Alfa Chemistry. 5 - Products
Alfa Chemistry offers an extensive catalog of building blocks, reagents, catalysts, reference materials, and research chemicals in a wide range of applications. In stock products can be shipped quickly.
| Product | Description | |
|---|---|---|
| Diglycolic-2,2,2',2'-d4acid | Heterocyclic Organic Compound. CAS No. 1032504-39-4. Molecular formula: 138.11. Purity: 98 atom % D. Catalog: ACM1032504394. |  |
| Digoxigenin bisdigitoxoside | Heterocyclic Organic Compound. CAS No. 5297-5-2. Molecular formula: C35H54O11. Catalog: ACM1240853. | |
| Diheptadecanoin | Glycerides. Alternative Names: Diheptadecanoate-Glycerol; (1-heptadecanoyloxy-3-hydroxypropan-2-yl) heptadecanoate; heptadecanoic acid [1-(hydroxymethyl)-2-(1-oxoheptadecoxy)ethyl] ester. CAS No. 121957-72-0. Molecular formula: C37H72O5. Mole weight: 596.96. Purity: 99%+. Catalog: ACM121957720. | |
| Dihydrexidine hydrochloride | Heterocyclic Organic Compound. Alternative Names: Dihydrexidine hydrochloride;(+/-)-trans-10,11-Dihydroxy-5,6,6a,7,8,12b-hexahydrobenzo[a]phenanthridine hydrochloride. CAS No. 123039-93-0. Molecular formula: C17H17NO2.HCl. Mole weight: 303.78. Purity: >99 %. Catalog: ACM123039930. | |
| Dihydro-5,5-dimethyl-2H-thiopyran-3(4H)-one-1,1-dioxide | Heterocyclic Organic Compound. Alternative Names: 1049093-43-7, SureCN4971863, AKOS015950429, RP08898, FT-0685952, 5,5-dimethyl-1$l^{6}-thiane-1,1,3-trione, Dihydro-5,5-dimethyl-2H-thiopyran-3(4H)-one-1,1-dioxide. CAS No. 1049093-43-7. Molecular formula: C7H12O3S. Mole weight: 176.24. Purity: 0.96. IUPACName: 5,5-dimethyl-1,1-dioxothian-3-one. Canonical SMILES: CC1(CC(=O)CS(=O)(=O)C1)C. Catalog: ACM1049093437. | |
| Dihydrobonducellin | Flavonoids. CAS No. 103680-87-1. Molecular formula: C17H16O4. Mole weight: 284.3. Appearance: Cryst. Purity: 0.98. IUPACName: 7-hydroxy-3-[(4-methoxyphenyl)methyl]-2,3-dihydrochromen-4-one. Canonical SMILES: COC1=CC=C (C=C1)CC2COC3=C (C2=O)C=CC (=C3)O. Catalog: ACM103680871. | |
| Dihydrodaidzin | Flavonoids. CAS No. 121927-96-6. Molecular formula: C21H22O9. Mole weight: 418.4. Appearance: Powder. Purity: 0.98. IUPACName: 3-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one. Canonical SMILES: C1C (C (=O)C2=C (O1)C=C (C=C2)OC3C (C (C (C (O3)CO)O)O)O)C4=CC=C (C=C4)O. Catalog: ACM121927966. | |
| Dihydrodehydrodiconiferyl Alcohol Beta-D-Xylopyranoside | Phenylpropanoids. CAS No. 1048996-18-4. Molecular formula: C25H32O10. Mole weight: 492.5. Appearance: Powder. Purity: 0.98. IUPACName: (2R,3R,4S,5R)-2-[[(2R,3R)-2-(4-hydroxy-3-methoxyphenyl)-5-(3-hydroxypropyl)-7-methoxy-2,3-dihydro-1-benzofuran-3-yl]methoxy]oxane-3,4,5-triol. Canonical SMILES: COC1=CC (=CC2=C1OC (C2COC3C (C (C (CO3)O)O)O)C4=CC (=C (C=C4)O)OC)CCCO. Catalog: ACM1048996184. | |
