Alfa Chemistry. 3 - Products
Alfa Chemistry is an ISO 9001:2015 Certified Supplier of various building blocks, reagents, catalysts, nanomaterials, reference materials, and research chemicals. In-stock products can be shipped quickly.
| Product | Description | |
|---|---|---|
| Disodium 6-chloro-6'-methoxy-4-methyl[2, 2'-bibenzo[b]thiophene]-3, 3'-diyl disulfate | Heterocyclic Organic Compound. Alternative Names: EINECS 233-351-5, Disodium 6-chloro-6-methoxy-4-methyl(2,2-bibenzo(b)thiophene)-3,3-diyl disulphate, 10126-92-8. CAS No. 10126-92-8. Molecular formula: C18H11ClNa2O9S4. Mole weight: 580.967079 [g/mol]. Purity: 0.96. IUPACName: disodium;[6-chloro-2-(6-methoxy-3-sulfonatooxy-1-benzothiophen-2-yl)-4-methyl-1-benzothiophen-3-yl] sulfate. Canonical SMILES: CC1=CC (=CC2=C1C (=C (S2)C3=C (C4=C (S3)C=C (C=C4)OC)OS (=O) (=O)[O-])OS (=O) (=O)[O-])Cl. [Na+]. [Na+]. ECNumber: 233-351-5. Catalog: ACM10126928. |  |
| Disodium8-(anilino)-5-[4-(3-sulfonatophenyl)diazenylnaphthalen-1-yl]diazenylnaphthalene-1-sulfonate | Heterocyclic Organic Compound. Alternative Names: ACID BLUE 113, Neutral Blue 5R, Sulfon Blue 5R, Cirene Blue 5RA, Fenazo Blue S5R, Cloth Blue 5R, Erionyl Blue S5R, Sulfonine Blue 5R, Alphanol Blue 5RN, Cloth Fast Blue R, Fast Blue 5R, Kayanol Cyanine 5R, Sulphoncin Blue 5R, Sulphonol Navy 5RX, Cloth Fast Blue RN, Acid Fast Blue 5R, Java Fast Blue 5R, Wool Fast Blue 5R, Erio Fast Blue S5R, Acid Leather Blue RN. CAS No. 101708-55-8. Molecular formula: C32H21N5Na2O6S2. Mole weight: 681.649 g/mol. Purity: 0.96. IUPACName: disodium;8-anilino-5-[[4-[(3-sulfonatophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-1-sulfonate. Canonical SMILES: C1=CC=C (C=C1)NC2=C3C (=C (C=C2)N=NC4=CC=C (C5=CC=CC=C54)N=NC6=CC (=CC=C6)S (=O) (=O)[O-])C=CC=C3S (=O) (=O)[O-]. [Na+]. [Na+]. ECNumber: 222-111-5. Catalog: ACM101708558. | |
| Disodium monofluorophosphate | Metal & Ceramic Materials. Alternative Names: disodium monofluorophosphate; Phosphorofluoridic acid disodium salt;SODIUM FLUOROPHOSPHATE; 7631-97-2disodiumfluorophosphate; disodiumphosphorofluoridate; mfp; sodiumfluorophosphate(na2po3f); sodiumphosphorofluoridate. CAS No. 10163-15-2. Molecular formula: Na2PFO3;FNa2O3P. Mole weight: 143.95g/mol. IUPACName: disodium;fluoro-dioxido-oxo-??5-phosphane. Canonical SMILES: [O-]P(=O)([O-])F.[Na+].[Na+]. ECNumber: 233-433-0;231-552-2. Catalog: ACM10163152. | |
| disodium; oxygen(-2) anion; titanium(+4) cation | Heterocyclic Organic Compound. Alternative Names: Disodium titanate, Disodium titanate(2-), AC1L4OKP, Disodium trititanium heptaoxide, Sodium titanium oxide (Na2TiO3), Sodium titanium oxide (Na2Ti3O7), Sodium titanium oxide (Na2Ti4O9), EINECS 234-802-9, EINECS 234-803-4, EINECS 235-622-3, disodium; oxygen(2-); titanium(4+), 12034-34-3, 12384-38-2. CAS No. 12034-34-3. Molecular formula: Na2O3Ti. Mole weight: 141.84474. Purity: 0.96. IUPACName: disodium;oxygen(2-);titanium(4+). Density: g/cm³. Catalog: ACM12034343. | |
