A directory of where to buy chemicals in the USA, including: distributors, industrial manufacturers, bulk supplies and wholesalers of raw ingredients & finished goods.
Search for products or services, then visit the suppliers website for prices or more information.
| Product | Description | |
|---|---|---|
| Ethyl 2- (3, 4-dimethoxyphenyl) acetate | Ethyl 2- (3, 4-dimethoxyphenyl) acetate. Group: Biochemicals. Grades: Highly Purified. CAS No. 18066-68-7. Pack Sizes: 25g, 50g, 100g, 250g, 500g. US Biological Life Sciences. |  Worldwide |
| Ethyl 2,3,4-tri-O-acetyl-6-azido-6-deoxy-a-D-thiomannopyranoside | Ethyl 2,3,4-tri-O-acetyl-6-azido-6-deoxy-a-D-thiomannopyranoside is a profound and intricate compound, specifically engineered for the synthesand advancement of therapeutic compounds aimed at studying viral infections, cancerous malignancies and perplexing autoimmune maladies. Molecular formula: C14H21N3O7S. Mole weight: 375.4. |  |
| Ethyl 2,3,4-tri-O-acetyl-a-L-rhamnopyranoside | Ethyl-2,3,4-tri-O-acetyl-a-L-rhamnopyranoside is a biomedical product used in the research of certain diseases. It acts as a precursor and synthetic intermediate for synthesizing various drugs targeting a range of medical conditions. With its unique chemical structure, this compound plays a crucial role in the production of pharmaceuticals tailored to study specific pathogens and ailments, contributing to advancements. Molecular formula: C14H22O8. Mole weight: 318.32. | |
| Ethyl 2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester | Ethyl 2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester, a compound of immense significance in the biomedical industry, finds extensive utility in research endeavors. Its role as a synthetic precursor in targeting diseases, namely cancer, inflammation, and hepatic disorders, renders it indispensable. This remarkable compound showcases promising therapeutic traits, propelling advancements in comprehending molecular intricacies governing multiple pathological states. Synonyms: methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-ethoxyoxane-2-carboxylate; Ethyl 2,3,4-tri-O-acetyl-|A-D-glucuronide methyl ester; Ethyl 2,3,4-Tri-O-acetyl-beta-D-glucuronide, Methyl Ester; Ethyl methyl 2,3,4-tri-O-acetyl-beta-D-glucopyranosiduronate; MFCD09037651; Ethyl 2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester; DTXSID10661666; AKOS037649238; BS-17499; W-203773; Ethyl 2,3,4-tri-O-acetyl--D-glucuronide methyl ester; Ethyl 2,3,4-tri-O-acetyl-ss-D-glucuronide methyl ester; Ethyl 2,3,4-Tri-O-acetyl-?-D-glucuronide, Methyl Ester; ETHYL 2,3,4-TRI-O-ACETYL-ALPHA-D-GLUCURONIDE METHYL ESTER. CAS No. 77392-66-6. Molecular formula: C15H22O10. Mole weight: 362.33. | |
| Ethyl 2,3,4-tri-O-acetyl-b-L-thiofucopyranoside | Ethyl 2,3,4-tri-O-acetyl-b-L-thiofucopyranoside, a highly significant compound employed in extensive biomedical investigations, exhibits remarkable efficacy in the synthesis of pharmaceuticals designed to treat a diverse range of diseases, including cancer, diabetes, and infectious ailments. CAS No. 127501-41-1. Molecular formula: C14H22O7S. Mole weight: 334.39. | |
| Ethyl 2,3,4-tri-O-acetyl-b-L-thiofucopyranoside | Heterocyclic Organic Compound. Alternative Names: SCHEMBL8090874, MolPort-028-959-341, K-3974, ETHYL 2,3,4-TRI-O-ACETYL-BETA-L-THIOFUCOPYRANOSIDE, 127501-41-1. CAS No. 127501-41-1. Molecular formula: C14H26O8. Mole weight: 332.36. Purity: 0.96. IUPACName: [(2S,3R,4R,5S,6R)-4,5-diacetyloxy-6-ethylsulfanyl-2-methyloxan-3-yl] acetate. Catalog: ACM127501411. |  |
