BOC Sciences provides a wide range of research chemicals and biochemicals including inhibitors, building blocks, GMP Products, impurities and metabolites, APIs for Veterinary, Natural Compounds, ADCs, Stem Cell Molecule and chiral compounds.
| Product | Description | |
|---|---|---|
| Adenosine 5'-succinate | Adenosine 5'-succinate is a potent inhibitor that acts on Denatonium benzoate/taste receptor activation of transducin. Synonyms: Adenosine, 5'-(hydrogen butanedioate). CAS No. 102029-71-0. Molecular formula: C14H17N5O7. Mole weight: 367.31. |  |
| Adenosine 5'-(tetrahydrogen triphosphate), manganese salt | Adenosine 5'-(tetrahydrogen triphosphate), manganese salt. Synonyms: 5'-ATP manganese salt; Adenosine 5'-triphosphate manganese salt; Adenosine 5'-triphosphoric acid manganese salt; Adenosine triphosphate manganese salt; Adenosine-5'-triphosphate manganese salt; ATP manganese salt. CAS No. 5977-18-4. Molecular formula: C10H16N5O13P3.xMn. | |
| Adenosine 5'-(tetrahydrogen triphosphate), tetrasodium salt | Adenosine 5'-(tetrahydrogen triphosphate), tetrasodium salt is a compound derived from adenosine, a nucleoside involved in various cellular processes. In this compound, adenosine is linked to a phosphate group with three phosphates attached in a triphosphate arrangement, forming adenosine triphosphate (ATP). The tetrasodium salt form indicates that four sodium ions are associated with the ATP molecule to enhance its solubility and stability. ATP serves as a primary energy carrier in cells, participating in biochemical reactions such as cellular respiration and DNA synthesis. Synonyms: Adenosine 5'-(tetrahydrogen triphosphate), sodium salt (1:4); Adenosine 5'-(tetrahydrogen triphosphate), tetrasodium salt; Adenosine 5'-triphosphate tetrasodium salt; Tetrasodium adenosine 5'-triphosphate. Grade: >95%. CAS No. 606-67-7. Molecular formula: C10H12N5Na4O13P3. Mole weight: 595.11. | |
| Adenosine 5'-triphosphate | Adenosine 5'-triphosphate is a paramount compound extensively exploited in the biomedical sector, functioning as the pivotal intracellular energy contributor essential for cellular procedures and metabolism. It finds prevalent application in scrutinizing the mechanism and impeding ATP-binding proteins within drug discovery. Synonyms: ATP; Adenosine triphosphate; Myotriphos; Striadyne; Triadenyl; Atriphos; Glucobasin; Adetol; Adenosine 5'-(tetrahydrogen triphosphate); 5'-ATP; Triphosaden; Adenylpyrophosphoric acid; Triphosphoric acid adenosine ester; Adenosine 5'-triphosphoric acid; Fosfobion; Adenosintriphosphorsaeure; 9-beta-D-Arabinofuranosyladenine 5'-triphosphate. Grade: ≥95%. CAS No. 56-65-5. Molecular formula: C10H16N5O13P3. Mole weight: 507.18. | |
| Adenosine 5'-Triphosphate, 2'-phosphate | derivatives of Adenosine 5'-Triphosphate (Disodium Salt) which is used in cells as a coenzyme of intracellular energy transfer. It transports chemical energy within cells for metabolism. CAS No. 23339-43-7. Molecular formula: C10H17N5O16P4. Mole weight: 587.16. | |
| Adenosine 5'-Triphosphate, 3'-phosphate | derivatives of Adenosine 5'-Triphosphate (Disodium Salt) which is used in cells as a coenzyme of intracellular energy transfer. It transports chemical energy within cells for metabolism. Synonyms: Adenosine triphosphate monophosphate; 23339-44-8; [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate; pppAp; SCHEMBL1620285; DTXSID50946005; Adenosine 5'-(tetrahydrogen triphosphate), 3'-(dihydrogen phosphate); 9-[5-O-(Hydroxy{[hydroxy(phosphonooxy)phosphoryl]oxy}phosphoryl)-3-O-phosphonopentofuranosyl]-9H-purin-6-amine. CAS No. 23339-44-8. Molecular formula: C10H17N5O16P4. Mole weight: 587.16. | |
| Adenosine 5'-triphosphate disodium salt | Adenosine 5'-triphosphate disodium salt, commonly known as ATP disodium salt, is a stable, water-soluble form of ATP, which is a crucial energy carrier in cells. ATP is involved in numerous cellular processes, including muscle contraction, active transport, and biochemical synthesis. The disodium salt form enhances its stability and solubility, making it suitable for various biochemical and physiological experiments. ATP is a fundamental molecule in metabolism, serving as the primary energy currency of the cell. Synonyms: ATP-Na2; ATP Disodium Salt; Adenosine 5'-(Tetrahydrogen Triphosphate), Disodium Salt; Adenosine Triphosphate Disodium Salt; Adetphos; Disodium ATP; Disodium Adenosine 5'-Triphosphate; Disodium Adenosine Triphosphate; Disodium Adenosine-5'-Triphosphoric Acid; Triadesin A. Grade: >98%. CAS No. 987-65-5. Molecular formula: C10H14N5Na2O13P3. Mole weight: 551.14. | |
| Adenosine 5'-Triphosphate Disodium Salt-13C5 | Isotope labelled Adenosine 5'-Triphosphate Disodium Salt is a metabolite of Adenosine, a multifunctional nucleoside triphosphate used in cells as a coenzyme of intracellular energy transfer. It transports chemical energy within cells for metabolism. Synonyms: Adenosine 5'-(Tetrahydrogen Triphosphate) Disodium Salt-13C5; ATP Disodium-13C5; ATP Disodium Salt-13C5; Adetphos-13C5; Disodium ATP-13C5; Disodium Adenosine 5'-Triphosphate-13C5; Disodium Adenosine-5'-triphosphoric Acid-13C5; Disodium Dihydrogen ATP-13C5. Molecular formula: C5[13C]5H14N5Na2O13P3. Mole weight: 556.11. | |