| Dihydroethidium | Other Fluorophores. Alternative Names: 2,7-Diamino-10-ethyl-9-phenyl-9,10-dihydrophenthridine,3,8-Diamino-5,6-dihydro-5-ethyl-6-phenylphenthridine. CAS No. 104821-25-2. Molecular formula: C21H21N3. Mole weight: 315.41. Appearance: Pink solid. Purity: 95%+. IUPACName: 5-ethyl-6-phenyl-6H-phenanthridine-3,8-diamine. Canonical SMILES: CCN1C (C2=C (C=CC (=C2)N)C3=C1C=C (C=C3)N)C4=CC=CC=C4. Catalog: ACM104821252-1. | |
| Dihydro fk-506 | Heterocyclic Organic Compound. Alternative Names: Tsukubamycin B. CAS No. 104987-30-6. Molecular formula: C44H71NO12. Mole weight: 806.03. Catalog: ACM104987306. | |
| Dihydrogentrifluoride | Heterocyclic Organic Compound. Alternative Names: DIHYDROGENTRIFLUORIDE POLYMER-SUPPORTED; ca.7mmolhf/gofamberlysta26resin; Dihydrogentrifluoride; Polymer-supported; Dihydrogen trifluoride anion.;DIHYDROGENTRIFLUORIDE POLYMER-SUPPORTED, CA 7 MMOL HF/G OF AMBERLYST A26 RESIN. CAS No. 12260-12-7. Molecular formula: F3H2-. Mole weight: 59.01. Catalog: ACM12260127. | |
| (-)-Dihydroguaiaretic Acid | Phenylpropanoids. CAS No. 124649-78-1. Molecular formula: C20H26O4. Mole weight: 330.42. Appearance: Powder. Purity: 0.98. IUPACName: 4-[(2R,3R)-4-(4-hydroxy-3-methoxyphenyl)-2,3-dimethylbutyl]-2-methoxyphenol. Canonical SMILES: CC (CC1=CC (=C (C=C1)O)OC)C (C)CC2=CC (=C (C=C2)O)OC. Catalog: ACM124649781. | |
| Dihydroobovatin | Flavonoids. CAS No. 104055-79-0. Molecular formula: C20H20O4. Mole weight: 324.4. Appearance: Powder. Purity: 0.98. IUPACName: (2S)-5-hydroxy-8,8-dimethyl-2-phenyl-2,3,9,10-tetrahydropyrano[2,3-h]chromen-4-one. Canonical SMILES: CC1 (CCC2=C3C (=C (C=C2O1)O)C (=O)CC (O3)C4=CC=CC=C4)C. Catalog: ACM104055790. | |
| Dihydroxy etravirine | Heterocyclic Organic Compound. CAS No. 1246818-67-6. Molecular formula: C20H15BrN6O3. Mole weight: 467.28. Catalog: ACM1246818676. | |
| Dihydroxy[styphnato(2-)]dilead | Heterocyclic Organic Compound. Alternative Names: Dihydroxy(styphnato(2-))dilead, EINECS 235-642-2, Dihydroxy(2,4,6-trinitro-1,3-benzenediolato(2-)dilead, Lead, dihydroxy(2,4,6-trinitro-1,3-benzenediolato(2-))di-, 12403-82-6, 39380-79-5. CAS No. 12403-82-6. Molecular formula: C6H3N3O10Pb2. Mole weight: 693.518000 [g/mol]. Purity: 0.96. IUPACName: (3-$l^{1}-plumbanyloxy-2,4,6-trinitrophenoxy)lead dihydrate. Canonical SMILES: C1=C (C (=C (C (=C1[N+] (=O)[O-])O[Pb])[N+] (=O)[O-])O[Pb])[N+] (=O)[O-]. O. O. ECNumber: 235-642-2. Catalog: ACM12403826. | |
| Diiodo(1,5-cyclooctadiene)platinum(II) | Platinum series of catalysts. Alternative Names: (1Z,5Z)-Cycloocta-1,5-diene;diiodoplatinum. CAS No. 12266-72-7. Molecular formula: C8H12I2Pt. Mole weight: 557.07. Appearance: Powder. Purity: 0.99. Canonical SMILES: C1CC=CCCC=C1.I[Pt]I. Catalog: ACM12266727-1. | |
| Diisobutyl azelate | Heterocyclic Organic Compound. Alternative Names: Hallco-3880;Nonanedioic acid bis(2-methylpropyl) ester;bis(2-methylpropyl) nonanedioate. CAS No. 105-80-6. Molecular formula: C17H32O4. Catalog: ACM105806. | |
