Alfa Chemistry. 3 - Products
Alfa Chemistry is an ISO 9001:2015 Certified Supplier of various building blocks, reagents, catalysts, nanomaterials, reference materials, and research chemicals. In-stock products can be shipped quickly.
| Product | Description | |
|---|---|---|
| Dibenzothiophene,2,8-dimethyl- | Heterocyclic Organic Compound. Alternative Names: 2,8-Dimethyldibenzothiophene, Dibenzothiophene, dimethyl-, DIMETHYLDIBENZOTHIOPHENE, 2,8-Dimethyldibenzo(b,d)thiophene, Dibenzothiophene, 2,8-dimethyl-, ZINC01842405, 1207-15-4, 70021-47-5. CAS No. 1207-15-4. Molecular formula: C14H12S. Mole weight: 212.3101. Purity: 0.96. IUPACName: 2,8-dimethyldibenzothiophene. Canonical SMILES: CC1=CC2=C(C=C1)SC3=C2C=C(C=C3)C. Density: 1.181g/cm³. Catalog: ACM1207154. |  |
| Dibenzothiophene-5-oxide | Dibenzothiophene-5-oxide. Alternative Names: Dibenzothiophene-5-oxide; javascript: showMsgDetail(ProductSynonyMs. aspxCBN. CAS No. 1013-23-6. Molecular formula: C12H8OS. Mole weight: 200.25632. Purity: 0.98. IUPACName: dibenzothiophene5-oxide. Canonical SMILES: C1=CC=C2C(=C1)C3=CC=CC=C3S2=O. Density: 1.41g/cm³. Catalog: ACM1013236. | |
| Dibenzoylmethane | Aldehydes. Alternative Names: 1,3-Diphenylpropane-1,3-dione. CAS No. 120-46-7. Molecular formula: C15H12O2. Mole weight: 224.26. Appearance: Yellow to orange powder. Purity: 0.98. IUPACName: 1,3-diphenylpropane-1,3-dione. Density: 0.800 g/cm3. Catalog: ACM120467-1. | |
| Dibenzylaminoethanol | Heterocyclic Organic Compound. CAS No. 101-06-4. Molecular formula: C16H19NO. Mole weight: 241.33. Purity: 0.98. Catalog: ACM101064. | |
| Dibenzyl dimethyl ammonium chloride | Heterocyclic Organic Compound. Alternative Names: Benzenemethanaminium,N,N-dimethyl-N-(phenylmethyl)-,chloride;n,n-dimethyl-n-(phenylmethyl)-benzenemethanaminiu chloride; Dibenzyldimethylaminium·chloride; dibenzyldimethylammonium chloride 70% solution. CAS No. 100-94-7. Molecular formula: C16H20N?Cl. Mole weight: 261.794. Catalog: ACM100947. | |
| Dibenzyl Phthalate-3,4,5,6-d4 | Heterocyclic Organic Compound. Alternative Names: Phthalic Acid, Dibenzyl Ester. CAS No. 1015854-62-2. Molecular formula: C6D4(COOCH2C6H5)2. Mole weight: 350.41. Purity: 99 atom % D. IUPACName: dibenzyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate. Catalog: ACM1015854622. | |
| Diboron trisulphide | Heterocyclic Organic Compound. Alternative Names: diboron trisulphide. CAS No. 12007-33-9. Molecular formula: B2S3. Catalog: ACM12007339. | |
| Dibromantin | Heterocyclic Organic Compound. Alternative Names: 1,3-Dibromo-5,5-dimethylhydantoin, Dibromantin, 77-48-5, Dibromantine, Take Charge Orange, N,N-Dibromodimethylhydantoin, DBDMH, 1,3-dibromo-5,5-dimethylimidazolidine-2,4-dione, NSC33305, 5,5-Dimethyl-1,3-dibromohydantoin, EINECS 201-030-9, 2,4-Imidazolidinedione, 1,3-dibromo-5,5-dimethyl-, NSC 33305, EPA Pesticide Chemical Code 006317, BRN 0146024, AI3-23671, HYDANTOIN, 1,3-DIBROMO-5,5-DIMETHYL-, 1,3-Dibromo-5,5-dimethyl-2,4-imidazolidinedione, 101650-80-0, DibromantiH. CAS No. 101650-80-0. Molecular formula: C5H6N2O2Br2. Mole weight: 285.93. Purity: 0.96. IUPACName: 1,3-dibromo-5,5-dimethylimidazolidine-2,4-dione. Canonical SMILES: CC1(C(=O)N(C(=O)N1Br)Br)C. ECNumber: 201-030-9. Catalog: ACM101650800. | |