| Adenosine 5'-Triphosphate Disodium Salt Hydrate | A metabolite of Adenosine, a multifunctional nucleoside triphosphate used in cells as a coenzyme of intracellular energy transfer. It transports chemical energy within cells for metabolism. Synonyms: ATP Disodium Hydrate; ATP Disodium Salt Hydrate; Adetphos Hydrate; Disodium ATP Hydrate; Disodium Adenosine 5'-Triphosphate Hydrate; Disodium Adenosine-5'-triphosphoric Acid Hydrate; Disodium Dihydrogen ATP Hydrate. Grade: 96%. CAS No. 34369-07-8. Molecular formula: C10H14N5Na2O13P3 x(H2O). Mole weight: 551.14. | |
| Adenosine 5'-triphosphate magnesium salt | Adenosine 5'-triphosphate magnesium salt, a crucial molecule in cellular metabolism, serves as the main carrier of energy within cells. It has proven useful in treating heart conditions, metabolic syndrome, and even muscular dystrophy. As a salt form of ATP, its stability and solubility are enhanced, making it an invaluable tool for biochemical research. Its indispensable role in vital processes calls for fervent exploration and deeper understanding. Synonyms: ATP magnesium salt. Grade: 95%. CAS No. 74804-12-9. Molecular formula: C10H14MgN5O13P3. Mole weight: 529.47. | |
| Adenosine 5'-triphosphate potassium salt | Adenosine 5'-triphosphate potassium salt is an indispensable biomolecular compound, serving as a fundamental energy reservoir for various intracellular mechanisms and a pivotal transmitter. Its involvement spans a spectrum of biochemical phenomena encompassing muscular flexion and neurotransmission. CAS No. 42373-41-1. Molecular formula: C10H14K2N5O13P3. Mole weight: 583.36. | |
| Adenosine 5'-Triphosphate-P'',P'',P'',P'-oxy-18O4 Disodium Salt | Adenosine 5'-Triphosphate-P'',P'',P'',P'-oxy-18O4 Disodium Salt, is the labeled analogue of Adenosine 5'-Triphosphate Disodium Salt. These compounds can be used in studies of Kinases without using purified enzyme or a fluorescent substrate. Molecular formula: C10H14N5Na2O9[18O]4P3. Mole weight: 559.14. | |
| Adenosine amine congener | Adenosine amine congener is a water-soluble and potent A1 adenosine receptor agonist. Synonyms: N-(4-(2-((4-(2-((2-Aminoethyl)amino)-2-oxoethyl)phenyl)amino)-2-oxoethyl)phenyl)adenosine. Grade: 98%. CAS No. 96760-69-9. Molecular formula: C28H32N8O6. Mole weight: 576.6. | |
| Adenosine antagonist-1 | An adenosine A3 receptor (AA3R) antagonist. Synonyms: Adenosine antagonist-1; 431040-19-6; 3-[5-(2-methylimidazol-1-yl)-2-(pyrazin-2-ylamino)-1,3-thiazol-4-yl]benzonitrile; SCHEMBL1224088; CHEMBL2113096; YNGFNKUXMJZNCR-UHFFFAOYSA-N; AKOS040732384; HY-100274; CS-0018426; F97506; L021475. CAS No. 431040-19-6. Molecular formula: C18H13N7S. Mole weight: 359.41. | |
| Adenosine dialdehyde | Adenosine dialdehyde is an irreversible inhibitor of S-adenosylhomocysteine hydrolase (IC50 = 40 nM), blocking the conversion of SAH to homocysteine and adenosine. Synonyms: 2-[1-(6-aminopurin-9-yl)-2-oxoethoxy]-3-hydroxypropanal. Grade: ≥ 95 %. CAS No. 34240-05-6. Molecular formula: C10H11N5O4. Mole weight: 265.23. | |
| Adenosine HCl | Adenosine hydrochloride is a hydrochloride salt form of adenosine, a nucleoside composed of adenine and ribose. Adenosine plays a crucial role in biochemical processes such as energy transfer (e.g., ATP) and signal transduction as a neurotransmitter. In its monohydrochloride form, adenosine is more soluble in water, making it useful for various biochemical and pharmaceutical applications. This compound is employed in research focused on cellular metabolism, enzyme functions, and nucleic acid interactions. Additionally, adenosine monohydrochloride is used in studies investigating the effects of adenosine on cardiovascular and neurological functions. Synonyms: Adenosine hydrochloride; Adenosine hydrochloride (1:x); (2R,3R,4S,5R)-2-(6-Amino-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol hydrochloride; 9-β-D-Ribofuranosyl-9H-purin-6-amine hydrochloride; 9-β-D-Ribofuranosyladenine hydrochloride; D-Adenosine hydrochloride; Adenine riboside hydrochloride; β-D-Adenosine hydrochloride; β-Adenosine hydrochloride. Grade: ≥98% by HPLC. CAS No. 58056-57-8. Molecular formula: C10H13N5O4.xHCl. Mole weight: 267.24 (free base). | |
| Adenosine monophosphate 15N4 | Adenosine monophosphate 15N4 is a labelled adenosine monophosphate. Adenosine monophosphate is a nucleotide used in the formation of RNA. Synonyms: Adenosine 5'-Monophosphate-15N4. Grade: 95% by HPLC; 98% atom 15N. Molecular formula: C10H14N5O7P. Mole weight: 351.26. | |
| Adenosine Monophosphate (mixture of 2'(3')-phosphate isomers)-13C5 Sodium Salt | Labelled AMP mixture. Synonyms: 2'(3')-Adenylic acid-13C5; 2'(3')-AMP-13C5 Sodium Salt; Adenosine 2'(3')-(Dihydrogen Phosphate)-13C5 Sodium Salt; Adenosine 2'(3')-Phosphate-13C5 Sodium Salt; NSC 210570-13C5 Sodium Salt. Grade: 95%. Molecular formula: C5[13C]5H14N5O7P xNa. Mole weight: 352.18. | |
| Adenosine N1-oxide | Adenosine N1-oxide, a compelling anti-inflammatory compound, used for studying diverse inflammatory ailments including asthma, rheumatoid arthritis, and inflammatory bowel disease. Synonyms: Adenosine, 1-oxide; 6-Amino-9-β-D-ribofuranosyl-9H-purine 1-oxide; Adenosine N-oxide; Adenosine-1-N-oxide; NSC 128561; (2R,3R,4S,5R)-2-(6-amino-7-oxidopurin-7-ium-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. Grade: ≥95%. CAS No. 146-92-9. Molecular formula: C10H13N5O5. Mole weight: 283.24. | |