| Diisobutyl sulfone | Heterocyclic Organic Compound. CAS No. 10495-45-1. Molecular formula: C8H18O2S. Mole weight: 178.3. Catalog: ACM10495451. | |
| Di-iso-propyl-d14-amine hcl | Heterocyclic Organic Compound. Alternative Names: Dimethyldiethylamine Hydrochloride, N,N-Diisopropylamine-d14 Hydrochloride, N-(1-Methylethyl)-2-propanamine Hydrochloride, 1219803-88-9. CAS No. 1219803-88-9. Molecular formula: 151.74. Mole weight: 151.737205 [g/mol]. Purity: 98 atom % D. IUPACName: 1,1,1,2,3,3,3-heptadeuterio-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)propan-2-amine;hydrochloride. Canonical SMILES: CC(C)NC(C)C.Cl. Catalog: ACM1219803889. | |
| Diisopropylsulfamoyl chloride | Heterocyclic Organic Compound. Alternative Names: DIISOPROPYLSULFAMOYL CHLORIDE. CAS No. 10539-95-4. Molecular formula: C6H14ClNO2S. Mole weight: 199.7. Catalog: ACM10539954. | |
| Dilanthanum trititanium nonaoxide | Heterocyclic Organic Compound. Alternative Names: Dilanthanum trititanium nonaoxide, EINECS 235-377-2, 12201-13-7. CAS No. 12201-13-7. Molecular formula: La2O9Ti3. Mole weight: 565.406540 [g/mol]. Purity: 0.96. IUPACName: lanthanum(3+); oxygen(2-); titanium(4+). Canonical SMILES: [O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[Ti+4].[Ti+4].[Ti+4].[La+3].[La+3]. ECNumber: 235-377-2. Catalog: ACM12201137. | |
| Dilauryl thiodipropionate | Polymer/Macromolecule. Alternative Names: Propanoic acid, 3,3'-thiobis-, didodecyl ester. CAS No. 123-28-4. Molecular formula: C30H58O4S. Mole weight: 514.84. Appearance: White crystalline powder. IUPACName: Dodecyl 3-(3-dodecoxy-3-oxopropyl)sulfanylpropanoate. Canonical SMILES: CCCCCCCCCCCCOC (=O)CCSCCC (=O)OCCCCCCCCCCCC. Density: 0.915g/ml. ECNumber: 204-614-1. Catalog: ACM123284. | |
| Dilithium tripotassium pentaniobate | Heterocyclic Organic Compound. CAS No. 12337-13-2. Mole weight: 835.6998. Catalog: ACM12337132. | |
| Diltiazem hydrochloride | Heterocyclic Organic Compound. Alternative Names: (2S-trans)-3-(Acetyloxy)-5-[2-(dimethylamino)ethyl]-2,3-dihydro-2-(4-methoxyphenyl) -1,5-benzothiazepin-4(5H)-one Monohydrochloride; (-)-trans-Diltiazem Hydrochloride. CAS No. 103532-26-9. Molecular formula: C22H27ClN2O4S. Mole weight: 450.98. Catalog: ACM103532269. | |
| Dimagnesium dichloride oxide | Heterocyclic Organic Compound. Alternative Names: Dimagnesium dichloride oxide, EINECS 235-685-7, 12515-52-5. CAS No. 12515-52-5. Molecular formula: Cl2Mg2O. Mole weight: 135.515400 [g/mol]. Purity: 0.96. IUPACName: dimagnesium oxygen(2-) dichloride. Canonical SMILES: [O-2].[Mg+2].[Mg+2].[Cl-].[Cl-]. ECNumber: 235-685-7. Catalog: ACM12515525. | |
| Dimethachlor Metabolite SYN 528702 sodium salt | Heterocyclic Organic Compound. Alternative Names: Dimethachlor Metabolite SYN 528702 sodium salt, Sodium 3-{2-[(2,6-dimethylphenyl)(2-hydroxyacetyl)amino]ethylsulfanyl}-2-hydroxypropionate, 1228182-52-2. CAS No. 1228182-52-2. Molecular formula: C15H20NNaO5S. Mole weight: 349.38. Purity: 0.96. IUPACName: sodium; 2-hydroxy-3-[2- (N- (2-hydroxyacetyl) -2, 6-dimethylanilino) ethylsulfanyl]propanoate. Canonical SMILES: CC1=C (C (=CC=C1)C)N (CCSCC (C (=O)[O-])O)C (=O)CO. [Na+]. Catalog: ACM1228182522. | |
