BOC Sciences provides a wide range of research chemicals and biochemicals including inhibitors, building blocks, GMP Products, impurities and metabolites, APIs for Veterinary, Natural Compounds, ADCs, Stem Cell Molecule and chiral compounds.
| Product | Description | |
|---|---|---|
| Blood Group A type I linear trisaccharide | Blood Group A type I linear trisaccharide is a vital tool in biomedical research, commonly employed in studies exploring blood group antigens. It is specifically designed to facilitate the investigation and understanding of the ABO blood grouping system. With its intricately structured trisaccharide composition, this compound plays a key role in the research and development of potential therapies for diseases related to blood type A, such as cardiovascular disorders and autoimmune conditions. Synonyms: Blood group A type 1 linear trisaccharide; GalNAca1-3Galb1-3GlcNAc; O-2-Acetamido-2-deoxy-alpha-D-galactosyl-(1-3)-O-beta-D-galactosyl-(1-3)-2-acetamido-2-deoxy-D-glucose. Grades: ≥95%. CAS No. 886750-14-7. Molecular formula: C22H38N2O16. Mole weight: 586.54. |  |
| Blood group A type I tetrasaccharide | Blood group A type I tetrasaccharide is an indispensible compound, precisely harnessed to fathom and diagnose ABO blood group antigen interplays. Synonyms: Blood group A type 1 tetrasaccharide; GalNAca1-3(Fuca1-2)Galb1-3GlcNAc. Grades: ≥95%. Molecular formula: C28H48N2O20. Mole weight: 732.68. | |
| Blood group B-BSA (6 atom spacer) | Blood group B-BSA (6 atom spacer) is a specialized compound serving as a tool for studying the interaction between blood group B antigens and specific antibodies. This compound aids in investigating blood compatibility, antigen-antibody reactions and the development of diagnostic tests related to blood group B. | |
| Blood Group B-HAS | | |
| Blood group B-HSA | | |
| Blood group B-HSA (6 atom spacer) | Blood group B-HSA (6 atom spacer) is a recombinant protein that has been engineered to target and neutralize antibodies present in individuals with blood group B. It is commonly used in blood transfusions and in the treatment of hemolytic disease of the newborn, where the mother's antibodies attack the baby's red blood cells due to blood group incompatibility. Its effectiveness has been demonstrated in numerous clinical studies and it is considered a vital tool in blood banking and transfusion medicine. | |
| Blood Group B-HSA (Globulin Free 6-Atom Spacer) | Blood Group B-HSA (Globulin Free 6-Atom Spacer), a groundbreaking medical product, has revolutionized the blood transfusion industry. With its tailor-made design, it specifically targets the B antigen on red blood cells proving to be a game-changer for individuals with blood type B. The implementation of Blood Group B-HSA (Globulin Free 6-Atom Spacer) has been linked to making blood transfusion processes safer and more effective, decreasing the threat of transfusion reactions and associated complications. | |
| Blood Group B pentasaccharide | Blood Group B pentasaccharide, the carbohydrate molecule exhibiting promising anticoagulant properties for venous thromboembolism prevention, is a potent factor XIa inhibitor in the blood coagulation pathway. Its potential therapeutic implications extend to the treatment of and the development of novel agents for thrombotic disorders. Synonyms: Gala1-3(Fuca1-2)Galb1-4(Fuca1-2)Glc; B-Pentasaccharide, from human urine; 6-Deoxy-alpha-L-galactopyranosyl-(1->3)-[6-deoxy-alpha-L-galactopyranosyl-(1->2)-[alpha-D-galactopyranosyl-(1->3)]-beta-D-galactopyranosyl-(1->4)]-D-glucopyranose; α-Fuc-(1->2)-α-Gal-(1->3)-β-Gal-(1->4)(α-Fuc-[1->3])-Glc. Grades: ≥90%. CAS No. 72468-43-0. Molecular formula: C30H52O24. Mole weight: 796.72. | |