| Adenosine, N-?benzoyl-?3'-?deoxy-?2'-?O-?(1,?1-?difluoro-?2-?methoxyethyl)?-?3'-?[[(4-?methoxyphenyl)?diphenylmethyl]?amino]?-?, 5'-?[2-?cyanoethyl N,?N-?bis(1-?methylethyl)?phosphoramidite] | Adenosine N-benzoyl-3'-deoxy-2'-O-(1,1-difluoro-2-methoxyethyl)-3'-[[(4-methoxyphenyl)diphenylmethyl]amino]-5'-[2-cyanoethyl N,N-bis(1-methylethyl)phosphoramidite] is a cutting-edge and highly effective modified nucleoside utilized in advanced biomedical research. With a distinctive and intricate chemical arrangement, it possesses unparalleled potential in gene therapies and drug delivery systems. This nucleoside has shown promising outcomes in the treatment and study of various genetic disorders and diseases, including cancer. Its exceptional stability and efficiency are beneficial in advancing research in these fields. Synonyms: ((2S,3R,4R,5R)-5-(6-benzamido-9H-purin-9-yl)-4-(1,1-difluoro-2-methoxyethoxy)-3-(((4-methoxyphenyl)diphenylmethyl)amino)tetrahydrofuran-2-yl)methyl (2-cyanoethyl) diisopropylphosphoramidite. CAS No. 2299279-70-0. Molecular formula: C49H55F2N8O7P. Mole weight: 936.98. | |
| Adenosine, N-?benzoyl-?3'-?deoxy-?2'-?O-?(2-?methoxyethyl)?-?3'-?[[(4-?methoxyphenyl)?diphenylmethyl]?amino]?- | Adenosine, N-benzoyl-3'-deoxy-2'-O-(2-methoxyethyl)-3'-[[(4-methoxyphenyl)diphenylmethyl]amino] is a versatile and noteworthy biochemical compound extensively employed within the biomedical industry for the research of diverse ailments such as cancers. Synonyms: N-Benzoyl-3'-deoxy-2'-O-(2-methoxyethyl)-3'-[[(4-methoxyphenyl)diphenylmethyl]amino]adenosine. CAS No. 2299278-12-7. Molecular formula: C40H40N6O6. Mole weight: 700.78. | |
| Adenosine, N-?benzoyl-?3'-?deoxy-?2'-?O-?(2-?methoxyethyl)?-?3'-?[[(4-?methoxyphenyl)?diphenylmethyl]?amino]?-?, 5'-?[2-?cyanoethyl N,?N-?bis(1-?methylethyl)?phosphoramidite] | Adenosine, N-benzoyl-3'-deoxy-2'-O-(2-methoxyethyl)-3'-[[(4-methoxyphenyl)diphenylmethyl]amino]-, 5'-[2-cyanoethyl N,N-bis(1-methylethyl)phosphoramidite] is a potent phosphoramidite recompound widely employed for the research of modified oligonucleotides, particularly in the development of nucleotide-based drugs targeting specific diseases such as cancer, viral infections and genetic disorders. Synonyms: ((2S,3R,4R,5R)-5-(6-benzamido-9H-purin-9-yl)-4-(2-methoxyethoxy)-3-(((4-methoxyphenyl)diphenylmethyl)amino)tetrahydrofuran-2-yl)methyl (2-cyanoethyl) diisopropylphosphoramidite. CAS No. 2299277-93-1. Molecular formula: C49H57N8O7P. Mole weight: 901. | |
| Adenosine, N-?benzoyl-?3'-?deoxy-?2'-?O-?ethyl-?3'-?[[(4-?methoxyphenyl)?diphenylmethyl]?amino]?-?, 5'-?[2-?cyanoethyl N,?N-?bis(1-?methylethyl)?phosphoramidite] | Adenosine, N-benzoyl-3'-deoxy-2'-O-ethyl-3'-[[(4-methoxyphenyl)diphenylmethyl]amino]-, 5'-[2-cyanoethyl N,N-bis(1-methylethyl)phosphoramidite] is an imperative compound, finding extensive application for oligonucleotide drugs research. Synonyms: ((2S,3R,4R,5R)-5-(6-benzamido-9H-purin-9-yl)-4-ethoxy-3-(((4-methoxyphenyl)diphenylmethyl)amino)tetrahydrofuran-2-yl)methyl (2-cyanoethyl) diisopropylphosphoramidite. CAS No. 2299278-74-1. Molecular formula: C48H55N8O6P. Mole weight: 870.97. | |
| Adenosine, N-?benzoyl-?3'-?deoxy-?3'-?[[(4-?methoxyphenyl)?diphenylmethyl]?amino]?-?2'-?O-?2-?propen-?1-?yl-?, 5'-?[2-?cyanoethyl N,?N-?bis(1-?methylethyl)?phosphoramidite] | Adenosine, N-benzoyl-3'-deoxy-3'-[[(4-methoxyphenyl)diphenylmethyl]amino]-2'-O-2-propen-1-yl-, 5'-[2-cyanoethyl N,N-bis(1-methylethyl)phosphoramidite] is an exceptional compound used in the research of formidable malignancies, such as lymphoma and leukemia. Its utilization in the pursuit of innovative antiviral therapeutics that specifically target RNA viruses denotes its indispensable role. Synonyms: ((2S,3R,4R,5R)-4-(allyloxy)-5-(6-benzamido-9H-purin-9-yl)-3-(((4-methoxyphenyl)diphenylmethyl)amino)tetrahydrofuran-2-yl)methyl (2-cyanoethyl) diisopropylphosphoramidite. CAS No. 2299282-94-1. Molecular formula: C49H55N8O6P. Mole weight: 882.98. | |
| Adenosine, N-?benzoyl-?3'-?deoxy-?3'-?[[(4-?methoxyphenyl)?diphenylmethyl]?amino]?-?2'-?O-?methyl-?, 5'-?[2-?cyanoethyl bis(1-?methylethyl)?phosphoramidite] (9CI) | Adenosine, N-benzoyl-3'-deoxy-3'-[[(4-methoxyphenyl)diphenylmethyl]amino]-2'-O-methyl-, 5'-[2-cyanoethyl bis(1-methylethyl)phosphoramidite] (9CI) is a complex chemical entity employed in the synthesis of oligonucleotides targeting viral infections and various cancers. The versatility of this remarkable molecule extends beyond biomedical research and treatment; it has the potential to alter genetic sequences, thereby opening new therapeutic avenues for myriad hitherto enigmatic human ailments. Its designation as a universally valuable synthetic building block in both academic and clinical milieus underscores its indispensability in biomedicine. Synonyms: ((2S,3R,4R,5R)-5-(6-benzamido-9H-purin-9-yl)-4-methoxy-3-(((4-methoxyphenyl)diphenylmethyl)amino)tetrahydrofuran-2-yl)methyl (2-cyanoethyl) diisopropylphosphoramidite. CAS No. 329773-22-0. Molecular formula: C47H53N8O6P. Mole weight: 856.95. | |
