A directory of where to buy chemicals in the USA, including: distributors, industrial manufacturers, bulk supplies and wholesalers of raw ingredients & finished goods.
Search for products or services, then visit the suppliers website for prices or more information.
| Product | Description | |
|---|---|---|
| N-Fmoc-(2R,3R)-3-Amino-2-hydroxy-3-(2-methoxy-phenyl)-propionic acid | N-Fmoc-(2R,3R)-3-Amino-2-hydroxy-3-(2-methoxy-phenyl)-propionic acid. CAS No. 1217836-38-8. Molecular formula: C25H23NO6. Mole weight: 433.45. |  |
| N-Fmoc-(2R,3R)-3-Amino-2-hydroxy-3-(2-trifluoromethyl-phenyl)-propionic acid | N-Fmoc-(2R,3R)-3-Amino-2-hydroxy-3-(2-trifluoromethyl-phenyl)-propionic acid. CAS No. 1217682-40-0. Molecular formula: C25H20F3NO5. Mole weight: 471.43. | |
| N-Fmoc-(2R,3R)-3-Amino-2-hydroxy-3-(3,4-dimethoxy-phenyl)-propionic acid | N-Fmoc-(2R,3R)-3-Amino-2-hydroxy-3-(3,4-dimethoxy-phenyl)-propionic acid. CAS No. 1217840-66-8. Molecular formula: C26H25NO7. Mole weight: 463.48. | |
| N-Fmoc-(2R,3R)-3-Amino-2-hydroxy-3-(3-trifluoromethyl-phenyl)-propionic acid | N-Fmoc-(2R,3R)-3-Amino-2-hydroxy-3-(3-trifluoromethyl-phenyl)-propionic acid. CAS No. 1217817-77-0. Molecular formula: C25H20F3NO5. Mole weight: 471.43. | |
| N-Fmoc-(2R,3R)-3-Amino-2-hydroxy-3-(4-trifluoromethyl-phenyl)-propionic acid | N-Fmoc-(2R,3R)-3-Amino-2-hydroxy-3-(4-trifluoromethyl-phenyl)-propionic acid. Molecular formula: C25H20F3NO5. Mole weight: 471.4. | |
| N-Fmoc-(2R,3R)-3-Amino-2-hydroxy-3-m-tolyl-propionic acid | N-Fmoc-(2R,3R)-3-Amino-2-hydroxy-3-m-tolyl-propionic acid. CAS No. 1217663-73-4. Molecular formula: C25H23NO5. Mole weight: 417.45. | |
| N-Fmoc-(2R,3R)-3-Amino-2-hydroxy-3-o-tolyl-propionic acid | N-Fmoc-(2R,3R)-3-Amino-2-hydroxy-3-o-tolyl-propionic acid. CAS No. 1217724-38-3. Molecular formula: C25H23NO5. Mole weight: 417.45. | |
| N-Fmoc-(2R,3R)-3-Amino-2-hydroxy-3-p-tolyl-propionic acid | N-Fmoc-(2R,3R)-3-Amino-2-hydroxy-3-p-tolyl-propionic acid. CAS No. 1217669-56-1. Molecular formula: C25H23NO5. Mole weight: 417.45. | |
| N-Fmoc-(2R,3R)-3-Amino-2-hydroxy-4-phenyl-butyric acid | N-Fmoc-(2R,3R)-3-Amino-2-hydroxy-4-phenyl-butyric acid. CAS No. 1217715-67-7. Molecular formula: C25H23NO5. Mole weight: 417.45. | |
| N-Fmoc-(2R,3R)-3-Amino-3-(2-fluoro-phenyl)-2-hydroxy-propionic acid | N-Fmoc-(2R,3R)-3-Amino-3-(2-fluoro-phenyl)-2-hydroxy-propionic acid. CAS No. 1217828-02-8. Molecular formula: C24H20FNO5. Mole weight: 421.4. | |
| N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(2,3-dimethoxy-phenyl)-propanoic acid | N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(2,3-dimethoxy-phenyl)-propanoic acid. Synonyms: N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(2,3-dimethoxy-phenyl)-propionic acid. CAS No. 959579-76-1. Molecular formula: C26H25NO7. Mole weight: 463.48. | |
| N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(2-methoxy-phenyl)-propanoic acid | N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(2-methoxy-phenyl)-propanoic acid. Synonyms: N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(2-methoxy-phenyl)-propionic acid. CAS No. 959576-01-3. Molecular formula: C25H23NO6. Mole weight: 433.45. | |