| DISODIUM TRIS(1,2-BENZENEDIOLATO-O,O)-S ILICATE | Heterocyclic Organic Compound. Alternative Names: Natrium-triphenylmethyl; sodium tris(benzene-1,2diolato)silicate; sodium triphenylmethide; Sodium,(triphenylmethyl); Tritylnatrium; triphenylmethyl sodium; tritylsodium. CAS No. 101519-12-4. Molecular formula: C18H12Na2O6Si. Mole weight: 398.349. Purity: 0.96. IUPACName: Disodium tris(1,2-benzenediolato-O,O inverted exclamation marka)silica. Catalog: ACM101519124. | |
| Disperse yellow 1 | Heterocyclic Organic Compound. Alternative Names: LABOTEST-BB LT01487957;DISPERSE YELLOW 1;2, 4-DINITRO-4'-HYDROXYDIPHENYLAMINE;4-[(2', 4'-DINITROPHENYL)AMINO]-PHENOL;4-(2, 4-DINITROANILINO)PHENOL;P-(2, 4-DINITROANILINO)PHENOL;TIMTEC-BB SBB001098;2,4-Dinitro-p-hydroxydiphenylamine. CAS No. 119-15-3. Molecular formula: C12H9N3O5. Mole weight: 275.24. Appearance: Reddish-brown solid. Purity: 0.96. IUPACName: 4-(2,4-dinitroanilino)phenol. Canonical SMILES: C1=CC (=CC=C1NC2=C (C=C (C=C2)[N+] (=O)[O-])[N+] (=O)[O-])O. Density: 1.549g/cm³. ECNumber: 204-300-4. Catalog: ACM119153. | |
| Disperse yellow 65 (C.I. 671205) | Heterocyclic Organic Compound. CAS No. 10116-20-8. Catalog: ACM10116208. | |
| Distillates(petroleum), heavy thermal cracked, polymd. | Heterocyclic Organic Compound. CAS No. 100815-94-9. Catalog: ACM100815949. | |
| Distillates (petroleum), hydrodesulfurized full-range middle | Heterocyclic Organic Compound. Alternative Names: Distillates (petroleum), hydrodesulfurized full-range middle;Distillates (petroleum), hydrodesulfurized full-range middle Heavy Fuel oil;Einecs 309-863-0. CAS No. 101316-57-8. Catalog: ACM101316578. | |
| Disulfiram-d20 | Heterocyclic Organic Compound. Alternative Names: (Tetraethyl-d20)thioperoxydicarbonic Diamide. CAS No. 1216403-88-1. Molecular formula: C10D20N2S4. Mole weight: 316.66. Appearance: Pale Yellow Solid. Catalog: ACM1216403881. | |
| Ditantalum monocarbide | Heterocyclic Organic Compound. Alternative Names: ditantalum monocarbide;Tantalum carbide sputtering target, 76.2mm (3.0in) dia x 6.35mm (0.250in) thick, 99.95% (metals basi;Tantalum carbide sputtering target, 50.8mm (2.0in) dia x 6.35mm (0.250in) thick, 99.95% (metals basi;Tantalum carbide sputtering t. CAS No. 12070-07-4. Molecular formula: CTa2. Mole weight: 192.96. Catalog: ACM12070074. | |
| Ditantalum strontium hexaoxide | Heterocyclic Organic Compound. Alternative Names: STRONTIUM (II) METATANTALATE;STRONTIUM TANTALATE;ditantalum strontium hexaoxide. CAS No. 12065-74-6. Molecular formula: SrTa2O6. Mole weight: 545.51. Catalog: ACM12065746. | |
| Di-tert-butyl 2-isocyanosuccinate | Heterocyclic Organic Compound. Alternative Names: Di-tert-butyl 2-isocyanosuccinate, Ditert-butyl 2-isocyanobutanedioate, 1027757-05-6, DL-Aspartic acid di-tert-butyl ester isocyanide, AC1MNBKS, ACMC-20al4c, AGN-PC-0KS21G, 51492_ALDRICH, SCHEMBL377216, 51492_FLUKA, CTK8C5666, AG-L-65402, TC-167043. CAS No. 1027757-05-6. Molecular formula: C13H21NO4. Mole weight: 255.31. Purity: 0.96. IUPACName: ditert-butyl 2-isocyanobutanedioate. Canonical SMILES: CC (C) (C)OC (=O)CC (C (=O)OC (C) (C)C)[N+]#[C-]. Catalog: ACM1027757056. | |