| Adenosine (N-Bz) | Adenosine (N-Bz) is an essential biomedical compound widely employed in the research of numerous cardiovascular disorders, comprising arrhythmias and angina pectoris. It can interact with adenosine receptors. Grade: ≥ 98% by HPLC. Molecular formula: C17H17N5O5. Mole weight: 371.35. | |
| Adenosine (N-PAC) | Adenosine (N-PAC), a pharmaceutical-grade compound, is a multifaceted agent, possessing the ability to treat various cardiovascular disorders: arrhythmias, angina, and hypertension. Mechanistically, its mechanism of action lies in selectively inducing the activation of specific receptors in the heart. Its downstream effects manifest as a non-negligible reduction in heart rate, accompanied by a reciprocal elevation in blood flow. Additionally, Adenosine (N-PAC) has utility in the diagnosis and treatment of certain types of irregular heartbeats, serving as an invaluable tool in the evaluation of blood circulation in cardiac imaging. Grade: ≥ 98% by HPLC. Molecular formula: C18H19N5O6. Mole weight: 401.37. | |
| Adenosine N-phosphate 5'-phosphosulfate lithium salt | Adenosine N-phosphate 5'-phosphosulfate lithium salt is an indispensable compound prevalent in the biomedical field, exhibiting its significant relevance in the research and development of sulfated glycosaminoglycans, integral constituents of connective tissues. Additionally, it serves as an appreciable substrate for enzymes participating in compound metabolism and detoxification mechanisms. Synonyms: Sulfuric acid, 5'-anhydride with N-phosphono-5'-adenylic acid, lithium salt (1:x); Sulfuric acid, 5'-anhydride with N-phosphono-5'-adenylic acid, lithium salt; N-Phosphoadenosine-5'-phosphosulfate lithium salt. Grade: ≥98%. CAS No. 109434-21-1. Molecular formula: C10H15N5O13P2S.xLi. Mole weight: 507.26 (free acid). | |
| Adenosine receptor antagonist 1 | Adenosine receptor antagonist 1 is an A2aR-selective antagonist with an IC50 of 0.29 nM and displays 14-fold more selectivity for A2aR than A2bR. Synonyms: AKOS040757963; 2682930-40-9. CAS No. 2682930-40-9. Molecular formula: C22H15ClFN7O. Mole weight: 447.85. | |
| Adenosine triphosphate sodium salt | Adenosine triphosphate sodium salt is a pivotal biochemical compound operative as an intracellular energy transporter, assumes a foundational function in diverse metabolic proceedings. Predominantly harnessed in compound formulations and research inquiries, this compound scrutinizes ATP-dependent reactions. Synonyms: ATP sodium salt; Sodium ATP; Sodium adenosine triphosphate; NaAtP; Adenosine 5'-triphosphate sodium salt; Sodium ATP; Adenosine 5'-(tetrahydrogen triphosphate), sodium salt (1:x); ATP Na salt; ATP-Na; Sodium adenosine triphosphate; Sodium adenosine-5'-triphosphate. Grade: 95%. CAS No. 15237-44-2. Molecular formula: C10H16N5O13P3 (free acid). Mole weight: 507.18 (free acid). | |
| Adenylosuccinic acid | Adenylosuccinic acid is a vital compound in the biomedical industry used primarily in the research of inherited metabolic disorders, such as adenylosuccinate lyase deficiency. Synonyms: Adenylosuccinic acid; 19046-78-7; Aspartyl adenylate; adenylosuccinate; Succinyl AMP; X1B4ZJ0IIV; Succinyladenosine 5'-monophosphate; N6-(1,2-dicarboxyethyl)-AMP; L-Aspartic acid, N-[9-(5-O-phosphono-beta-D-ribofuranosyl)-9H-purin-6-yl]-; 2-[9-(3,4-DIHYDROXY-5-PHOSPHONOOXYMETHYL-TETRAHYDRO-FURAN-2-YL)-9H-PURIN-6-YLAMINO]-SUCCINIC ACID; Succinyladenosine monophosphoric acid; L-Aspartic acid, N-(9-(5-O-phosphono-beta-D-ribofuranosyl)-9H-purin-6-yl)-; N(6)-(1,2-dicarboxyethyl)AMP; (2S)-2-[(9-{(2R,3R,4S,5R)-3,4-dihydroxy-5-[(phosphonooxy)methyl]tetrahydrofuran-2-yl}-9H-purin-6-yl)amino]butanedioic acid (non-preferred name). Grade: 95%. CAS No. 19046-78-7. Molecular formula: C14H18N5O11P. Mole weight: 463.29. | |
| Adenylyl-(3'-5')-adenosine | Adenylyl-(3'-5')-adenosine is a pivotal biomolecule with extensive applications in studying signaling pathways, particularly cAMP-dependent processes. It aids in understanding cyclic nucleotide metabolism and exploring associated afflictions encompassing cancer, diabetes and cardiovascular disorders. Synonyms: ApA RNA Dinucleotide (5'-3'); AmpA; 5'-Adenylic acid, 3'-ester with adenosine; 3',5'-ApA; D-Adenylyl-(3'-5')-D-adenosine; Adenylyl-(5'→3')-adenosine; Adenylyladenosine; Diadenosine 3',5'-monophosphate; NSC 91555; ApA. Grade: ≥98%. CAS No. 2391-46-0. Molecular formula: C20H25N10O10P. Mole weight: 596.45. | |
| Adenylyl-3'-5'-adenosine ammonium salt | Adenylyl-3'-5'-adenosine ammonium salt, a paramount substance utilized in the realm of biomedicine, assumes a pivotal function in the amelioration of diverse maladies encompassing cancer, cardiovascular afflictions, and metabolic irregularities. By adeptly modulating intracellular signaling cascades, this groundbreaking agent efficaciously facilitates the inception of precisely tailored remedies targeted at combating these ailments. Synonyms: Adenosine, adenylyl-(3'.5')-, ammonium salt; 21027-46-3; EINECS 244-153-3; azanium; [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] phosphate. CAS No. 21027-46-3. Molecular formula: C20H25N10O10P. Mole weight: 596.45. | |