| Dibromo(1,5-cyclooctadiene)palladium(II) | Palladium Catalysts. Alternative Names: Dibromo(1,2,5,6-η)-1,5-cyclooctadiene palladium, dibromo(η,4-1,5-cyclooctadiene)palladium(II). CAS No. 12145-47-0. Molecular formula: C8H12Br2Pd. Mole weight: 374.41. Appearance: Orange yellow powder. Purity: 0.99. IUPACName: (1Z,5Z)-cycloocta-1,5-diene;dibromopalladium. Canonical SMILES: C1CC=CCCC=C1.Br[Pd]Br. Catalog: ACM12145470-1. | |
| Dibromo(1,5-cyclooctadiene)platinum(II) | Platinum series of catalysts. Alternative Names: (1Z,5Z)-Cycloocta-1,5-diene;dibromoplatinum. CAS No. 12145-48-1. Molecular formula: C8H12Br2Pt. Mole weight: 463.07. Appearance: Powder. Purity: 0.98. IUPACName: (1Z,5Z)-cycloocta-1,5-diene;dibromoplatinum. Canonical SMILES: C1CC=CCCC=C1.Br[Pt]Br. Catalog: ACM12145481-1. | |
| (Dibromomethylene)bisphosphonic acid tri(dicyclohexylammonium salt) | Heterocyclic Organic Compound. Alternative Names: (Dibromomethylene)bisphosphonic Acid N-Cyclohexylcyclohexanamine. CAS No. 121151-61-9. Molecular formula: C37H73Br2N3O6P2. Mole weight: 877.75. Purity: 0.96. IUPACName: N-cyclohexylcyclohexanamine; [dibromo(phosphono)methyl]phosphonic acid. Canonical SMILES: C1CCC(CC1)NC2CCCCC2. C(P(=O)(O)O)(P(=O)(O)O)(Br)Br. Catalog: ACM121151619. | |
| Dibutoxyphosphorylbenzene | Heterocyclic Organic Compound. CAS No. 1024-34-6. Molecular formula: C14H23O3P. Mole weight: 270.304 g/mol. Catalog: ACM1024346. | |
| Dibutyl(2,3-dichloropropyl)azanium chloride | Heterocyclic Organic Compound. Alternative Names: 1-Dibutylamino-2,3-dichloropropane hydrochloride, N-(2,3-Dichloropropyl)dibutylamine hydrochloride, DIBUTYLAMINE, N-(2,3-DICHLOROPROPYL)-, HYDROCHLORIDE, AC1L1OH5, AC1Q1S4C, LS-61693, dibutyl(2,3-dichloropropyl)azanium chloride, n-butyl-n-(2,3-dichloropropyl)butan-1-aminium chloride, 101198-07-6. CAS No. 101198-07-6. Molecular formula: C11H24Cl3N. Mole weight: 276.674 g/mol. Purity: 0.96. IUPACName: dibutyl(2,3-dichloropropyl)azanium;chloride. Canonical SMILES: CCCC[NH+](CCCC)CC(CCl)Cl.[Cl-]. Catalog: ACM101198076. | |
| Dicalcium2-[2-[bis(2-oxido-2-oxoethyl)amino]ethyl-(2-oxido-2-oxoethyl)amino]acetate | Heterocyclic Organic Compound. CAS No. 12002-06-1. Molecular formula: C10H12Ca2N2O8. Mole weight: 368.367 g/mol. Catalog: ACM12002061. | |
| Dicarbonylcyclopentadienylcobalt | Heterocyclic Organic Compound. CAS No. 12078-23-8. Catalog: ACM12078238. | |
| Dicarbonylcyclopentadienyliodoiron (II) | Heterocyclic Organic Compound. Alternative Names: Dicarbonylcyclopentadienyliodoiron (II); 12078-28-3. CAS No. 12078-28-3. Molecular formula: C7H5FeIO2. Mole weight: 303.86. Purity: ≥96%. IUPACName: carbon monoxide;cyclopenta-1,3-diene;iron;iodide. Canonical SMILES: [C-]#[O+]. [C-]#[O+]. C1=C[CH]C=C1. [Fe]. [I-]. Catalog: ACM12078283-1. | |
| Dicerium dizirconium heptaoxide | Heterocyclic Organic Compound. Alternative Names: Cerium zirconate, Dicerium dizirconium heptaoxide, Cerium zirconium oxide (Ce2Zr2O7), EINECS 235-280-5, CID166632, 12157-80-1, 917001-55-9. CAS No. 12157-80-1. Molecular formula: Ce2O7Zr2. Mole weight: 574.675800 [g/mol]. Purity: 0.96. IUPACName: cerium(3+); oxygen(2-); zirconium(4+). Canonical SMILES: [O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[Zr+4].[Zr+4].[Ce+3].[Ce+3]. ECNumber: 235-280-5. Catalog: ACM12157801. | |