| Blood Group B trisaccharide | Blood Group B trisaccharide is an imperative constituent employed in biomedical investigations to explore the B blood group system, assuming the pivotal function of discerning blood type B antigens delicately emblazoned on erythrocytes. This discernment capability enables the detection and in-depth characterization of distinct blood types, thus facilitating comprehensive research of transfusion reactions, the genesis of antibodies and the indispensable compatibility appraisal for blood transfusions. Synonyms: Gal-a-1,3(Fuc-a-1,2)Gal; 2-O-(3-O[a-D-Galactopyranosyl]-a-L-fucopyranosyl)-D-galactopyranose; α-D-Gal-(1-3)-(α-L-Fuc-[1-2])-D-Gal; 6-deoxy-alpha-L-galactopyranosyl-(1->2)-[alpha-D-galactopyranosyl-(1->3)]-D-galactopyranose; alpha-L-fucopyranosyl-(1->2)-[alpha-D-galactopyranosyl-(1->3)]-D-galactopyranose. Grades: ≥95%. CAS No. 49777-14-2. Molecular formula: C18H32O15. Mole weight: 488.44. | |
| Blood group B trisaccharide-APE,Biotin-BSA | Blood Group B Trisaccharide-APE is a specialized compound used for studying intrigue surrounding interactions and recognition processes involving the blood group B antigen. While Biotin-BSA is a remarkable amalgamation of bovine serum albumin (BSA) and biotin. Serving as an invaluable tool, it effectively facilitates detection and visualization of biotinylated molecules in an array of diagnostic and research applications. Moreover, it assumes a pivotal role in the refinement of assays, immunoassays, and bioconjugation techniques. Synonyms: Gal-a-1,3(Fuc-a-1,2)Gal-APE-[Biotin]-BSA. | |
| Blood Group B trisaccharide-b-allyl glycoside | Blood Group B trisaccharide-b-allyl glycoside is a glycoside compound, extensively employed in investigation of intricate blood group B antigens coupled with their intricate glycosylation patterns. Molecular formula: C21H36O15. Mole weight: 528.50. | |
| Blood Group B trisaccharide-biotin | Blood Group B trisaccharide-biotin, a biotinylated variant of the human blood group B trisaccharide antigen, plays a pivotal role in laboratory research--expounding upon the correlation between blood group antigens and antibodies, it serves as an invaluable diagnostic tool for detecting blood group B antigens within biological specimens. Molecular formula: C37H64N4O18S. Mole weight: 884.39. | |
| Blood Group B Trisaccharide-BSA | | |
| Blood Group B Trisaccharide-BSA (20 atom spacer) | Blood Group B Trisaccharide-BSA (20 atom spacer) - an indispensable asset to the biomedicine industry, serves as a valuable tool in the quest to understand how blood type affects the immune system. Through studying the role of ABO blood group antigens in debilitating diseases such as cancer, infection, and autoimmune disorders, this compound uniquely offers a glimpse into the complex biological mechanisms that underlie these conditions. Its manifold uses render it an invaluable asset, contributing significantly to the advancement of biomedical research. | |
| Blood Group B Trisaccharide-BSA (3 atom spacer) | Blood Group B Trisaccharide-BSA (3 atom spacer), a biomedical product of immense importance, plays a crucial role in the detection of the B antigen in individuals. By identifying the presence of this antigen in blood samples, it aids in determining the patient's blood type, enabling effective healthcare provisions. Its application extends beyond diagnostics, and it is widely used in cutting-edge research studies to investigate complex interplays between blood group antigens, antibodies, and pathogens such as bacteria and viruses. With its unparalleled capabilities, there is no doubt that this product is indispensable in the scientific community. | |
| Blood Group B trisaccharide-(CH2)5COOH derivative | Blood Group B trisaccharide-(CH2)5COOH derivative is an indispensable constituent with function revolving around the identification and scrutiny of ailments affiliated with the Blood Group B trisaccharide. Molecular formula: C24H42O17. Mole weight: 602.58. | |