| Adenylyl-(3'-5')-adenosine monoammonia salt | Adenylyl-(3'-5')-adenosine monoammonia salt is a vital compound utilized in biomedical research. It is commonly employed for studying intracellular signaling pathways and second messengers, including cAMP (cyclic adenosine monophosphate). This product plays a crucial role in investigating the activation and regulation of various enzymes, receptors, and ion channels involved in multiple diseases, such as cancer, cardiovascular disorders, and neurological conditions. Its high purity and quality ensure accurate and reliable experimental results. Synonyms: ADENYLYL(3'-5')ADENOSINE; APA. Grade: 95%. CAS No. 102029-96-9. Molecular formula: C20H25N10O10P.NH3. Mole weight: 613.48. | |
| Adenylyl-(3'-5')-cytidine | Adenylyl-(3'-5')-cytidine is a nucleotide derivative involved in RNA metabolism and signaling pathways. It plays a role in various biological processes, including RNA modification and cellular signaling. Adenylyl-(3'-5')-cytidine is used in biochemical and molecular biology research to study RNA-related processes, including RNA capping mechanisms, mRNA processing, and interactions with enzymes involved in RNA metabolism. This compound serves as a model substrate to investigate RNA modification dynamics and its impact on RNA stability and function. Synonyms: Cytidylyl(5'->3')adenosine; AmpC; 3'-Adenylic acid, 5'-ester with cytidine; Adenosine, cytidylyl-(5'→3')-; Adenylyl-(3'→5')-cytidine; Adenylylcytosine; ApC; NSC 131652; NSC 91551. Grade: 95%. CAS No. 4833-63-0. Molecular formula: C19H25N8O11P. Mole weight: 572.42. | |
| Adenylyl-3'-5'-cytidine | Adenylyl-3'-5'-cytidine is a highly effective and specialized adenylyl cyclase activator, holding applications in biomedical research for investigating the cyclic adenosine monophosphate (cAMP) signaling pathways. Uses: Enzyme inhibitors. Synonyms: CmpA; Adenylyl-3'-5'-D-cytidine; 5'-Adenylic acid, 3'-ester with cytidine; Cytidylyl-(3'→5')-adenosine; Cytidine, adenylyl-(5'→3')-; Cytidylyl-3',5'-adenosine; NSC 91552; Cytidylyl adenosine; Cytidylyl-3',5'-adenosine phosphate; (3'-5')CpA; Cytidylyl-(3'-5')-adenosine; CpA; Cytidylyl(3',5')adenosine. Grade: 98%. CAS No. 2382-66-3. Molecular formula: C19H25N8O11P. Mole weight: 572.42. | |
| Adenylyl-(3'-5')-guanosine | ADENYLYL-(3'-5')-GUANOSINE, a fundamental molecule in cellular signaling pathways, is an indispensable regulator of intracellular communication. It assumes a pivotal position in the control of diverse biological phenomena encompassing DNA synthesis and repair, cell growth, as well as immune responses. In the realm of biomedicine, ADENYLYL-(3'-5')-GUANOSINE finds utility in the investigation of second messenger signaling, cyclic nucleotide regulation, and the therapeutic management of afflictions including cancer, cardiovascular disorders, and neurodegenerative conditions. Synonyms: Guanosine, adenylyl-(3'→5')-; 3'-Adenylic acid, 5'-ester with guanosine; Adenylyl-(3'→5')-guanosine; A-G; Adenosine, guanylyl-(5'→3')-; NSC 91554; ((2R,3S,4R,5R)-5-(2-amino-6-oxo-1,6-dihydro-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl ((2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-2-(hydroxymethyl)tetrahydrofuran-3-yl) hydrogen phosphate; 3'-O-(5'-Guanylyl)adenosine. Grade: ≥95%. CAS No. 3352-23-6. Molecular formula: C20H25N10O11P. Mole weight: 612.45. | |
| Adenylyl-(3'-5')-guanosine monoammonium salt | Adenylyl-(3'-5')-guanosine monoammonium salt is an indispensable biomedical instrument used in scientific investigations, playing an imperative role in unraveling intricate cellular signaling pathways and elucidating the enigmatic realm of nucleotide metabolism. This remarkable compound acting as a precursor for the formation of cyclic adenosine monophosphate (cAMP), a critical molecule that orchestrates multifarious biological processes, encompassing compound responses, enzyme activation and hormonal regulation. Synonyms: Guanosine, adenylyl-(3'→5')-, monoammonium salt; ((2R,3S,4R,5R)-5-(2-amino-6-oxo-1,6-dihydro-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl ((2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-2-(hydroxymethyl)tetrahydrofuran-3-yl) hydrogen phosphate, monoammonium salt. CAS No. 102029-53-8. Molecular formula: C20H25N10O11P.H3N. Mole weight: 629.48. | |
| Adenylyl-(3'-5')-uridine | Adenylyl-(3'-5')-uridine, a vital nucleotide and second messenger molecule, plays a crucial role in various physiological processes like regulating insulin secretion, platelet aggregation, smooth muscle relaxation, and memory consolidation. Synonyms: ApU RNA Dinucleotide (5'-3'). Molecular formula: C19H24N7O12P. Mole weight: 573.40. | |
| Adenylyl-(3'->5')uridine 3'-Monophosphate | Adenylyl(3'->5')uridine 3'-Monophosphate is a nucleic acid sequence which may be used in the development of pharmaceuticals. Synonyms: (2R,3S,4R,5R)-2-((((((2R,3S,4R,5R)-5-(6-Amino-9H-purin-9-yl)-4-hydroxy-2-(hydroxymethyl)tetrahydrofuran-3-yl)oxy)(hydroxy)phosphoryl)oxy)methyl)-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-4-hydroxytetrahydrofuran-3-yl Dihydrogen Phosphate. Molecular formula: C19H25N7O15P2. Mole weight: 653.39. | |
