Alfa Chemistry. 5 - Products
Alfa Chemistry offers an extensive catalog of building blocks, reagents, catalysts, reference materials, and research chemicals in a wide range of applications. In stock products can be shipped quickly.
| Product | Description | |
|---|---|---|
| 3-Methyl-1-(4-(trifluoromethyl)phenyl)butan-1-ol | Heterocyclic Organic Compound. Alternative Names: 3-methyl-1-(4-(trifluoromethyl)phenyl)butan-1-ol, 1225790-22-6, MolPort-008-662-973, SBB068940, AKOS012083866, AK120488, KB-236509, S01-0673. CAS No. 1225790-22-6. Molecular formula: C12H15F3O. Mole weight: 232.242110 [g/mol]. Purity: 0.96. IUPACName: 3-methyl-1-[4-(trifluoromethyl)phenyl]butan-1-ol. Canonical SMILES: CC(C)CC(C1=CC=C(C=C1)C(F)(F)F)O. Catalog: ACM1225790226. |  |
| 3-Methyl-1-Butanol | Environmental Standards. Alternative Names: Isoamyl alcohol. CAS No. 123-51-3. Molecular formula: C5H12O. Mole weight: 88.15. Catalog: ACM123513-1. | |
| 3-Methyl-1-butyl-1,1,2,2-d4alcohol | Heterocyclic Organic Compound. CAS No. 1219795-21-7. Molecular formula: 92.17. Purity: 98 atom % D. Catalog: ACM1219795217. | |
| (3-Methyl-1H-indazol-5-yl)boronic acid | Boronic Acids. Alternative Names: 3-Methyl-1H-indazole-5-boronic acid, 1245816-25-4, 3-Methyl-1H-indazol-5-yl-5-boronic acid, 3-methyl-1H-indazol-5-ylboronic acid, SureCN5751011, CTK7I2613, MolPort-016-581-666, 1H-3-methyl-indazole-5-boronic acid, AKOS006319201, AG-B-97471, OR40150, PB21094, QC-3989, RP09335, 3-METHYLINDAZOLE-5-BORONIC ACID, 3-methyl-1H-indazol-5-yl-5-boronicacid, AK-47793, BR-47793, KB-12237, KB-32676. CAS No. 1245816-25-4. Molecular formula: C8H9BN2O2. Mole weight: 175.98. Purity: 0.96. IUPACName: (3-methyl-2H-indazol-5-yl)boronic acid. Canonical SMILES: B(C1=CC2=C(NN=C2C=C1)C)(O)O. Catalog: ACM1245816254. | |
| 3-methyl-1H-indazol-6-yl-6-boronic acid | Heterocyclic Organic Compound. Alternative Names: 3-Methyl-1H-indazol-6-yl-6-boronic acid, 3-Methyl-1H-indazole-6-boronic acid, 1245816-26-5, 3-methyl-1H-indazol-6-ylboronic acid, CTK7I2611, MolPort-016-581-538, AKOS006307071, AG-B-97472, OR30840, PB11976, QC-3990, RP09336, 3-methyl-1H-indazol-6-yl-6-boronicacid, AK-47794, BR-47794, KB-70941, KB-236524, FT-0685873, X9601, 3-METHYL-1H-INDAZOL-6-YL-BORONIC ACID. CAS No. 1245816-26-5. Molecular formula: C8H9BN2O2. Mole weight: 175.98. Purity: 0.96. IUPACName: (3-methyl-2H-indazol-6-yl)boronic acid. Canonical SMILES: B(C1=CC2=NNC(=C2C=C1)C)(O)O. Catalog: ACM1245816265. | |
| 3-Methyl-1-nonyn-3-ol | Heterocyclic Organic Compound. CAS No. 1035-43-0. Purity: 0.96. Catalog: ACM1035430. | |
| 3-Methyl-1-phenyl-3-pentanol | Alkynyl. CAS No. 10415-87-9. Molecular formula: C9H6F2O. Mole weight: 178.27. Catalog: ACM10415879. | |
| 3-Methyl-2,4-dioxo-1-phenyl-1,2,3,4-tetrahydropyrimidine-5-carbothioamide | Heterocyclic Organic Compound. Alternative Names: 3-METHYL-2,4-DIOXO-1-PHENYL-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBOTHIOAMIDE. CAS No. 125187-18-0. Molecular formula: C12H11N3O2S. Mole weight: 261.3. Catalog: ACM125187180. | |