| Ethyl 2,3,4-tri-O-benzoyl-b-D-thioglucopyranosiduronic acid methyl ester | Ethyl 2,3,4-tri-O-benzoyl-b-D-thioglucopyranosiduronic acid methyl ester, a compound of great significance in the field of biomedicine, plays a pivotal role in the treatment and exploration of diverse ailments and pharmaceutical interventions. With its distinctive molecular configuration and inherent characteristics, it stands as an indispensable constituent for biomedical investigations and therapeutic advances aimed at effectively combating a multitude of diseases. Synonyms: Ethyl 1-thio-b-D-glucopyranosiduronic acid methyl ester tribenzoate. CAS No. 302965-09-9. Molecular formula: C30H28O9S. Mole weight: 564.60. | |
| Ethyl 2,3,4-tri-O-benzyl-b-D-thiogalactopyranoside | Ethyl 2,3,4-tri-O-benzyl-b-D-thiogalactopyranoside is a prominent substrate mimic for β-galactosidase. Its application extends to a diverse range of enzymatic assays. This paramount compound finds its utmost significance in the drugs development of β-galactosidase-associated afflictions, notably those encompassing lysosomal storage disorders. CAS No. 139574-31-5. | |
| Ethyl 2,3,4-tri-O-benzyl-b-D-thioglucopyranoside | Ethyl 2,3,4-tri-O-benzyl-b-D-thioglucopyranoside is a valuable compound used in biomedical research. It acts as a precursor for the synthesis of thioglucoside-based molecules, which have shown potential in the development of anti-cancer drugs. This compound plays a crucial role in studying the structure-activity relationship and designing new therapeutic agents targeting various diseases, particularly cancer. Synonyms: Ethyl 2,3,4-tri-O-benzyl-b-D-thioglucopyranoside; [(2R,3R,4S,5R,6S)-6-ethylsulfanyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol; ((2R,3R,4S,5R,6S)-3,4,5-Tris(benzyloxy)-6-(ethylthio)tetrahydro-2H-pyran-2-yl)methanol; CBDivE_002673; W-200993; Ethyl2,3,4-tri-O-benzyl-1-thio-b-D-glucopyranoside; [(2R,3R,4S,5R,6S)-3,4,5-tris(benzyloxy)-6-(ethylsulfanyl)oxan-2-yl]methanol. CAS No. 126461-54-9. Molecular formula: C29H34O5S. Mole weight: 494.64. | |
| Ethyl 2,3,4-tri-O-benzyl-beta-D-thioglucopyranoside | Heterocyclic Organic Compound. CAS No. 126461-54-9. Molecular formula: C29H34O5S. Mole weight: 494.64. Catalog: ACM126461549. | |
| Ethyl 2,3,4-tri-O-benzyl-b-L-thiofucopyranoside | Cas No. 116391-11-8. | |
| Ethyl 2,3,4-tri-O-benzyl-L-fucopyranoside | Ethyl 2,3,4-tri-O-benzyl-L-fucopyranoside is an intermediary compound in the biomedical industry, playing an important role in certain drugs development. Molecular formula: C29H34O5. Mole weight: 462.58. | |
| Ethyl 2,3,4-tri-O-benzyl-L-thiofucopyranoside | Ethyl 2,3,4-tri-O-benzyl-L-thiofucopyranoside, a highly significant biomedicine compound, showcases immense potential in the pharmaceutical sector. It remarkably contributes to the synthesis of novel drug candidates addressing an extensive array of diseases, encompassing but not limited to cancer and neurological disorders. Synonyms: Ethyl 6-deoxy-2,3,4-tris-O-(phenylmethyl)-1-thio-L-galactopyranoside. CAS No. 169532-17-6. Molecular formula: C29H34O4S. Mole weight: 478.64. | |
| ethyl 2-(3,5-dicyano-4-isobutoxyphenyl)-4-methylthiazole-5-carboxylate | ethyl 2-(3,5-dicyano-4-isobutoxyphenyl)-4-methylthiazole-5-carboxylate is an impurity of Febuxostat. Febuxostat is an antihyperuricemic nonpurine inhibitor of both the oxidized and reduced forms of xanthine oxidase. CAS No. 2428631-67-6. Molecular formula: C19H19N3O3S. Mole weight: 369.44. | |