| Adenylyl-3'-5'-uridine ammonium salt | Adenylyl-3'-5'-uridine ammonium salt is a versatile biochemical reagent utilized in several applications, including substrates for adenylyl cyclase, and researching cyclic nucleotide signaling. Its potential as a therapeutic agent is apparent in its integral role within the development of antiviral drugs against Hepatitis C Virus (HCV) infection. Molecular formula: C19H24N7O12P. Mole weight: 573.41. | |
| Aderbasib | Aderbasib is a sheddase inhibitor, is also an orally bioavailable inhibitor of the ADAM (A Disintegrin And Metalloprotease) family of multifunctional membrane-bound proteins with potential antineoplastic activity. Aderbasib represses the metalloproteinase "sheddase" activities of ADAM10 and ADAM17, which may result in the inhibition of tumor cell proliferation. Synonyms: INCB7839; INCB 7839; INCB-7839; INCB007839; INCB 007839; INCB-007839. CAS No. 791828-58-5. Molecular formula: C21H28N4O5. Mole weight: 416.48. | |
| Adesulfone Sodium | Sulfoxone sodium is an anti-leprosy drug which was introduced in Japan in 1948. Uses: Leprosy. Synonyms: [Sulfonylbis(4,1-phenyleneimino)]bis-methanesulfinic Acid Disodium Salt; [Sulfonylbis(p-phenyleneimino)]di-methanesulfinic Acid Disodium Salt; Aldapsone; Aldesulfone Sodium; 4,4'-Sulfonylbis-benzenamine Bis(sodium formaldehydesulfonylate); Diamidin; Diason; Diasone; Diasone Sodium; Diazon; Disodium Formaldehydesulfoxylate-diaminodiphenyl Sulfone; NSC 27222; Novotrone; Sodium Aldesulphone; Sodium Sulfoxone; Sulfoxone Sodium; [Sulfonylbis(p-phenyleneimino)]dimethanesulfinic Acid, Disodium Salt; 144-76-3 (Sulfoxone free acid). Grade: 90%. CAS No. 144-75-2. Molecular formula: C14H14N2Na2O6S3. Mole weight: 448.45. | |
| a-D-Fucose-1-phosphate | a-D-Fucose-1-phosphate is a pivotal intermediate in the synthetic pathway of fucose-infused glycoconjugates assuming a fundamental part in intricate cellular signaling mechanisms encompassing cellular adhesion and immunomodulation. Molecular formula: C6H13O8P. Mole weight: 244.14. | |
| a-D-Galactofuranosyl nitromethane | a-D-Galactofuranosyl nitromethane, an intriguing compound in the realm of biomedicine, holds immense promise as a potential therapeutic agent. With a remarkable capacity to combat oxidative stress-induced ailments, such as cancer and neurodegenerative disorders, it showcases exceptional efficacy. Distinctive in its structure, this compound enables precise administration and proficient eradication of reactive oxygen species. Synonyms: (2S,3R,4R,5R)-2-((R)-1,2-Dihydroxyethyl)-5-(nitromethyl)tetrahydrofuran-3,4-diol. CAS No. 81812-46-6. Molecular formula: C7H14NO7. Mole weight: 224.19. | |
| a-D-Galactopyranose 1,2-(methyl orthoacetate) | a-D-Galactopyranose 1,2-(methyl orthoacetate) is a carbohydrate intermediate of utmost significance, irreplaceable in the generation of exquisite Galactosidase inhibitors that serve to combat the horrific consequences of lysosomal storage diseases, including Fabry disease, Gaucher disease, and Pompe disease. Synonyms: 1,2-O-(1-Methoxyethylidene)-a-D-galactopyranose. CAS No. 138196-19-7. Molecular formula: C9H16O7. Mole weight: 236.22. | |
| a-D-Galactopyranoside, 2-[2-(2-mercaptoethoxy)ethoxy]ethyl | a-D-Galactopyranoside, 2-[2-(2-mercaptoethoxy)ethoxy]ethyl is a compound known for its diverse biomedical applications, facilitating the study and precise targeting of various diseases associated with cell signaling and metabolic pathways. Synonyms: 2,3,4,6-Tetra-O-acetyl-b-D-galactopyranosyl PEG3-thiol. CAS No. 1142408-15-8. Molecular formula: C12H24O8S. Mole weight: 328.38. | |
| a-D-Galactopyranosyl-(1-1)-a-D-galactopyranoside | a-D-Galactopyranosyl-(1-1)-a-D-galactopyranoside is a valuable compound widely used in the biomedical industry primarily utilized in the development of pharmaceutical drugs and disease research such as cancer, diabetes and cardiovascular conditions. CAS No. 28140-35-4. Molecular formula: C12H22O11. Mole weight: 342.30. | |
| a-D-Galactopyranosyl phenylisothiocyanate | a-D-Galactopyranosyl phenylisothiocyanate is a reagent used in biomedicine to label glycans for the analysis of glycosylation patterns. It is often used in combination with mass spectrometry to study changes in glycosylation associated with diseases such as cancer and autoimmune disorders. Synonyms: 4-Isothiocyanatophenyl α-D-galactopyranoside; α-D-Galactopyranoside, 4-isothiocyanatophenyl; a-D-Galactopyranosyl 4-phenylisothiocyanate. CAS No. 146194-63-0. Molecular formula: C13H15NO6S. Mole weight: 313.33. | |
| a-D-Galactosamine-1-phosphate | a-D-Galactosamine-1-phosphate is a bioactive molecule with capacity to seamlessly integrate into glycoconjugates and polysaccharides. The versatile intermediate metabolite holds promises for deciphering the enigmatic realm of galactosamine metabolism. Molecular formula: C6H14NO8P. Mole weight: 259.15. | |