| 3-Methyl-3-(2-pyridinyl)-1-azetidineethanamine | Heterocyclic Organic Compound. CAS No. 1048648-23-2. Molecular formula: C11H17N3. Mole weight: 191.27278;g/mol. Purity: 0.96. IUPACName: 2-(3-methyl-3-pyridin-2-ylazetidin-1-yl)ethanamine. Canonical SMILES: CC1(CN(C1)CCN)C2=CC=CC=N2. Catalog: ACM1048648232. | |
| 3-Methyl-3-buten-2-ol | Heterocyclic Organic Compound. Alternative Names: 2-methyl-1-buten-3-ol;CH2=C(CH3)CH(OH)CH3;Methyl isopropenyl carbinol;3-METHYL-3-BUTEN-2-OL;1,2-Dimethyl-2-propen-1-ol. CAS No. 10473-14-0. Molecular formula: C5H10O. Mole weight: 86.13. Catalog: ACM10473140. | |
| 3-Methyl-4H-pyrazolo[1,5-a]pyrimidin-7-one | Heterocyclic Organic Compound. Alternative Names: 3-METHYL-4H-PYRAZOLO[1,5-A]PYRIMIDIN-7-ONE. CAS No. 104556-85-6. Molecular formula: C7H7N3O. Mole weight: 149.15. Catalog: ACM104556856. | |
| 3-Methyl-4-nitropyridinen-oxide | Heterocyclic Organic Compound. Alternative Names: Heptamethyl-<2-phenyl-propyl>-cyclotetrasiloxan. CAS No. 1047-98-0. Molecular formula: C16H32O4Si4. Mole weight: 400.765. Purity: 0.96. IUPACName: 2,2,4,4,6,6,8-heptamethyl-8-(2-phenylpropyl)-1,3,5,7,2,4,6,8-tetraoxat. Catalog: ACM1047980. | |
| 3-Methyl-4-oxo-3,4-dihydro-7-quinazolinecarboxylic acid | Heterocyclic Organic Compound. Alternative Names: Ambcb4033368, SureCN2040732, CTK4A4387, MolPort-016-631-287, STL367185, AKOS006339177, AG-D-20318, 3-methyl-4-oxo-3,4-dihydroquinazoline-7-carboxylic acid, 3-METHYL-4-OXO-3,4-DIHYDRO-7-QUINAZOLINECARBOXYLIC ACID, 1060817-67-5. CAS No. 1060817-67-5. Molecular formula: C10H8N2O3. Mole weight: 204.182120 [g/mol]. Purity: 0.96. IUPACName: 3-methyl-4-oxoquinazoline-7-carboxylic acid. Canonical SMILES: CN1C=NC2=C(C1=O)C=CC(=C2)C(=O)O. Catalog: ACM1060817675. | |
| 3-Methyl-4-pyridinethiol | Heterocyclic Organic Compound. Alternative Names: 3-METHYL-4-PYRIDINETHIOL, 3-METHYL-4(1H)-PYRIDINETHIONE, 10351-13-0, SureCN2643285, AKOS005258690, V2297, 953018-17-2. CAS No. 10351-13-0. Molecular formula: C6H7NS. Mole weight: 125.191480 [g/mol]. Purity: 0.96. IUPACName: 3-methyl-1H-pyridine-4-thione. Canonical SMILES: CC1=CNC=CC1=S. Density: 1.122g/cm³. Catalog: ACM10351130. | |
| [3-Methyl-5-(1-methylethyl)-4-isoxazolyl][4-(3-methylphenyl)-1-piperazinyl]-methanone | Heterocyclic Organic Compound. Alternative Names: T6149321, ZINC12537602, MCULE-9548656887, KB-78372, Methanone,[3-methyl-5-(1-methylethyl)-4-isoxazolyl][4-(3-methylphenyl)-1-piperazinyl]-, 1036686-42-6. CAS No. 1036686-42-6. Molecular formula: C19H25N3O2. Mole weight: 327.420700 [g/mol]. Purity: 0.96. IUPACName: [4-(3-methylphenyl)piperazin-1-yl]-(3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)methanone. Canonical SMILES: CC1=CC (=CC=C1)N2CCN (CC2)C (=O)C3=C (ON=C3C)C (C)C. Catalog: ACM1036686426. | |