| ethyl 2-(3,5-diformyl-4-isobutoxyphenyl)-4-methylthiazole-5-carboxylate | ethyl 2-(3,5-diformyl-4-isobutoxyphenyl)-4-methylthiazole-5-carboxylat is an impurity of Febuxostat. Febuxostat is an antihyperuricemic nonpurine inhibitor of both the oxidized and reduced forms of xanthine oxidase. Synonyms: Ethyl 2-(3,5-diformyl-4-isobutoxyphenyl)-4-methylthiazole-5-carboxylate. CAS No. 2375033-26-2. Molecular formula: C19H21NO5S. Mole weight: 375.44. | |
| Ethyl 2,3,6,2',3',4',6'-Hepta-O-acetyl-α,β-D-thiolactopyranoside | A useful reagent for the preparation of lactosides. Grades: 95%. CAS No. 146788-09-2. Molecular formula: C28H40O17S. Mole weight: 680.57. | |
| Ethyl 2,3,6-tri-O-acetyl-4-O-(2,3,4,6-tetra-O-acetyl-b-D-galactopyranosyl)-D-thioglucopyranoside | Ethyl 2,3,6-tri-O-acetyl-4-O-(2,3,4,6-tetra-O-acetyl-β-D-galactopyranosyl)-D-thioglucopyranoside is an esteemed chemical compound having immense potential to study specific strains impervious to drugs, heighten drug delivery systems and facilitate targeted therapies. Synonyms: Ethyl 2,3,6,2,3,4,6-hepta-O-acetyl-D-thiolactopyranoside. Molecular formula: C28H40O17S. Mole weight: 680.67. | |
| Ethyl 2,3,6-tri-O-benzoyl-b-D-thioglucopyranoside | Ethyl 2,3,6-tri-O-benzoyl-b-D-thioglucopyranoside is a key compound commonly employed as a precursor in the synthesis of carbohydrate-based drugs, which target specific diseases like cancer, diabetes and viral infections. | |
| Ethyl 2,3,6-tri-O-benzyl-b-D-thioglucopyranoside | Ethyl 2,3,6-tri-O-benzyl-b-D-thioglucopyranoside is an exceedingly valuable compound, finding wide application in the realm of glycoside and carbohydrate synthesis. It is used for studying a multitude of ailments such as cancer, diabetes and cardiovascular afflictions. Synonyms: Ethyl 2,3,6-tri-O-benzyl-1-thio-b-D-glucopyranoside; Ethyl 2,3,6-tri-O-benzyl-b-D-thioglucopyranoside; (2R,3R,4S,5R,6S)-6-ethylsulfanyl-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-ol; (2R,3R,4S,5R,6S)-4,5-Bis(benzyloxy)-2-((benzyloxy)methyl)-6-(ethylthio)tetrahydro-2H-pyran-3-ol; DTXSID901186204; ETHYL 2,3,6-TRI-O-BENZYL-BETA-D-THIOGLUCOPYRANOSIDE; W-201210; ethyl 2,3,6-tri-O-benzyl-1-thio-beta-d-glucopyranoside; Ethyl 2,3,6-tris-O-(phenylmethyl)-1-thio-beta-D-glucopyranoside; (2R,3R,4S,5R,6S)-4,5-BIS(BENZYLOXY)-2-[(BENZYLOXY)METHYL]-6-(ETHYLSULFANYL)OXAN-3-OL. CAS No. 141263-02-7. Molecular formula: C29H34O5S. Mole weight: 494.64. | |
| Ethyl 2-(3-aminooxetan-3-yl)acetate | Heterocyclic Organic Compound. Alternative Names: Ethyl 2-(3-aminooxetan-3-yl)acetate, 1207175-54-9, CTK8C0372, ANW-64574, AKOS006336490, AK103689, KB-252119. CAS No. 1207175-54-9. Molecular formula: C7H13NO3. Mole weight: 159.18. Purity: 0.96. IUPACName: ethyl 2-(3-aminooxetan-3-yl)acetate. Canonical SMILES: CCOC(=O)CC1(COC1)N. Catalog: ACM1207175549. | |
| Ethyl 2,3'-bipyridine-6-carboxylate | Nitrogen-Donor Ligands. CAS No. 1214382-00-9. Molecular formula: C13H12N2O2. Mole weight: 228.25. IUPACName: ethyl 6-pyridin-3-ylpyridine-2-carboxylate. Catalog: ACM1214382009. | |
| ethyl 2-(3-carbamoyl-4-isobutoxyphenyl)-4-methylthiazole-5-carboxylate | ethyl 2-(3-carbamoyl-4-isobutoxyphenyl)-4-methylthiazole-5-carboxylate is an impurity of Febuxostat. Febuxostat is an antihyperuricemic nonpurine inhibitor of both the oxidized and reduced forms of xanthine oxidase. Synonyms: SCHEMBL458831; ethyl 2-(3-carbamoyl-4-isobutoxyphenyl)-4-methylthiazole-5-carboxylate; 1346238-15-0. CAS No. 1346238-15-0. Molecular formula: 18H22N2O4S. Mole weight: 362.44. | |
| Ethyl 2-(3-chloro-2-fluorophenyl)-2,2-difluoroacetate | Heterocyclic Organic Compound. Alternative Names: ETHYL 2-(3-CHLORO-2-FLUOROPHENYL)-2,2-DIFLUOROACETATE, 1215205-78-9, ACMC-209ac5, CTK4B2429, MolPort-015-143-433, ANW-17667, AKOS015848711, AG-L-20867, AK-96365, KB-50745, A-5449, I14-25292, Ethyl 2-(3-chloro-2-fluorophenyl)-2,2-difluoroacetate. CAS No. 1215205-78-9. Molecular formula: C10H8ClF3O2. Mole weight: 252.6. Purity: 0.98. IUPACName: ethyl 2-(3-chloro-2-fluorophenyl)-2,2-difluoroacetate. Catalog: ACM1215205789. | |
