Alfa Chemistry. 5 - Products
Alfa Chemistry offers an extensive catalog of building blocks, reagents, catalysts, reference materials, and research chemicals in a wide range of applications. In stock products can be shipped quickly.
| Product | Description | |
|---|---|---|
| 4-Hydroxypiperidine-2,2,3,3,4,5,5,6,6-d9 | Heterocyclic Organic Compound. CAS No. 1219799-39-9. Molecular formula: 110.2. Purity: 98 atom % D. Catalog: ACM1219799399. |  |
| 4-Hydroxypiperidine-3,3,4,5,5-d5 | Heterocyclic Organic Compound. CAS No. 1219799-35-5. Molecular formula: 106.18. Purity: 98 atom % D. Catalog: ACM1219799355. | |
| 4'-Hydroxypiptocarphin A | Terpenoids. Alternative Names: 2-Propenoic Acid, 2-(Hydroxymethyl)-, (4S, 6R, 7S, 10R, 11E)-3-[(Acetyloxy)Methyl]-2, 4, 5, 6, 7, 8, 9, 10-Octahydro-6, 7-Dihydroxy-6, 10-Dimethyl-2-Oxo-7, 10-Epoxycyclodeca[B]Furan-4-Yl Ester. CAS No. 103994-39-4. Molecular formula: C21H26O10. Mole weight: 438.42. Appearance: Powder. Purity: 0.98. IUPACName: [(1R,2E,8S,10R,11S)-6-(acetyloxymethyl)-10,11-dihydroxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-8-yl] 2-(hydroxymethyl)prop-2-enoate. Canonical SMILES: CC (=O)OCC1=C2C (CC (C3 (CCC (O3) (C=C2OC1=O)C)O) (C)O)OC (=O)C (=C)CO. Density: 1.4±0.1 g/cm3. Catalog: ACM103994394. | |
| (±)-4-Hydroxypropranolol-d7hcl(iso-propyl-d7) | Heterocyclic Organic Compound. Alternative Names: [2H7]- 4-Hydroxypropranolol hydrochloride, 1219804-03-1. CAS No. 1219804-03-1. Molecular formula: 318.85. Mole weight: 318.846912 [g/mol]. Purity: 99 atom % D. IUPACName: 4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]naphthalen-1-ol;hydrochloride. Canonical SMILES: CC(C)NCC(COC1=CC=C(C2=CC=CC=C21)O)O. Cl. Catalog: ACM1219804031. | |
| 4-Hydroxyquinoline-3-carbohydrazide | Heterocyclic Organic Compound. Alternative Names: 4-Hydroxy-chinolin-3-carbonsaeure-hydrazid; 4-Hydroxyquinoline-3-carbohydrazide. CAS No. 103264-46-6. Molecular formula: C10H9N3O2. Mole weight: 203.197. Purity: 0.96. IUPACName: 4-hydroxy-quinoline-3-carboxylic acid hydrazide. Catalog: ACM103264466. | |
| 4-Hydroxy triamterene | Heterocyclic Organic Compound. Alternative Names: 4-(2,4,7-Triamino-6-pteridinyl)phenol. CAS No. 1226-52-4. Molecular formula: C12H11N7O. Mole weight: 269.26. Appearance: Yellow Solid. Catalog: ACM1226524. | |
| 4-Imidazo[1,2-a]pyrimidin-2-yl-benzonitrile | Heterocyclic Organic Compound. Alternative Names: 4-IMIDAZO[1,2-A]PYRIMIDIN-2-YL-BENZONITRILE;4-Imidazo[1,2-a]pyrimidin-2-yl-benzonitrile >99%;4-IMIDAZO[1,2-A]PYRIMIDIN-2-YL-. CAS No. 104691-51-2. Molecular formula: C13H8N4. Mole weight: 220.23. Catalog: ACM104691512. | |