| 3-Methyl-5-Nitrobenzonitrile | Heterocyclic Organic Compound. Alternative Names: 3-METHYL-5-NITROBENZONITRILE, 124289-22-1, 3-Cyano-5-nitrotoluene, AGN-PC-001TXQ, SureCN1344128, KSC494G5N, CTK3J4356, Benzonitrile, 3-methyl-5-nitro-, ANW-47975, WT1787, AKOS015919702, AK-53982, BD216256, BR-53982, KB-70964, FT-0688159, X2202, 124289-22-1 3-methyl-5-nitrobenzonitrile. CAS No. 124289-22-1. Molecular formula: C8H6N2O2. Mole weight: 162.15. Purity: 0.96. IUPACName: 3-methyl-5-nitrobenzonitrile. Canonical SMILES: CC1=CC(=CC(=C1)C#N)[N+](=O)[O-]. Catalog: ACM124289221. | |
| 3-Methyl-5-nitroquinoline | Heterocyclic Organic Compound. CAS No. 103754-53-6. Catalog: ACM103754536. | |
| 3-Methyl-5-phenylpyridine | Heterocyclic Organic Compound. Alternative Names: 3-METHYL-5-PHENYLPYRIDINE; Methylphenylpyridine; 3-METHYL-5-PHENYLPYRIDINE 95+%. CAS No. 10477-94-8. Molecular formula: C12H11N. Mole weight: 169.22. Density: 1,07 g/cm3. Catalog: ACM10477948. | |
| 3-Methyl-5-propoxyphenylboronic acid,pinacol ester | Heterocyclic Organic Compound. Alternative Names: 1218789-73-1, 4,4,5,5-Tetramethyl-2-(3-methyl-5-propoxyphenyl)-1,3,2-dioxaborolane, 3-Methyl-5-propoxyphenylboronic acid pinacol ester, CTK8C1210, ANW-66067, AKOS016004643, AK-85011, KB-32795, X1709, A-5611, 3-Methyl-5-propoxyphenylboronic acid, pinacol ester. CAS No. 1218789-73-1. Molecular formula: C16H25BO3. Mole weight: 276.2. Purity: 0.95. IUPACName: 4,4,5,5-tetramethyl-2-(3-methyl-5-propoxyphenyl)-1,3,2-dioxaborolane. Canonical SMILES: B1 (OC (C (O1) (C)C) (C)C)C2=CC (=CC (=C2)OCCC)C. Catalog: ACM1218789731. | |
| 3-Methyl-6-nitrocoumarin | Heterocyclic Organic Compound. CAS No. 103030-08-6. Molecular formula: C10H7NO4. Mole weight: 205.17. Catalog: ACM103030086. | |
| 3-[(Methylamino)methyl]azetidine,n1-boc protected | Heterocyclic Organic Compound. Alternative Names: 1049730-81-5, tert-butyl 3-((methylamino)methyl)azetidine-1-carboxylate, 1-Boc-3-((Methylamino)methyl)azetidine, 1-N-Boc-3-methylaminomethyl-azetidine, 3-[(Methylamino)methyl]azetidine, N1-BOC protected, tert-butyl 3-[(methylamino)methyl]azetidine-1-carboxylate, azetidine-1-carboxylate, SureCN2675378, CTK8B6734, MolPort-009-200-039, tert-butyl 3-((methylamino)methyl), ANW-54186, AKOS005258631, PB15960, RP03454, AK-38937, KB-12994, KB-60940, Y6906, B-1705. CAS No. 1049730-81-5. Molecular formula: C10H20N2O2. Mole weight: 200.28. Purity: 0.96. IUPACName: tert-butyl 3-(methylaminomethyl)azetidine-1-carboxylate. Canonical SMILES: CC(C)(C)OC(=O)N1CC(C1)CNC. Catalog: ACM1049730815. | |
| 3-[(Methylamino)methyl]phenol | Heterocyclic Organic Compound. Alternative Names: Ambnee4028180, 3-(methylaminomethyl)phenol, 3-[(methylamino)methyl]phenol, MolPort-004-304-821, ALBB-004075, STK502898, CID10486905, 123926-62-5. CAS No. 123926-62-5. Molecular formula: C8H11NO. Mole weight: 137.18. Purity: 0.96. IUPACName: 3-(methylaminomethyl)phenol. Canonical SMILES: CNCC1=CC(=CC=C1)O. Density: 1.059g/cm³. Catalog: ACM123926625. | |