| Dimethenamid-d3 | 2H Labeled Compounds. Alternative Names: 2-Chloro-N-(2,4-dimethyl-3-thienyl)-N-[2-(methoxy-d3)-1-methylethyl]acetamide; Fieldstar-d3; Frontier-d3; SAN 582-d3; SAN 582H-d3. CAS No. 1246816-31-8. Molecular formula: C12H15D3ClNO2S. Mole weight: 278.81. Catalog: ACM1246816318. | |
| Dimethiodal sodique | Heterocyclic Organic Compound. CAS No. 124-88-9. Molecular formula: C10H11N3O3S. Catalog: ACM124889. | |
| Dimethoate | Heterocyclic Organic Compound. CAS No. 12-45-78. Catalog: ACM124578. | |
| (Dimethyl)[10h-pyrido[3,2-b][1,4]benzothiazine-10-propyl]ammonium chloride | Heterocyclic Organic Compound. Alternative Names: N,N-Dimethyl-10H-pyrido[3,2-b][1,4]benzothiazine-10-propanamine Hydrochloride; AY 56031; Azacon; D 206; Dominal Hydrochloride; Prothipendyl Monohydrochloride; Tolnate. CAS No. 1225-65-6. Molecular formula: C16H19N3S?ClH. Mole weight: 321.874. Catalog: ACM1225656. | |
| DIMETHYL-(2,3-DIMETHYL-2-BUTYL)SILYL TRIFLUOROMETHANESULFONATE | Heterocyclic Organic Compound. CAS No. 103588-79-0. Molecular formula: C9H19F3O3SSi. Mole weight: 292.39. Catalog: ACM103588790. | |
| Dimethyl 2-(5-bromo-3-nitropyridin-2-yl)malonate | Heterocyclic Organic Compound. CAS No. 1245563-09-0. Molecular formula: C10H9BrN2O6. Purity: 0.98. Catalog: ACM1245563090. | |
| Dimethyl 2,6-diisopropyl-4-(4-fluorophenyl)-pyridine-3,5-dicarboxylate | Heterocyclic Organic Compound. Alternative Names: DIMETHYL 2,6-DIISOPROPYL-4-(4-FLUOROPHENYL)-PYRIDINE-3,5-DICARBOXYLATE. CAS No. 122549-42-2. Molecular formula: C21H24FNO4. Mole weight: 373.42. Appearance: White Crystalline Solid. Catalog: ACM122549422. | |
| Dimethyl 2-(thiophen-2-ylmethyl)malonate | Heterocyclic Organic Compound. CAS No. 122308-25-2. Molecular formula: C10H12O4S. Catalog: ACM122308252. | |
| Dimethyl-[3-(1-methyl-2-oxo-3-phenylindol-3-yl)propyl]azanium chloride | Heterocyclic Organic Compound. Alternative Names: CID25394, LU 3-022, LS-83554, 2-INDOLINONE, 3-(3-DIMETHYLAMINOPROPYL)-1-METHYL-3-PHENYL-, HYDROCHLORIDE, Propylamine, N,N-dimethyl-3-(1-methyl-2-oxo-3-phenylindolin-3-yl)-, hydrochloride, 10565-90-9. CAS No. 10565-90-9. Molecular formula: C20H25ClN2O. Mole weight: 344.878 g/mol. Purity: 0.96. IUPACName: dimethyl-[3-(1-methyl-2-oxo-3-phenylindol-3-yl)propyl]azanium chloride. Canonical SMILES: CN1C2=CC=CC=C2C (C1=O) (CCC[NH+] (C)C)C3=CC=CC=C3. [Cl-]. Catalog: ACM10565909. | |