| Ethyl2-(3-chloro-2-fluorophenyl)acetate | Heterocyclic Organic Compound. Alternative Names: SureCN1626000, ETHYL 2-(3-CHLORO-2-FLUOROPHENYL)ACETATE, 1035262-78-2. CAS No. 1035262-78-2. Molecular formula: C10H10ClFO2. Mole weight: 216.636603 [g/mol]. Purity: 0.96. IUPACName: ethyl 2-(3-chloro-2-fluorophenyl)acetate. Canonical SMILES: CCOC(=O)CC1=C(C(=CC=C1)Cl)F. Catalog: ACM1035262782. | |
| Ethyl 2-(3-chloro-2-methylphenyl)-2,2-difluoroacetate | Heterocyclic Organic Compound. CAS No. 1215205-45-0. Molecular formula: C11H11ClF2O2. Purity: 0.98. Catalog: ACM1215205450. | |
| ethyl 2-(3-chloro-2-oxopiperazin-1-yl)acetate | Heterocyclic Organic Compound. Alternative Names: ethyl 2-(3-chloro-2-oxopiperazin-1-yl)acetate, 1222655-64-2, SBB070806, AKOS015919254, KB-201178, FT-0653528, A804862, S05-0127, 2-(3-chloro-2-oxo-1-piperazinyl)acetic acid ethyl ester, ethyl 2-(3-chloranyl-2-oxidanylidene-piperazin-1-yl)ethanoate. CAS No. 1222655-64-2. Molecular formula: C8H13ClN2O3. Mole weight: 220.653420 [g/mol]. Purity: 0.96. IUPACName: ethyl 2-(3-chloro-2-oxopiperazin-1-yl)acetate. Canonical SMILES: CCOC(=O)CN1CCNC(C1=O)Cl. Catalog: ACM1222655642. | |
| Ethyl 2-[3-(cyanomethyl)-4-oxo-3,4-dihydrophthalazin-1-yl]acetate | Heterocyclic Organic Compound. Alternative Names: ETHYL 2-[3-(CYANOMETHYL)-4-OXO-3,4-DIHYDROPHTHALAZIN-1-YL]ACETATE;ETHYL [3-(CYANOMETHYL)-4-OXO-3,4-DIHYDROPHTHALAZIN-1-YL]ACETATE. CAS No. 122665-86-5. Molecular formula: C14H13N3O3. Mole weight: 271.27. Catalog: ACM122665865. | |
| ethyl 2,3-diamino-6-fluorobenzoate | Synonyms: 2,3-Diamino-6-fluoro-benzoic acid ethyl ester. CAS No. 1258070-71-1. Molecular formula: C9H11FN2O2. Mole weight: 198.19. | |
| Ethyl 2,3-dibromo-3-p-tolylpropanoate | Heterocyclic Organic Compound. Alternative Names: ETHYL 2,3-DIBROMO-3-P-TOLYLPROPANOATE; 2,3-Dibrom-3-p-tolyl-propionsaeure-aethylester; BENZENEPROPANOICACID. ALPHA.. BETA.-DIBROMO-4-METHYL-, ETHYLESTER; ethyl 2,3-dibromo-3-(4-methylphenyl)propanoate. CAS No. 101458-36-0. Molecular formula: C12H14Br2O2. Mole weight: 350.046. Purity: 0.96. IUPACName: 2,3-dibromo-3-p-tolyl-propionic acid ethyl ester. Catalog: ACM101458360. | |
| Ethyl 2,3-dibromopropionate | Ethyl 2,3-dibromopropionate. CAS No. 3674-13-3. Categories: ethyl 2,3-dibromopropionate. |  Pennsylvania PA |
| Ethyl 2,3-dichloro propionate | Ethyl 2,3-dichloro propionate. Group: Biochemicals. Grades: Reagent Grade. CAS No. 6628-21-3. Pack Sizes: 5g, 25g. US Biological Life Sciences. | Worldwide |
| Ethyl 2,3-dicyanopropionate | Ethyl 2,3-dicyanopropionate. Group: Biochemicals. Alternative Names: 2,3-Dicyanopropionic acid ethyl ester; 2,3-Dicyanopropanoic acid ethyl ester; Ethyl 2,3-dicyanopropanoate. Grades: Highly Purified. CAS No. 40497-11-8. Pack Sizes: 250mg, 500mg, 1g, 2g, 5g. Molecular Formula: C7H8N2O2. US Biological Life Sciences. | Worldwide |
| Ethyl 2,3-Dicyanopropionate-13C2 15N2 | Ethyl 2,3-Dicyanopropionate-13C2 15N2. Group: Biochemicals. Alternative Names: 2,3-Dicyanopropionic Acid Ethyl Ester-3C2 15N2; 2,3-Dicyanopropanoic Acid Ethyl Ester-3C2 15N2; Ethyl 2,3-Dicyanopropanoate-3C2 15N2. Grades: Highly Purified. Pack Sizes: 25mg. Molecular Formula: C513C2H815N2O2, Molecular Weight: 156.12. US Biological Life Sciences. | Worldwide |
| Ethyl 2,3-Di-O-(4-Methoxybenzy)-4,6-(4-methoxybenzylidene)-β-D-thiogalactopyranoside | Ethyl 2,3-Di-O-(4-Methoxybenzy)-4,6-(4-methoxybenzylidene)-β-D-thiogalactopyranoside is a compound useful in organic synthesis. Molecular formula: C32H38O10S. Mole weight: 614.7. | |