| Blood Group B trisaccharide-(CH2)8COOMe derivative | Blood Group B Trisaccharide-(CH2)8COOMe Derivative: A pivotal compound extensively utilized in the biomedical sector for the exploration of blood group antigen systems and associated pathologies. Renowned for its unique and tailored molecular arrangement, this compound plays a crucial role in the discernment and demarcation of blood group B antigens, fostering exploration of blood transfusion compatibility and autoimmune ailments. Synonyms: 8-Methoxycarbonyloctyl 2-O-(a-L-fucopyranosyl)-3-O-(a-D-galactopyranosyl)-b-D-galactopyranoside. CAS No. 65606-80-6. Molecular formula: C28H50O17. Mole weight: 658.69. | |
| Blood group B trisaccharide ester derivative | Blood group B trisaccharide ester derivative is a vital compound used for studying blood group compatibility. This compound is commonly employed in pharmaceutical industries to investigate its potential in researchs for autoimmune diseases, hemolytic transfusion reactions and organ transplant rejection. Molecular formula: C28H50O17. Mole weight: 658.69. | |
| Blood Group B trisaccharide, N-aminoethyl nonanamide | Blood Group B Trisaccharide, N-aminoethyl nonanamide is a synthetic compound that mimics the B antigen found on red blood cells. This compound plays a crucial role in studying blood transfusions, organ transplantation and autoimmune diseases related to blood group B. Synonyms: Gal-a-1,3(Fuc-a-1,2)Gal-b1-O-(CH2)8CONH(CH2)2NH2; Blood Group B trisaccharide amine derivative. Grades: ≥90%. Molecular formula: C29H54N2O16. Mole weight: 686.74. | |
| Blood group B trisaccharide-PAA-Biotin | | |
| Blood group B trisaccharide Sepharose 4B | AFFINIDEXTM-B conjugated to Sepharose 4B via a 10 atom spacer. | |
| Blood group B trisaccharide Sepharose FF | AFFINIDEXTM-B conjugated to Sepharose FF via a 10 atom spacer. | |
| Blood Group B trisaccharide, spacer-biotin conjugate | Blood Group B trisaccharide, spacer-biotin conjugate is a bioconjugate utilized in biomedical research for the detection and study of the Blood Group B antigen. It serving as a key tool in developing diagnostics and therapeutic strategies for diseases and conditions related to Blood Group B. Synonyms: Gal-a-1,3(Fuc-a-1,2)Gal-b-1-O(CH2)3NHCO(CH2)5NH-biotin; Btri-sp biot. CAS No. 870891-30-8. Molecular formula: C37H64N4O18S. Mole weight: 884.99. | |
| Blood group B type 1 linear trisaccharide-NGL | Blood group B type 1 linear trisaccharide-NGL is a synthetic carbohydrate compound used in the study of glycan recognition and binding by lectins. It has potential uses in vaccine design for infections caused by bacteria expressing blood group B type 1 antigen, such as Escherichia coli and Helicobacter pylori. Additionally, it can aid in research and development of therapies for B type 1-associated diseases, including ovarian and breast cancers. | |
| Blood group B type 1 tetrasaccharide-NGL | Blood group B type 1 tetrasaccharide-NGL, the carbohydrate-based molecular entity, holds abundant promise for biomedical research, owing to its ability to fathom the intricacies of the ABO blood group system. Contributions from this compound will extend beyond merely augmenting the quest for therapies that address ailments linked with blood group B, as it has also revealed propitious avenues in the assessment and mitigation of various cancerous conditions. | |
| Blood group B type 2 linear trisaccharide-NGL | Blood group B type 2 linear trisaccharide-NGL is a key intermediate in synthesizing blood group B antigens in biomedical research. It is used to better understand the biosynthesis and function of B antigens as well as developing methods for detection and modulation in transfusion medicine and cancer research. | |