| Di-tert-butylcyclopentadiene | Heterocyclic Organic Compound. Alternative Names: 120937-44-2, ACMC-20al48, di(t-butyl) cyclopentadiene, di(tert-butyl)-cyclopentadiene, CTK0H3277, BKXWLTGDCDAPQT-UHFFFAOYSA-N, RT-022081. CAS No. 120937-44-2. Molecular formula: C13H22. Mole weight: 178.31. Purity: 0.96. IUPACName: 1,2-ditert-butylcyclopenta-1,3-diene. Canonical SMILES: CC(C)(C)C1=C(C=CC1)C(C)(C)C. Density: 0.836 g/mL at 20ºC(lit.). Catalog: ACM120937442. | |
| Dithallium trisulfide | Heterocyclic Organic Compound. Alternative Names: Thallium sulfide, Dithallium sulphide, Dithallium trisulphide, Thallium(III) sulfide, Thallium sulfide (Tl2S), Thallium sulfide (Tl2S3), EINECS 215-250-8, EINECS 234-886-7, CID159376, 12039-17-7, 1314-97-2. CAS No. 12039-17-7. Molecular formula: S3Tl2. Mole weight: 440.831600 [g/mol]. Purity: 0.96. IUPACName: thallium(1+) sulfide. Canonical SMILES: [S-2].[Tl+].[Tl+]. ECNumber: 234-886-7. Catalog: ACM12039177. | |
| Dithiophosphoric acid O-butyl O-octyl ester zinc salt | Heterocyclic Organic Compound. CAS No. 121684-27-3. Catalog: ACM121684273. | |
| dithulium oxide silicate | Heterocyclic Organic Compound. CAS No. 12161-63-6. Molecular formula: O12Si3Tm2-6. Mole weight: 614.11772. Catalog: ACM12161636. | |
| dititanium oxide | Heterocyclic Organic Compound. CAS No. 12035-94-8. Molecular formula: O4Ti2. Mole weight: 159.7316. Catalog: ACM12035948. | |
| Ditridecyl amine | Heterocyclic Organic Compound. Alternative Names: DITRIDECYLAMINE;Tridecanamine, N-tridecyl-, branched and linear;Ditridecylamine Mixture of Isomers;N-Tridecyl-1-tridecylamine. CAS No. 101012-97-9. Molecular formula: C26H55N. Mole weight: 381.72. Density: 0.836 g/cm³ (20 °C). Catalog: ACM101012979. | |
| Ditridecyl phthalate | Heterocyclic Organic Compound. Alternative Names: Polycizer 962BPA. CAS No. 119-06-2. Molecular formula: C34H58O4. Mole weight: 530.8. IUPACName: Ditridecyl benzene-1,2-dicarboxylate. Canonical SMILES: CCCCCCCCCCCCCOC (=O)C1=CC=CC=C1C (=O)OCCCCCCCCCCCCC. Density: 0.9510 g/mL. Catalog: ACM119062-1. | |
| Ditungsten nitride | Heterocyclic Organic Compound. CAS No. 12033-72-6. Molecular formula: NW2. Mole weight: 217.91. Catalog: ACM12033726. | |
| Ditungsten pentaboride,w2b5 | Heterocyclic Organic Compound. Alternative Names: DITUNGSTEN PENTABORIDE;TUNGSTEN BORIDE;TUNGSTEN PENTABORIDE;TUNGSTEN BORIDE 99+%;TUNGSTEN BORIDE, 99.4% (METALS BASIS);99.4%(metalsbasis). CAS No. 12007-98-6. Molecular formula: B5W2. Mole weight: 421.75. Purity: 0.96. IUPACName: boranylidyne ($l^{2}-boranylidene)tungsten; boranylidynetungsten; $l^{2}-boranylideneboron. Catalog: ACM12007986. | |
| Ditungsten pentaoxide | Heterocyclic Organic Compound. CAS No. 12036-84-9. Molecular formula: O5W2. Catalog: ACM12036849. | |
| DIURON D6 | Heterocyclic Organic Compound. CAS No. 1007536-67-5. Molecular formula: C9H4Cl2D6N2O. Mole weight: 239.13. Purity: 99 atom % D. Catalog: ACM1007536675. | |