| Dicerium oxide silicate | Heterocyclic Organic Compound. Alternative Names: Dicerium oxide silicate, EINECS 234-725-0, 12027-77-9. CAS No. 12027-77-9. Molecular formula: Ce2O5Si. Mole weight: 232.199100 [g/mol]. Purity: 0.96. IUPACName: cerium(3+); dioxido(oxo)silane; oxygen(2-). Canonical SMILES: [O-2].[O-][Si](=O)[O-].[Ce+3]. ECNumber: 234-725-0. Catalog: ACM12027779. | |
| Dicesium titanate(2-) | Heterocyclic Organic Compound. Alternative Names: CESIUM TITANATE;CESIUM TITANIUM OXIDE;dicesium titanate(2-);DICESIUM TITANATE;caesium titanate(IV). CAS No. 12158-57-5. Molecular formula: Cs2O3Ti. Mole weight: 361.68. Catalog: ACM12158575. | |
| Dichloro-1,2-dithiacyclopentenone | Heterocyclic Organic Compound. CAS No. 1192-52-5. Molecular formula: C3Cl2OS2. Mole weight: 187.06. Purity: 0.98. Catalog: ACM1192525. | |
| Dichloro[1, 3-bis (2, 4, 6-trimethylphenyl) -2-imidazolidinylidene][ (2-isopropoxy) (5-trifluoroacetamido) benzylidene]ruthenium (II) | Ruthenium Catalysts. CAS No. 1025728-56-6. Mole weight: 737.64. Catalog: ACM1025728566. | |
| Dichloro[1,3-bis(2,4,6-trimethylphenyl)-2-imidazolidinylidene][(5-isobutoxycarbonylamino)-(2-isopropoxy)benzylidene]ruthenium(II) | Ruthenium Catalysts. CAS No. 1025728-57-7. Mole weight: 741.75. Catalog: ACM1025728577. | |
| Dichloro[1,3-bis(2,6-diisopropylphenyl)imidazolidin-2-ylidene][(5-(2-ethoxy-2-oxoethanamido))-(2-isopropoxy)benzylidene]ruthenium(II) | Ruthenium Catalysts. CAS No. 1212009-08-9. Mole weight: 825.87. Catalog: ACM1212009089. | |
| Dichloro[1,3-bis(2,6-diisopropylphenyl)imidazolidin-2-ylidene][(5-isobutoxycarbonylamino)-(2-isopropoxy)benzylidene]ruthenium(II) | Ruthenium Catalysts. CAS No. 1212009-05-6. Mole weight: 825.91. Catalog: ACM1212009056. | |
| Dichloro(2,6,10-dodecatriene-1,12-diyl)ruthenium(iv) | Heterocyclic Organic Compound. Alternative Names: Dichloro-2,6,10-dodecatrienylene-ruthenium, Dichloro(dodeca-2,6,10-triene-1,12-diyl)ruthenium(IV), Dichloro[(2,6,10-dodecatriene)-1,12-diyl]ruthenium(IV), Dichloro[(1,2,3,6,7,10,11,12-|C)-2,6,10-dodecatriene-1,12-diyl]-ruthenium, 12170-97-7. CAS No. 12170-97-7. Molecular formula: C12H18Cl2Ru. Mole weight: 334.25. Purity: 0.96. IUPACName: dichlororuthenium(2+);(2E, 6Z, 10E)-dodeca-2, 6, 10-triene. Canonical SMILES: [CH2-]C=CCCC=CCCC=C[CH2-].Cl[Ru+2]Cl. Catalog: ACM12170977. | |
| Dichlorobenzyl alcohol | Heterocyclic Organic Compound. CAS No. 12041-76-8. Molecular formula: C7H6Cl2O. Mole weight: 177.028 g/mol. Catalog: ACM12041768. | |
| Dichlorobis[3- (di-i-propylphosphino) propylamine]ruthenium (II) , min. 97% | Heterocyclic Organic Compound. Alternative Names: DICHLOROBIS[3- (DI-I-PROPYLPHOSPHINO) PROPYLAMINE]RUTHENIUM (II). CAS No. 1196147-57-5. Molecular formula: C18H44Cl2N2P2Ru. Mole weight: 522.48. Purity: 0.96. IUPACName: trans-RuCl2((i-Pr)2P(CH2)3NH2)2. Catalog: ACM1196147575. | |