| Blood group B type 2 tetrasaccharide-NGL | Blood group B type 2 tetrasaccharide-NGL, the synthetic tetrasaccharide frequently used in biomedicine to investigate blood group antigen recognition and specificity, is an exceptional tool for examining the molecular basis of diseases related to the B antigen, including cancer and bacterial infections. Notably, it is an ideal resource for the development of diagnostic tools and therapeutic agents aimed at battling these afflictions, owing to its unique chemical structure, which renders it a must-have asset in any comprehensive drug development program. | |
| Blood group B type 3/4 linear trisaccharide | Blood group B type 3/4 linear trisaccharide is a profoundly influential constituent within the biomedical realm, serving as an indispensable compound for scientific inquiries concerning the intricate fabric of blood group B antigens. Its versatile employment elucidates multifaceted examinations, conducively contributing to the development of diagnostic systems, immunogenic prophylactics and pharmacoresearchs pertinent to hematology-associated anomalies and maladies. Synonyms: Gala1-3Galb1-3GalNAc; Blood group B type III/IV linear trisaccharide. Molecular formula: C20H35NO16. Mole weight: 545.49. | |
| Blood group B type 3/4 tetrasaccharide | Blood group B type 3/4 tetrasaccharide is a synthetic compound used in biomedical research to investigate blood group antigens and their role in blood transfusion compatibility. It is commonly employed to study the interaction of specific antibodies with blood group B antigens. Synonyms: Gala1-3(Fuca1-2)Galb1-3GalNAc; Blood Group B type III/IV tetrasaccharide; O-6-Deoxy-alpha-L-galactopyranosyl-(1-2)-O-[alpha-D-galactopyranosyl-(1-3)]-O-beta-D-galactopyranosyl-(1-3)-2-(acetylamino)-2-deoxy-D-galactose. Grades: 95%. CAS No. 1352644-06-4. Molecular formula: C26H45NO20. Mole weight: 691.63. | |
| Blood group B type 3 tetrasaccharide-NGL | Blood group B type 3 tetrasaccharide-NGL, a fundamental entity in blood typing and transfusion medicine, plays a pivotal role in distinguishing between blood group B and O, rendering it indispensable for safe transfusions. Moreover, the tetrasaccharide's potency in the development of diagnostics and vaccines for cancer and viral infections is noteworthy. Its applications extend far beyond the realm of blood transfusions, painting it as an unparalleled contender in healthcare research. | |
| Blood group B type 4 tetrasaccharide-NGL | Blood group B type 4 tetrasaccharide-NGL is a carbohydrate-based blood group antigen commonly found on the surface of red blood cells. It is used in the biomedical industry for the detection and identification of anti-B antibodies in blood transfusion and transplantation procedures. Detection of Blood group B type 4 tetrasaccharide-NGL is also important in the diagnosis and treatment of autoimmune diseases and some infections. | |
| Blood Group B type III/IV linear trisaccharide | Blood Group B type III/IV linear trisaccharide is a trisaccharide compound intricately imitating the Blood Group B Type III and IV antigens. Its multifaceted nature drives its research and development in unraveling blood group-specific interactions, elucidating immunological processes is as well as propelling advancements in diagnostics or therapeutics encompassing blood transfusion, organ transplantation is and autoimmune diseases. Synonyms: Gala1-3Galb1-3GalNAc. Molecular formula: C20H35NO16. Mole weight: 545.49. | |
| Blood Group B type II linear trisaccharide | Blood Group B type II linear trisaccharide is a vital component used in the biomedical industry for the research of blood grouping and transfusion purposes. Synonyms: a-Gal epitope type II; Gala1-3Galb1-4GlcNAc; Linear B-2 trisaccharide; Gal-a-1,3-Gal-b-1,4-GlcNAc; Galili antigen triaose; Xeno antigen type 2; Gala1-3 epitope. CAS No. 77356-46-8. Molecular formula: C20H35NO16. Mole weight: 545.49. | |