| N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(2-trifluoromethyl-phenyl)-propanoic acid | N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(2-trifluoromethyl-phenyl)-propanoic acid. Synonyms: N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(2-trifluoromethyl-phenyl)-propionic acid. CAS No. 959575-82-7. Molecular formula: C25H20F3NO5. Mole weight: 471.43. | |
| N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(3,4-dimethoxy-phenyl)-propanoic acid | N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(3,4-dimethoxy-phenyl)-propanoic acid. Synonyms: N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(3,4-dimethoxy-phenyl)-propionic acid. CAS No. 959577-99-2. Molecular formula: C26H25NO7. Mole weight: 463.48. | |
| N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(3-methoxy-phenyl)-propanoic acid | N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(3-methoxy-phenyl)-propanoic acid. Synonyms: N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(3-methoxy-phenyl)-propionic acid. CAS No. 959576-00-2. Molecular formula: C25H23NO6. Mole weight: 433.45. | |
| N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(3-trifluoromethyl-phenyl)-propanoic acid | N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(3-trifluoromethyl-phenyl)-propanoic acid. Synonyms: N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(3-trifluoromethyl-phenyl)-propionic acid. CAS No. 959581-13-6. Molecular formula: C25H20F3NO5. Mole weight: 471.43. | |
| N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(4-methoxy-phenyl)-propanoic acid | N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(4-methoxy-phenyl)-propanoic acid. Synonyms: Fmoc-(2S,3S)-3-amino-2-hydroxy-3-(4-methoxyphenyl)propionic acid. Grade: ≥ 99% by HPLC. CAS No. 959576-95-5. Molecular formula: C25H23NO6. Mole weight: 433.45. | |
| N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(4-trifluoromethyl-phenyl)-propanoic acid | N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(4-trifluoromethyl-phenyl)-propanoic acid. Synonyms: N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-(4-trifluoromethyl-phenyl)-propionic acid. CAS No. 959574-18-6. Molecular formula: C25H20F3NO5. Mole weight: 471.43. | |
| N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-m-tolyl-propionic acid | N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-m-tolyl-propionic acid. Synonyms: N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-m-tolyl-propionic acid. Molecular formula: C25H23NO5. Mole weight: 417.5. | |
| N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-naphthalen-1-yl-propanoic acid | N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-naphthalen-1-yl-propanoic acid. Synonyms: N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-naphthalen-1-yl-propionic acid. CAS No. 959573-34-3. Molecular formula: C28H23NO5. Mole weight: 453.49. | |
