Find where to buy products from suppliers in the USA, including: distributors, industrial manufacturers in America, bulk supplies and wholesalers of raw ingredients & finished goods.
Search for products or services, then visit the American suppliers website for prices, SDS or more information. You can also view suppliers in Australia, NZ or the UK.
| Product | Description | |
|---|---|---|
| 2,3,4,6-Tetra-O-acetyl-a-D-glucopyranosyl fluoride | 2,3,4,6-Tetra-O-acetyl-a-D-glucopyranosyl fluoride, a glycosyl fluoride, serves as a significant donor substrate for synthesizing complex carbohydrates. Employing this compound enzymatically generates various α-linked glycoconjugates for experimental and pharmacological purposes. Additionally, its application extends to investigations regarding the enzymatic mechanisms implicated in the metabolism of the carbohydrate. Synonyms: Acetofluoro-a-D-glucose; (2R,3R,4S,5R,6R)-2-(Acetoxymethyl)-6-fluorotetrahydro-2H-pyran-3,4,5-triyl triacetate; 1-Fluoro-1-deoxy-alpha-D-glucopyranose tetraacetate; α-D-Glucopyranosyl fluoride 2,3,4,6-tetraacetate. CAS No. 3934-29-0. Molecular formula: C14H19FO9. Mole weight: 350.29. |  |
| 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl fluoride | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl fluoride, a highly potent reagent, finds valuable application in the realm of biomedicine. Its utilization lies in the synthesis of drugs and probes based on carbohydrates, thereby rendering it indispensable in the pursuit of scientific advancements. Synonyms: beta-D-Glucopyranosyl fluoride tetraacetate; 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl fluoride; [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-fluorooxan-2-yl]methyl acetate; acetofluoro-glucose; BETA-D-GLUCOPYRANOSYL FLUORIDE TETRA-; SCHEMBL813505; JJXATNWYELAACC-RKQHYHRCSA-; DTXSID40472545; AKOS015912680; beta -D-Glucopyranosyl fluoride tetraacetate; beta-D-Glucopyranosyl fluoride tetraacetate, 96%; J-017009; InChI=1/C14H19FO9/c1-6 (16)20-5-10-11 (21-7 (2)17)12 (22-8 (3)18)13 (14 (15)24-10)23-9 (4)19/h10-14H, 5H2, 1-4H3/t10-, 11-, 12+, 13-, 14-/m1/s1. CAS No. 2823-46-3. Molecular formula: C14H19FO9. Mole weight: 350.29. | |
| 2,3,4,6-Tetra-O-benzoyl-b-D-glucopyranosyl fluoride | 2,3,4,6-Tetra-O-benzoyl-b-D-glucopyranosyl fluoride, a widely used compound in the synthesis of complex carbohydrates and glycoproteins, can serve as an ideal glycosyl donor in the enzymatic synthesis of oligosaccharides and glycosides. Its multifaceted properties are exemplified by its ability to exhibit potential inhibitory activity against numerous bacterial and fungal pathogens, indicating its prospective role as a therapeutic agent for addressing a spectrum of infectious diseases. Synonyms: [(2R,3r,4s,5r,6s)-3,4,5-tribenzoyloxy-6-fluoro-tetrahydropyran-2-yl]methyl benzoate; 2,3,4,6-Tetra-O-benzoyl-1-deoxy-1-fluoro-beta-D-glucopyranoside; [(2R,3R,4S,5R,6S)-3,4,5-Tribenzoyloxy-6-fluorooxan-2-yl]methyl benzoate; AKOS030211026; 2,3,4,6-Tetra-o-benzoyl-beta-d-glucopyranosyl fluoride. CAS No. 4163-40-0. Molecular formula: C34H27FO9. Mole weight: 598.59. | |