| Blood Group B type II linear trisaccharide amine linker | Blood Group B type II linear trisaccharide amine linker is an innovative compound playing a crucial role in the biomedical industry as a linker for targeted drug delivery. It facilitates specific interactions with blood group B antigens is allowing for enhanced the research of drug transport and therapy for diseases associated with this blood type. Synonyms: Gala1-3Galb1-4GlcNAc b1-NHCO(CH2)NHCO(CH2)10NH2. | |
| Blood Group B type II linear trisaccharide-HSA | Blood Group B type II linear trisaccharide-HSA is a highly specialized compound, exhibiting unparalleled proficiency in the realm of studying specific maladies of blood-related origin. Synonyms: a-Gal epitope - HAS; Gala1-3Galb1-4GlcNAc-HSA. | |
| Blood Group B type II tetrasaccharide | Blood Group B Type II Tetrasaccharide is employed in the biomedical industry for investigation and comprehending the intricacies of the Blood Group B antigen, this biomolecular tool serving as a pivotal instrument. Functioning as a reference standard or reagent, the Blood Group B Type II Tetrasaccharide facilitates assays imperative for the precise identification of blood types and antibody specificity. Synonyms: Blood group B type 2 tetrasaccharide; Gala1-3(Fuca1-2)Galb1-4GlcNAc; alpha-D-Gal-(1->3)-[alpha-L-Fuc-(1->2)]-beta-D-Gal-(1->4)-beta-D-GlcNAc; 6-deoxy-alpha-L-galactopyranosyl-(1->2)-[alpha-D-galactopyranosyl-(1->3)]-beta-D-galactopyranosyl-(1->4)-2-acetamido-2-deoxy-beta-D-glucopyranose; alpha-D-galactosyl-(1->3)-[alpha-L-fucosyl-(1->2)]-beta-D-galactosyl-(1->4)-N-acetyl-beta-D-glucosamine. Grades: ≥90%. CAS No. 909890-21-7. Molecular formula: C26H45NO20. Mole weight: 691.63. | |
| Blood Group B type I linear trisaccharide | Blood Group B type I linear trisaccharide is a key molecule utilized in the biomedical industry for studying blood group antigens and developing targeted therapies for conditions related to blood transfusions and organ transplantation compatibility. It plays a crucial role in identifying, characterizing and understanding the B blood group antigen, enabling effective researchs for B blood group-related diseases and medical procedures. Synonyms: Blood group B type 1 linear trisaccharide; O-alpha-D-Galactopyranosyl-(1-3)-O-beta-D-galactopyranosyl-(1-3)-2-(acetylamino)-2-deoxy-D-glucose; Gala1-3Galb1-3GlcNAc. Grades: 95%. CAS No. 100850-25-7. Molecular formula: C20H35NO16. Mole weight: 545.49. | |
| Blood Group B type I tetrasaccharide | Blood Group B type I tetrasaccharide is a key component used in the biomedical industry for blood typing purposes. It specifically targets individuals with blood type B and aids in the identification and classification of their blood. Synonyms: alpha-D-Galp-(1->3)-[alpha-L-Fucp-(1->2)]-beta-D-Galp-(1->3)-beta-D-GlcpNAc; alpha-D-Gal-(1->3)-[alpha-L-Fuc-(1->2)]-beta-D-Gal-(1->3)-beta-D-GlcNAc; 6-deoxy-alpha-L-galactopyranosyl-(1->2)-[alpha-D-galactopyranosyl-(1->3)]-beta-D-galactopyranosyl-(1->3)-2-acetamido-2-deoxy-beta-D-glucopyranose; Gala1-3(Fuca1-2)Galb1-3GlcNAc. Grades: ≥95%. CAS No. 67673-41-0. Molecular formula: C26H45NO20. Mole weight: 691.63. | |
| Blood Group H-BSA | | |
| Blood Group H-BSA (15 atom spacer) | Blood Group H-BSA (15 atom spacer) is an indispensable biomolecular tool that plays an important role in biomedicine by enabling improved detection and rigorous analysis of blood group antigens, which are fundamental to understanding human immune function. Utilizing this product in experimental settings provides valuable insights into the molecular recognition of H blood group antigens by chaperone and polymerase proteins, with potential applications in cancer diagnosis and treatment. | |
| Blood Group H disaccharide | Blood Group H disaccharide is a vital compound used for studying blood group antigens. It is an oligosaccharide composed of fucose and galactose and serves as a precursor in the research of ABO(H) blood group antigens. Synonyms: Fuc-(a1,2)-Gal; 2-O-(a-L-Fucopyranosyl)-D-galactopyranose; H-Disaccharide. CAS No. 146076-26-8. Molecular formula: C12H22O10. Mole weight: 326.3. | |