| N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-naphthalen-2-yl-propanoic acid | N-Fmoc-(2S,3S)-3-Amino-2-hydroxy-3-naphthalen-2-yl-propanoic acid. Uses: Designed for use in research and industrial production. Additional or Alternative Names: (2S,3S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-hydroxy-3-(naphthalen-2-yl)propanoic acid, 959581-87-4, AC1MC6TA, N-Fmoc-3-(S)-Amino-2-(S)-hydroxy-3-naphthalen-2-yl-propionic acid, CTK7G2336, MolPort-003-795-010, AKOS015949762, AG-B-36846, AK119195, KB-206648, N-FMOC-(2S,3S)-3-AMINO-2-HYDROXY-3-NAPHTHALEN-2-YL-PROPANOIC ACID, (2S,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxy-3-naphthalen-2-ylpropanoic acid. Product Category: Heterocyclic Organic Compound. CAS No. 959581-87-4. Molecular formula: C28H23NO5. Mole weight: 453.49. Purity: 0.96. IUPACName: (2S,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxy-3-naphthalen-2-ylpropanoic acid. Canonical SMILES: C1=CC=C2C=C(C=CC2=C1)C(C(C(=O)O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35. Product ID: ACM959581874. Alfa Chemistry ISO 9001:2015 Certified. |  |
| N-Fmoc-(2S,3S)-3-Amino-3-(2-fluoro-phenyl)-2-hydroxy-propanoic acid | N-Fmoc-(2S,3S)-3-Amino-3-(2-fluoro-phenyl)-2-hydroxy-propanoic acid. Synonyms: N-Fmoc-(2S,3S)-3-Amino-3-(2-fluoro-phenyl)-2-hydroxy-propionic acid. CAS No. 959572-41-9. Molecular formula: C24H20FNO5. Mole weight: 421.42. | |
| N-Fmoc-(2S,3S)-3-Amino-3-(3-fluoro-phenyl)-2-hydroxy-propionic acid | N-Fmoc-(2S,3S)-3-Amino-3-(3-fluoro-phenyl)-2-hydroxy-propionic acid. CAS No. 1217603-27-4. Molecular formula: C24H20FNO5. Mole weight: 421.42. | |
| N-Fmoc-3-ethenyl-L-Phenylalanine | N-Fmoc-3-ethenyl-L-Phenylalanine. CAS No. 1213179-63-5. Molecular formula: C11H13NO2. Mole weight: 191.23. | |
| N-Fmoc-3-fluoro-L-tyrosine | N-Fmoc-3-fluoro-L-tyrosine. Synonyms: (S)-Fmoc-3-Fluoro-Tyrosine. CAS No. 1270290-56-6. Molecular formula: C24H20FNO5. Mole weight: 421.42. | |
| N-Fmoc-3-iodo-D-alanine tert-butyl ester | N-Fmoc-3-iodo-D-alanine tert-butyl ester. Synonyms: (S)-tert-Butyl 2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-iodopropanoate; tert-butyl (2S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-iodopropanoate. Molecular formula: C22H24INO4. Mole weight: 493.33. | |
| N-Fmoc-3-iodo-L-alanine tert-butyl ester | N-Fmoc-3-iodo-L-alanine tert-butyl ester. Synonyms: (R)-tert-Butyl 2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-iodopropanoate. Grade: 95%. CAS No. 282734-33-2. Molecular formula: C22H24INO4. Mole weight: 493.33. | |
| N-Fmoc-4-Br-D-tryptophan | N-Fmoc-4-Br-D-tryptophan. Synonyms: N-Fmoc-4-Br-D-Try; N Fmoc 4 Br D Try. Molecular formula: C26H21BrN2O4. Mole weight: 505.36. | |
| N-Fmoc-4-Br-L-tryptophan | N-Fmoc-4-Br-L-tryptophan. Synonyms: N-Fmoc-4-Br-L-Try; N Fmoc 4 Br L Try. CAS No. 2244532-69-0. Molecular formula: C26H21BrN2O4. Mole weight: 505.36. | |
| N-Fmoc-4-(methylamino)benzoic acid | N-Fmoc-4-(methylamino)benzoic acid. Uses: Designed for use in research and industrial production. Additional or Alternative Names: N-FMOC-4-(METHYLAMINO)BENZOIC ACID;Fmoc-4-methylaminobenzoic acid. Product Category: Heterocyclic Organic Compound. CAS No. 160977-92-4. Molecular formula: C23H19NO4. Mole weight: 373.4. Purity: 0.96. IUPACName: 4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]benzoic acid. Canonical SMILES: CN(C1=CC=C(C=C1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24. Product ID: ACM160977924. Alfa Chemistry ISO 9001:2015 Certified. | |