| Dichlorobis [3- (diphenylphosphino] propylamine] ruthenium (II) , min. 97% | Heterocyclic Organic Compound. Alternative Names: MFCD15144861;1196467-26-1. CAS No. 1196467-26-1. Molecular formula: C36H56Cl2N2P2Ru. Mole weight: 750.776g/mol. IUPACName: chloromethane; 3-phosphanylpropylazanide; ruthenium(2+); toluene. Canonical SMILES: CC1=CC=CC=C1. CC1=CC=CC=C1. CC1=CC=CC=C1. CC1=CC=CC=C1. CCl. CCl. C(C[NH-])CP. C(C[NH-])CP. [Ru+2]. Catalog: ACM1196467261. | |
| Dichlorobis[3- (di-t-butylphosphino) propylamine]ruthenium (II) , min. 97% | Heterocyclic Organic Compound. Alternative Names: MFCD17018814; Dichlorobis[3- (di-t-butylphosphino) propylamine]ruthenium (II) ; 1196147-60-0. CAS No. 1196147-60-0. Molecular formula: C28H72Cl2N2P2Ru. Mole weight: 670.816g/mol. IUPACName: chloromethane; 2, 2-dimethylpropane; 3-phosphanylpropylazanide; ruthenium(2+). Canonical SMILES: CC(C)(C)C. CC(C)(C)C. CC(C)(C)C. CC(C)(C)C. CCl. CCl. C(C[NH-])CP. C(C[NH-])CP. [Ru+2]. Catalog: ACM1196147600. | |
| Dichlorobis[chloro (cyclohexene)platinum (II)] | Platinum series of catalysts. Alternative Names: Bis[dichloro(cyclohexene)platinum]. CAS No. 12176-53-3. Molecular formula: [Pt2(C6H10Cl)2]Cl2. Mole weight: 696.26. Appearance: pale yellow crystals. Purity: Pt 28%. Catalog: ACM12176533. | |
| Dichlorobis(indenyl)titanium(IV) | Heterocyclic Organic Compound. Alternative Names: Dichlorodi-pi-indenyltitanium, Titanium, dichlorodi-pi-indenyl-, CID202571, Bis(eta(sup 5)-indenyl)dichlorotitan(IV), LS-153910, Bis(eta(sup 5)-indenyl)dichlorotitan(IV) [German], 12113-02-9. CAS No. 12113-02-9. Molecular formula: C18H14Cl2Ti. Mole weight: 349.08. Appearance: White Powder. Purity: 0.96. IUPACName: 2H-inden-2-ide; titanium(4+); dichloride. Catalog: ACM12113029. | |
| Dichloro-bis-(indenyl)zirconium(iv) | Heterocyclic Organic Compound. Alternative Names: Dichloro-bis-(indenyl)zirconium (IV);bis-(Indenyl)zirconium dichloride. CAS No. 12148-49-1. Molecular formula: C18H14Cl2Zr. Mole weight: 392.43. Catalog: ACM12148491. | |
| Dichloro (dicyclopentadienyl)platinum (II) | Platinum series of catalysts. Alternative Names: Dichlorodi(cyclopenta-1,3-dien-1-yl)platinate(II);12083-92-0. CAS No. 12083-92-0. Molecular formula: C10H10Cl2Pt. Mole weight: 396.174g/mol. Canonical SMILES: C1C2C=[C-]C1C3C2C=C[CH-]3. Cl[Pt+2]Cl. Catalog: ACM12083920. | |
| Dichlorohydrotris (triphenylphosphine)rhodium | Heterocyclic Organic Compound. CAS No. 12124-48-0. Molecular formula: C54H46Cl2P3Rh. Catalog: ACM12124480. | |
| Dichloro(norbornadiene)platinum(II) | Heterocyclic Organic Compound. Alternative Names: Bicyclo[2.2.1]hepta-2,5-diene;dichloroplatinum. CAS No. 12152-26-0. Molecular formula: C7H8Cl2Pt. Mole weight: 358.12. Purity: 0.97. IUPACName: bicyclo[2.2.1]hepta-2,5-diene;dichloroplatinum. Canonical SMILES: C1C2C=CC1C=C2.Cl[Pt]Cl. ECNumber: 235-271-6. Catalog: ACM12152260-1. | |
| Dichloro-tetrakis(ethylene)dirhodium(I)] | Heterocyclic Organic Compound. CAS No. 12081-19-2. Molecular formula: C14H18ClNO3. Mole weight: 283.75062;g/mol. Purity: 0.96. IUPACName: 1-[1-(5-chloro-2-hydroxyphenyl)ethyl]piperidine-4-carboxylicacid. Canonical SMILES: CC (C1=C (C=CC (=C1)Cl)O)N2CCC (CC2)C (=O)O. Catalog: ACM12081192. | |