| 4-Iodo-2,3-dimethyl acetanilide | Heterocyclic Organic Compound. Alternative Names: N-(4-IODO-2,3-DIMETHYLPHENYL)-ACETAMIDE;SALOR-INT L168181-1EA;4-IODO-2,3-DIMETHYL ACETANILIDE. CAS No. 123765-66-2. Molecular formula: C10H12INO. Mole weight: 289.11. Purity: 0.96. IUPACName: 4-IODO-2,3-DIMETHYL ACETANILIDE. Catalog: ACM123765662. | |
| 4-Iodo-2-(trifluoromethyl)pyridine | Heterocyclic Organic Compound. CAS No. 1250277-69-2. Purity: 0.96. Catalog: ACM1250277692. | |
| 4-Iodo-3-nitroaniline | Heterocyclic Organic CompoundAmines. Alternative Names: 4-Iodo-3-nitroaniline, 105752-04-3, NSC141348, AC1Q5ADW, ACMC-1C4ER, SureCN616675, Benzenamine,4-iodo-3-nitro-, 667927_ALDRICH, AC1L620C, CTK4A4098, AR-1G2912, 4-Iodo-3-nitroaniline;NSC 141348, AG-D-19577, NSC-141348. CAS No. 105752-04-3. Molecular formula: C6H5IN2O2. Mole weight: 264.02. Purity: 0.96. IUPACName: 4-iodo-3-nitroaniline. Canonical SMILES: C1=CC(=C(C=C1N)[N+](=O)[O-])I. Density: 2.101g/cm³. Catalog: ACM105752043. | |
| 4-Iodo-5-methoxypyridin-3-amine | Heterocyclic Organic Compound. Alternative Names: 4-Iodo-5-methoxypyridin-3-amine, 1045855-66-0, AC1Q4F6W, CTK7B1907, MolPort-005-956-993, AKOS015853974, AG-A-76060, KB-242443, A-5889. CAS No. 1045855-66-0. Molecular formula: C6H7IN2O. Mole weight: 250.04. Purity: 0.96. IUPACName: 4-iodo-5-methoxypyridin-3-amine. Canonical SMILES: COC1=C(C(=CN=C1)N)I. Catalog: ACM1045855660. | |
| 4-Iodooxazole | Heterocyclic Organic Compound. CAS No. 1224742-18-0. Molecular formula: C3H2INO. Mole weight: 194.959. Purity: 0.96. IUPACName: 4-iodooxazole. Catalog: ACM1224742180. | |
| 4-Iodo suberoylanilide hydroxamic acid | Heterocyclic Organic Compound. Alternative Names: N1-Hydroxy-N8-(4-iodophenyl)octanediamide; 4-Iodo-SAHA. CAS No. 1219807-87-0. Molecular formula: C14H19IN2O3. Mole weight: 390.22. Purity: 0.96. IUPACName: N-hydroxy-N-(4-iodophenyl)octanediamide. Canonical SMILES: C1=CC(=CC=C1NC(=O)CCCCCCC(=O)NO)I. Catalog: ACM1219807870. | |
| 4-Iodotoluene-d7 | Heterocyclic Organic Compound. CAS No. 1039678-66-4. Molecular formula: 225.08. Mole weight: 225.078. Purity: 98 atom % D. IUPACName: [D]-p-iodotoluene. Catalog: ACM1039678664. | |
| 4'-Isobutyl-2,2-dibromopropiophenone | Heterocyclic Organic Compound. Alternative Names: 2,2-Dibromo-1-[4-(2-methylpropyl)phenyl]-1-propanone. CAS No. 104483-05-8. Molecular formula: C13H16Br2O. Mole weight: 348.07. Appearance: Pale Yellow Solid. Purity: 0.96. IUPACName: 2,2-dibromo-1-[4-(2-methylpropyl)phenyl]propan-1-one. Canonical SMILES: CC(C)CC1=CC=C(C=C1)C(=O)C(C)(Br)Br. Catalog: ACM104483058. | |
| 4-Isobutylmorpholine | Heterocyclic Organic Compound. Alternative Names: Morpholine, 4-(2-methylpropyl)-;Morpholine, 4-isobutyl-; 4-ISOBUTYLMORPHOLINE; N-ISOBUTYLMORPHOLINE; ISOBUTYLMORPHOLINE; 4-(2-methylpropyl)-Morpholine. CAS No. 10315-98-7. Molecular formula: C8H17NO. Mole weight: 143.23. Density: 0,89 g/cm3. Catalog: ACM10315987. | |