| N-Fmoc-4-methyl-L-tryptophan | N-Fmoc-4-methyl-L-tryptophan. Synonyms: N-Fmoc-4-me-L-Try; N Fmoc 4 me L Try. Molecular formula: C27H24N2O4. Mole weight: 440.49. | |
| N-(Fmoc-5-amino-3-oxa-pentyl)succinamic acid | N-(Fmoc-5-amino-3-oxa-pentyl)succinamic acid. Group: Biochemicals. Grades: Highly Purified. CAS No. 669073-62-5. Pack Sizes: 250mg, 500mg, 1g, 2g, 5g. US Biological Life Sciences. |  Worldwide |
| N-(Fmoc-5-amino-3-oxa-pentyl)succinamic acid 99+% (HPLC) | N-(Fmoc-5-amino-3-oxa-pentyl)succinamic acid 99+% (HPLC). Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 250mg, 1g, 5g. US Biological Life Sciences. | Worldwide |
| N-Fmoc-6-Methoxy-DL-tryptophan | N-Fmoc-6-Methoxy-DL-tryptophan. Synonyms: N-Fmoc-6-Methoxy-DL-Try; N Fmoc 6 Methoxy DL Try. CAS No. 1313032-63-1. Molecular formula: C27H24N2O5. Mole weight: 456.49. | |
| N-Fmoc-6-Methoxy-D-tryptophan | N-Fmoc-6-Methoxy-D-tryptophan. Synonyms: N-Fmoc-6-Methoxy-D-Try; N Fmoc 6 Methoxy D Try. Molecular formula: C27H24N2O5. Mole weight: 456.49. | |
| N-Fmoc-6-Methoxy-L-tryptophan | N-Fmoc-6-Methoxy-L-tryptophan. Synonyms: N-Fmoc-6-Methoxy-L-Try; N Fmoc 6 Methoxy L Try. CAS No. 2173568-57-3. Molecular formula: C27H24N2O5. Mole weight: 456.49. | |
| N-Fmoc-7-fluoro-L-tryptophan | N-Fmoc-7-fluoro-L-tryptophan. Synonyms: (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(7-fluoro-1H-indol-3-yl)propanoic acid; Fmoc-L-Trp(7-F)-OH. CAS No. 1956434-65-3. Molecular formula: C26H21FN2O4. Mole weight: 444.45. | |
| N-Fmoc-7-methyl-D-tryptophan | N-Fmoc-7-methyl-D-tryptophan. Synonyms: N-Fmoc-7-methyl-D-Try; N Fmoc 7 methyl D Try. Molecular formula: C27H24N2O4. Mole weight: 440.5. | |
| N-Fmoc-7-methyl-L-tryptophan | N-Fmoc-7-methyl-L-tryptophan. Synonyms: N-Fmoc-7-methyl-L-Try; N Fmoc 7 methyl L Try. CAS No. 1808268-53-2. Molecular formula: C27H24N2O4. Mole weight: 440.5. | |
| N-(Fmoc-8-amino-3,6-dioxa-octyl)succinamic acid | N-(Fmoc-8-amino-3,6-dioxa-octyl)succinamic acid. Group: Biochemicals. Alternative Names: Fmoc-(PEG)2-Suc-OH. Grades: Highly Purified. CAS No. 613245-91-3. Pack Sizes: 500mg, 1g, 2g, 5g. US Biological Life Sciences. | Worldwide |
| N-(Fmoc-8-Amino-3,6-dioxa-octyl)succinamic acid | N-(Fmoc-8-Amino-3,6-dioxa-octyl)succinamic acid, a short PEG spacer, can be incorporated into peptides during SPPS. Synonyms: N-(Fmoc-amino-PEG2-ethyl)-succinamic acid; Fmoc-amino-PEG2-ethylamino-Suc-OH; 1-(9H-Fluoren-9-yl)-3,14-dioxo-2,7,10-trioxa-4,13-diazaheptadecan-17-oic acid; Fmoc-Ebes. Grade: ≥95%. CAS No. 613245-91-3. Molecular formula: C25H30N2O7. Mole weight: 470.51. | |
| N-(Fmoc-8-amino-3,6-dioxa-octyl)succinamic acid 99+% (HPLC) | N-(Fmoc-8-amino-3,6-dioxa-octyl)succinamic acid 99+% (HPLC). Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 250mg, 1g, 5g. US Biological Life Sciences. | Worldwide |