| Dimethyl-[3-(1-phenyl-3,4-dihydro-2H-naphthalen-1-yl)propyl]azaniumchloride | Heterocyclic Organic Compound. Alternative Names: LU 3-023, 1-Naphthalenepropylamine, 1,2,3,4-tetrahydro-N,N-dimethyl-1-phenyl-, hydrochloride, Naphthalene, 1,2,3,4-tetrahydro-1-(3-dimethylaminopropyl)-1-phenyl-, hydrochloride, Propylamine, N,N-dimethyl-3-(1,2,3,4-tetrahydro-1-phenylnaphthyl)-, hydrochloride, AC1L190U, LS-94852, dimethyl-[3-(1-phenyl-3,4-dihydro-2H-naphthalen-1-yl)propyl]azanium chloride, 10565-84-1. CAS No. 10565-84-1. Molecular formula: C21H28ClN. Mole weight: 329.907 g/mol. Purity: 0.96. IUPACName: dimethyl-[3-(1-phenyl-3,4-dihydro-2H-naphthalen-1-yl)propyl]azanium;chloride. Canonical SMILES: C[NH+] (C)CCCC1 (CCCC2=CC=CC=C21)C3=CC=CC=C3. [Cl-]. Catalog: ACM10565841. | |
| Dimethyl-[3-(1-phenyl-3,4-dihydroisochromen-1-yl)propyl]azanium chloride | Heterocyclic Organic Compound. Alternative Names: LU 3-026, 1-ISOCHROMANPROPYLAMINE, N,N-DIMETHYL-1-PHENYL-, HYDROCHLORIDE, Isochroman, 1-(3-dimethylaminopropyl)-1-phenyl-, hydrochloride, AC1L190I, LS-84424, dimethyl-[3-(1-phenyl-3,4-dihydroisochromen-1-yl)propyl]azanium chloride, 10565-82-9. CAS No. 10565-82-9. Molecular formula: C20H26ClNO. Mole weight: 331.88 g/mol. Purity: 0.96. IUPACName: dimethyl-[3-(1-phenyl-3,4-dihydroisochromen-1-yl)propyl]azanium;chloride. Canonical SMILES: C[NH+] (C)CCCC1 (C2=CC=CC=C2CCO1)C3=CC=CC=C3. [Cl-]. Catalog: ACM10565829. | |
| Dimethyl-[3-(2-methyl-1-phenyl-2,3-dihydroisoindol-2-ium-1-yl)propyl]azanium dichloride | Heterocyclic Organic Compound. Alternative Names: CID25390, LU 3-045, LS-84710, ISOINDOLINE, 1-(3-DIMETHYLAMINOPROPYL)-2-METHYL-1-PHENYL-, DIHYDROCHLORIDE, Propylamine, N,N-dimethyl-3-(2-methyl-1-phenylisoindolin-1-yl)-, dihydrochloride, 10565-86-3. CAS No. 10565-86-3. Molecular formula: C20H28Cl2N2. Mole weight: 367.356 g/mol. Purity: 0.96. IUPACName: dimethyl-[3-(2-methyl-1-phenyl-2,3-dihydroisoindol-2-ium-1-yl)propyl]azanium dichloride. Catalog: ACM10565863. | |
| Dimethyl 3,3'-bipyridine-6,6'-dicarboxylate | Heterocyclic Organic Compound. Alternative Names: 1033202-47-9, DIMETHYL 3,3-BIPYRIDINE-6,6-DICARBOXYLATE, Dimethyl [3,3-bipyridine]-6,6-dicarboxylate, ACMC-20986n, CTK4A1980, ANW-14877, AKOS015854750, AG-D-13954, AK-92194, BD230361, KB-50007, A-4269, Dimethyl 3,3-bipyridine-6,6-dicarboxylate,, I02-3521. CAS No. 1033202-47-9. Molecular formula: C14H12N2O4. Mole weight: 272.3. Purity: 0.98. IUPACName: methyl 5-(6-methoxycarbonylpyridin-3-yl)pyridine-2-carboxylate. Catalog: ACM1033202479. | |
| Dimethyl(3-phenylpropyl)azanium chloride | Heterocyclic Organic Compound. Alternative Names: N,N-dimethyl-3-phenylpropylamine hydrochloride; N,N-dimethyl-3-phenylpropan-1-aminium chloride; PROPYLAMINE,N,N-DIMETHYL-3-PHENYL-,HYDROCHLORIDE; N,N-dimethyl-3-phenylpropylamine; N,N-Dimethyl-3-phenylpropylamin-hydrochlorid. CAS No. 10344-82-8. Molecular formula: C11H18ClN. Mole weight: 199.72 g/mol. Purity: 0.96. IUPACName: dimethyl(3-phenylpropyl)azanium chloride. Catalog: ACM10344828. | |
| Dimethyl 4,4'-biphenyl-d8-dicarboxylate | Heterocyclic Organic Compound. CAS No. 1219803-50-5. Molecular formula: 278.33. Purity: 98 atom % D. Catalog: ACM1219803505. | |