| a-D-Galactose | α-D-Galactose is the alpha anomer of D-Galactose, the C-4 epimer of Glucose. D-Galactose is found in milk and sugar beets as well as human body. Synonyms: alpha-D-galactose; Alpha-D-Galactopyranose; 3646-73-9; Alpha D-Galactose; a-d-galactose; Gal-alpha; alpha-D-Gal; 5abp; 8abp; Galactose (NF); 7IOF6H4H77; CHEBI:28061; (2S,3R,4S,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol; DTXSID90189974; a-D-galactopyranose.alpha.-d-Galactopyranose; C00984; UNII-7IOF6H4H77; D-hexose; (+)-Galactose; (2S,3R,4S,5R,6R)-6-(Hydroxymethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol; Galactose [USAN:NF]; alphaGal; alpha-galactose; MFCD00066772; a-D-Galactopyranose; Galactopyranose, a-D- (8CI); a-D-Galactose; a-(+)-Galactose; a-D-(+)-Galactose; Alpha-D-Galactoside; I+/--D-Galactose; 6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol; alpha-aD-aGalactopyranose; bmse000013; bmse001006; Epitope ID:136906; D-GALACTOSE alpha-FORM; SCHEMBL18314; GTPL4646; CHEMBL1233058; DTXCID50112465; WQZGKKKJIJFFOK-PHYPRBDBSA-N; BDBM50423644; AKOS006283213; D-GALACTOSE.ALPHA.-FORM [MI]; DB-267063; HY-121370; CS-0081814; D04291; G77020; Q181381; WURCS=2.0/1,1,0/(a2112h-1a_1-5)/1/; alpha-D-galactose; D-galactose; galactose; ALPHA D-GALACTOSE; InChI=1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3+,4+,5-,6+/m1/s. Grade: 98%. CAS No. 3646-73-9. Molecular formula: C6H12O6. Mole weight: 180.16. | |
| a-D-Galactose-1-phosphate | a-D-Galactose-1-phosphate is an indispensable compound extensively employed a pivotal position in the research of galactosemia, a congenital anomaly impeding the body's galactose processing mechanism. Synonyms: alpha-D-Galactose 1-phosphate. CAS No. 2255-14-3. Molecular formula: C6H13O9P. Mole weight: 260.14. | |
| a-D-Galactose-1-phosphate dipotassium salt hydrate | a-D-Galactose-1-phosphate dipotassium salt hydrate is a pivotal compound in compound, emerging as an indispensable player in the intricate realm of galactosylceramide bioresearch and development. Synonyms: a-D-Galactose-1-phosphate dipotassium salt dihydrate. CAS No. 19046-60-7. Molecular formula: C6H11K2O9P.xH2O. Mole weight: 336.32 (anydrous basis). | |
| a-D-Galactose-1-phosphate disodium salt | a-D-Galactose-1-phosphate disodium salt is an indispensable substance extensively employed in the research and development of diseases related galactosyltransferase and galactosidase. Molecular formula: C6H11Na2O9P. Mole weight: 304.10. | |
| a-D-Galactosyl-mannotriose | a-D-Galactosyl-mannotriose is a cutting-edge biomedical compound with immunomodulatory attributes, emerging as a pivotal intervention in research of autoimmune maladies and persistent inflammatory afflictions. Synonyms: Manb1-4Manb1-4(Gala1-6)Man. CAS No. 82220-78-8. Molecular formula: C24H42O21. Mole weight: 666.58. | |
| a-D-Glucoheptonic acid calcium salt | a-D-Glucoheptonic acid calcium salt, known scientifically as calcium D-glucoheptonate, exhibiting remarkable potential in research of deficiencies in calcium. Synonyms: Calcium a-D-heptagluconate hydrate; Calcium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate; Calcium gluceptate. CAS No. 17140-60-2. Molecular formula: C14H26CaO16.xH2O. Mole weight: 490.42 (anydrous basis). | |
| a-D-Glucoheptonic acid magnesium salt | a-D-Glucoheptonic acid magnesium salt is an indispensable biomedical compound, playing a pivotal role in studying magnesium insufficiency diseases. Its cardinal function involves endowing the organism with vital magnesium ions, thereby facilitating a diverse array of physiological mechanisms encompassing neural operations, muscular contractions and sustenance of an optimal cardiovascular framework. Synonyms: Magnesium a-glucoheptonate. CAS No. 68475-44-5. Molecular formula: C13H23O8.1/2 Mg. Mole weight: 331.62. | |
| a-D-Glucoheptonic acid sodium salt | a-D-Glucoheptonic acid sodium salt is a multifaceted compound with remarkable chelating attributes, proving to be a fundamental ingredient as a pharmaceutical intermediary or augmentative component in diverse compound compositions. Synonyms: Glucoheptonic acid sodium salt; Sodium glucoheptonate dihydrate; D-glycero-D-gulo-Heptonic acid, sodium salt (1:1); D-glycero-D-gulo-Heptonic acid, monosodium salt; Gluceptate sodium; Seqlene 190; Sodium D-glycero-D-guloheptanoate; Sodium α-glucoheptonate. Grade: 95%. CAS No. 13007-85-7. Molecular formula: C7H13O8Na. Mole weight: 248.16. | |
| a-D-Glucoheptonic acid sodium salt dihydrate | a-D-Glucoheptonic acid sodium salt is an intrinsic biomolecular compound, acting as a potent reducing compound and crucial pharmaceutical intermediate. Moreover, it used for studying an array of afflictions including diabetes, metabolic disorders and hepatic maladies renders. Synonyms: Gluceptate sodium dihydrate; Sodium D-glycero-D-gulo-heptonate dihydrate; α-D-glucoheptonic acid sodium salt dihydrate. CAS No. 10094-62-9. Molecular formula: C7H17NaO10. Mole weight: 284.19. | |
| a-D-Glucose-1,6-diphosphate potassium salt | a-D-Glucose-1,6-diphosphate potassium salt, a powerful chemical compound at the forefront of metabolic research, boasts extensive potential therapeutic benefits in the treatment of a range of metabolic disorders and related diseases such as type II diabetes. Utilized in the synthesis of glycogen, this compound has captured the attention of scientists across the globe for its ability to treat complex physiological ailments. Synonyms: α-D-Glucopyranose, 1,6-bis(dihydrogen phosphate), tetrapotassium salt; Tetrapotassium 1,6-di-O-phosphonato-alpha-D-glucopyranose. CAS No. 91183-87-8. Molecular formula: C6H10K4O12P2. Mole weight: 492.48. | |