| 3-Methylbutan-2-yl nitrate | Heterocyclic Organic Compound. Alternative Names: 3-methylbutan-2-yl Nitrate, 123041-25-8, ACMC-20mqd9, AC1L3B2H, CTK0I3808. CAS No. 123041-25-8. Molecular formula: C5H11NO3. Mole weight: 133.1457. Purity: 0.96. IUPACName: 3-methylbutan-2-yl nitrate. Canonical SMILES: CC(C)C(C)O[N+](=O)[O-]. Density: 1.016g/cm³. Catalog: ACM123041258. | |
| 3-Methylbutyl acetate-d3 | Heterocyclic Organic Compound. CAS No. 1219804-75-7. Molecular formula: 133.2. Purity: 99 atom % D. Catalog: ACM1219804757. | |
| 3-Methylbutyryl-d9chloride | Heterocyclic Organic Compound. CAS No. 1219803-46-9. Molecular formula: 129.63. Purity: 98 atom % D. Catalog: ACM1219803469. | |
| 3-Methyl-d3-4-nitrophenol-2,5,6-d3 | Heterocyclic Organic Compound. CAS No. 1219803-89-0. Molecular formula: 159.17. Purity: 98 atom % D. Catalog: ACM1219803890. | |
| 3-Methyl-d3-butyric-3,4,4,4-d4acid | Heterocyclic Organic Compound. CAS No. 1219805-32-9. Molecular formula: 109.18. Purity: 98 atom % D. Catalog: ACM1219805329. | |
| 3-Methylfuran-methyl-d3 | Heterocyclic Organic Compound. Alternative Names: 3-Methylfuran-methyl-D3. CAS No. 105855-05-8. Molecular formula: C5H3D3O. Appearance: Clear Colourless liquid. Catalog: ACM105855058. | |
| 3-Methylpentanedioic-2,2,4,4-d4acid | Heterocyclic Organic Compound. CAS No. 1219798-68-1. Molecular formula: 150.17. Purity: 98 atom % D. Catalog: ACM1219798681. | |
| 3-methylpentanoic acid | Heterocyclic Organic Compound. Alternative Names: 10347-93-0, NSC165643, NSC-165643. CAS No. 10347-93-0. Molecular formula: C6H12NaO2+. Mole weight: 139.148049 [g/mol]. Purity: 0.96. IUPACName: sodium;3-methylpentanoic acid. Density: 0.947g/cm³. Catalog: ACM10347930. | |
| 3-Methylpicolinic acid hydrochloride | Heterocyclic Organic Compound. Alternative Names: 3-Methylpicolinic acid hydrochloride;3-Methyl-2-pyridinecarboxylic acid hydrochloride. CAS No. 123811-72-3. Molecular formula: C7H8ClNO2. Mole weight: 173.6. Appearance: prisms. Catalog: ACM123811723. | |
| 3-Methylpyrazine-2-carboxamide | Heterocyclic Organic Compound. Alternative Names: 3-METHYLPYRAZINE-2-CARBOXAMIDE;Pyrazinecarboxamide, 3-methyl- (9CI). CAS No. 104893-52-9. Molecular formula: C6H7N3O. Mole weight: 137.13928. Purity: 0.96. IUPACName: 3-methylpyrazine-2-carboxamide. Canonical SMILES: CC1=NC=CN=C1C(=O)N. Catalog: ACM104893529. | |
| 3-Methylpyridine-4-boronic acid pinacol ester | Heterocyclic Organic Compound. Alternative Names: 3-METHYLPYRIDINE-4-BORONIC ACID PINACOL ESTER. CAS No. 1032358-00-1. Molecular formula: C12H18BNO2. Mole weight: 219.08782. Purity: 0.96. IUPACName: 3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. Canonical SMILES: B1(OC(C(O1)(C)C)(C)C)C2=C(C=NC=C2)C. Density: 1.02 g/cm³. Catalog: ACM1032358001. | |