| Diytterbium oxide silicate | Heterocyclic Organic Compound. Alternative Names: Diytterbium oxide silicate, EINECS 234-731-3, 12027-89-3. CAS No. 12027-89-3. Molecular formula: O5SiYb2. Mole weight: 454.162500 [g/mol]. Purity: 0.96. IUPACName: dioxido(oxo)silane; oxygen(2-); ytterbium(3+). Canonical SMILES: [O-2].[O-2].[O-][Si](=O)[O-].[Yb+3].[Yb+3]. ECNumber: 234-731-3. Catalog: ACM12027893. | |
| Diyttrium oxide silicate | Heterocyclic Organic Compound. Alternative Names: Diyttrium oxide silicate, 39318-36-0 (Parent), EINECS 234-730-8, CID165992, Yttrium oxide silicate (Y2O(SiO4)), 12027-88-2, 12412-59-8, 12439-98-4. CAS No. 12027-88-2. Molecular formula: O5SiY2. Mole weight: 631.872700 [g/mol]. Purity: 0.96. IUPACName: dioxido(oxo)silane; oxygen(2-); yttrium(3+). Catalog: ACM12027882. | |
| Dl-1,1'-bi(2-naphthyl diacetate) | Heterocyclic Organic Compound. Alternative Names: (+/-)-2,2'-DIACETOXY-1,1'-BINAPHTHYL;2,2'-DIACETOXY-1,1'-BINAPHTHYL;DL-1,1'-BI(2-NAPHTHYL DIACETATE);(R)-(-)-2,2'-DIACETOXY-1,1'-BINAPHTHYL;(R)-(-)-1,1'-BI-2-NAPHTHOL DIACETATE;(S)-(+)-2,2'-DIACETOXY-1,1'-BINAPHTHYL;1,1'-BI-2-NAPHTHYL DITACETATE;(+)-1,1'. CAS No. 100569-82-2. Molecular formula: C24H18O4. Mole weight: 370.4. Purity: 0.97. Catalog: ACM100569822. | |
| Dl-1,2-Isopropylideneglycerol | Ortho Esters. Alternative Names: Solketal. CAS No. 100-79-8. Molecular formula: C6H12O3. Mole weight: 132.16. Appearance: Clear colorless liquid. Purity: 0.98. IUPACName: (2,2-dimethyl-1,3-dioxolan-4-yl)methanol. Canonical SMILES: CC1(OCC(O1)CO)C. Density: 1.063. ECNumber: 202-888-7. Catalog: ACM100798. | |
| Dl-2,3-diphenylsuccinic acid anhydride | Heterocyclic Organic Compound. Alternative Names: DL-2,3-DIPHENYL-SUCCINIC ACID ANHYDRIDE. CAS No. 101278-21-1. Molecular formula: C16H12O3. Purity: >96. Catalog: ACM101278211. | |
| D,L-Carnitine-d3 chloride | Isotope-labeled Amino Acids2H Labeled Compounds. CAS No. 119766-67-5. Molecular formula: C7H13D3ClNO3. Mole weight: 200.68. IUPACName: 4-[dimethyl (trideuteriomethyl)azaniumyl]-3-hydroxybutanoate; hydrochloride. Canonical SMILES: [2H]C ([2H]) ([2H])[N+] (C) (C)CC (CC (=O)[O-])O. Cl. Catalog: ACM119766675. | |
| Dl-cyclopropylglycine | Heterocyclic Organic Compound. Alternative Names: 2-(cyclopropylamino)acetic acid, DL-Cyclopropylglycine, SBB065743, 10294-18-5, Glycine, N-cyclopropyl-, SureCN75440, (cyclopropylamino)acetic acid, CTK0D8799, 2-(cyclopropylamino)ethanoic acid, MolPort-003-986-894, AC1Q7624, ACT09258, AKOS009234984, AG-B-87108, MCULE-7811029224, AK117378, KB-50294, Q854, KB-223974, TL8003300. CAS No. 10294-18-5. Molecular formula: C5H9NO2. Mole weight: 115.130460 [g/mol]. Purity: 0.96. IUPACName: 2-(cyclopropylamino)acetic acid. Canonical SMILES: C1CC1NCC(=O)O. Catalog: ACM10294185. | |
| Dl-fluorocitric acid barium salt | Heterocyclic Organic Compound. Alternative Names: DL-FLUOROCITRIC ACID BARIUM SALT;dl-fluorocitric acid;DL-FLUOROCITRIC ACID, BARIUM;barium DL-fluorocitrate. CAS No. 100929-81-5. Molecular formula: C6H5BaFO7. Mole weight: 345.43. Purity: 0.96. IUPACName: barium;1-fluoro-2-hydroxypropane-1,2,3-tricarboxylic acid. Canonical SMILES: C (C (=O)O)C (C (C (=O)[O-])F) (C (=O)[O-])O. [Ba+2]. Catalog: ACM100929815. | |