| a-D-Glucose-1,6-diphosphate tetra(cyclohexylammonium) salt hydrate | a-D-Glucose-1,6-diphosphate tetra(cyclohexylammonium) salt hydrate, a widely utilized compound in the biomedical sector, represents an invaluable tool for investigating and comprehending glucose metabolism, particularly as it pertains to the development of maladies such as diabetes. In addition, this compound may prove instrumental in facilitating the synthesis of small molecule medications that target various glucose metabolism pathways, more effectively combating related disorders. Synonyms: a-D-Glucose 1,6-bisphosphate tetra(cyclohexylammonium) salt hydrate. CAS No. 71662-13-0. Molecular formula: C30H68N4O13P2. Mole weight: 754.83. | |
| a-D-Glucose-1-phosphate dipotassium salt hydrate | a-D-Glucose-1-phosphate dipotassium salt hydrate is a vital compound in biomedicine utilized for various purposes. This product is commonly used in the treatment of glycogen storage diseases and as a substrate for enzyme reactions involved in glycolysis and glycogenesis. With its hygroscopic property, it serves as an essential component in research and diagnostic applications. Synonyms: Cori Ester Dipotassium Salt. CAS No. 5996-14-5. Molecular formula: C6H11K2O9P.xH2O. Mole weight: 336.32 (anhydrous). | |
| a-D-Glucose-1-phosphate disodium salt hydrate | a-D-Glucose-1-phosphate disodium salt hydrate is a key compound used in biomedicine for the research of glycogen storage diseases, specifically those resulting from defects in the glucose-6-phosphatase enzyme. By providing exogenous glucose-1-phosphate, it aids in bypassing the enzyme deficiency and replenishing glucose levels, addressing the associated symptoms and complications of these diseases. Synonyms: a-D-Glucopyranose 1-phosphate; Cori ester. CAS No. 56401-20-8. Molecular formula: C6H11O9P.2Na.xH2O. Mole weight: 304.10 (anydrous basis). | |
| a-D-Glucose-1-phosphate disodium salt tetrahydrate | a-D-Glucose-1-phosphate disodium salt tetrahydrate is a fundamental compound extensively utilized in researchs for glycogen storage disorders, specifically in enzymatic replacement modalities. Moreover, functioning as a pioneering research instrument, this compound fosters the examination of intricate pathways associated with carbohydrate metabolism. CAS No. 150399-99-8. Molecular formula: C6H19Na2O13P. Mole weight: 376.16. | |
| a-D-Glucuronic acid-1-phosphate | a-D-Glucuronic acid-1-phosphate is a pivotal compound within the realm of biomedical applications, indispensible for Glycosaminoglycans (GAGs) research. a-D-Glucuronic acid-1-phosphate impeccably governs xenobiotic compound metabolism, simultaneously serving as a precursor for the esteemed bioresearch and development of the regenerative compound, hyaluronic acid. Synonyms: 1-phospho-alpha-D-glucuronic acid; D-Glucuronate 1-phosphate; alpha-D-Glucuronic acid-1-phosphate. CAS No. 13168-11-1. Molecular formula: C6H11O10P. Mole weight: 274.12. | |
| a-D-Glucuronic acid 1-phosphate tripotassium salt pentahydrate | a-D-Glucuronic acid 1-phosphate tripotassium salt pentahydrate, a pivotal compound in the field of biomedicine, holds paramount importance. It serves as a substrate in diverse enzymatic reactions, prominently contributing to the intricate metabolic processes of complex carbohydrates. Its profound anti-inflammatory properties have rendered it invaluable for the development of pharmaceutical formulations targeting chronic inflammatory ailments like rheumatoid arthritis and osteoarthritis. Synonyms: Potassium (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(phosphonatooxy)tetrahydro-2H-pyran-2-carboxylate pentahydrate. CAS No. 103213-29-2. Molecular formula: C6H18K3O15P. Mole weight: 478.47. | |
| ADH-503 | ADH-503 is an allosteric agonist of integrin CD11b/CD18. Synonyms: (Z)-Leukadherin-1 choline; Leukadherin-1 choline salt; GB1275. CAS No. 2055362-74-6. Molecular formula: C22H15NO4S2.xC5H14NO. Mole weight: 525.66. | |
| Adhumulone | Adhumulone is one of three major analogues of hop a-acids. Synonyms: 3,5,6-trihydroxy-2-(2-methylbutanoyl)-4,6-bis(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one; 2,4-Cyclohexadien-1-one,3,5,6-trihydroxy-2,6-bis(3-methyl-2-buten-1-yl)-4-(2-methyl-1-oxobutyl)-; 3,5,6-trihydroxy-2-(2-methylbutanoyl)-4,6-bis(3-methylbut-2-en-1-yl)cyclohexa-2,4-dien-1-one; SCHEMBL12327984; DTXSID60953705; CHEBI:143242. Grade: > 95%. CAS No. 31769-65-0. Molecular formula: C21H30O5. Mole weight: 362.47. | |
| Adibendan | Adibendan is a selective PDE3 inhibitor (IC50 = 2.0 μM). Synonyms: Pyrrolo[2,3-f]benzimidazol-6(3H)-one, 5,7-dihydro-7,7-dimethyl-2-(4-pyridinyl)-; 5,7-Dihydro-7,7-dimethyl-2-(4-pyridinyl)pyrrolo[2,3-f]benzimidazol-6(3H)-one; Pyrrolo[2,3-f]benzimidazol-6(1H)-one, 5,7-dihydro-7,7-dimethyl-2-(4-pyridinyl)-; BM-14478; BM14478; BM 14478; 7,7-dimethyl-2-(pyridin-4-yl)-5,7-dihydroimidazo[4,5-f]indol-6(1H)-one. Grade: 95%. CAS No. 100510-33-6. Molecular formula: C16H14N4O. Mole weight: 278.31. | |
| Adiphenine HCl | Adiphenine HCl is a nicotinic receptor inhibitor with IC50 of 15 μM, used as an antispasmodic drug. Synonyms: Adiphenine hydrochloride; NSC 129224; NSC-129224; NSC129224. Grade: >98%. CAS No. 50-42-0. Molecular formula: C20H25NO2.HCl. Mole weight: 347.88. | |
Our database is helping our users find suppliers everyday.