| 3-Methylsulfinylphenylboronic acid | Heterocyclic Organic Compound. Alternative Names: 3-METHYLSULFINYLPHENYLBORONIC ACID, 1056475-66-1, ACMC-2098h8, CTK4A3996, MolPort-000-139-847, 3-Methylsulfinylphenylboronic acid,, (3-methylsulfinylphenyl)boronic acid, ANW-15258, AKOS006279143, AG-D-19398, NCGC00249554-01, KB-32872, X1516, A-4349, A810727, I04-2293. CAS No. 1056475-66-1. Molecular formula: C7H9BO3S. Mole weight: 184. Purity: 0.98. IUPACName: (3-methylsulfinylphenyl)boronic acid. Canonical SMILES: B(C1=CC(=CC=C1)S(=O)C)(O)O. Catalog: ACM1056475661. | |
| 3-Methylsulfonyl-2,2',3',4',5,5'-hexachlorobiphenyl | Heterocyclic Organic Compound. CAS No. 104086-18-2. Catalog: ACM104086182. | |
| 3-Methylsulfonyl-4,5,3',4'-tetrachlorobiphenyl | Heterocyclic Organic Compound. CAS No. 104104-34-9. Catalog: ACM104104349. | |
| 3-[(Methylsulfonyl)amino]propanoic acid | Heterocyclic Organic Compound. CAS No. 105611-92-5. Molecular formula: C4H9NO4S. Mole weight: 167.18. Catalog: ACM105611925. | |
| 3-(Methylthio)-1H-indazole | Heterocyclic Organic Compound. CAS No. 1040502-51-9. Molecular formula: C8H8N2S. Catalog: ACM1040502519. | |
| 3-(Morpholine-4-carbonyl)phenylboronic acid pinacol ester | Heterocyclic Organic Compound. Alternative Names: 1036991-25-9, 3-(Morpholine-4-carbonyl)phenylboronic acid pinacol ester, AMTB027, CTK8B3829, ANW-43263, AKOS016004779, AK-84713, KB-27188, A-4294, [3-(Morpholine-4-carbonyl)phenyl]boronic acid pinacol ester, 3-(4-Morpholinylcarbonyl)phenylboronic acid pinacol ester, 3-(4-Morpholinylcarbonyl)phenylboronic acid pinacol ester,, 4-[3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]morpholine, Morpholino(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanone. CAS No. 1036991-25-9. Molecular formula: C17H24BNO4. Mole weight: 317.2. Purity: 0.96. IUPACName: morpholin-4-yl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone. Canonical SMILES: B1 (OC (C (O1) (C)C) (C)C)C2=CC (=CC=C2)C (=O)N3CCOCC3. Catalog: ACM1036991259. | |
| 3-N-(2-Fluoroethyl)spiperone | Heterocyclic Organic Compound. Alternative Names: 3-N-(2-fluoroethyl)spiperone;3-(2-fluoroethyl)-8-[4-(4-fluorophenyl)-4-oxobutyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one;FESP, Fluoroethylspiperone;Fluoroethyl-spiperone. CAS No. 106114-42-5. Molecular formula: C25H29F2N3O2. Catalog: ACM106114425. | |
| 3-[[n-(3-Amino-2,4,6-triiodophenyl)-N-methylamino]carbonyl]propionic acid | Heterocyclic Organic Compound. CAS No. 1221-05-2. Catalog: ACM1221052. | |
| 3-(N-Acetylamino)-5-(N-decyl-N-methylamino)benzyl alcohol | Heterocyclic Organic Compound. CAS No. 103955-90-4. Molecular formula: C20H34N2O2. Mole weight: 334.5. Catalog: ACM103955904. | |