| 4-Isobutylphenylboronic acid,pinacol ester | Heterocyclic Organic Compound. Alternative Names: 4-ISOBUTYLPHENYLBORONIC ACID, PINACOL ESTER, 1033753-01-3, 4-Isobutylphenylboronic acid pinacol ester, 4,4,5,5-tetramethyl-2-[4-(2-methylpropyl)phenyl]-1,3,2-dioxaborolane, 2-(4-Isobutylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, SureCN648399, AGN-PC-01LR0O, CTK8B3019, MolPort-002-054-910, BM180, ANW-41615, AKOS015960147, AB21926, AK-84709, KB-39367, 4-Isobutylphenylboronic acid, pinacol ester,, X1507, A-4278, 1,3,2-DIOXABOROLANE, 4,4,5,5-TETRAMETHYL-2-[4-(2-METHYLPROPYL)PHENYL]-. CAS No. 1033753-01-3. Molecular formula: C16H25BO2. Mole weight: 260.2. Purity: 0.95. IUPACName: 4,4,5,5-tetramethyl-2-[4-(2-methylpropyl)phenyl]-1,3,2-dioxaborolane. Canonical SMILES: B1 (OC (C (O1) (C)C) (C)C)C2=CC=C (C=C2)CC (C)C. Catalog: ACM1033753013. | |
| 4-Isobutyrylacetophenone | Heterocyclic Organic Compound. Alternative Names: 4-ISOBUTYRYLACETOPHENONE;1-(4-Acetylphenyl)-2-methyl-1-propanone. CAS No. 103931-20-0. Molecular formula: C12H14O2. Mole weight: 190.24. Appearance: Light Yellow Oil. Catalog: ACM103931200. | |
| 4-Isocyanoacetophenone | Heterocyclic Organic Compound. Alternative Names: 1-(4-isocyanophenyl)ethanone, 4-Isocyanoacetophenone, AC1L9NKL, CHEMBL74929, AKOS006293683, 125192-28-1. CAS No. 125192-28-1. Molecular formula: C9H7NO. Mole weight: 145.16. Purity: 0.96. IUPACName: 1-(4-isocyanophenyl)ethanone. Canonical SMILES: CC(=O)C1=CC=C(C=C1)[N+]#[C-]. Catalog: ACM125192281. | |
| 4-(Isonicotinamido)phthalic acid | Carboxylated Nitrogen Hybrid MOFs Ligands. CAS No. 1245212-48-9. Molecular formula: C14H10N2O5. Mole weight: 286.23. Purity: 95%+. Catalog: ACM1245212489-1. | |
| 4- (Isopropoxycarbonylamino) phenylboronic acid | Heterocyclic Organic Compound. CAS No. 1033726-21-4. Molecular formula: C10H14BNO4. Purity: 0.96. Catalog: ACM1033726214. | |
| (4-ISOPROPOXY-PHENYL)-HYDRAZINE HYDROCHLORIDE | Heterocyclic Organic Compound. CAS No. 104033-62-7. Molecular formula: C9H15ClN2O. Mole weight: 202.68. Catalog: ACM104033627. | |
| 4'-iso-Propyl-2,2,2-trifluoroacetophenone | Heterocyclic Organic Compound. Alternative Names: 4-iso-Propyl-2,2,2-trifluoroacetophenone, 124211-72-9, 2,2,2-trifluoro-1-(4-isopropylphenyl)ethanone, Ethanone,2,2,2-trifluoro-1-[4-(1-methylethyl)phenyl]-, ZINC02378553, AC1MC0LC, ACMC-1C5ZV, SureCN13384248, CTK4B3790, AKOS012259943, AB08904, AG-D-51844, 4-isopropyl-2,2,2-trifluoroacetophenone, KB-192918, 2,2,2-trifluoro-1-(4-isopropyl-phenyl)-ethanone, 2,2,2-trifluoro-1-(4-propan-2-ylphenyl)ethanone, 2,2,2-TRIFLUORO-1-[4-(1-METHYLETHYL)PHENYL]-ETHANONE, 2,2,2-TRIFLUORO-1-[4-(PROPAN-2-YL)PHENYL]ETHAN-1-ONE, ETHANONE, 2,2,2-TRIFLUORO-1-[4-(1-METHYLETHYL)PHENYL]-, Ethanone, 2,2,2-trifluoro-1-[4-(1-methylethyl)phenyl]- (9CI). CAS No. 124211-72-9. Molecular formula: C11H11F3O. Mole weight: 216.2. Purity: 0.96. IUPACName: 2,2,2-trifluoro-1-(4-propan-2-ylphenyl)ethanone. Density: 1.153g/cm³. Catalog: ACM124211729. | |