| Ethyl 2,3-Di-O-(4-Methoxybenzy)-4,6-(4-methoxybenzylidene)-β-D-thiogalactopyranoside S-Oxide | Ethyl 2,3-Di-O-(4-Methoxybenzy)-4,6-(4-methoxybenzylidene)-β-D-thiogalactopyranoside S-Oxide is a compound useful in organic synthesis. Molecular formula: C32H38O11S. Mole weight: 630.7. | |
| Ethyl 2,3-di-O-(4-methoxybenzyl)-4,6-O-(4-methoxybenzylidene)-b-D-thiogalactopyranoside | Ethyl 2,3-di-O-(4-methoxybenzyl)-4,6-O-(4-methoxybenzylidene)-b-D-thiogalactopyranoside, commonly known as EM4BMTB, represents a fascinating biomedical compound esteemed for its synthetic carbohydrate properties. Molecular formula: C32H38O8S. Mole weight: 582.70. | |
| Ethyl 2,3-di-O-(4-methoxybenzyl)-4,6-O-(4-methoxybenzylidene)-b-D-thiogalactopyranoside S-oxide | Ethyl 2,3-di-O-(4-methoxybenzyl)-4,6-O-(4-methoxybenzylidene)-b-D-thiogalactopyranoside S-oxide is a highly potent compound with abilities to target specific cellular pathways associated with disease progression. Molecular formula: C32H38O9S. Mole weight: 598.72. | |
| Ethyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-thiogalactopyranoside | Ethyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-thiogalactopyranoside is a compound commonly utilized as a precursor in the synthesis of various pharmaceutical compounds aimed at studying specific diseases. Synonyms: β-D-Galactopyranoside, ethyl 4,6-O-(phenylmethylene)-1-thio-, dibenzoate; Ethyl 4,6-O-benzylidene-1-thio-β-D-galactopyranoside 2,3-dibenzoate; (4aR,6S,7R,8S,8aS)-6-(Ethylthio)-2-phenylhexahydropyrano[3,2-d][1,3]dioxine-7,8-diyl dibenzoate. Grades: ≥95%. CAS No. 56119-30-3. Molecular formula: C29H28O7S. Mole weight: 520.59. | |
| Ethyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-thioglucopyranoside | Ethyl 2,3-di-O-benzoyl-4,6-O-benzylidene-b-D-thioglucopyranoside is an esteemed biomedical product renowned for facilitating the exploration of multifarious ailments encompassing cancer, inflammation, and diabetes. Molecular formula: C29H28O7S. Mole weight: 520.59. | |
| Ethyl 2,3-di-O-benzoyl-b-D-thiogalactopyranoside | Ethyl 2,3-di-O-benzoyl-b-D-thiogalactopyranoside is a valuable compound primarily employed in the synthesis of carbohydrates and glycosides for studying various cellular processes. This compound acts as a key intermediate in the development of drugs targeting carbohydrate metabolism-related diseases, such as diabetes and obesity. Synonyms: (2S,3R,4S,5S,6R)-2-(Ethylthio)-5-hydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4-diyl dibenzoate. CAS No. 154391-05-6. Molecular formula: C22H24O7S. Mole weight: 432.5. | |
| Ethyl 2,3-di-O-benzyl-4,6-O-benzylidene-a-D-thiomannopyranoside | Ethyl 2,3-di-O-benzyl-4,6-O-benzylidene-α-D-thiomannopyranoside, a compound found in biomedicine, holds immense significance in the treatment of diverse ailments. Its exceptional structure and properties position it as a promising contender for the creation of targeted therapeutic drugs. Meticulous investigation has demonstrated its potential efficacy in combating afflictions including cancer, diabetes, and cardiovascular maladies. CAS No. 218937-71-4. Molecular formula: C29H32O5S. Mole weight: 492.63. | |
| Ethyl 2,3-di-O-benzyl-4,6-O-benzylidene-a-D-thiomannopyranoside S-oxide | Ethyl 2,3-di-O-benzyl-4,6-O-benzylidene-a-D-thiomannopyranoside S-oxide is a crucial compound employed in biomedicine. With its unique structure, it plays a vital role in the development of new drugs for the treatment of various diseases. This compound exhibits promising potential in targeting specific enzymes and receptors associated with certain diseases, aiding in the exploration of novel therapeutic interventions. Synonyms: 2,3-Di-O-benzyl-4,6-O-benzylidene 1-deoxy-1-(ethylsulfinyl)-a-D-mannopyranose. CAS No. 188357-34-8. Molecular formula: C29H32O6S. Mole weight: 508.63. | |