| Dimethyl 4'-(4-iodoophenyl)-2,2':6',2''-terpyridine-4,4''-dicarboxylate | Nitrogen-Donor Ligands. CAS No. 1218918-53-6. Molecular formula: C25H18IN3O4. Mole weight: 551.33. Catalog: ACM1218918536. | |
| Dimethyl 4,4'-stilbenedicarboxylate | Heterocyclic Organic Compound. Alternative Names: Dimethyl stilbene-4,4'-dicarboxylate;4,4'-(Ethene-1,2-diyl)bis(benzoic acid methyl) ester;Stilbene-4,4'-dicarboxylic acid dimethyl ester. CAS No. 10374-80-8. Molecular formula: C18H16O4. Mole weight: 296.31724. Catalog: ACM10374808. | |
| DiMethyl 4'-hydroxy-[1,1'-biphenyl]-3,5-dicarboxylate | Hydroxyl COFs Ligands. CAS No. 1245828-39-0. Molecular formula: C16H14O5. Mole weight: 286.27936. Purity: 0.97. Catalog: ACM1245828390. | |
| Dimethyl(4-methoxyphenyloxomethyl)phosphonate | Heterocyclic Organic Compound. Alternative Names: DIMETHYL(4-METHOXYPHENYLOXOMETHYL)PHOSPHONATE; Dimethyl (4-methoxybenzoyl)phosphonate. CAS No. 10570-48-6. Molecular formula: C10H13O5P. Mole weight: 244.18. Catalog: ACM10570486. | |
| Dimethyl (5-methoxycarbonyl-2-oxopentyl)phosphonate | Heterocyclic Organic Compound. Alternative Names: 5,7-Dimethyl-1,3-dihydro-imidazo[4,5-b]pyridin-2-on; 2-Oxo-5-carbomethoxypentan-dimethylphosphonat; 2-Oxo-4-phthalimido-1-butyl acetate; N-(4-acetoxy-3-oxo-butyl)-phthalimide; 1-Acetoxy-4-phthalimido-2-butanon; 5,7-dimethyl-1,3-dihydro-imidazo[4,5-b]pyrid. CAS No. 104227-38-5. Molecular formula: C9 H17 O6 P. Mole weight: 252.21. Purity: 0.98. IUPACName: methyl6-dimethoxyphosphoryl-5-oxohexanoate. Canonical SMILES: COC(=O)CCCC(=O)CP(=O)(OC)OC. Catalog: ACM104227385. | |
| Dimethyl Acetylsuccinate | Heterocyclic Organic Compound. CAS No. 10420-33-4. Molecular formula: C8H12O5. Mole weight: 188.18. Purity: 0.96. Catalog: ACM10420334. | |
| Dimethyl L-isothiocyanatosuccinate | Heterocyclic Organic Compound. CAS No. 121928-38-9. Molecular formula: C7H9NO4S. Mole weight: 203.21566. Catalog: ACM121928389. | |
| Dimethyl N,N-diisopropylphosphoramidite | Heterocyclic Organic Compound. CAS No. 122194-07-4. Molecular formula: C8H20NO2P. Mole weight: 193.22. Catalog: ACM122194074. | |
| Dimethyl(N, N, N', N'-tetramethylethylenediamine)nickel | Nickel Complexes. Alternative Names: Carbanide;nickel;N, N, N', N'-tetramethylethane-1, 2-diamine. CAS No. 122905-76-4. Molecular formula: C8H22N2Ni. Mole weight: 204.97. Purity: 0.97. Canonical SMILES: [CH3-].[CH3-].CN(C)CCN(C)C.[Ni]. Catalog: ACM122905764. | |
| Dimethyl[[p-[ (2, 6-dichloro-4-nitrophenyl)azo]phenyl]imino]bis (ethylenecarbonate) | Heterocyclic Organic Compound. Alternative Names: CID82568, EINECS 233-756-7, Dimethyl ( (p- ( (2, 6-dichloro-4-nitrophenyl)azo)phenyl)imino)bis (ethylenecarbonate), ( (2, 6-Dichloro-4-nitrophenyl) azo) -4- (N-bis (2-methoxycarbonyloxyethyl) amino) benzene, Carbonic acid, ( (p- ( (2, 6-dichloro-4-nitrophenyl) azo) phenyl) imino) diethylene dimethyl ester, 10347-09-8, 2,4,10-Trioxa-7-azaundecan-11-oic acid, 