| (4-Isopropyl-3-methyl-phenoxy)-acetic acid | Heterocyclic Organic Compound. Alternative Names: ZINC03097099, CID2303819, 105401-43-2. CAS No. 105401-43-2. Molecular formula: C12H16O3. Mole weight: 208.254. Purity: 0.96. IUPACName: 2-(3-methyl-4-propan-2-ylphenoxy)acetate. Density: g/cm³. Catalog: ACM105401432. | |
| 4-Isopropylamino-3-nitrophenylboronic acid,pinacol ester | Heterocyclic Organic Compound. Alternative Names: 4-Isopropylamino-3-nitrophenylboronic acid pinacol ester, 1218791-21-9, KB-39394, X1756, B-2719, 4-Isopropylamino-3-nitrophenylboronic acid, pinacol ester. CAS No. 1218791-21-9. Molecular formula: C15H23BN2O4. Mole weight: 306.2. Purity: 0.98. IUPACName: 2-nitro-N-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. Canonical SMILES: B1 (OC (C (O1) (C)C) (C)C)C2=CC (=C (C=C2)NC (C)C)[N+] (=O)[O-]. Catalog: ACM1218791219. | |
| 4-iso-Propylaniline-2,3,5,6-d4 | Heterocyclic Organic Compound. CAS No. 1219804-95-1. Molecular formula: 139.23. Purity: 98 atom % D. Catalog: ACM1219804951. | |
| 4- ( (Isopropyldimethylsilyl)Oxy)Cyclohex-1-En-1-Yl Trifluoromethanesulfonate | Organosilicone. CAS No. 1245648-54-7. Molecular formula: C12H21F3O4SSi. Purity: 0.95. Catalog: ACM1245648547. | |
| 4-iso-Propylphenol-d12 | Heterocyclic Organic Compound. CAS No. 1219805-27-2. Molecular formula: 148.27. Mole weight: 384.8991;g/mol. Purity: 98 atom % D. IUPACName: 2-(4-chloro-2-methylphenoxy)-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]ethanone. Canonical SMILES: CC1=C (C=CC (=C1)Cl)OCC (=O)N2CCN (CC2)CC=CC3=CC=CC=C3. Catalog: ACM1219805272. | |
| 4-Isothiocyanatophenyl ether | Heterocyclic Organic Compound. Alternative Names: 4-Isothiocyanatophenyl ether, 10396-05-1, 1-isothiocyanato-4-(4-isothiocyanatophenoxy)benzene, AC1MC0LO, CTK4A2529, MolPort-000-156-697, AKOS015853652, KB-61470, Benzene,1,1-oxybis[4-isothiocyanato- (9CI), I09-2833. CAS No. 10396-05-1. Molecular formula: C14H8N2OS2. Mole weight: 284.36. Purity: 0.96. IUPACName: 1-isothiocyanato-4-(4-isothiocyanatophenoxy)benzene. Canonical SMILES: C1=CC (=CC=C1N=C=S)OC2=CC=C (C=C2)N=C=S. Density: 1.21g/cm³. Catalog: ACM10396051. | |
| 4ME 16:0 NBD PE (NBD-DPhPE) | OthersFluorescent Lipids. Alternative Names: 1,2-Diphytanoyl-sn-glycero-3-phosphoethanolamine-N-(7-nitro-2-1,3-benzoxadiazol-4-yl) (ammonium salt); NBD-DPhPE. CAS No. 1246355-56-5. Molecular formula: C51H94N5O11P. Mole weight: 984.29. Appearance: Powder. Purity: >99%. Catalog: ACM1246355565. | |