| Ethyl 2,3-di-O-benzyl-4,6-O-benzylidene-b-D-thiogalactopyranoside | Ethyl 2,3-di-O-benzyl-4,6-O-benzylidene-b-D-thiogalactopyranoside is an extensively utilized compound in the biomedical industry widely employed as a substrate in enzymatic assays. It serves as a valuable tool for investigating antiviral activities against HIV and various other diseases. | |
| Ethyl 2,3-di-O-benzyl-4,6-O-benzylidene-b-D-thioglucopyranoside | Ethyl 2,3-di-O-benzyl-4,6-O-benzylidene-b-D-thioglucopyranoside, a pivotal compound in the realm of biomedicine, is employed for the synthesis of prospective pharmaceuticals in the battle against an array of ailments. CAS No. 141263-01-6. Molecular formula: C29H32O5S. Mole weight: 492.63. | |
| Ethyl 2,3-epoxypropanoate | Ethyl 2,3-epoxypropanoate. Group: Biochemicals. Grades: Highly Purified. CAS No. 4660-80-4. Pack Sizes: 500mg, 1g, 2g, 5g, 10g. Molecular Formula: C5H8O3. US Biological Life Sciences. | Worldwide |
| Ethyl 2-(3-fluoro-phenyl)-thiazole-5-carboxylate | Ethyl 2-(3-fluoro-phenyl)-thiazole-5-carboxylate. Group: Biochemicals. Alternative Names: 2-(3-Fluoro-phenyl)-thiazole-5-carboxylic acid ethyl ester. Grades: Highly Purified. CAS No. 886369-79-5. Pack Sizes: 250mg, 500mg, 1g, 2g, 5g. US Biological Life Sciences. | Worldwide |
| Ethyl 2-(3-fluoro-phenyl)-thiazole-5-carboxylate ≥95% (HPLC) | Ethyl 2-(3-fluoro-phenyl)-thiazole-5-carboxylate ≥95% (HPLC). Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 100mg, 250mg, 1g, 5g. US Biological Life Sciences. | Worldwide |
| Ethyl 2-[3-Fluoro- (trifluoromethyl) phenyl]-4-methyl-thiazole-5-carboxylate | Ethyl 2-[3-Fluoro- (trifluoromethyl) phenyl]-4-methyl-thiazole-5-carboxylate. Group: Biochemicals. Grades: Highly Purified. Pack Sizes: 50mg. US Biological Life Sciences. | Worldwide |
| Ethyl-2 3-Methyl Pyrazine | Ethyl-2 3-Methyl Pyrazine. CAS No. 15707-23-0. FEMA No. 3155. Kosher: Y. VIGON Item # 504548. Categories: Speciality Ingrdients Suppliers, Flavors, Fragrances, Perfumers. |  America & Internationally |
| ethyl 2-(3-(methylsulfonamido)-2-oxopyridin-1(2H)-yl)acetate | Heterocyclic Organic Compound. Alternative Names: 1184916-52-6, ethyl 2-(3-(methylsulfonamido)-2-oxopyridin-1(2H)-yl)acetate, AKOS015916835, KB-201175, FT-0651737, ST51055902, A803986, S02-0098, 2-[3-(methanesulfonamido)-2-oxo-1-pyridinyl]acetic acid ethyl ester, ethyl 2-[3-(methylsulfonylamino)-2-oxidanylidene-pyridin-1-yl]ethanoate. CAS No. 1184916-52-6. Molecular formula: C10H14N2O5S. Mole weight: 274.293560 [g/mol]. Purity: 0.96. IUPACName: ethyl 2-[3-(methanesulfonamido)-2-oxopyridin-1-yl]acetate. Catalog: ACM1184916526. | |
| Ethyl 2,3-O-isopropylidene-a-L-thiorhamnopyranoside | Ethyl 2,3-O-isopropylidene-a-L-thiorhamnopyranoside is a vital compound used in the biomedical industry for various purposes. It acts as a precursor molecule for synthesizing pharmaceutical drugs targeting diverse diseases, such as cancer, diabetes, and viral infections. Extensive research has shown its potential in drug design and development due to its unique chemical structure and pharmacological properties. CAS No. 145124-97-6. Molecular formula: C11H20O4S. Mole weight: 248.34. | |