| DLin-KC2-DMA | Others. Alternative Names: 1,3-Dioxolane-4-ethanamine, N,N-dimethyl-2,2-di-(9Z,12Z)-9,12-octadecadien-1-yl-. CAS No. 1190197-97-7. Molecular formula: C43H79NO2. Mole weight: 642.1. Purity: 98%+. IUPACName: 2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N,N-dimethylethanamine. Canonical SMILES: CCCCC/C=C\C/C=C\CCCCCCCCC1 (OC (CO1)CCN (C)C)CCCCCCCC/C=C\C/C=C\CCCCC. Density: 0.885±0.06 g/cm3(Predicted). Catalog: ACM1190197977. | |
| d,l-Mevalonic acid dicyclohexylammonium salt | Heterocyclic Organic Compound. Alternative Names: 3,5-Dihydroxy-3-(methyl) Pentanoic Acid Dicyclohexylammonium Salt; Hiochic Acid Dicyclohexylammonium Salt; 3,5-Dihydroxy-3-(methyl)valeric Acid Dicyclohexylammonium Salt; MK 91; MVA; MVS; (RS)-Mevalonic Acid Dicyclohexylammonium Salt. CAS No. 1215802-31-5. Molecular formula: C18H35NO4. Mole weight: 329.47. Appearance: White Solid. Catalog: ACM1215802315. | |
| DL-Normetanephrine hydrochloride | Heterocyclic Organic Compound. Alternative Names: DL-α-(Aminomethyl)-4-hydroxy-3-methoxybenzenemethanol hydrochloride. CAS No. 1011-74-1. Molecular formula: C9H13NO3HCl. Mole weight: 219.67. Catalog: ACM1011741. | |
| D,L-O-Desmethylvenlafaxine-d6 | 2H Labeled Compounds. Alternative Names: 4-[2-(Dimethylamino)-1-(1-hydroxycyclo-hexyl)ethyl]phenol-d6. CAS No. 1020719-35-0. Molecular formula: C16H19D6NO2. Mole weight: 269.41. Catalog: ACM1020719350. | |
| Dl-phenylalanine-obzl p-tosylate | Heterocyclic Organic Compound. Alternative Names: 1738-78-9, DL-Phe-Obzl HCl, 3-phenyl-l-alanine benzyl ester 4-toluenesulphonate, 119290-61-8, NSC524126, PubChem20612, AC1L6ZGE, ACMC-209h3p, 962-39-0 (Parent), PHENYLALANINE BENZYL ESTER, MolPort-003-912-425, EINECS 217-096-7, AKOS015908895, NSC-524126, I498, A811579, O-Benzyl-3-phenyl-L-alanine toluene-4-sulphonate, I01-3295, L-Phenylalanine benzyl ester p-toluenesulfonate salt, I14-34290. CAS No. 119290-61-8. Molecular formula: C16H17NO2·C7H8O3S. Mole weight: 427.52. Purity: 0.96. IUPACName: benzyl 2-amino-3-phenylpropanoate;4-methylbenzenesulfonic acid. Canonical SMILES: CC1=CC=C(C=C1)S(=O)(=O)O. C1=CC=C(C=C1)CC(C(=O)OCC2=CC=CC=C2)N. Catalog: ACM119290618. | |
| Dl-serinol hydrochloride | Heterocyclic Organic Compound. Alternative Names: SERINOL HCL;DL-SERINOL HYDROCHLORIDE;2-AMINO-1,3-PROPANDIOL HCL;DL-SERINOL 98+%;2-Amino-1,3-propanediolHClpurum;2-Amino-1,3-propanediolhydrochloridepurum. CAS No. 100929-48-4. Molecular formula: C3H9NO2.HCl. Mole weight: 127.57. Appearance: White Crystalline Powder. Catalog: ACM100929484. | |
| D-Mannose (3-13C) | Isotope-labeled Carbohydrates13C Labeled Compounds. Alternative Names: D-[3-13C]mannose D-mannose-3-13C. CAS No. 101615-89-8. Molecular formula: 13CC5H12O6. Mole weight: 181.15. Appearance: White crystalline powder. IUPACName: (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxy(3-13C)hexanal. Catalog: ACM101615898. | |
| D-Myo-inositol-1,5,6-triphosphate sodium salt | Heterocyclic Organic Compound. CAS No. 120965-76-6. Molecular formula: C6H9O15P3.3Na. Mole weight: 492.011968 [g/mol]. Purity: 0.96. IUPACName: (2,5-dihydroxy-3,4,6-triphosphonatooxycyclohexyl) phosphate. Catalog: ACM120965766. | |