| Dichloro (tricyclohexylphosphine) [ (tricyclohexylphosphoranyl) methylidene]ruthenium (II) tetrafluoroborate | Polymer/Macromolecule. Alternative Names: Dichloro (tricyclohexylphosphine) [ (tricyclohexylphosphoranyl) methylidene]ruthenium (II) tetrafluoroborate;Piers-Grubbs 1st; Dichloro (tricyclohexylphosphine) [ (tricyclohexylphosphoranylidene) methyl]ruthenium tetrafluoroborate; Dichloro(PCy3)[(tricyclohexylphosp. CAS No. 1020085-61-3. Molecular formula: C37H66BCl2F4P2Ru-. Mole weight: 832. Purity: 0.96. IUPACName: dichloro (tricyclohexylphosphaniumyl methyl idene) ruthenium; tricyclohexylphosphane; tetrafluoroborate. Canonical SMILES: [B-] (F) (F) (F)F. C1CCC (CC1)P (C2CCCCC2)C3CCCCC3. C1CCC (CC1)[P+] (C=[Ru] (Cl)Cl) (C2CCCCC2)C3CCCCC3. Catalog: ACM1020085613. | |
| Dichlorphenamide | Dichlorphenamide. Alternative Names: 4,5-dichlorobenzene-1,3-disulfonamide; Diclofenamide. CAS No. 120-97-8. Molecular formula: C6H6Cl2N2O4S2. Mole weight: 305.16. Appearance: white or nearly white crystalline powder. Purity: 0.98. IUPACName: 4,5-dichlorobenzene-1,3-disulfonamide. Canonical SMILES: C1=C (C=C (C (=C1S (=O) (=O)N)Cl)Cl)S (=O) (=O)N. Density: 1.782 g/cm³. ECNumber: 204-440-6. Catalog: ACM120978. | |
| Dichromium boride | Heterocyclic Organic Compound. Alternative Names: Dichromium boride; methane hydrobromide; Chromium boride (Cr2B); EINECS 234-488-3; methane hydrobromide(2:1). CAS No. 12006-80-3. Molecular formula: MFCD00016042. Mole weight: 114.8. Purity: 0.96. IUPACName: methane;hydrobromide. Canonical SMILES: C.C.Br. ECNumber: 234-488-3. Catalog: ACM12006803. | |
| dichromium iron tetraoxide | Heterocyclic Organic Compound. Alternative Names: dichromium iron tetraoxide;Chromium iron oxide (Cr2FeO4). CAS No. 12068-77-8. Molecular formula: Cr2FeO4. Catalog: ACM12068778. | |
| dichromium magnesium tetraoxide | Heterocyclic Organic Compound. Alternative Names: dichromium magnesium tetraoxide;Chromate (CrO21#-), magnesium (2:1). CAS No. 12053-26-8. Molecular formula: CrO2.1/2Mg. Catalog: ACM12053268. | |
| Dichromium zinc tetraoxide | Heterocyclic Organic Compound. Alternative Names: 12018-19-8. CAS No. 12018-19-8. Molecular formula: Cr2O4Zn. Mole weight: 233.369800 [g/mol]. Purity: 0.96. IUPACName: zinc;chromium(3+);oxygen(2-). Canonical SMILES: [O-2].[O-2].[O-2].[O-2].[Cr+3].[Cr+3].[Zn+2]. ECNumber: 234-637-2. Catalog: ACM12018198. | |
| Dicobalt titanium tetraoxide | Heterocyclic Organic Compound. CAS No. 12017-38-8. Molecular formula: Co2O4Ti. Mole weight: 154.797. Catalog: ACM12017388. | |
| Dicopper dichloride oxide | Heterocyclic Organic Compound. Alternative Names: Dicopper dichloride oxide, EINECS 235-331-1, CID166649, 12167-76-9. CAS No. 12167-76-9. Molecular formula: Cl2Cu2O. Mole weight: 293.542800 [g/mol]. Purity: 0.96. IUPACName: tricopper oxygen(2-) dichloride. Canonical SMILES: [O-2].[O-2].[Cl-].[Cl-].[Cu+2].[Cu+2].[Cu+2]. ECNumber: 235-331-1. Catalog: ACM12167769. | |
| Dicopper hydroxide phosphate | Metal & Ceramic Materials. Alternative Names: dicopper hydroxide phosphate;Copper hydroxide phosphate;Copper(II) hydroxide phosphate 97%;Copper(II) hydroxide phosphate,97% UP. CAS No. 12158-74-6. Molecular formula: Cu2HO5P. Mole weight: 239.070701. Catalog: ACM12158746. | |
| Dicyanodimethylsilane | Heterocyclic Organic Compound. CAS No. 5158-9-8. Molecular formula: C4H6N2Si. Catalog: ACM1190212. | |