| 4-Methoxy-1,3-phenylenediamine sulfate hydrate | Heterocyclic Organic Compound. Alternative Names: 1,3-benzenediamine,4-methoxy-,sulfate(1:1),hydrate;4-methoxy-1,3-benzenediaminesulfate(1:1)hydrate;m-phenylenediamine,1-methoxy-,sulfate,hydrate;4-METHOXY-M-PHENYLENEDIAMINE SULFATE HYDRATE;4-METHOXY-M-PHENYLENEDIAMINE SULFATE SALT;4-METHOXY-1,3-PHENYLEN. CAS No. 123333-56-2. Molecular formula: C7H10N2O.H2O4S. Mole weight: 236.25. Catalog: ACM123333562. | |
| 4-Methoxy-1H-pyrrolo[2,3-b]pyridine | Heterocyclic Organic Compound. CAS No. 123379-63-9. Purity: 0.96. Catalog: ACM123379639. | |
| 4-Methoxy-1-methyl-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine-2-carboxylic acid | Heterocyclic Organic Compound. CAS No. 1219354-88-7. Purity: 0.96. Catalog: ACM1219354887. | |
| 4-Methoxy-2-(1-phenyl-ethyl)-phenol | Heterocyclic Organic Compound. Alternative Names: 4-METHOXY-2-(1-PHENYL-ETHYL)-PHENOL. CAS No. 10446-37-4. Molecular formula: C15H16O2. Mole weight: 228.28634. Catalog: ACM10446374. | |
| 4-Methoxy-2-indanone | Heterocyclic Organic Compound. Alternative Names: 4-Methoxy-2-indanone. CAS No. 124067-30-7. Molecular formula: C10H10O2. Mole weight: 162.1852. Catalog: ACM124067307. | |
| 4-Methoxy-2-(methoxymethoxy)benzaldehyde | Heterocyclic Organic Compound. Alternative Names: 4-Methoxy-2-(methoxymethoxy)benzaldehyde. CAS No. 124555-63-1. Molecular formula: C10H12O4. Mole weight: 196.203. Purity: 0.96. IUPACName: 4-methoxy-2-(methoxymethoxy)benzaldehyde. Canonical SMILES: COCOC1=C(C=CC(=C1)OC)C=O. Catalog: ACM124555631. | |
| 4'-Methoxy-2-(trifluoromethyl)biphenyl-4-amine | Heterocyclic Organic Compound. Alternative Names: 4-Methoxy-2-(trifluoromethyl)-[1,1-biphenyl]-4-amine, 1044209-50-8, AGN-PC-0CMKB5, CTK8C0935, ANW-65490, AKOS016005474, AK102690, KB-242498, 4-(4-methoxyphenyl)-3-(trifluoromethyl)aniline. CAS No. 1044209-50-8. Molecular formula: C14H12F3NO. Mole weight: 267.246390 [g/mol]. Purity: 0.96. IUPACName: 4-(4-methoxyphenyl)-3-(trifluoromethyl)aniline. Canonical SMILES: COC1=CC=C (C=C1)C2=C (C=C (C=C2)N)C (F) (F)F. Catalog: ACM1044209508. | |
| 4-Methoxy-3-Nitrobenzoyl Chloride | Heterocyclic Organic Compound. Alternative Names: 4-METHOXY-3-NITROBENZOYL CHLORIDE;3-Nitro-4-methoxybenzoic acid chloride. CAS No. 10397-28-1. Molecular formula: C8H6NO4Cl. Mole weight: 215.59. Purity: 0.96. IUPACName: 4-methoxy-3-nitrobenzoyl chloride. Canonical SMILES: COC1=C(C=C(C=C1)C(=O)Cl)[N+](=O)[O-]. Density: 1.421g/cm³. Catalog: ACM10397281. | |
| 4-Methoxy-4-trifluoromethyl-biphenyl | Heterocyclic Organic Compound. CAS No. 10335-12-1. Purity: 0.96. Catalog: ACM10335121. | |
| 4-Methoxy-6-(trifluoromethyl)-1,3,5-triazin-2-amine | Heterocyclic Organic Compound. CAS No. 5311-5-7. Molecular formula: C5H8N4O. Catalog: ACM1245970. | |