| Dnp-dl-ethionine | Heterocyclic Organic Compound. CAS No. 102783-71-1. Molecular formula: C12H15N3O6S. Mole weight: 329.329;g/mol. Purity: 0.96. IUPACName: 2-(2,4-dinitroanilino)-4-ethylsulfanylbutanoicacid. Canonical SMILES: CCSCCC (C (=O)O)NC1=C (C=C (C=C1)[N+] (=O)[O-])[N+] (=O)[O-]. Catalog: ACM102783711. | |
| Dnp-teg cep | Heterocyclic Organic Compound. CAS No. 1027512-01-1. Molecular formula: C48H64N5O13P. Mole weight: 950.021. Catalog: ACM1027512011. | |
| Docosahexaenoic Acid Ethyl Ester | Heterocyclic Organic Compound. CAS No. 1020718-25-5. Molecular formula: C24H36O2. Mole weight: 356.55. Appearance: A solution in ethanol. Canonical SMILES: CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC. Catalog: ACM1020718255. | |
| Docosane,13-ethyl-2,3,6,7,10,13,17,20,21-nonamethyl- | Heterocyclic Organic Compound. Alternative Names: BOTRYOCOCCANE C33. CAS No. 100664-68-4. Molecular formula: C33H68. Mole weight: 464.89. Catalog: ACM100664684. | |
| Docosanoic-22,22,22-d3acid | Heterocyclic Organic Compound. CAS No. 1193721-67-3. Molecular formula: 343.61. Purity: 98 atom % D. Catalog: ACM1193721673. | |
| Docosanoic-7,7,8,8-d4acid | Heterocyclic Organic Compound. CAS No. 1193721-65-1. Molecular formula: 344.61. Purity: 98 atom % D. Catalog: ACM1193721651. | |
| Docosanoic acid (3,3,5,5-D4) | Fatty Acids and Fatty Acid Esters2H Labeled Compounds. Alternative Names: (3,3,5,5-D4)-Docosanoic acid. CAS No. 1208430-53-8. Molecular formula: C22H40D4O2. Mole weight: 344.61. Appearance: White solid. IUPACName: 3,3,5,5-tetradeuteriotetracosanoic acid. Density: 0.54 g/cm3 at 25 °C (77 °F). Catalog: ACM1208430538. | |
| Docosapentaenoic acid-d5 | Fatty Acids and Fatty Acid Esters2H Labeled Compounds. Alternative Names: 7(Z), 10(Z), 13(Z), 16(Z), 19(Z)-docosapentaenoic-21, 21, 22, 22, 22-d5 acid; DPA-d5. CAS No. 1215168-70-9. Molecular formula: C22H29D5O2. Mole weight: 335.5. Appearance: Liquid. IUPACName: (7Z,10Z,13Z,16Z,19Z)-21,21,22,22,22-pentadeuteriodocosa-7,10,13,16,19-pentaenoic acid. Catalog: ACM1215168709. | |
| DOCOSYL FERULATE (50 MG)F0E1430.99MG/MG(AI) | DOCOSYL FERULATE (50 MG)F0E1430.99MG/MG(AI). CAS No. 101927-24-6. Molecular formula: C32H54O4. Catalog: ACM101927246. | |
| DODEC-2E-ENE-8,10-DIYNOIC ACID ISOBUTYLAMIDE | Other. CAS No. 120727-29-9. Mole weight: 245.37. Appearance: Off-white powder. Catalog: ACM120727299. | |
| Dodecairon lead nonadecaoxide | Heterocyclic Organic Compound. Alternative Names: Lead ferrite, Dodecairon lead nonadecaoxide, Lead ferrite (Fe12PbO19), Iron lead oxide (Fe12PbO19), EINECS 234-684-9, CID165982, 12023-90-4. CAS No. 12023-90-4. Molecular formula: Fe12O19Pb. Mole weight: 606.087000 [g/mol]. Purity: 0.96. IUPACName: iron(3+); lead(2+); oxygen(2-). Catalog: ACM12023904. | |
| Dodecan-5-ol | Heterocyclic Organic Compound. Alternative Names: 5-DODECANOL;dodecan-5-ol. CAS No. 10203-33-5. Molecular formula: C12H26O. Mole weight: 186.33. Catalog: ACM10203335. | |
| Dodecanoic acid, cadmium salt, basic | Dodecanoic acid, cadmium salt, basic. CAS No. 101012-89-9. Catalog: ACM101012899. | |