| Ethyl 2-(4-(4-bromophenylsulfonyl)piperazinoacetate | Heterocyclic Organic Compound. Alternative Names: Ethyl 2-(4-((4-bromophenyl)sulfonyl)piperazin-1-yl)acetate, 1022353-79-2, AC1MQ2F6, CTK8B6447, Ethyl 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]acetate, ANW-53474, AKOS015900464, AK-92566, KB-50757, A-4188, I13-558, Ethyl 2- (4- (4-bromophenylsulfonyl) piperazinoacetate. CAS No. 1022353-79-2. Molecular formula: C14H19BrN2O4S. Mole weight: 391.3. Purity: 0.98. IUPACName: ethyl 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]acetate. Catalog: ACM1022353792. | |
| Ethyl 2-[(4,5-dichloro-2-nitrophenyl)oxy]acetate | Heterocyclic Organic Compound. CAS No. 1003878-22-5. Molecular formula: C10H9Cl2NO5. Mole weight: 294.08816;g/mol. Purity: 0.96. IUPACName: ethyl2-(4,5-dichloro-2-nitrophenoxy)acetate. Canonical SMILES: CCOC (=O)COC1=CC (=C (C=C1[N+] (=O)[O-])Cl)Cl. Catalog: ACM1003878225. | |
| Ethyl 2,4,6-tri-O-acetyl-3-O-benzyl-b-D-thioglucopyranoside | Ethyl 2,4,6-tri-O-acetyl-3-O-benzyl-b-D-thioglucopyranoside is a highly intricate compound displaying noteworthy antimicrobial attributes, rendering it a fundamental constituent in the formulation of antiviral and antibacterial medications. Molecular formula: C21H28O8S. Mole weight: 440.51. | |
| Ethyl 2,4,6-tri-O-acetyl-a-D-thiomannopyranoside | Ethyl 2,4,6-tri-O-acetyl-α-D-thiomannopyranoside, a highly esteemed compound extensively employed in pharmaceutical intermediate synthesis, exhibiting paramount importance in the research of diverse ailments such as cancer, neurological disorders, and infectious diseases. Synonyms: Ethyl 1-thio-a-D-mannopyranoside 2,4,6-triacetate. CAS No. 1637783-63-1. Molecular formula: C14H22O8S. Mole weight: 350.39. | |
| Ethyl 2,4,6-tri-O-benzoyl-a-D-thiomannopyranoside | Ethyl 2,4,6-tri-O-benzoyl-a-D-thiomannopyranoside is a valuable compound widely utilized in the biomedical industry. This product plays a crucial role in the research and development of drugs targeting various diseases, including cancer, diabetes and infectious diseases. Molecular formula: C29H28O8S. Mole weight: 536.59. | |
| Ethyl 2,4,6-tri-O-benzoyl-b-D-thiogalactopyranoside | Ethyl 2,4,6-tri-O-benzoyl-b-D-thiogalactopyranoside is a synthetic compound functioning as a substrate or inhibitor of specific enzymes involved in carbohydrate metabolism. It contributes to biochemical research on various diseases such as diabetes and cancer. Synonyms: Ethyl-b-D-thiogalactopyranoside 2,4,6-tribenzoate; ETBTG. CAS No. 1423018-01-2. Molecular formula: C29H28O8S. Mole weight: 536.59. | |
| Ethyl 2-(4-aminobenzyl)propanoate | Heterocyclic Organic Compound. Alternative Names: ethyl 3-(4-aminophenyl)-2-methylpropanoate, 1234846-44-6, SureCN2432711, CTK8D3754, Ethyl2-(4-aminobenzyl)propanoate, MolPort-019-878-820, ethyl 2-(4-aminobenzyl)propanoate, AKOS015890914, AK-41954, KB-252154, A25922, I01-8722, 4-Amino-alpha-methylbenzenepropanoic acid ethyl ester. CAS No. 1234846-44-6. Molecular formula: C12H17NO2. Mole weight: 207.268880 [g/mol]. Purity: 0.96. IUPACName: ethyl 3-(4-aminophenyl)-2-methylpropanoate. Canonical SMILES: CCOC(=O)C(C)CC1=CC=C(C=C1)N. Catalog: ACM1234846446. | |
| Ethyl 2,4'-bipyridine-6-carboxylate | Nitrogen-Donor Ligands. CAS No. 1214382-54-3. Molecular formula: C13H12N2O2. Mole weight: 228.25. IUPACName: ethyl 6-pyridin-4-ylpyridine-2-carboxylate. Catalog: ACM1214382543. | |
| Ethyl 2-(4-bromophenyl)-2,2-difluoroacetate | Heterocyclic Organic Compound. CAS No. 1004305-97-8. Molecular formula: C10H9BrF2O2. Purity: 0.98. Catalog: ACM1004305978. | |
| ethyl 2-(4-butoxy-3-cyanophenyl)-4-methylthiazole-5-carboxylate | ethyl 2-(4-butoxy-3-cyanophenyl)-4-methylthiazole-5-carboxylate is an impurity of Febuxostat. Febuxostat is an antihyperuricemic nonpurine inhibitor of both the oxidized and reduced forms of xanthine oxidase. CAS No. 2230270-05-8. Molecular formula: C18H20N2O3S. Mole weight: 344.43. | |
