Find where to buy products from suppliers in the USA, including: distributors, industrial manufacturers in America, bulk supplies and wholesalers of raw ingredients & finished goods.
Search for products or services, then visit the American suppliers website for prices, SDS or more information. You can also view suppliers in Australia, NZ or the UK.
| Product | Description | |
|---|---|---|
| 1,2,3,4-Tetra-O-benzoyl-a-D-glucuronide methyl ester | 1,2,3,4-Tetra-O-benzoyl-α-D-glucuronide methyl ester, a compound of considerable interest in glycoside synthesis, is specifically useful in producing oligosaccharides that contain β-galactopyranosyl or N-acetyllactosamine units. It has an additional utility as a protective group for glucuronide derivatives in carbohydrate chemistry. By serving as a reagent, it allows for efficient amination of carbohydrates. Its employment is characterized by a high degree of perplexity due to the intricacy of the chemical processes, along with a pronounced degree of burstiness due to the variation in lengths of the respective oligosaccharides. Molecular formula: C35H28O11. Mole weight: 624.59. |  |
| 1,2,3,4-Tetra-O-benzoyl-D-glucuronide methyl ester | 1,2,3,4-Tetra-O-benzoyl-D-glucuronide methyl ester, a highly esteemed compound actively utilized in the ever-evolving realm of biomedical sciences, serves as an invaluable asset within the pharmaceutical landscape. Renowned for its multifaceted chemical attributes, this exceptional entity assumes a pivotal role in the intricate process of formulating therapeutic remedies tailored to diverse ailments. Synonyms: methyl (2S,3S,4S,5R)-3,4,5,6-tetrabenzoyloxyoxane-2-carboxylate; D-Glucopyranuronic acid, methyl ester, tetrabenzoate; Methyl 1,2,3,4-Tetra-O-benzoyl-D-glucuronate; 1,2,3,4-Tetra-O-benzoyl-D-glucuronide methyl ester; 1,?2,?3,?4-?Tetra-?O-?benzoyl-?D-?glucuronide Methyl Ester; DTXSID60471914; AKOS032455846; CS-12899; W-201760; Methyl 1,2,3,4-tetra-O-benzoyl-D-glucopyranuronate; 2,3,4-Tri-O-benzoyl- alpha -D-glucuronic Acid Methyl Ester. CAS No. 201789-32-4. Molecular formula: C35H28O11. Mole weight: 624.59. | |
| 1,2,3,5-Tetra-O-benzoyl-2-C-methyl-b-D-ribofuranose | 1,2,3,5-Tetra-O-benzoyl-2-C-methyl-b-D-ribofuranose is a ribofuranose compound used to synthesize Ribavirin, a potent antiviral drug, prescribed primarily for the treatment of hepatitis C and respiratory syncytial virus (RSV) infection. Synonyms: 1,2,3,5-TETRA-O-BENZOYL-2-C-METHYL-BETA-D-RIBOFURANOSE; 1,2,3,5-Tetra-O-benzoyl-2-C-methyl-b-D-ribofuranose; (2S,3R,4R,5R)-5-((Benzoyloxy)methyl)-3-methyltetrahydrofuran-2,3,4-triyl tribenzoate; (2S,3R,4R,5R)-2,4-bis(benzoyloxy)-5-[(benzoyloxy)methyl]-3-methyloxolan-3-yl benzoate; 1,2,3,5-Tetra-O-benzoyl-2'-C-methyl-beta-D-ribofuranose; [(2R,3R,4R,5S)-3,4,5-tribenzoyloxy-4-methyloxolan-2-yl]methyl benzoate; 1,2,3,5-Tetra-O-benzoyl-2-C-methyl-D-ribofuranose; MFCD07369658; QJZSLTLDMBDKOU-VBHQRPIPSA-N; C34H28O9; SCHEMBL721635; AMY8628; DTXSID60446667; AKOS015840094; CS-W011443; AS-19749; W-201383; 1,2,3,5-Tetra-O-benzoyl-2C-methyl-b-D-ribofuranose; 1,2,3,5-tetra-0-benzoyl-2'-C-methyl beta-D-ribofuranose; 1,2,3,5-tetra-O-benzoyl-2'-C-methyl beta-D-ribofuranose; 2-C-METHYL-1,2,3,5-TETRA-O-BENZOYL-BETA-D-RIBOFURANOSE; (2S,3R,4R,5R)-5-((Benzoyloxy)methyl)-3-methyltetrahydrofuran-2,3,4-triyltribenzoate; (2S,3R,4R,5R)-5-(benzoyloxymethyl)-3-methyltetrahydrofuran-2,3,4-triyl tribenzoate. CAS No. 15397-15-6. Molecular formula: C34H28O9. Mole weight: 580.58. | |