7-(4-((2,6-dichloro-4-nitrophenyl)azo)phenyl)-3-oxo-, methyl ester, 2,8,10-Trioxa-5-azaundecanoic acid, 5-(4-(2-(2,6-dichloro-4-nitrophenyl)diazenyl)phenyl)-9-oxo-, methyl ester. CAS No. 10347-09-8. Molecular formula: C20H20Cl2N4O8. Mole weight: 515.301 g/mol. Purity: 0.96. IUPACName: 2-[4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-N-(2-methoxycarbonyloxyethyl)anilino]ethyl methyl carbonate. Canonical SMILES: CC1=C (C=CC (=C1C)N (C2COC (=O)O2)C3COC (=O)O3)N=NC4=C (C=C (C=C4Cl)[N+] (=O)[O-])Cl. Density: 1.43g/cm³. Catalog: ACM10347098. | |
| Dimethylphenylethylcarbinyl acetate | Heterocyclic Organic Compound. CAS No. 103-07-7. Molecular formula: C13H18O2. Catalog: ACM103077. | |
| Dimethylsulfonioproprionate-d6 | 2H Labeled Compounds. CAS No. 1246341-06-9. Molecular formula: C5H4D6O2S. Mole weight: 140.23. Catalog: ACM1246341069. | |
| Di-N-heptyl disulfide | Heterocyclic Organic Compound. Alternative Names: 8, 9-dithiahexadecane; diheptyldisulfide; disulfide, diheptyl; heptyldisulfide; DI-N-HEPTYL DISULFIDE;DI-N-HEPTYL DISULPHIDE;N-HEPTYL DISULFIDE;diheptyl disulphide. CAS No. 10496-16-9. Molecular formula: C14H30S2. Mole weight: 262.52. Density: 0.91. Catalog: ACM10496169. | |
| Dioctadecylamidoglycylspermine | Heterocyclic Organic Compound. CAS No. 124050-77-7. Catalog: ACM124050777. | |
| Di(octadecyl/hexadecyl) MethylaMines | Di(octadecyl/hexadecyl) MethylaMines. CAS No. 1227096-04-9. Catalog: ACM1227096049. | |
| Dioleyl maleate | Heterocyclic Organic Compound. Alternative Names: Dioleyl maleate, EINECS 203-325-8, CID6436864, 105-73-7. CAS No. 105-73-7. Molecular formula: C40H72O4. Mole weight: 616.997280 [g/mol]. Purity: 0.96. IUPACName: bis[(E)-octadec-9-enyl] (E)-but-2-enedioate. Canonical SMILES: CCCCCCCCC=CCCCCCCCCOC (=O)C=CC (=O)OCCCCCCCCC=CCCCCCCCC. Density: 0.911g/cm³. ECNumber: 203-325-8. Catalog: ACM105737. | |
| Diosbulbin L | Terpenoids. CAS No. 1236285-87-2. Molecular formula: C19H22O7. Mole weight: 362.37. Appearance: Powder. Purity: 0.98. IUPACName: (2S,4aS,6aS,7R,9R,10aR,10bS)-2-(furan-3-yl)-9-hydroxy-10b-methyl-4,6-dioxo-1,2,4a,5,6a,7,8,9,10,10a-decahydrobenzo[f]isochromene-7-carboxylic acid. Canonical SMILES: CC12CC (OC (=O)C1CC (=O)C3C2CC (CC3C (=O)O)O)C4=COC=C4. Catalog: ACM1236285872. | |
| Diosmin Impurity 5 | Flavonoids. CAS No. 122087-66-5. Molecular formula: C30H38O15. Mole weight: 638.6. Appearance: Powder. Purity: 0.98. Catalog: ACM122087665. | |
| Dioxacarb-d3(N-methyl-d3) | Heterocyclic Organic Compound. CAS No. 1219795-12-6. Molecular formula: 226.25. Purity: 99 atom % D. Catalog: ACM1219795126. | |
| Dioxifedrine | Heterocyclic Organic Compound. Alternative Names: dioxifedrine; alpha-methylepinephrine; 3, 4-Dihydroxy-α -[1- (methylamino)ethyl]benzenemethanol. CAS No. 10329-60-9. Molecular formula: C10H15NO3. Mole weight: 197.232. Purity: 0.96. IUPACName: 4-[1-hydroxy-2-(methylamino)propyl]benzene-1,2-diol. Canonical SMILES: CC(C(C1=CC(=C(C=C1)O)O)O)NC. Density: 1.236g/cm³. ECNumber: 233-716-9. Catalog: ACM10329609. | |