| 3'-N-Acetylneuraminyl-3-fucosyllactose sodium salt | Heterocyclic Organic Compound. Alternative Names: 3'-N-ACETYLNEURAMINYL-3-FUCOSYLLACTOSE SODIUM SALT;3'-SIALYL-3-FUCOSYLLACTOSE;ALPHA-NEU-5AC-[2->3]-BETA-D-GAL-[1->4]-[ALPHA-FUC-(1->3)]-GLC SODIUM SALT;NEU5AC-ALPHA2,3GAL-BETA1,4(FUC-ALPHA1,3)GLC, NA;NEUNAC-ALPHA2-3GAL-BETA1-4(FUC-ALPHA1-3)GLC;SFT;3'-N-a. CAS No. 122560-33-2. Molecular formula: C29H49NO23. Mole weight: 779.69. Catalog: ACM122560332. | |
| (3-N-Boc-amino-2-oxo-2,3,4,5-tetrahydro-benzo[b]azepin-1-yl)-acetic acid | Heterocyclic Organic Compound. CAS No. 103105-97-1. Molecular formula: C17H22N2O5. Catalog: ACM103105971. | |
| 3-(N-Cyclohexylamino)phenol | Heterocyclic Organic Compound. CAS No. 5269-5-6. Molecular formula: C12H17NO. Catalog: ACM1230630. | |
| 3-(Neopentyloxy)phenylboronic acid | Heterocyclic Organic Compound. Alternative Names: 3-(NEOPENTYLOXY)PHENYLBORONIC ACID, 1236191-14-2, ACMC-209apb, CTK4B3567, MolPort-015-143-029, 3-(Neopentyloxy)phenylboronic acid,, ANW-18141, (3-(Neopentyloxy)phenyl)boronic acid, AKOS015837682, AG-L-21341, AM90028, AK-95136, KB-27690, B-2803, I04-1955. CAS No. 1236191-14-2. Molecular formula: C11H17BO3. Mole weight: 208.1. Purity: 0.96. IUPACName: [3-(2,2-dimethylpropoxy)phenyl]boronic acid. Canonical SMILES: B(C1=CC(=CC=C1)OCC(C)(C)C)(O)O. Catalog: ACM1236191142. | |
| 3-Nitro-2-pyridinecarboxylic acid methyl ester | Heterocyclic Organic Compound. Alternative Names: methyl 3-nitropyridine-2-carboxylate, 103698-08-4, 2-Pyridinecarboxylic acid, 3-nitro-, methyl ester, AC1LBDQZ, methyl 3-nitropicolinate, CTK6J1283, Methyl 3-nitro-2-pyridinecarboxylate, AKOS006310685, AG-K-79600, QC-6593, InChI=1/C7H6N2O4/c1-13-7 (10)6-5 (9 (11)12)3-2-4-8-6/h2-4H, 1H. CAS No. 103698-08-4. Molecular formula: C7H6N2O4. Mole weight: 182.133540 [g/mol]. Purity: 0.96. IUPACName: methyl 3-nitropyridine-2-carboxylate. Canonical SMILES: COC(=O)C1=C(C=CC=N1)[N+](=O)[O-]. Catalog: ACM103698084. | |
| 3-Nitro-4-(2-hydroxyethyl)amino toluene | Heterocyclic Organic Compound. CAS No. 10418-33-5. Purity: 0.96. Catalog: ACM10418335. | |
| 3-Nitro-4-methoxypropiophenone | Heterocyclic Organic Compound. Alternative Names: 3-nitro-4-methoxypropiophenone;1-(3-nitro-4-methoxyphenyl)propan-1-one. CAS No. 103204-39-3. Molecular formula: C10H11NO4. Catalog: ACM103204393. | |
| 3-NITRO-5,6,7,8-TETRAHYDRO-[1,6]NAPHTHYRIDINE | Heterocyclic Organic Compound. CAS No. 123792-68-7. Molecular formula: C8H9N3O2. Mole weight: 179.18. Catalog: ACM123792687. | |
| 3-Nitro-5-phenylpyridine | Heterocyclic Organic Compound. Alternative Names: 3-NITRO-5-PHENYLPYRIDINE. CAS No. 123792-62-1. Molecular formula: C11H8N2O2. Mole weight: 200.19. Purity: 0.96. IUPACName: 3-nitro-5-phenylpyridine. Canonical SMILES: C1=CC=C (C=C1)C2=CC (=CN=C2)[N+] (=O)[O-]. Density: 1.252g/cm³. Catalog: ACM123792621. | |
| 3'-Nitrobenzanilide | Heterocyclic Organic Compound. Alternative Names: 3'-Nitrobenzanilide;N-(m-Nitrophenyl)benzamide. CAS No. 4771-8-8. Molecular formula: C13H10N2O3. Catalog: ACM1048832. | |