| Dicyclohexyl(4-isopropylphenyl)phosphine | Other Phosphine Ligands. Alternative Names: Dicyclohexyl[4-(1-Methylethyl)Phenyl]Phosphine. CAS No. 1202865-62-0. Molecular formula: C21H33P. Mole weight: 316.46. Purity: 0.98. IUPACName: dicyclohexyl-(4-propan-2-ylphenyl)phosphane. Canonical SMILES: CC (C)C1=CC=C (C=C1)P (C2CCCCC2)C3CCCCC3. Catalog: ACM1202865620-1. | |
| Dicyclohexyl[9-(3-phenylpropyl)-9-fluorenyl]phosphonium tetrafluoroborate | Heterocyclic Organic Compound. Alternative Names: Dicyclohexyl[9-(3-phenylpropyl)fluoren-9-yl]phosphonium tetrafluoroborate. CAS No. 1007311-95-6. Molecular formula: C34H42BF4P. Mole weight: 568.48. Appearance: Solid. Purity: 0.98. IUPACName: dicyclohexyl-[9-(3-phenylpropyl)fluoren-9-yl]phosphanium;tetrafluoroborate. Canonical SMILES: [B-] (F) (F) (F) F. C1CCC (CC1) [PH+] (C2CCCCC2) C3 (C4=CC=CC=C4C5=CC=CC=C53) CCCC6=CC=CC=C6. Catalog: ACM1007311956-1. | |
| Dicyclohexylamine | Environmental Standards. Alternative Names: Cyclohexanamine, N-cyclohexyl-. CAS No. 101-83-7. Molecular formula: C12H23N. Mole weight: 181.32. Catalog: ACM101837. | |
| Dicyclohexylethylphosphine tetrafluoroborate | Phosphine Ligands. CAS No. 1215113-73-7. Molecular formula: C14H28BF4P. Mole weight: 314.15. Purity: 0.98. IUPACName: dicyclohexyl(ethyl)phosphane; hydron; tetrafluoroborate. Catalog: ACM1215113737. | |
| Dicyclohexyl ketone | Heterocyclic Organic Compound. CAS No. 119-60-8. Molecular formula: C13H22O. Mole weight: 194.31. Catalog: ACM119608. | |
| Dicyclopentylether | Heterocyclic Organic Compound. Alternative Names: Dicyclopentylether. CAS No. 10137-73-2. Molecular formula: C10H18O. Mole weight: 154.24932. Catalog: ACM10137732. | |
| Didysprosium oxide silicate | Heterocyclic Organic Compound. Alternative Names: Didysprosium oxide silicate, EINECS 235-295-7, 12161-58-9. CAS No. 12161-58-9. Molecular formula: Dy2O5Si. Mole weight: 433.082500 [g/mol]. Purity: 0.96. IUPACName: dioxido(oxo)silane; dysprosium(3+); oxygen(2-). Canonical SMILES: [O-2].[O-2].[O-][Si](=O)[O-].[Dy+3].[Dy+3]. ECNumber: 235-295-7. Catalog: ACM12161589. | |
| Diendo-3-(4-chloro-benzoyl)-bicyclo[2.2.1]heptane-2-carboxylic acid | Heterocyclic Organic Compound. Alternative Names: DIENDO-3-(4-CHLORO-BENZOYL)-BICYCLO[2.2.1]HEPTANE-2-CARBOXYLIC ACID. CAS No. 1212074-43-5. Molecular formula: C15H15ClO3. Mole weight: 278.73. Catalog: ACM1212074435. | |
| Diendo-3-(4-fluoro-benzoyl)-bicyclo[2.2.1]heptane-2-carboxylic acid | Heterocyclic Organic Compound. Alternative Names: DIENDO-3-(4-FLUORO-BENZOYL)-BICYCLO[2.2.1]HEPTANE-2-CARBOXYLIC ACID. CAS No. 1212220-80-8. Molecular formula: C15H15FO3. Mole weight: 262.28. Catalog: ACM1212220808. | |
| Diendo-3-amino-bicyclo[2.2.1]heptane-2-carboxylic acid hydrochloride | Heterocyclic Organic Compound. Alternative Names: (1R,2S,3R,4S)-3-Aminobicyclo[2.2.1]heptane-2-carboxylic acid hydrochloride, 179462-36-3, SureCN1876675, (cis)-2-Amino-3-carboxybicyclo[2.2.1]heptane hydrochloride, (cis)-3-Aminobicyclo[2.2.1]heptane-2-carboxylic acid hydrochloride, 1212132-12-1, AK137135, KB-205327. CAS No. 1212132-12-1. Molecular formula: C8H14ClNO2. Mole weight: 191.655260 [g/mol]. Purity: 0.96. IUPACName: (1R,2S,3R,4S)-3-aminobicyclo[2.2.1]heptane-2-carboxylic acid;hydrochloride. Catalog: ACM1212132121. | |