| Dodecyl- [3- [dodecyl (dimethyl) azaniumyl] -2-hydroxypropyl] -dimethylazaniumdibromide | Heterocyclic Organic Compound. Alternative Names: Damol, 10232-86-7, NSC305949, NSC-305949, 1, N,N-didodecyl-2-hydroxy-N,N,N,N-tetramethyl-, dibromide. CAS No. 10232-86-7. Molecular formula: C31H68Br2N2O. Mole weight: 644.692 g/mol. Purity: 0.96. IUPACName: dodecyl-[3-[dodecyl (dimethyl)azaniumyl]-2-hydroxypropyl]-dimethylazanium; bromide. Canonical SMILES: CCCCCCCCCCCC[N+] (C) (C)CC (C[N+] (C) (C)CCCCCCCCCCCC)O. [Br-]. [Br-]. ECNumber: 233-554-9. Catalog: ACM10232867. | |
| Dodecyl 4-methylbenzenesulfonate | Heterocyclic Organic Compound. Alternative Names: 4-methyl-benzenesulfonicacidodecylester; DODECYL P-TOLUENESULFONATE;Dodecyl 4-methylbenzenesulfonate;4-toluenesulfonic acid dodecyl ester;4-Methylbenzenesulfonic acid dodecyl ester;4-methyl-benzenesulfonic acid dodecyl ester;1-Dodecyl p-tosylate;Benzenesu. CAS No. 10157-76-3. Molecular formula: C19H32O3S. Mole weight: 340.52. Density: 1.015g/cm³. Catalog: ACM10157763. | |
| Dodecylbenzenesulfonic acid | Heterocyclic Organic Compound. CAS No. 121-65-3. Molecular formula: C18H30O3S. Mole weight: 326.49. Catalog: ACM121653. | |
| Dodecylbenzenesulphonic acid,compound with butylamine(1:1) | Heterocyclic Organic Compound. Alternative Names: dodecylbenzenesulphonic acid, compound with butylamine (1:1);Butylamine dodecyl benzene sulfonate. CAS No. 12068-09-6. Molecular formula: C22H41NO3S. Mole weight: 399.63084. Catalog: ACM12068096. | |
| Dodecyltrimethylammonium | Heterocyclic Organic Compound. Alternative Names: Dotac compound; 1-Dodecanaminium,N,N,N-trimethyl; dodecyl-trimethyl-ammonium cation; Trimethyl-dodecyl-ammonium; DODECANE-TRIMETHYLAMINE; n-dodecyltrimethylammonium; N,N,N-Trimethyl-1-dodecanaminium; dodecyl(trimethyl)azanium; N-Dodecyl-N-trimethyl-ammoni. CAS No. 10182-91-9. Molecular formula: C15H34N+. Mole weight: 228.437160 [g/mol]. Purity: 0.96. IUPACName: dodecyl(trimethyl)azanium. Canonical SMILES: CCCCCCCCCCCC[N+](C)(C)C. Catalog: ACM10182919. | |
| Donasine | Other Alkaloids. CAS No. 1017237-81-8. Molecular formula: C23H28N4O3. Mole weight: 408.49. Purity: 98%+ (HPLC). Catalog: ACM1017237818. | |
| Dorzolamide hydrochloride, pharma130693-82-2; 122028-36-8; 122028-16-4 | Heterocyclic Organic Compound. CAS No. 120279-36-9. Purity: 0.96. Catalog: ACM120279369. | |
| Dowexsbr-c cl form | Heterocyclic Organic Compound. CAS No. 121181-80-4. Molecular formula: ClH. Mole weight: 36.46094;g/mol. Purity: 0.96. IUPACName: chlorane. Canonical SMILES: Cl. ECNumber: 231-595-7. Catalog: ACM121181804. | |
| Doxylamine-d5 succinate | Heterocyclic Organic Compound. Alternative Names: N,N-Dimethyl-2-[1-(phenyl-d5)-1-(2-pyridinyl)ethoxy]ethanamine. CAS No. 1216840-94-6. Molecular formula: C17H17D5N2O.C4H6O4. Mole weight: 393.49. Appearance: Off-White Solid. Catalog: ACM1216840946. | |
