formula: C35H49NO9. Mole weight: 627.76. Appearance: solid. Purity: 98%+. IUPACName: Bulleyaconitine A. Canonical SMILES: CCN1CC2 (CCC (C34C2C (C (C31)C5 (CC (C6 (CC4C5C6C (=O)C7=CC=C (C=C7)OC)O)OC)OC (=O)C)OC)OC)COC. Density: 1.28g/cm³. Catalog: ACM107668791. | |
| Bumetanide Related Com | Heterocyclic Organic Compound. CAS No. 4852-5-7. Catalog: ACM1078325. | |
| BupenPTC | Organic Thin-Film Transistor (OTFT). CAS No. 110613-98-4. Catalog: ACM110613984. | |
| Bupivacaine Related Compo | Heterocyclic Organic Compound. CAS No. 4852-11-16. Catalog: ACM1078518. | |
| Bupropion Hydrochlorid | Heterocyclic Organic Compound. CAS No. 4853-7-11. Catalog: ACM1078755. | |
| Bupropion Hydrochloride | Heterocyclic Organic Compound. CAS No. 4853-6-30. Catalog: ACM1078744. | |
| But-3-enyloxy-tert-butyl-dimethyl-silane | Heterocyclic Organic Compound. Alternative Names: BUT-3-ENYLOXY-TERT-BUTYL-DIMETHYL-SILANE, 108794-10-1, CTK4A6192, AKOS006330752, AG-D-25408. CAS No. 108794-10-1. Molecular formula: C10H22OSi. Mole weight: 186.366580 [g/mol]. Purity: 0.96. IUPACName: but-3-enoxy-tert-butyl-dimethylsilane. Canonical SMILES: CC(C)(C)[Si](C)(C)OCCC=C. Catalog: ACM108794101. | |
| Butanamide,2-fluoro-N,N-dimethyl-(9ci) | Heterocyclic Organic Compound. Alternative Names: Butanamide, 2-fluoro-N,N-dimethyl- (9CI). CAS No. 126543-33-7. Molecular formula: C6H12FNO. Mole weight: 133.1639832. Catalog: ACM126543337. | |
| Butanamide,3,4-dihydroxy-,(3S)- | Heterocyclic Organic Compound. Alternative Names: BUTANAMIDE, 3,4-DIHYDROXY-, (S);(S)-3,4-DIHYDROXYBUTANAMIDE;(S)-3,4-DIHYDROXYBUTYRAMIDE. CAS No. 126495-84-9. Molecular formula: C4H9NO3. Mole weight: 119.12. Purity: 0.96. IUPACName: 3,4-dihydroxybutanamide. Canonical SMILES: C(C(CO)O)C(=O)N. Catalog: ACM126495849. | |
| Butanamide,N-cyclopropyl-3-oxo-(9ci) | Heterocyclic Organic Compound. CAS No. 110262-87-8. Catalog: ACM110262878. | |
| Butanediamide | Heterocyclic Organic Compound. Alternative Names: butanediamide; Succinamide. CAS No. 110-14-5. Molecular formula: C4H8N2O2. Mole weight: 116.1185. Appearance: white to off-white fine crystalline powder. Purity: 0.96. IUPACName: butanediamide. Density: 1.207 g/cm³. Catalog: ACM110145. | |
| Butanedioic acid | Heterocyclic Organic Compound. Alternative Names: Asuccin; AMBER ACID; Butanedioic acid; Butane diacid; Sal succini; Butanedioic acid,natural; Katasuccin; Succinic acid; Succinic Acid; Wormwood. CAS No. 110-15-61. Molecular formula: C4H6O4. Mole weight: 118.088. Appearance: White crystalline powder. Purity: 0.96. IUPACName: succinic acid. Density: 1.552. Catalog: ACM1101561. | |
| Butanedioic acid,2-[(4,5-dihydro-5-thioxo-1,3,4-thiadiazol-2-yl)thio]- | Heterocyclic Organic Compound. Alternative Names: 2-(5-MERCAPTO-1,3,4-THIADIAZOL-2-YLSULFANYL)SUCCINIC ACID;2-(5-MERCAPTO-1,3,4-THIADIAZOL-2-YLTHIO)SUCCINIC ACID;2-(5-MERCAPTO-1,3,4-THIADIAZOL-2-YLSULFANYL)SUCCINIC ACID 97%;2-(5-Mercapto-1,3,4-thiadiazol-2-ylsulfanyl). CAS No. 125605-97-2. Molecular formula: C6H6N2O4S3. Mole weight: 266.32. Purity: N/A. IUPACName: 2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanedioic acid. Canonical SMILES: C(C(C(=O)O)SC1=NNC(=S)S1)C(=O)O. Density: 1.94g/cm³. Catalog: ACM125605972. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.