| dioxoiron | Heterocyclic Organic Compound. Alternative Names: Iron dioxide, Dimolybdenum hexaoxide, Iron oxide (FeO2), Iron oxide (Fe2O4), CID123289, 12411-15-3. CAS No. 12411-15-3. Molecular formula: FeO2. Mole weight: 87.8438 g/mol. Purity: 0.96. IUPACName: dioxoiron. Canonical SMILES: O=[Fe]=O. Catalog: ACM12411153. | |
| Dioxygenyl hexafluoroantimonate | Heterocyclic Organic Compound. Alternative Names: DIOXYGENYL HEXAFLUOROANTIMONATE;dioxygenyl hexafluoroantimonate(1-);Dioxygenyl hexafluoroantimonate 98%; Dioxygenylhexafluoroantimonate98%. CAS No. 12361-66-9. Molecular formula: F6O2Sb. Mole weight: 267.75. Catalog: ACM12361669. | |
| Dipentadecanoin | Glycerides. Alternative Names: Dipentadecanoate-Glycerol; [1-(hydroxymethyl)-2-pentadecanoyloxy-ethyl] pentadecanoate; (1-hydroxy-3-pentadecanoyloxypropan-2-yl) pentadecanoate. CAS No. 121957-69-5. Molecular formula: C33H64O5. Mole weight: 540.86. Purity: 99%+. Catalog: ACM121957695. | |
| Diphacinone-d4(indanedione-4,5,6,7-d4) | Heterocyclic Organic Compound. CAS No. 1219802-15-9. Molecular formula: 344.4. Purity: 99 atom % D. Catalog: ACM1219802159. | |
| Diphenhydramine-d5hcl(phenyl-d5) | Heterocyclic Organic Compound. CAS No. 1219795-16-0. Molecular formula: 296.85. Purity: 99 atom % D. Catalog: ACM1219795160. | |
| Diphenyl(1,5-cyclooctadiene)platinum(II) | Platinum series of catalysts. CAS No. 12277-88-2. Molecular formula: C20H22Pt. Mole weight: 457.47. Appearance: yellow powder. Purity: Pt 42.6%. Catalog: ACM12277882. | |
| Diphenyl(chloromethyl)phosphonate | Heterocyclic Organic Compound. Alternative Names: diphenyl (chloromethyl)phosphonate; (Chloromethyl)phosphonic acid diphenyl ester;Chloromethylphosphonic acid diphenyl ester. CAS No. 10419-85-9. Molecular formula: C13H12ClO3P. Mole weight: 282.659341. Catalog: ACM10419859. | |
| Diphosphoric acid,aluminum sodium salt | Heterocyclic Organic Compound. CAS No. 10305-79-0. Molecular formula: AlNaO7P2. Mole weight: 223.914630 [g/mol]. Purity: 0.96. IUPACName: aluminum sodium phosphonato phosphate. Canonical SMILES: [O-]P(=O)([O-])OP(=O)([O-])[O-]. [Na+]. [Al+3]. ECNumber: 233-680-4. Catalog: ACM10305790. | |
| Dipotassium heptadecaoxotetra zincatetetra chromate (2-) | Heterocyclic Organic Compound. Alternative Names: Europium silicide (EuSi2), EINECS 235-663-7, CID159447, Potassium zinc chromate oxide (K2Zn4(CrO4)4O), Dipotassium heptadecaoxotetra zincatetetra chromate (2-) , 12433-50-0, 137904-18-8, 58319-32-7, 871483-10-2. CAS No. 12433-50-0. Molecular formula: CrKO5Zn-. Mole weight: 236.500400 [g/mol]. Purity: 0.96. IUPACName: potassium; zinc; dioxido(dioxo)chromium; oxygen(2-). Canonical SMILES: [O-2].[O-][Cr](=O)(=O)[O-].[K+].[Zn+2]. ECNumber: 235-663-7. Catalog: ACM12433500. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.