| 3-Nitrobenzoic Acid | Environmental Standards. Alternative Names: m-Nitrobenzoic acid. CAS No. 121-92-6. Molecular formula: C7H5NO4. Mole weight: 167.12. Catalog: ACM121926. | |
| 3-NitrobenzoicAcidForSynthesis | Heterocyclic Organic Compound. Alternative Names: 3-NitrobenzoicAcidForSynthesis. CAS No. 121-92-3. Catalog: ACM121923. | |
| 3-Nitrobenzonitrile | Heterocyclic Organic Compound. CAS No. 12402-46-9. Molecular formula: C7H4N2O2. Mole weight: 148.12. Catalog: ACM12402469. | |
| 3-Nitrobenzyl-d6alcohol | Heterocyclic Organic Compound. CAS No. 1219795-18-2. Molecular formula: 159.17. Purity: 99 atom % D. Catalog: ACM1219795182. | |
| 3-Nitropyridazine | Heterocyclic Organic Compound. CAS No. 122429-11-2. Mole weight: 125.087. Catalog: ACM122429112. | |
| 3-(N-Methyl-N-pentyl-amino)propionic Acid-d3 Hydrochloride | Heterocyclic Organic Compound. Alternative Names: N-Methyl-N-pentyl-β-alanine-d3 Hydrochloride; Ibanic Acid-d3 Hydrochloride. CAS No. 1246817-11-7. Molecular formula: C9H17D3ClNO2. Mole weight: 212.73. Appearance: Off-White Solid. Catalog: ACM1246817117. | |
| 3-(N-Morpholino)propanesulfonic acid-d15 | Heterocyclic Organic Compound. CAS No. 1219799-30-0. Molecular formula: C7H15NO4S. Mole weight: 224.35. Purity: 97-98 atom % D. IUPACName: deuterio 1,1,2,2,3,3-hexadeuterio-3-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)propane-1-sulfonate. Catalog: ACM1219799300. | |
| 3-(N,N-Dimethylamino)methylphenylboronic acid,pinacol ester,hcl | Heterocyclic Organic Compound. Alternative Names: 1036991-19-1, 3-(N,N-Dimethylaminomethy)phenylboronic acid pinacol ester hydrochloride, 3-[(N,N-Dimethylamino)methyl]benzeneboronic acid pinacol ester hydrochloride, 3-((N,N-DIMETHYLAMINO)METHYL)PHENYL BORONIC ACID PINACOL ESTER HYDROCHLORIDE, N,N-Dimethyl-1-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanamine hydrochloride, SureCN2006790, CTK8B3382, MolPort-001-760-987, ANW-42438, OR2766, AKOS016004778, AB25707, AK-84712, KB-105896, X1510, A-4293, 3-(N,N-Dimethylamino)methylphenylboronic acid, pinacol ester, HCl,, 3-(N,N-DIMETHYLAMINO)METHYLPHENYLBORONIC ACID, PINACOL ESTER, HCL, 3-[ (DIMETHYLAMINO)METHYL]BENZENEBORONIC ACID, PINACOL ESTER HYDROCHLORIDE, dimethyl({[3-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl})amine hydrochloride. CAS No. 1036991-19-1. Molecular formula: C15H24BNO2.ClH. Mole weight: 297.6. Purity: 0.97. IUPACName: N,N-dimethyl-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine;hydrochloride. Canonical SMILES: B1 (OC (C (O1) (C)C) (C)C)C2=CC (=CC=C2)CN (C)C. Cl. Catalog: ACM1036991191. | |
| 3-N-Octadecylthiophene | Heterocyclic Organic Compound. Alternative Names: 3-Octadecylthiophene, 104934-54-5, 3-Stearylthiophene, 3-Octadecylthiophene;, AC1LBZA4, Thiophene, 3-octadecyl-, SureCN148237, AC1Q7FZ8, 3-N-OCTADECYLTHIOPHENE, ACMC-2098e5, CTK0H4172, ANW-15147, AR-1F4739, GEO-02055, AKOS005255126, AG-D-17919, KB-71025, FT-0642577, O0245, A801104. CAS No. 104934-54-5. Molecular formula: C22H40S. Mole weight: 336.62. Purity: >98.0%(GC). IUPACName: 3-octadecylthiophene. Density: 0.895 g/cm³. Catalog: ACM104934545. | |