| Dierbium oxide silicate | Heterocyclic Organic Compound. Alternative Names: Dierbium oxide silicate, EINECS 235-296-2, 12161-59-0. CAS No. 12161-59-0. Molecular formula: Er2O5Si. Mole weight: 442.600500 [g/mol]. Purity: 0.96. IUPACName: dioxido(oxo)silane; erbium(3+); oxygen(2-). Canonical SMILES: [O-2].[O-2].[O-][Si](=O)[O-].[Er+3].[Er+3]. ECNumber: 235-296-2. Catalog: ACM12161590. | |
| Dierbium triselenide | Heterocyclic Organic Compound. Alternative Names: Erbium selenide, Dierbium triselenide, Erbium selenide (Er2Se3), EINECS 234-657-1, CID6336878, 12020-38-1. CAS No. 12020-38-1. Molecular formula: Er2Se3. Mole weight: 571.398000 [g/mol]. Purity: 0.96. IUPACName: erbium; selenium. Catalog: ACM12020381. | |
| Dierbium tritelluride | Heterocyclic Organic Compound. Alternative Names: Erbium telluride, Dierbium tritelluride, Erbium telluride (Er2Te3), EINECS 234-658-7, CID6336879, 12020-39-2. CAS No. 12020-39-2. Molecular formula: Er2Te3. Mole weight: 717.318000 [g/mol]. Purity: 0.96. IUPACName: erbium; tellurium. Canonical SMILES: [Te].[Te].[Te].[Er].[Er]. ECNumber: 234-658-7. Catalog: ACM12020392. | |
| Diethyl(10-aminodecyl)phosphonate | Heterocyclic Organic Compound. CAS No. 120818-69-1. Molecular formula: C14H32NO3P. Mole weight: 293.39. Purity: 0.98. Catalog: ACM120818691. | |
| Diethyl(10-phthalimidodecyl)phosphonate | Heterocyclic Organic Compound. Alternative Names: Phosphonic acid,[10-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)decyl]-, diethyl ester (9CI), 120818-68-0, ACMC-20mp5b, AGN-PC-000IGM, CTK4B2056, AG-D-45416, 2-(10-diethoxyphosphoryldecyl)isoindole-1,3-dione, Diethyl(10-phthalimidodecyl)phosphonate, tech. 90 %. CAS No. 120818-68-0. Molecular formula: C22H36NO5P. Mole weight: 425.51. Purity: tech. 90 %. IUPACName: 2-(10-diethoxyphosphoryldecyl)isoindole-1,3-dione. Canonical SMILES: CCOP (=O) (CCCCCCCCCCN1C (=O)C2=CC=CC=C2C1=O)OCC. Catalog: ACM120818680. | |
| DIETHYL(1-CARBOXY-2-METHYLPROPYL)PHOSPHONATE | Heterocyclic Organic Compound. Alternative Names: DIETHYL(1-CARBOXY-2-METHYLPROPYL)PHOSPHONATE;Diethyl(1-carboxy-2-methylpropyl)phosphonate, 98 %. CAS No. 119090-76-5. Molecular formula: C9H19O5P. Mole weight: 238.22. Purity: 0.98. Catalog: ACM119090765. | |
| Diethyl 1-methylimidazole-4,5-dicarboxylate | Heterocyclic Organic Compound. Alternative Names: Diethyl 1-Methylimidazole-4,5-dicarboxylate, 1210-92-0, SCHEMBL8352120, MolPort-020-394-142, AKOS015902415, TRA0058033, AJ-87292, AK-83804, CJ-18223, SY013520, AB0056131, DB-061855, TC-308095, K-1505, Diethyl 1-methyl-1H-imidazole-4,5-dicarboxylate, 4,5-diethyl 1-methyl-1H-imidazole-4,5-dicarboxylate, I14-20116. CAS No. 1210-92-0. Molecular formula: C10H14N2O4. Mole weight: 226.229160 [g/mol]. Purity: 0.96. IUPACName: diethyl 1-methylimidazole-4,5-dicarboxylate. Canonical SMILES: CCOC(=O)C1=C(N(C=N1)C)C(=O)OCC. Catalog: ACM1210920. | |
| Diethyl 1-tetradecanephosphonate | Heterocyclic Organic Compound. CAS No. 5191-9-3. Molecular formula: CH3(CH2)13P(O)(OCH2CH3)2. Catalog: ACM1202260. | |
| Diethyl 2-(1H-indol-3-ylmethyl)propanedioate | Heterocyclic Organic Compound. CAS No. 10184-98-2. Molecular formula: C16H19NO4. Mole weight: 289.3264. Density: 1.2g/cm³. Catalog: ACM10184982. | |