| N-Fmoc-α-ethyl-β-alanine | N-Fmoc-α-ethyl-β-alanine. Synonyms: N-Fmoc-α-et-β-ala; N Fmoc α et β ala; (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino) pentanoic acid. CAS No. 1353293-73-8. Molecular formula: C20H21NO4. Mole weight: 339.4. | |
| N-Fmoc-α-methyl-4-tert-butoxy-L-phenylalanine | N-Fmoc-α-methyl-4-tert-butoxy-L-phenylalanine is pivotal in peptide synthesis, offering precise control over the modification and assembly of peptide chains. The Fmoc protecting group ensures the selective reactivity of the amino group, while the α-methyl and tert-butoxy modifications provide unique structural and functional properties that are valuable in the development of peptides and peptidomimetics for pharmaceutical applications. Synonyms: O-(1,1-Dimethylethyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-α-methyl-L-tyrosine; Fmoc-aMeTyr(tBu)-OH; N-(fluorenylmethoxycarbonyl)-alpha-methyl-O4-tert-butyl-L-tyrosine; Fmoc-α-Me-Tyr(tBu)-OH; (S)-2-Fmoc-amino-3-(4-(tert-butoxy)phenyl)-2-methylpropanoic acid. Grade: ≥95%. CAS No. 1309873-74-2. Molecular formula: C29H31NO5. Mole weight: 473.56. | |
| N-Fmoc-(βS)-3-bromo-β-hydroxy-L-Phenylalanine | N-Fmoc-(βS)-3-bromo-β-hydroxy-L-Phenylalanine. Molecular formula: C24H20BrNO5. Mole weight: 482.32. | |
| N-Fmoc-D,L-gamma-carboxyglutamic acid gamma,gamma-di-t-butyl ester | N-Fmoc-D,L-gamma-carboxyglutamic acid gamma,gamma-di-t-butyl ester. Group: Biochemicals. Alternative Names: 3-[[ (9H-Fluoren-9-ylmethoxy) carbonyl]amino]-1, 1, 3-propanetricarboxylic acid 1,1-bis(1,1-dimethylethyl) ester; Fmoc-gla(otBu)2-OH. Grades: Highly Purified. CAS No. 308357-14-4. Pack Sizes: 2mg, 5mg, 10mg, 25mg, 50mg. Molecular Formula: C29H35NO8. US Biological Life Sciences. | Worldwide |
| N-Fmoc-DL-Gly(piperidyl-4-Boc)-OH | N-Fmoc-DL-Gly(piperidyl-4-Boc)-OH. Synonyms: 2-(Fmoc-amino)-2-(1-boc-4-piperidyl)acetic acid; 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-(1-(tert-butoxycarbonyl)piperidin-4-yl)acetic acid. CAS No. 313051-96-6. Molecular formula: C27H32N2O6. Mole weight: 480.6. | |
| N-Fmoc DMNB-L-serine | N-Fmoc DMNB-L-serine. Group: Biochemicals. Alternative Names: O-[(4,5-Dimethoxy-2-nitrophenyl)methyl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-serine. Grades: Highly Purified. CAS No. 628280-43-3. Pack Sizes: 2mg, 5mg, 10mg, 25mg, 50mg. Molecular Formula: C27H26N2O9. US Biological Life Sciences. | Worldwide |
| N-Fmoc-D-Ser(Et)-OH | N-Fmoc-D-Ser(Et)-OH. Synonyms: O-Ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-serine. CAS No. 2093993-48-5. Molecular formula: C20H21NO5. Mole weight: 355.38. | |
| N-Fmoc-D-serine | N-Fmoc-D-serine is an N-Fmoc-protected form of D-Serine (S270975). D-Serine is a neurotransmitter that is concentrated in the mammalian brain, and is one of the very few amino acids that occur in the D- and L-configurations in significant amounts. D-Serine is an potent agonist of the N-methyl-D-aspartate (NMDA) receptor in the brain, which is associated with schizophrenia. Use of D-Serine has been considered as an additional therapy for refractory schizophrenic patients. Group: Biochemicals. Grades: Highly Purified. CAS No. 116861-26-8. Pack Sizes: 1g, 5g. Molecular Formula: C18H17NO5, Molecular Weight: 327.33. US Biological Life Sciences. | Worldwide |