| 2,3,4,6-Tetra-O-benzyl-a-D-glucopyranosyl fluoride | 2,3,4,6-Tetra-O-benzyl-a-D-glucopyranosyl fluoride, a paramount compound in the field of biomedicine, holds immense significance. It is extensively utilized in the amalgamation of diverse medications aimed at combating afflictions like diabetes, cancer, and cardiovascular maladies. This pivotal product serves as a catalyst in the progression of innovative pharmaceuticals, characterized by augmented therapeutic efficacy. Synonyms: 2,3,4,6-Tetra-O-benzyl-alpha-D-glucopyranosyl Fluoride; (2R,3R,4S,5R,6R)-3,4,5-Tris(benzyloxy)-2-((benzyloxy)methyl)-6-fluorotetrahydro-2H-pyran; (2R,3R,4S,5R,6R)-2-fluoro-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane; 2,3,4,6-Tetra-O-benzyl-|A-D-glucopyranosyl Fluoride; 2,3,4,6-Tetra-O-benzyl-a-D-glucopyranosyl fluoride; SCHEMBL2124878; DTXSID40454866; MFCD03701104; AKOS015888992; HY-W145636; AS-74271; CS-0226064; T1922; T73043; 2,3,4,6-Tetra-O-benzyl- alpha -D-glucopyranosyl Fluoride; (2R,3R,4S,5R,6R)-3,4,5-tris(benzyloxy)-2-(benzyloxymethyl)-6-fluorotetrahydro-2H-pyran; (2R,3R,4S,5R,6R)-3,4,5-TRIS(BENZYLOXY)-2-[(BENZYLOXY)METHYL]-6-FLUOROOXANE. CAS No. 89025-46-7. Molecular formula: C34H35FO5. Mole weight: 542.64. | |
| 2,3,4,6-Tetra-O-benzyl-b-D-glucopyranosyl Fluoride | 2,3,4,6-Tetra-O-benzyl-b-D-glucopyranosyl Fluoride, a glucose derivative incorporating fluorine, functions as a glycosylation agent for synthesizing convoluted carbohydrates of paramount significance. Additionally, this compound finds extensive application in the manufacture of glycopeptides that deliver therapeutic interventions for fatal ailments, cancer and HIV/AIDS, among others. Synonyms: 2,3,4,6-Tetra-O-benzyl-beta-D-glucopyranosyl Fluoride; 2,3,4,6-tetra-o-benzyl-beta-d-glucopyranosylfluoride; (2R,3R,4S,5R,6S)-3,4,5-Tris(benzyloxy)-2-((benzyloxy)methyl)-6-fluorotetrahydro-2H-pyran; (2S,3R,4S,5R,6R)-2-fluoro-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane; MFCD01862264; 2,3,4,6-Tetra-O-benzyl-|A-D-glucopyranosyl Fluoride; SCHEMBL7155426; DTXSID10447063; HY-W145623; CS-0226050; T1923; D92545; J-004847; 2,3,4,6-Tetra-O-benzyl-?-D-glucopyranosyl fluoride; 2,3,4,6-Tetra-O-benzyl-|A-D-glucopyranosylfluoride. CAS No. 78153-79-4. Molecular formula: C34H35FO5. Mole weight: 542.64. | |
| 2,3,4,6-Tetra-O-benzyl-beta-D-glucopyranosyl fluoride | Heterocyclic Organic Compound. Alternative Names: 2,3,4,6-TETRA-O-BENZYL-BETA-D-GLUCOPYRANOSYL FLUORIDE;2,3,4,6-TETRA-O-BENZYL-D-GLUCOPYRANOSYL FLUORIDE. CAS No. 122741-44-0. Molecular formula: C34H35FO5. Mole weight: 542.64. Purity: >96.0%(LC). IUPACName: (3R,4S,5R,6R)-2-fluoro-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane. Density: 1.206g/cm³. Catalog: ACM122741440. |  |
| 2,3,4,6-Tetra-O-benzyl-D-glucopyranosyl fluoride | 2,3,4,6-Tetra-O-benzyl-D-glucopyranosyl fluoride, an indispensable reagent in the biomedical domain, plays a pivotal role. Its usage primarily revolves around synthesizing diverse glycosidic compounds, particularly in the realm of potential drug development addressing diseases associated with anomalous carbohydrate metabolism. Synonyms: 2,3,4,6-Tetra-O-benzyl-D-glucopyranosyl Fluoride; D-Glucopyranosyl fluoride, 2,3,4,6-tetrakis-O-(phenylmethyl)-; (3R,4S,5R,6R)-2-fluoro-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane; SCHEMBL2124872; DTXSID40449454; QNXIKNZDQVSBCO-BKJHVTENSA-N; AKOS037646847; HY-W145533; AS-71162; CS-0214498; T1971; E78804; A891021; 2,3,4,6-tetra-O-benzyl-alpha/beta-D-glucopyranosyl fluoride; (2R,3R,4S,5R)-3,4,5-TRIS(BENZYLOXY)-2-[(BENZYLOXY)METHYL]-6-FLUOROOXANE. CAS No. 122741-44-0. Molecular formula: C34H35FO5. Mole weight: 542.64. | |