| 4-Methoxy-7-azaindole | Heterocyclic Organic Compound. CAS No. 122379-63-9. Molecular formula: C8H8N2O. Mole weight: 148.16. Catalog: ACM122379639. | |
| 4'-Methoxyagarotetrol | Aldehydes. CAS No. 123278-01-3. Molecular formula: C18H20O7. Mole weight: 348.35. Catalog: ACM123278013. | |
| 4-Methoxy-alpha-methyl-N-(phenylmethyl)benzeneethanamine hydrochloride | Heterocyclic Organic Compound. Alternative Names: 4-Methoxy-alpha-methyl-N-(phenylmethyl)benzeneethanamine hydrochloride. CAS No. 1049695-95-5. Molecular formula: C17H21NO.HCl. Mole weight: 291.81568. Catalog: ACM1049695955. | |
| 4-Methoxyaniline-2,3,5,6-d4 | Heterocyclic Organic Compound. Alternative Names: 4-METHOXYANILINE--D4; 4-Methoxyaniline-2,3,5,6-d4. CAS No. 1219798-55-6. Molecular formula: 127.18. Mole weight: 127.177. Purity: 99 atom % D. IUPACName: 2,3,5,6-tetradeuterio-4-methoxyaniline. Catalog: ACM1219798556. | |
| 4-Methoxybenzo[d]oxazole-2(3H)-thione | Heterocyclic Organic Compound. Alternative Names: 4-Methoxybenzo[d]oxazole-2(3H)-thione, 1246471-39-5, SureCN10012992, CTK8E1806, AKOS016012436, AK127077, KB-242581. CAS No. 1246471-39-5. Molecular formula: C8H7NO2S. Mole weight: 181.211680 [g/mol]. Purity: 0.96. IUPACName: 4-methoxy-3H-1,3-benzoxazole-2-thione. Canonical SMILES: COC1=CC=CC2=C1NC(=S)O2. Catalog: ACM1246471395. | |
| 4-Methoxybenzoic-d7acid | Heterocyclic Organic Compound. CAS No. 1219803-08-3. Molecular formula: 156.17. Mole weight: 366.47988;g/mol. Purity: 98 atom % D. IUPACName: N-(4-methylpiperazin-1-yl)-2-(5-methylthiophen-2-yl)quinoline-4-carboxamide. Canonical SMILES: CC1=CC=C (S1)C2=NC3=CC=CC=C3C (=C2)C (=O)NN4CCN (CC4)C. Catalog: ACM1219803083. | |
| ((4-Methoxybenzoyl)oxy)acetic acid | Heterocyclic Organic Compound. CAS No. 10414-68-3. Catalog: ACM10414683. | |
| (4-Methoxy-benzyl)-(2-methoxy-ethyl)-amine | Heterocyclic Organic Compound. CAS No. 103464-79-5. Molecular formula: C11H17NO2. Mole weight: 195.26. Catalog: ACM103464795. | |
| 4-Methoxybenzyl Acetate | Esters. Alternative Names: Anisyl acetate. CAS No. 104-21-2. Molecular formula: C10H12O3. Mole weight: 180.2. Purity: 0.99. IUPACName: (4-Methoxyphenyl)methyl acetate. Canonical SMILES: CC(=O)OCC1=CC=C(C=C1)OC. Density: 1.107 g/mL at 25 °C(lit.). Catalog: ACM104212. | |
| 4-Methoxybenzyl alcohol | Alcohols. Alternative Names: Anise alcohol. CAS No. 105-13-5. Molecular formula: C8H10O2. Mole weight: 138.16. Purity: 99%+. IUPACName: (4-Methoxyphenyl)methanol. Canonical SMILES: COC1=CC=C(C=C1)CO. Density: 1.113 g/mL at 25 °C(lit.). Catalog: ACM105135. | |
| 4-METHOXYBENZYL FORMATE | Heterocyclic Organic Compound. Alternative Names: Anisyl formate. CAS No. 122-91-8. Molecular formula: C9H10O3. Mole weight: 166.17. Purity: 95%+. IUPACName: (4-Methoxyphenyl)methyl formate. Canonical SMILES: COC1=CC=C(C=C1)COC=O. Density: 1.035 g/mL at 25 °C(lit.). ECNumber: 204-582-9. Catalog: ACM122918. | |