| 3-Nonen-8-yn-2-one,(3E)-(9ci) | Heterocyclic Organic Compound. CAS No. 123405-87-8. Catalog: ACM123405878. | |
| 3-[n-Tris(hydroxymethyl)methylamino]-2-hydroxypropanesulfonic acid sodium salt | Heterocyclic Organic Compound. CAS No. 105140-25-8. Molecular formula: C7H16NNaO7S. Mole weight: 281.26. Purity: Purity >98%. Catalog: ACM105140258. | |
| 3-O-(4-Toluenesulfonyl)-2-O-acetyl-L-methylfucoside | Heterocyclic Organic Compound. Alternative Names: 3-O-(4-TOLUENESULFONYL)-2-O-ACETYL-L-METHYLFUCOSIDE. CAS No. 103930-42-3. Molecular formula: C16H22O8S. Mole weight: 374.41. Catalog: ACM103930423. | |
| 3-O-Acetyl 9,11-Dehydro Beta-Boswellic Acid | Terpenoids. CAS No. 122651-20-1. Molecular formula: C32H48O4. Mole weight: 496.7. Appearance: White powder. Purity: 0.98. IUPACName: (3R,4aS,11R,12S,12aR)-3-acetyloxy-4,6a,6b,8a,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a-dodecahydro-1H-picene-4-carboxylic acid. Canonical SMILES: CC1CCC2 (CCC3 (C (=CC=C4C3 (CCC5C4 (CCC (C5 (C)C (=O)O)OC (=O)C)C)C)C2C1C)C)C. Catalog: ACM122651201. | |
| 3-O-Acetyl ezetimibe | Heterocyclic Organic Compound. Alternative Names: (3R,4S)-3-[(3S)-3-(Acetyloxy)-3-(4-fluorophenyl)propyl]-1-(4-fluorophenyl)-4-(4-hydroxyphenyl)-2-azetidinone. CAS No. 1044664-24-5. Molecular formula: C26H23F2NO4. Mole weight: 451.46. Appearance: White Solid. Purity: 0.96. IUPACName: [(1R)-1-(4-fluorophenyl)-3-[(2S,3R)-1-(4-fluorophenyl)-2-(4-hydroxyphenyl)-4-oxoazetidin-3-yl]propyl] acetate. Canonical SMILES: CC (=O)OC (CCC1C (N (C1=O)C2=CC=C (C=C2)F)C3=CC=C (C=C3)O)C4=CC=C (C=C4)F. Catalog: ACM1044664245. | |
| 3-O-Caffeoylquinic Acid Methyl Ester | Phenols. CAS No. 123483-19-2. Molecular formula: C17H20O9. Mole weight: 368.34. Catalog: ACM123483192. | |
| 3-Octyn-2-one,1,1,1-trifluoro- | Heterocyclic Organic Compound. Alternative Names: 1,1,1-trifluorooct-3-yn-2-one, 3-Octyn-2-one,1,1,1-trifluoro-, 105439-85-8, ACMC-20cy1o, AC1Q4I2G, AC1L4F02, CTK4A3838, KST-1A9938, 1,1,1-Trifluorooct-3-yn-2-one;, AR-1B3869, AG-K-89001. CAS No. 105439-85-8. Molecular formula: C8H9 F3 O. Mole weight: 178.1517. Purity: 0.96. IUPACName: 1,1,1-trifluorooct-3-yn-2-one. Density: 1.131g/cm³. Catalog: ACM105439858. | |
| 3-O-Desmethyl Thiocolchicine D3 | 2H Labeled Compounds. Alternative Names: (S)-N-(3-hydroxy-1,2-dimethoxy-10-(methylthio)-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl)acetamide-2,2,2-d3. CAS No. 1246818-03-0. Mole weight: 404.5. Purity: >95%. Catalog: ACM1246818030. | |
| 3'-O-Methyl-D-adenosine | Heterocyclic Organic Compound. CAS No. 10300-22-8. Molecular formula: C11H15N5O4. Catalog: ACM10300228. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.