| 2-Acetamido-3,4,6-tri-O-acetyl-2-deoxy-a-D-glucopyranosyl fluoride | 2-Acetamido-3,4,6-tri-O-acetyl-2-deoxy-a-D-glucopyranosyl fluoride, a vital chemical compound in the realm of glycoconjugate synthesis, plays an essential role in various biological processes including those pertaining to cell signaling and immune response. As a key participant in the development of fluoro-glycosidase inhibitors, it offers the potential for treating diseases such as cancer and viral infections. The compound's complex and multifaceted nature underscores the opportunity for groundbreaking advancements in biomedical research. | |
| 2-Trifluroacetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyranosyl Fluoride | 2-Trifluroacetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyranosyl Fluoride, a compound of utmost importance, shows promise in the realm of antiviral therapeutics. Its intricate molecular arrangement contributes to its ability to impede key enzymes essential for viral replication, thereby exhibiting efficacy against a multitude of viral variants. This particular product has garnered extensive scientific scrutiny, with researchers investigating its potential utilization as an antiviral agent against formidable afflictions like influenza, HIV, and herpes. Molecular formula: C14H17F4NO8. Mole weight: 403.28. | |
| 3,4,6-Tri-O-acetyl-2-azido-2-deoxy-a-D-glucopyranosyl fluoride | | |
| 3,4,6-Tri-O-acetyl-2-deoxy-2-fluoro-D-glucopyranosyl fluoride | 3,4,6-Tri-O-acetyl-2-deoxy-2-fluoro-D-glucopyranosyl fluoride is a remarkably potent compound, finding extensive application within the biomedical industry to synthesize groundbreaking fluorinated pharmaceuticals. Its distinctive molecular structure bestows tremendous potential for research of combating a wide array of ailments, encompassing cancer, diabetes, and viral infections. Synonyms: 1,2-Dideoxy-1,2-difluoro-3,4,6-tri-O-acetyl-D-glucopyranose. CAS No. 86786-39-2. Molecular formula: C12H16F2O7. Mole weight: 310.25. | |
| 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-a-D-glucopyranosyl fluoride | 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-a-D-glucopyranosyl fluoride, a pharmaceutical intermediate, is utilized for synthesizing glycosylated natural products and oligosaccharides. Its potential in the field of developing therapies for cancer, bacterial infections, and autoimmune diseases cannot be overstated. This unparalleled substance selectively inhibits a range of glycosyltransferases enzymes, playing a critical role in the progression of these crippling diseases. Synonyms: 2-Deoxy-2-phthalimido-tri-acetofluoro-a-D-glucose. CAS No. 147157-97-9. Molecular formula: C20H20FNO9. Mole weight: 437.37. | |