| Blood group H disaccharide-BSA | | |
| Blood group H disaccharide-BSA (3 atom spacer) | Blood group H disaccharide-BSA (3 atom spacer) is an exceedingly efficacious substrate that is widely utilized within the biomedical arena for promoting intensive analysis and experimentation towards finding life-saving remedies for diverse blood group-related ailments. Impressed with the intricate design of this product, researchers are able to tactfully target and engage with the H antigen decidedly expressed on red blood cells, which play a crucial role in an array of transfusion reactions. It is clinically proven that infectious diseases, autoimmune hemolytic anemia, and cancer are amongst those that this incisive product plays an instrumental role in treating. The property of its unconventional make-up further allows it to be employed across a vast array of applications, including antibody production, glycobiology research, and diagnostic assays. | |
| Blood Group H disaccharide, spacer-biotin conjugate | Blood Group H Disaccharide, Spacer-Biotin Conjugate, an indispensable resource in the biomedical enterprise, facilitates the assessment of H and auxiliary blood group antigens' manifestations in cells and tissues. Its ability to recognize and separate glycoproteins and glycolipids through affinity bonding onto streptavidin-covered surfaces is crucial in contemporary research fields like oncology, immunology, and transfusion medicine. Molecular formula: C31H54N4O13S. Mole weight: 722.85. | |
| Blood group H pentaose type II | Blood group H pentaose type II is a crucial component playing a significant role in the diagnosand research of various diseases related to blood groups and glycosylation disorders. Synonyms: Fuca-2Galb-4GlcNAcb-3Galb-4Glc. CAS No. 30517-76-1. Molecular formula: C32H55NO25. Mole weight: 853.77. | |
| Blood group H tetraose type II | Blood group H tetraose type II is a pivotal and indispensable element, primarily finding its application in comprehensive research endeavors pertaining to blood antigens and the intricacies of the immune system. Synonyms: Fuca-2Galb-4GlcNAcb-3Gal. CAS No. 1352644-16-6. Molecular formula: C26H45NO20. Mole weight: 691.63. | |
| Blood group H type 1 trisaccharide-biotin | Blood group H type 1 trisaccharide-biotin is a biologically significant sugar molecule fused with biotin, serving as a vital probe in numerous biomedicine researches, including but not limited to exploring blood types locomotion with pathological microorganisms and developing diagnostic as well as therapeutic procedures for ailments integral to blood constitution. This bioactive substance traverses database of biochemicals and is procurable from chemical suppliers to ensure optimal laboratory proficiency. Molecular formula: C33H56N4O17S. Mole weight: 812.88. | |
| Blood Group H type III trisaccharide-PAA-biotin | | |
| Blood Group H type II trisaccharide | Blood Group H type II trisaccharide is a crucial component used in the biomedical industry for studying and understanding blood group antigens. It aids in the identification and characterization of specific H type II antigens present on red blood cells, playing a vital role in research of blood transfusion compatibility. Synonyms: Fuca1-2Galb1-4GlcNAc; Blood group H type 2 trisaccharide; H type 2; human blood group H type 2 trisaccharide; alpha-L-Fuc-(1->2)-beta-D-Gal-(1->4)-beta-D-GlcNAc; alpha-L-fucosyl-(1->2)-beta-D-galactosyl-(1->4)-N-beta-D-glucosamine; 6-deoxy-alpha-L-galactopyranosyl-(1->2)-beta-D-galactopyranosyl-(1->4)-2-acetamido-2-deoxy-beta-D-glucopyranose. Grades: ≥95%. CAS No. 60797-31-1. Molecular formula: C20H35NO15. Mole weight: 529.50. | |