| DPAVBi | Organic Light Emitting Diode (OLED). Alternative Names: 4,4'-Bis[4-(di-p-tolylamino)styryl]biphenyl. CAS No. 119586-44-6. Molecular formula: C56H48N2. Mole weight: 748.99 g/mol. Purity: 95%+. IUPACName: 4-methyl-N- [4- [ (E) -2- [4- [4- [ (E) -2- [4- (4-methyl-N- (4-methylphenyl) anilino) phenyl] ethenyl] phenyl] phenyl] ethenyl] phenyl] -N- (4-methylphenyl) aniline. Canonical SMILES: CC1=CC=C (C=C1)N (C2=CC=C (C=C2)C)C3=CC=C (C=C3)C=CC4=CC=C (C=C4)C5=CC=C (C=C5)C=CC6=CC=C (C=C6)N (C7=CC=C (C=C7)C)C8=CC=C (C=C8)C. Density: 1.154 g/ml. Catalog: ACM119586446. | |
| D-Phenyl-d5-alanine-2,3,3-d3 | Heterocyclic Organic Compound. CAS No. 1202064-02-5. Molecular formula: C9H3D8NO2. Mole weight: 173.24. Purity: 98 atom % D. IUPACName: (E)-2-(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)-3-(furan-2-yl)prop-2-enenitrile. Canonical SMILES: CC1=C (SC2=C1C (=O)NC (=N2)C (=CC3=CC=CO3)C#N)C. Catalog: ACM1202064025. | |
| D-Phenyl-d5-alanine-N-t-BOC | Heterocyclic Organic Compound. CAS No. 1213661-19-8. Molecular formula: C14H14D5NO4. Mole weight: 270.34. Purity: 99 atom % D. Catalog: ACM1213661198. | |
| Drevogenin A | Steroids. CAS No. 10163-83-4. Molecular formula: C28H42O7. Mole weight: 490.64. Appearance: Powder. Purity: 0.98. IUPACName: [(3S,8R,9S,10R,11S,12S,13S,14S,17S)-17-acetyl-11-acetyloxy-3,14-dihydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-12-yl] 3-methylbutanoate. Canonical SMILES: CC (C)CC (=O)OC1C (C2C (CC=C3C2 (CCC (C3)O)C)C4 (C1 (C (CC4)C (=O)C)C)O)OC (=O)C. Catalog: ACM10163834. | |
| D-Sorbitol (U-13C6) | Isotope-labeled Carbohydrates13C Labeled Compounds. Alternative Names: D-Glucitol-13C6; D-Sorbitol-13C6. CAS No. 121067-66-1. Molecular formula: 13C6H14O6. Mole weight: 188.13. Appearance: White solid. IUPACName: (2S, 3R, 4R, 5R)-(1, 2, 3, 4, 5, 6-13C6)hexane-1, 2, 3, 4, 5, 6-hexol. Catalog: ACM121067661. | |
| Dtpa-bma | Heterocyclic Organic Compound. Alternative Names: DTPA-BMA;5,8-Bis(carboxymethyl)-11-[2-(methylamino)-2-oxoethyl]-3-oxo-2,5,8,11-tetraazatridecan-13-oic acid;1,7-Bis(methylcarbamoylmethyl)-1,4,7-triazaheptane-1,4,7-triacetic acid;1,7-Bis(methylcarbamoylmethyl)-1,4,7-triazaheptane-1,4,7-trisacetic acid;6-Carboxymethyl-3,9-bis(methylcarbamoylmethyl)-3,6,9-triazaundecanedioic acid; N, N- (Carboxymethyliminobisethylene) bis[N- (methylcarbamoylmethyl) glycine]; N, N-Bis[ (methylcarbamoyl) methyl][N, N-bis (carboxymethyl) [2, 2- (carboxymethylimino) bis (ethaneamine) ]]. CAS No. 119895-95-3. Molecular formula: C16H29N5O8. Mole weight: 419.43. Density: 1.352. Catalog: ACM119895953. | |
| (d-Trp11)-neurotensin | Heterocyclic Organic Compound. Alternative Names: neurotensin [D-Trp11]. CAS No. 100929-52-0. Molecular formula: C80H122N22O19. Mole weight: 1695.98. Catalog: ACM100929520. | |
| (d-Trp2,7,9)-substance p | Heterocyclic Organic Compound. Alternative Names: (D-TRP2,7,9)-SUBSTANCE P;H-ARG-D-TRP-LYS-PRO-GLN-GLN-D-TRP-PHE-D-TRP-LEU-MET-NH2;ARG-D-TRP-LYS-PRO-GLN-GLN-D-TRP-PHE-D-TRP-LEU-MET-NH2. CAS No. 100930-11-8. Molecular formula: C80H109N21O13S. Mole weight: 1604.92. Catalog: ACM100930118. | |
Would you like to list your products on USA Chemical Suppliers?
Our database is helping our users find suppliers everyday.