| N-Fmoc-D-Ser(isopentyl)-OH | N-Fmoc-D-Ser(isopentyl)-OH. Molecular formula: C23H27NO5. Mole weight: 397.46. | |
| N-Fmoc (E)-Fluvoxamine | Protected Fluvoxamine. Group: Biochemicals. Alternative Names: 7-[4- (Trifluoromethyl) phenyl]-5, 12-dioxa-2, 6-diazatridec-6-enoic Acid 9H-Fluoren-9-ylmethyl Ester. Grades: Highly Purified. Pack Sizes: 5mg. US Biological Life Sciences. | Worldwide |
| N-Fmoc-erythro-DL-beta-methylphenylalanine | N-Fmoc-erythro-DL-beta-methylphenylalanine. Synonyms: Fmoc-DL-Phe(bR-Me)-OH; (2R,3R)/(2S,3S)-Fmoc-DL-beta-methyl-Phe-OH; (2R,3R)/(2S,3S)-racemic Fmoc-beta-methyl-phenylalanine. Grade: ≥ 98% (HPLC). CAS No. 321524-79-2. Molecular formula: C25H23NO4. Mole weight: 401.5. | |
| N-Fmoc-erythro-DL-beta-methylphenylalanine | N-Fmoc-erythro-DL-beta-methylphenylalanine. Group: Biochemicals. Alternative Names: (2R,3R)/(2S,3S)-Fmoc-DL-b-methyl-Phe-OH; (2R,3R)/(2S,3S)-Racemic Fmoc-b-methyl-phenylalanine. Grades: Highly Purified. CAS No. 321524-79-2. Pack Sizes: 250mg, 500mg, 1g, 2g, 5g. US Biological Life Sciences. | Worldwide |
| N-Fmoc-erythro-DL-b-methylphenylalanine 99+% (HPLC) | N-Fmoc-erythro-DL-b-methylphenylalanine 99+% (HPLC). Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 100mg, 250mg, 1g, 5g. US Biological Life Sciences. | Worldwide |
| N-Fmoc-ethylenediamine | N-Fmoc-ethylenediamine. Synonyms: (9H-Fluoren-9-yl)methyl (2-aminoethyl)carbamate; Carbamic acid, N-(2-aminoethyl)-, 9H-fluoren-9-ylmethyl ester; N-(2-aminoethyl)(fluoren-9-ylmethoxy)carboxamide; N-(2-Aminoethyl)carbamic acid 9H-fluoren-9-ylmethyl ester; Fmoc-1,2-diaminoethane. Grade: 95%. CAS No. 166410-32-8. Molecular formula: C17H18N2O2. Mole weight: 282.34. | |
| N-Fmoc-L-adamantylglycine | N-Fmoc-L-adamantylglycine. Synonyms: (2S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-(adamantan-1-yl)acetic acid; (αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]tricyclo[3.3.1.13,7]decane-1-acetic Acid. CAS No. 1221793-29-8. Molecular formula: C27H29NO4. Mole weight: 431.52. | |
| N-Fmoc-L-cysteine | N-Fmoc-L-cysteine is the N-Fmoc-protected form of L-Cysteine, a non-essential α-amino acid that is biosynthesized in humans. L-Cysteine is also a bicarbonate-sensitive endogenous excitotoxin in rats and possibly humans. . Synonyms: N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-cysteine; Fmoc-L-Cys-OH; Fmoc-cysteine; N-(9-Fluorenylmethoxycarbonyl)cysteine. Grade: 96%. CAS No. 135248-89-4. Molecular formula: C18H17NO4S. Mole weight: 343.40. | |
| N-Fmoc-L-gamma-carboxyglutamic acid gamma,gamma-di-t-butyl ester | N-Fmoc-L-gamma-carboxyglutamic acid gamma,gamma-di-t-butyl ester. Group: Biochemicals. Alternative Names: (3S) -3-[[ (9H-Fluoren-9-ylmethoxy) carbonyl]amino]-1, 1, 3-propanetricarboxylic acid 1,1-bis(1,1-dimethylethyl) ester; (S) -3-[[ (9H-Fluoren-9-ylmethoxy) carbonyl]amino]-1, 1, 3-propanetricarboxylic acid 1,1-bis(1,1-dimethylethyl) ester; Fmoc-gla(otBu)2-OH. Grades: Highly Purified. CAS No. 111662-64-7. Pack Sizes: 5mg, 10mg, 25mg, 50mg, 100mg. Molecular Formula: C29H35NO8. US Biological Life Sciences. | Worldwide |