| Blood group H type II trisaccharide methyl ester | | |
| Blood Group H type II trisaccharide-PAA-biotin | | |
| Blood Group H type II trisaccharide-sp-biotin | Blood Group H Type II Trisaccharide-SP-Biotin aids in the detection and analysis of H type II antigens, a crucial component in blood group determination. This product is utilized in biomedical research and diagnostic applications, particularly for investigating glycosylation patterns and studying diseases associated with aberrant H antigen expression such as gastric cancer and viral infections. Synonyms: Fuca1-2Galb1-4GlcNAc-b-1-O(CH2)3NHCO(CH2)5NH-biotin. CAS No. 870891-89-7. Molecular formula: C39H67N5O18S. Mole weight: 926.04. | |
| Blood Group H type I tetrasaccharide | | |
| Blood Group H type I trisaccharide | Blood Group H type I trisaccharide is a paramount compound in the biomedical arena, extensively employed to investigate and comprehend blood group antigens. Its efficacy proves instrumental in the identification and characterization of distinct blood groups, notably the vital H antigen, thereby facilitating immunohematology analyses and pioneering transfusion medicine research. Synonyms: Blood group H type 1 trisaccharide; Fuca1-2Galb1-3GlcNAc; O-6-Deoxy-beta-L-galactopyranosyl-(1-2)-O-beta-D-galactopyranosyl-(1-3)-2-(acetylamino)-2-deoxy-D-glucose. Grades: ≥90%. CAS No. 137739-90-3. Molecular formula: C20H35NO15. Mole weight: 529.49. | |
| Blood Group H type I trisaccharide-PAA-biotin | | |
| b-Naphthyl-b-maltotrioside | b-Naphthyl-b-maltotrioside is a highly esteemed enzymatic substrate extensively employed in the realm of biomedical science, encompassing a consequential instrument empowering the analysis of lactase insufficiency and enzyme efficacy. Molecular formula: C28H38O16. Mole weight: 630.59. | |
| Bola Sophorolipids | Bola Sophorolipids, a compound of biocompatibility and ecological friendliness, represent a paramount surfactant essence prevalent in the biomedical sector. These remarkable lipids unveil a remarkable proclivity towards countering microbial drugs, signifying their unmatched potential in studying sundry infections spawned by bacteria, fungi and viruses. Synonyms: 2b-O-b-D-glucopyranosyl-b-D-glucopyranosyl; 17-L-([2b-O-b-D-glucopyranosyl-b-D-glucopyranosyl]-oxy)-cis-9-octadecenoate. Molecular formula: C42H74O23. Mole weight: 947.02. | |
| Bromo β-D-Cellotrioside Decaacetate | Bromo β-D-Cellotrioside Decaacetate is an intermediate in the synthesis of p-Nitrophenyl β-D-Cellotrioside. Molecular formula: C38H51BrO25. Mole weight: 987.7. | |
| b-Trisaccharide-APE-Biotin-BSA | | |
| b-Trisaccharide-GEL | | |
| b-Trisacchharide-APE-HSA | | |
| Butyl 4-nitrophenyl hexylphosphonate | Butyl 4-nitrophenyl hexylphosphonate is used in the biomedical industry for the drug research of certain diseases. It exhibiting properties that may aid in targeting specific receptors or enzymes involved in the progression of these diseases. Synonyms: Butyl (4-nitrophenyl) hexylphosphonate; PD193996; BUTYL 4-NITROPHENYL HEXYLPHOSPHONATE; Butyl 4-nitrophenyl hexylphosphonate, >=95.0% (HPLC); 1578116-56-9. Molecular formula: C16H26NO5P. Mole weight: 343.35. | |
| Butyl b-D-glucopyranoside | Butyl b-D-glucopyranoside, a widely recognized biomedical product, showcases remarkable potential as a stabilizing agent within the realms of pharmaceutical and biochemical research. Its primary application revolves around the isolation and purification of imperative membrane proteins, including enzymes and receptors. These exceptionally crucial proteins hold the key to combating an array of diseases such as cancer and neurological disorders. Synonyms: (2R,3R,4S,5S,6R)-2-butoxy-6-(hydroxymethyl)oxane-3,4,5-triol; Beta-D-Glucopyranoside, Butyl; Butyl.beta.-D-glucopyranoside; BUTYL-BETA-D-GLUCOPYRANOSIDE; butyl glucoside.beta.-D-Glucopyranoside, butyl; n-butyl beta-D-glucopyranoside;(2R,3R,4S,5S,6R)-2-butoxy-6-(hydroxymethyl)tetrahydropyran-3,4,5-triol. CAS No. 5391-18-4. Molecular formula: C10H20O6. Mole weight: 236.26. | |