| Ethyl 2-(4-Butoxy-3-cyanophenyl)-4-methylthiazole-5-carboxylate | Ethyl 2-(4-Butoxy-3-cyanophenyl)-4-methylthiazole-5-carboxylate. Uses: For analytical and research use. Group: Impurity standards. Pack Sizes: 10MG. Catalog: APS008015. Format: Neat. Shipping: Room Temperature. |  |
| ethyl 2-(4-butoxy-3-formylphenyl)-4-methylthiazole-5-carboxylate | ethyl 2-(4-butoxy-3-formylphenyl)-4-methylthiazole-5-carboxylate is an impurity of Febuxostat. Febuxostat is an antihyperuricemic nonpurine inhibitor of both the oxidized and reduced forms of xanthine oxidase. Synonyms: Ethyl 2-(4-butoxy-3-formylphenyl)-4-methylthiazole-5-carboxylate; A934076; Ethyl2-(4-butoxy-3-formylphenyl)-4-methylthiazole-5-carboxylate. CAS No. 2230270-03-6. Molecular formula: C18H21NO4S. Mole weight: 347.43. | |
| Ethyl 2-(((4-carbamimidoylphenyl)amino)methyl)-1-methyl-1H-benzo[d]imidazole-5-carboxylate Hydrochloride | An impurity of Dabigatran. Dabigatran is a very potent anticoagulant, showing that the terminal phenyl can be substituted by the more hydrophilic 2-pyridyl group without substantial loss of activity. Synonyms: 2-[[[4- (Aminoiminomethyl) phenyl]amino]methyl]-1-methyl-1H-benzimidazole-5-carboxylic Acid Ethyl Ester Hydrochloride; Dabigatran impurity 14. Grades: ≥95%. CAS No. 1422435-39-9. Molecular formula: C19H22ClN5O2. Mole weight: 387.86. | |
| Ethyl 2-(4-(chloromethyl)pyridin-3-yloxy)acetate | Ethyl 2-(4-(chloromethyl)pyridin-3-yloxy)acetate. Group: Biochemicals. Grades: Reagent Grade. Pack Sizes: 100mg, 250mg, 1g, 2.5g. US Biological Life Sciences. | Worldwide |
| Ethyl 2- (4-chlorophenoxy) carbanilate | Ethyl 2- (4-chlorophenoxy) carbanilate. Group: Biochemicals. Alternative Names: 2- (4-Chlorophenoxy) phenyl]carbamic acid ethyl ester; o- (p-Chlorophenoxy) carbanilic acid ethyl ester. Grades: Highly Purified. CAS No. 31879-60-4. Pack Sizes: 5mg, 10mg, 25mg, 50mg, 100mg. Molecular Formula: C15H14ClNO3. US Biological Life Sciences. | Worldwide |
| Ethyl 2-(4-Chlorophenoxy)carbanilate | Ethyl 2-(4-Chlorophenoxy)carbanilate. Uses: For analytical and research use. Group: Impurity standards. CAS No. 31879-60-4. Pack Sizes: 10MG. Molecular Formula: C15H14ClNO3. Mole Weight: 291.73. Catalog: APS31879604. Format: Neat. Shipping: Room Temperature. | |
| Ethyl 2-(4-chlorophenylamino)-4,9-dioxo-4,9-dihydronaphtho[2,3-b]thiophene-3-carboxylate | Heterocyclic Organic Compound. Alternative Names: 1258638-44-6, AKOS015949537, RP08079, FT-0685192, Ethyl 2-(4-chlorophenylamino)-4,9-dioxo-4,9-dihydronaphtho[2,3-b]thiophene-3-carboxylate, ethyl 2-[(4-chlorophenyl)amino]-4,9-dioxonaphtho[2,3-b]thiophene-3-carboxylate. CAS No. 1258638-44-6. Molecular formula: C21H14ClNO4S. Mole weight: 411.864. Purity: 0.96. IUPACName: ethyl 2-(4-chloroanilino)-4,9-dioxobenzo[f][1]benzothiole-3-carboxylate. Canonical SMILES: CCOC (=O)C1=C (SC2=C1C (=O)C3=CC=CC=C3C2=O)NC4=CC=C (C=C4)Cl. Catalog: ACM1258638446. | |
| Ethyl 2,4-Decadienoate | Ethyl 2,4-Decadienoate (Pear Ester). CAS No. 3025-30-7. FEMA No. 3148. Kosher: Y. VIGON Item # 501573. Categories: Speciality Ingrdients Suppliers, Flavors, Fragrances, Perfumers. | America & Internationally |
| Ethyl 2,4-Decadienoate Natural | Ethyl 2,4-Decadienoate Natural. CAS No. 3025-30-7. FEMA No. 3148. Kosher: Y. VIGON Item # 503312. Categories: Speciality Ingrdients Suppliers, Flavors, Fragrances, Perfumers, Aromatherapy, Essetial Oils. | America & Internationally |
Our database is helping our users find suppliers everyday.