| N-Fmoc-L-g-carboxyglutamic Acid g,g-Di-t-butyl Ester (Fmoc-Gla (OtBu)2-OH) | N-Fmoc-L-g-carboxyglutamic Acid g,g-Di-t-butyl Ester (Fmoc-Gla (OtBu)2-OH). Group: Biochemicals. Alternative Names: Fmoc-Gla (OtBu)2-OH. Grades: Highly Purified. Pack Sizes: 5mg. US Biological Life Sciences. | Worldwide |
| N-Fmoc-L-Gly(piperidyl-4-Boc)-OH | N-Fmoc-L-Gly(piperidyl-4-Boc)-OH is a useful research chemical. Synonyms: (S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-2-(1-(tert-butoxycarbonyl)piperidin-4-yl)acetic acid. Grade: ≥ 99 % (HPLC). CAS No. 204058-24-2. Molecular formula: C27H32N2O6. Mole weight: 480.55. | |
| N-Fmoc-L-pipecolinic acid | N-Fmoc-L-pipecolinic acid. Group: Biochemicals. Grades: Highly Purified. CAS No. 86069-86-5. Pack Sizes: 1g, 2g, 5g, 10g, 25g. US Biological Life Sciences. | Worldwide |
| N-Fmoc-L-Pro(4-oxo)-OH | N-Fmoc-L-Pro(4-oxo)-OH. Molecular formula: C20H17NO5. Mole weight: 351.35. | |
| N-Fmoc-L-Ser(Cyclobutyl)-OH | N-Fmoc-L-Ser(Cyclobutyl)-OH. CAS No. 1509911-79-8. Molecular formula: C22H23NO5. Mole weight: 381.42. | |
| N-Fmoc-L-threonine (2-Tolyl-2-oxo-ethyl)ester | Intermediate in the production of T Epitope, Threonyl. Group: Biochemicals. Alternative Names: N- (9-Fluorenyl methoxycarbonyl ) threonine (2-Tolyl-2-oxo-ethyl)ester; N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-threonine 2-(4-Methylphenyl)-2-oxoethyl Ester. Grades: Highly Purified. CAS No. 1356841-91-2. Pack Sizes: 25mg. US Biological Life Sciences. | Worldwide |
| N-Fmoc-L-threonine allyl ester | N-Fmoc-L-threonine allyl ester. Group: Biochemicals. Alternative Names: N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-threonine 2-propen-1-yl ester; N- (9-Fluorenyl methoxycarbonyl ) threonine allyl ester. Grades: Highly Purified. CAS No. 136523-92-7. Pack Sizes: 5mg, 10mg, 25mg, 50mg, 100mg. Molecular Formula: C22H23NO5. US Biological Life Sciences. | Worldwide |
| N-FMOC Mitomycin C | N-FMOC Mitomycin C. Group: Biochemicals. Alternative Names: N-FMOC [1aS-(1aα,8 β , 8aα , 8bα ) -6-Amino-8-[[ (aminocarbonyl) oxy]methyl]-1, 1a, 2, 8, 8a, 8b-hexahydro-8a-methoxy-5-methylazirino[2, 3: 3, 4]pyrrolo[1, 2-a]indole-4, 7-dione. Grades: Highly Purified. Pack Sizes: 2.5mg. US Biological Life Sciences. | Worldwide |
| N-Fmoc-N-(2-(4-methoxyphenyl)ethyl)-Glycine | N-Fmoc-N-(2-(4-methoxyphenyl)ethyl)-Glycine. Synonyms: 2-({[(9H-fluoren-9-yl)methoxy]carbonyl}[2-(4-methoxyphenyl)ethyl]amino)acetic acid. CAS No. 1286711-20-3. Molecular formula: C26H25NO5. Mole weight: 431.48. | |
| N-Fmoc-N-(3-methylbutyl)glycine | N-Fmoc-N-(3-methylbutyl)glycine. Synonyms: Glycine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-N-(3-methylbutyl)-. CAS No. 2255321-55-0. Molecular formula: C22H25NO4. Mole weight: 367.44. | |
| N-(Fmoc-N-amido-PEG4)-N-Biotin-PEG4-t-Boc-Hydrazide | N-(Fmoc-N-amido-PEG4)-N-Biotin-PEG4-t-Boc-Hydrazide. Grade: 98%. Molecular formula: C55H81N7O15S. Mole weight: 1112.4. | |
Our database is helping our users find suppliers everyday.