| 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-b-D-glucopyranosyl fluoride | The compound name is 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-β-D-glucopyranosyl fluoride, showcasing exceptional efficacy as a glycosylation recompound during the research and development of oligosaccharides and glycoconjugates. Its distinctive structural attributes facilitate the development of efficient drug delivery system. Synonyms: 3,4,6-Tri-o-acetyl-2-deoxy-2-phthalimido-b-d-glucopyranosyl fluoride; [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-fluorooxan-2-yl]methyl acetate; SCHEMBL8333439; 3,4,6-Tri-o-acetyl-2-deoxy-2-phthalimido-b-d-glucopyranosylfluoride. Molecular formula: C20H20FNO9. Mole weight: 437.37. | |
| 3,4,6-Tri-O-acetyl-2-deoxy-2-trifluoroacetamido-b-D-glucopyranosyl fluoride | 3,4,6-Tri-O-acetyl-2-deoxy-2-trifluoroacetamido-b-D-glucopyranosyl fluoride, an extraordinary biomedical compound, stands as a burgeoning solution in combatting diverse maladies. With its remarkable capabilities, this product exhibits unrivaled potential as a powerful inhibitor of specific enzymes, rendering it invaluable for pioneering drug discovery endeavors aimed at combating resilient pathogens. Synonyms: [(2R,3S,4R,5R,6S)-3,4-Diacetyloxy-6-fluoro-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate; 2-Trifluroacetamido-3,4,6-tri-O-acetyl-2-deoxy-beta-D-glucopyranosyl Fluoride; (2R,3S,4R,5R,6S)-2-(Acetoxymethyl)-6-fluoro-5-(2,2,2-trifluoroacetamido)tetrahydro-2H-pyran-3,4-diyl diacetate; 3,4,6-Tri-O-acetyl-2-deoxy-2-trifluoroacetamido-b-D-glucopyranosyl fluoride; 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-D-glucopyranosyl bromide?; 2-Trifluroacetamido-3,4,6-tri-O-acetyl-2-deoxy-?-D-glucopyranosyl Fluoride; 2-Trifluroacetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranosyl Fluoride; (2R,3S,4R,5R,6S)-2-(Acetoxymethyl)-6-fluoro-5-(2,2,2-trifluoroacetamido)tetrahydro-2H-pyran-3,4-diyldiacetate. CAS No. 137686-91-0. Molecular formula: C14H17F4NO8. Mole weight: 403.28. | |
| 3,4,6-Tri-O-benzyl-2-deoxy-2-phthalimdo-b-D-glucopyranosyl fluoride | 3,4,6-Tri-O-benzyl-2-deoxy-2-phthalimdo-b-D-glucopyranosyl fluoride is an essential compound used in the biomedical industry for the research and development of potential antitumor compounds and drugs research of neurological diseases. By selectively blocking key enzymes and receptors, it exhibiting promising potential in research of combatting various diseases. Molecular formula: C35H32FNO6. Mole weight: 581.63. | |
| a-D-Glucopyranosyl fluoride | a-D-Glucopyranosyl fluoride is a compound of utmost importance, employed extensively for research in synthesizing drugs with a focus on metabolic disorders like diabetes and obesity. T. Molecular formula: C6H11FO5. Mole weight: 182.15. | |
| α-D-Glucopyranosyl Fluoride | α-D-Glucopyranosyl Fluoride is a key compound used in biomedicine for synthesizing various fluorinated carbohydrates and glycoconjugates. It plays a vital role in the development of novel drugs, diagnostics, and vaccines targeting metabolic disorders, such as diabetes, by modulating carbohydrate metabolism pathways. Synonyms: alpha-D-Glucopyranosyl fluoride; 1-FLUORO-ALPHA-1-DEOXY-D-GLUCOSE. Grades: 98%. CAS No. 2106-10-7. Molecular formula: C6H11FO5. Mole weight: 182.15. | |