| 4-Methoxycarbonyl-3-(trifluoromethyl)phenylboronic acid pinacol ester | Boronic Esters. CAS No. 1045795-70-7. Catalog: ACM1045795707. | |
| 4-Methoxy-d3-toluene-2,3,5,6-d4 | Heterocyclic Organic Compound. CAS No. 1219798-94-3. Molecular formula: 129.21. Purity: 99 atom % D. Catalog: ACM1219798943. | |
| 4-Methoxyindole-2-carboxylic acid | Indoles. Alternative Names: 1H-Indole-2-carboxylicacid, 4-methoxy-;Indole-2-carboxylicacid, 4-methoxy- (6CI);4-Methoxy-1H-indole-2-carboxylic acid. CAS No. 103260-65-7. Molecular formula: C10H9NO3. Mole weight: 191.18. Density: 1.381 g/cm³. Catalog: ACM103260657. | |
| 4-methoxymandelic acid | Heterocyclic Organic Compound. Alternative Names: α-Hydroxy-4-methoxybenzeneacetic acid. CAS No. 10502-44-0. Molecular formula: C9H10O4. Mole weight: 182.18. Appearance: Powder to crystal. Purity: 0.98. IUPACName: 2-Hydroxy-2-(4-methoxyphenyl)acetic acid. Canonical SMILES: COC1=CC=C(C=C1)C(C(=O)O)O. Density: 1.309 g/cm³. Catalog: ACM10502440. | |
| 4-Methoxynaphthalene-2-carboxaldehyde | Heterocyclic Organic Compound. Alternative Names: 4-Methoxynaphthalene-2-carboxaldehyde. CAS No. 123239-64-5. Molecular formula: C12H10O2. Mole weight: 186.2066. Purity: 0.96. IUPACName: 4-methoxynaphthalene-2-carbaldehyde. Canonical SMILES: COC1=CC(=CC2=CC=CC=C21)C=O. Catalog: ACM123239645. | |
| 4-Methoxy-N-methylaniline hcl | Heterocyclic Organic Compound. Alternative Names: 4-Methoxy-N-methylaniline hydrochloride, 10541-33-0, SureCN163829, AGN-PC-01ZS6V, AKOS015908244, AK130761, KB-39629, Benzenamine, 4-methoxy-N-methyl-, hydrochloride, I14-24518. CAS No. 10541-33-0. Molecular formula: C8H12ClNO. Mole weight: 173.6. Purity: 0.98. IUPACName: 4-methoxy-N-methylaniline;hydrochloride. Canonical SMILES: CNC1=CC=C(C=C1)OC.Cl. Catalog: ACM10541330. | |
| (4-methoxyphenyl)[1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl]-Methanone | Heterocyclic Organic Compound. Alternative Names: (4-methoxyphenyl)[1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl]-Methanone. CAS No. 103608-67-9. Catalog: ACM103608679. | |
| 4-Methoxyphenyl-2,3,5,6-d4-acetonitrile | 2H Labeled Compounds. CAS No. 1219798-74-9. Mole weight: 151.2. Catalog: ACM1219798749. | |
| 4-Methoxyphenylacetic acid | Heterocyclic Organic Compound. Alternative Names: p-Methioxy-toluicacid. CAS No. 104-01-8. Molecular formula: C9H10O3. Mole weight: 166.17. Appearance: White to off-yellow powder. Purity: 0.98. IUPACName: 2-(4-methoxyphenyl)acetic acid. Canonical SMILES: COC1=CC=C(C=C1)CC(=O)O. Density: 1.171 g/ml. Catalog: ACM104018. | |
| 4-MethoxyPhenylAceticAcid | Heterocyclic Organic Compound. CAS No. 104-1-8. Catalog: ACM10418. | |