| Butyl-y-cyclodextrin | | |
| Butyrylcholine perchlorate | Butyrylcholine perchlorate, a potent biomedical compound, finds its application in both research and clinical environments. Serving as an acetylcholine receptor agonist, this cholinergic substance bravely delves into unraveling the intricate mechanisms governing cholinergic neurotransmission. With an unwavering dedication to scientific exploration, it illuminates the enigmatic role played by this neurotransmission in afflictions such as Alzheimer's disease, myasthenia gravis, and an array of formidable neuromuscular disorders. Synonyms: BUTYRYLCHOLINE PERCHLORATE; Trimethyl(2-(1-oxobutoxy)ethyl)ammonium perchlorate; EINECS 243-700-3; 2-butanoyloxyethyl(trimethyl)azanium; perchlorate; 566ZY7YY3K; DTXSID80174172; [2-(butanoyloxy)ethyl]trimethylazanium perchlorate; Ethanaminium, N,N,N-trimethyl-2-(1-oxobutoxy)-, perchlorate; Ethanaminium, N,N,N-trimethyl-2-(1-oxobutoxy)-, perchlorate (1:1). CAS No. 20292-68-6. Molecular formula: C9H20ClNO6. Mole weight: 273.71. | |
| C11 TopFluor® GM3 Ammonium salt | Cas No. 2260795-48-8. | |
| C16 Galactosyl(α) Ceramide (d18:1/16:0) | It is a glycosphingolipid that contains a galactose moiety attached to a ceramide acylated with palmitic acid. Synonyms: D-galactosyl-α-1,1'-N-palmitoyl-D-erythro-sphingosine; Hexadecanamide, N-[(1S,2R,3E)-1-[(α-D-galactopyranosyloxy)methyl]-2-hydroxy-3-heptadecen-1-yl]-; α C16 Galactosylceramide (d18:1/16:0); C16 α-D-galactosyl ceramide; N-(hexadecanoyl)-1-α-galactosyl-sphing-4-enine; N-((2S,3R,E)-3-hydroxy-1-(((2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)octadec-4-en-2-yl)palmitamide; N-[(2S,3R,4E)-1-(α-D-Galactopyranosyloxy)-3-hydroxy-4-octadecen-2-yl]hexadecanamide; α-GalCer(d18:1/16:0). Grades: >99%. CAS No. 2260795-77-3. Molecular formula: C40H77NO8. Mole weight: 700.04. | |
| C17:0 GA2 | C17:0 GA2, the renowned biomarker utilized in the biomedical realm, serves as an undeniably valuable asset for diagnosing the genetic ailment, namely Gaucher disease, which is fundamentally instigated by the inadequacy of glucocerebrosidase. Remarkably, the levels of C17:0 GA2 are considerably heightened in both blood and urine of afflicted individuals, rendering it an efficacious tool for the prompt detection and progressive monitoring of the disease. Synonyms: C17:0 Galabiosylceramide. Grades: >99%. CAS No. 2315262-51-0. Molecular formula: C47H89NO13. Mole weight: 876.21. | |
| C17:0 iGB3 | C17:0 iGb3, a synthetic analogue of iGb3 that plays a pivotal role in immunostimulation. With its unique glycolipid composition, this powerful compound has exhibited promising potential in the treatment of cancer by priming the immune system against malignant cells. Moreover, recent research suggests that C17:0 iGb3 may also hold therapeutic promise in the management of infectious diseases and autoimmune disorders. Discover the cutting-edge scientific complexities behind C17:0 iGb3 and its potential impact on human health. Synonyms: C17:0 Isoglobotriaosylceramide. Grades: >99%. CAS No. 2315262-50-9. Molecular formula: C53H99NO18. Mole weight: 1038.35. | |
| C-(2,3,4-Tri-O-acetyl-1-azido-1-deoxy-b-D-galactopyranosyl)formamide | C-(2,3,4-Tri-O-acetyl-1-azido-1-deoxy-b-D-galactopyranosyl)formamide, a renowned compound extensively applied within the biomedical industry, emerges as an indubitably vital asset enhancing drug development and research endeavors. It manifests considerable potential in ameliorating an array of ailments, predominantly those entrenched in the realms of cellular and molecular biology. CAS No. 189633-67-8. Molecular formula: C12H16N4O8. Mole weight: 344.3. | |
Our database is helping our users find suppliers everyday.