| b-D-Glucopyranosyl fluoride | b-D-Glucopyranosyl fluoride, a paramount compound with extensive applications in biomedicine, assumes a pivotal role in the advancement of innovative pharmaceuticals targeting diverse ailments such as diabetes, cancer, and microbial infections. Its extraordinary chemical attributes render it a flawless contender for facilitating enzymatic and chemical conversions, thereby facilitating the synthesis of therapeutically targeted compounds. Moreover, b-D-Glucopyranosyl fluoride presents itself as an invaluable instrument in comprehending glycosylation mechanisms and scrutinizing molecular interplays associated with cellular signaling pathways. Thus, its significance in unraveling biological phenomena and pharmaceutical pursuits cannot be overstated. Synonyms: b-D-Glucopyranosyl fluoride; 7617-95-0; (2S,3R,4S,5S,6R)-2-fluoro-6-(hydroxymethyl)oxane-3,4,5-triol; 2-deoxy-2-fluro-d-glucose; SCHEMBL4340862; ATMYEINZLWEOQU-VFUOTHLCSA-; AKOS006370932; InChI=1/C6H11FO5/c7-6-5(11)4(10)3(9)2(1-8)12-6/h2-6,8-11H,1H2/t2-,3-,4+,5-,6-/m1/s1. CAS No. 7617-95-0. Molecular formula: C6H11FO5. Mole weight: 182.15. | |
| 2,3,6,2,3,4,6-Hepta-O-acetyl-a-D-lactosyl fluoride | 2,3,6,2,3,4,6-Hepta-O-acetyl-a-D-lactosyl fluoride is a biomedical reagent instrumental in studying infectious diseases. Its core utility lies in the synthesis of oligosaccharides, which may facilitate research into pharmaceuticals aimed at combating bacterial and viral infections. Synonyms: Peracetylated lactosyl fluoride 4-O-(2,3,4,6-Tetra-O-acetyl-b-D-galactopyranosyl)-2,3,6-tri-O-acetyl-a-D-glucopyranosyl fluoride. CAS No. 14227-57-7. Molecular formula: C26H35FO17. Mole weight: 638.54. | |
| a-D-1,5-Difluoroglucose | a-D-1,5-Difluoroglucose is an exquisite and indispensable biomedical compound aptly tailored for its pivotal role in the realm of positron emission tomography (PET) imaging. It acts as a scintillating radiotracer emulating the very essence of glucose. Synonyms: 5-C-Fluoro-a-D-glucopyranosyl fluoride. CAS No. 173349-22-9. Molecular formula: C6H10F2O5. Mole weight: 200.14. | |
| Cellobiosyl fluoride | Cellobiosyl fluoride is a profound chemical compound embraced in the realm of biomedical science, finding its purpose in scrutinizing and impeding enzymes implicated in the intricate disintegration of cellulose. By virtue of its presence, it bestows upon researchers an invaluable instrument to fathom the intricate machinations underpinning cellulose degradation within microorganisms. Synonyms: 4-O-b-D-Glucopyranosyl-a-D-glucopyranosyl fluoride. CAS No. 103531-01-7. Molecular formula: C12H21FO10. Mole weight: 344.29. | |
| Lactosyl fluoride | Lactosyl fluoride is an extensively employed compound in the realm of biomedical research, exhibiting its remarkable inhibitory potential towards distinct glycosidases and glycosyltransferases that play crucial roles in carbohydrate recognition and processing. This compound serves as an invaluable tool for investigating intricate glycosylation processes and unraveling their profound implications in various ailments, including cancer, diabetes and infectious diseases. Synonyms: alpha-lactosyl fluoride; L-1150; 4-O-|A-D-Galactopyranosyl-|A-D-glucopyranosyl fluoride; (2S,3R,4S,5R,6R)-2-(((2R,3S,4R,5R,6R)-6-Fluoro-4,5-dihydroxy-2-(hydroxymethyl)tetrahydro-2H-pyran-3-yl)oxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol; (2S,3R,4S,5R,6R)-2-[(2R,3S,4R,5R,6R)-6-fluoro-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol. CAS No. 7792-96-3. Molecular formula: C12H21FO10. Mole weight: 344.29. | |
Our database is helping our users find suppliers everyday.