| 4-Methoxyphenylacetone | Heterocyclic Organic Compound. Alternative Names: 1-(p-Methoxyphenyl)-2-propanon. CAS No. 122-84-9. Molecular formula: C10H12O2. Mole weight: 164.2. Appearance: Pale yellow liquid. Purity: 95%+. IUPACName: 1-(4-Methoxyphenyl)propan-2-one. Canonical SMILES: CC(=O)CC1=CC=C(C=C1)OC. Density: 1.067 g/mL at 25 °C(lit.). ECNumber: 204-578-7. Catalog: ACM122849. | |
| 4-Methoxypiperidine-2-carboxylic acid | Heterocyclic Organic Compound. Alternative Names: 4-METHOXY-PIPERIDINE-2-CARBOXYLIC ACID. CAS No. 123811-79-0. Molecular formula: C7H13NO3. Mole weight: 159.18. Catalog: ACM123811790. | |
| 4'-Methoxypropiophenone | Heterocyclic Organic Compound. CAS No. 121-97-1. Molecular formula: C10H12O2. Mole weight: 164.2. Purity: 0.98. Catalog: ACM121971. | |
| 4-Methoxy-pyridine-2-carboxylic acid hydrochloride | Heterocyclic Organic Compound. CAS No. 123811-74-5. Molecular formula: C7H8ClNO3. Mole weight: 189.6. Catalog: ACM123811745. | |
| 4-Methoxy(toluene-d7) | Heterocyclic Organic Compound. CAS No. 1036431-36-3. Molecular formula: 129.21. Mole weight: 129.208. Purity: 98 atom % D. IUPACName: 4-Methoxy(toluene-d7). Catalog: ACM1036431363. | |
| 4-Methyl-1-(4-(trifluoromethyl)phenyl)pentan-1-ol | Heterocyclic Organic Compound. CAS No. 1245806-42-1. Molecular formula: C13H17F3O. Mole weight: 246.269. Purity: 0.96. IUPACName: 4-methyl-1-(4-(trifluoromethyl)phenyl)pentan-1-ol. Catalog: ACM1245806421. | |
| 4-methyl-1H-indazol-5-yl-5-boronic acid | Heterocyclic Organic Compound. Alternative Names: 4-Methyl-1H-indazole-5-boronic acid, 1245816-09-4, 4-Methyl-1H-indazol-5-yl-5-boronic acid, (4-methyl-1H-indazol-5-yl)boronic acid, 5-Borono-4-methyl-1H-indazole, CTK7I2622, ANW-49205, WTI-10661, 4-methyl-1H-indazol-5-ylboronic acid, AKOS005258657, AG-C-03702, OR40151, RP09333, AK-39581, BR-39581, KB-242637, AM20050484, FT-0685602, X9598, C-2376. CAS No. 1245816-09-4. Molecular formula: C8H9BN2O2. Mole weight: 175.98. Purity: 0.96. IUPACName: (4-methyl-1H-indazol-5-yl)boronic acid. Canonical SMILES: B(C1=C(C2=C(C=C1)NN=C2)C)(O)O. Catalog: ACM1245816094. | |
| 4-Methyl-1-naphthalenesulfonyl chloride | Heterocyclic Organic Compound. Alternative Names: 4-METHYL-1-NAPHTHALENESULFONYL CHLORIDE;4-METHYL-1-NAPHTHALENESULPHONYL CHLORIDE. CAS No. 10447-11-7. Molecular formula: C11H9ClO2S. Mole weight: 240.71. Purity: 0.96. IUPACName: 4-methylnaphthalene-1-sulfonyl chloride. Canonical SMILES: CC1=CC=C(C2=CC=CC=C12)S(=O)(=O)Cl. Density: 1.363g/cm³. Catalog: ACM10447117. | |
| (4-Methyl-1-propan-2-ylcyclohex-2-en-1-yl)acetate | Heterocyclic Organic Compound. CAS No. 104806-93-1. Molecular formula: C12H20O2. Mole weight: 196.286 g/mol. Purity: 0.96. Catalog: ACM104806931. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.