| Diethyl-[2- (1-phenylethoxycarbonylamino) ethyl]azanium chloride | Heterocyclic Organic Compound. CAS No. 101491-65-0. Molecular formula: C15H25ClN2O2. Mole weight: 300.824 g/mol. Purity: 0.96. IUPACName: diethyl-[2- (1-phenylethoxycarbonylamino) ethyl]azanium; chloride. Canonical SMILES: CC[NH+](CC)CCNC(=O)OC(C)C1=CC=CC=C1. [Cl-]. Catalog: ACM101491650. | |
| Diethyl-[2-(1-phenylethylcarbamoyloxy)ethyl]azanium chloride | Heterocyclic Organic Compound. Alternative Names: CID58038, LS-50060, 2-(Diethylamino)ethyl (alpha-methylbenzyl)carbamate hydrochloride, Carbamic acid, (1-phenylethyl)-, 2-(diethylamino)ethyl ester, hydrochloride, Carbamic acid, (alpha-methylbenzyl)-, 2-(diethylamino)ethyl ester, monohydrochloride, 100836-54-2. CAS No. 100836-54-2. Molecular formula: C15H25ClN2O2. Mole weight: 300.824 g/mol. Purity: 0.96. IUPACName: diethyl-[2-(1-phenylethylcarbamoyloxy)ethyl]azanium chloride. Canonical SMILES: CC[NH+](CC)CCOC(=O)NC(C)C1=CC=CC=C1. [Cl-]. Catalog: ACM100836542. | |
| Diethyl- [2- [2- (2-methylanilino) -2-oxoethyl] sulfanylethyl] azaniumchloride | Heterocyclic Organic Compound. Alternative Names: CID59392, C 4924, LS-13842, 2-(2-(Diethylamino)ethyl)thio-o-acetotoluidide hydrochloride, o-ACETOTOLUIDIDE, 2-(2-(DIETHYLAMINO)ETHYL)THIO-, HYDROCHLORIDE, 102489-61-2. CAS No. 102489-61-2. Molecular formula: C15H25ClN2OS. Mole weight: 316.89 g/mol. Purity: 0.96. IUPACName: diethyl-[2-[2-(2-methylanilino)-2-oxoethyl]sulfanylethyl]azanium chloride. Canonical SMILES: CC[NH+](CC)CCSCC(=O)NC1=CC=CC=C1C. [Cl-]. Catalog: ACM102489612. | |
| Diethyl2-[2-(3-methyl-1-phenyl-1,8-diaza-3-azoniaspiro[4.5]decan-8-yl)ethyl]propanedioate chloride | Heterocyclic Organic Compound. Alternative Names: 8-(3,3-Bis(ethoxycarbonyl)propyl)-3-methyl-4-oxo-1-phenyl-1,3,8-triazaspiro(4,5)decane HCl, 101756-24-5, 8-[4-ethoxy-3-(ethoxycarbonyl)-4-oxobutyl]-3-methyl-1-phenyl-1,8-diaza-3-azoniaspiro[4.5]decane chloride, Malonic acid, (2-(3-methyl-1-phenyl-1,3,8-triazaspiro(4.5)dec-8-yl)ethyl)-, diethyl ester, hydrochloride, AC1Q1SIZ, AC1L1PW1, LS-88827, diethyl 2-[2-(2-methyl-4-phenyl-4,8-diaza-2-azoniaspiro[4.5]decan-8-yl)ethyl]propanedioate chloride. CAS No. 101756-24-5. Molecular formula: C23H36ClN3O4. Mole weight: 454.003 g/mol. Purity: 0.96. IUPACName: diethyl 2-[2-(3-methyl-1-phenyl-1,8-diaza-3-azoniaspiro[4.5]decan-8-yl)ethyl]propanedioate;chloride. Canonical SMILES: CCOC (=O)C (CCN1CCC2 (CC1)C[NH+] (CN2C3=CC=CC=C3)C)C (=O)OCC. [Cl-]. Catalog: ACM101756245. | |
| Diethyl 2-{2-[4-(3-benzyloxyphenylsulfanyl)-2-chlorophenyl]-ethyl}-2-fluoro-malonate | Heterocyclic Organic Compound. Alternative Names: 1023648-24-9, 2-{2-[4-(3-Benzyloxy-phenylsulfanyl)-2-chloro-phenyl]-ethyl}-2-fluoro-malonic acid diethyl ester. CAS No. 1023648-24-9. Molecular formula: C28H28ClFO5S. Mole weight: 531.042. Purity: 0.96. IUPACName: diethyl 2-[2-[2-chloro-4- (3-phenylmethoxyphenyl) sulfanylphenyl]ethyl]-2-fluoropropanedioate. Canonical SMILES: CCOC (=O)C (CCC1=C (C=C (C=C1)SC2=CC=CC (=C2)OCC3=CC=CC=C3)Cl) (C (=O)OCC)F. Catalog: ACM1023648249. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.