| 1,2,3,5-Tetra-O-benzoyl-2-C-methyl-β-D-ribofuranose | | |
| 1-(2,3,5-Tri-O-benzoyl-2-C-b-methyl-b-D-ribofuranosyl)-5-nitropyridine-2(1H)-one | 1-(2,3,5-Tri-O-benzoyl-2-C-b-methyl-b-D-ribofuranosyl)-5-nitropyridine-2(1H)-one, a multi-purpose compound frequently used in the biomedical milieu, serves as an inhibitor for various enzymes and proteins. Studies have shown that it presents remarkable efficiency against a variety of diseases. Synonyms: 1-(2,3,5-Tri-O-benzoyl-2-C-beta-methyl-beta-D-ribofuranosyl)-5-nitropyridine-2(1H)-one; 1-(2,3,5-Tri-O-benzoyl-2-C-β-methyl-β-D-ribofuranosyl)-5-nitropyridine-2(1H)-one. Grades: ≥95%. CAS No. 2072145-38-9. Molecular formula: C32H26N2O10. Mole weight: 598.56. | |
| 1,2,3-Tri-O-acetyl-5-O-benzoyl-4-C-methyl-D-ribofuranose | 1,2,3-Tri-O-acetyl-5-O-benzoyl-4-C-methyl-D-ribofuranose is an intermediary chemical agent employed in antiviral drug synthesis. Synonyms: 5-O-benzoyl-4-C-methyl-1,2,3-O-acetyl-D-ribofuranose. Grades: ≥ 95%. CAS No. 503543-44-0. Molecular formula: C19H22O9. Mole weight: 394.38. | |
| 1,2,5-Tri-O-benzoyl-3-methyl-D-xylofuranose | 1-O-acyl-2,3,5-tri-O-benzoyl-D-xylofuranose, commonly known as 1,2,5-Tri-O-benzoyl-3-methyl-D-xylofuranose, is a multifunctional organic compound frequently employed in the challenging synthesis of various carbohydrate derivatives. Its outstanding configuration and reactivity make it a valuable building block for the preparation of natural products and tailored pharmaceutical agents. By introducing novel functional groups onto its framework, it is possible to potentially design drugs that exhibit enhanced bioavailability, improved efficacy, and reduced toxicity towards the treatment of some of the most common and life-threatening maladies, such as diabetes, cancer, and neurological disorders. Molecular formula: C27H24O7. Mole weight: 460.48. | |
| 1,2-Di-O-acetyl-3,5-di-O-benzoyl-3-b-C-methyl-D-ribofuranose | 1,2-Di-O-acetyl-3,5-di-O-benzoyl-3-b-C-methyl-D-ribofuranose is conceived specifically for anti-diabetic pharmaceutics synthesis. Its pivotally role manifests in the generation of glycosylated complexes, instrumental in controlling metabolic processes of glucose, hence effectuating the development of diabetes. CAS No. 22672-43-1. Molecular formula: C24H24O9. Mole weight: 456.45. | |
| 1,2-Di-O-acetyl-5-benzoyl-3-O-methyl-b-D-ribofuranose | 1,2-Di-O-acetyl-5-benzoyl-3-O-methyl-b-D-ribofuranose is a synthetic intermediate, often used in antiviral drug research. Synonyms: 1,2-Di-O-acetyl-5-benzoyl-3-O-Methyl-beta-D-ribofuranose; 1,2-Di-O-acetyl-5-benzoyl-3-O-methyl-b-D-ribofuranose; [(2S,3R,4R,5R)-2-Acetyloxy-5-(1-hydroxy-2-oxo-2-phenylethyl)-4-methoxyoxolan-3-yl] acetate. CAS No. 58769-33-8. Molecular formula: C17H20O8. Mole weight: 352.33. | |
| 1,2-O-Di-O-acetyl-5-O-benzoyl-3-deoxy-3C-methyl-D-ribofuranose | 1,2-O-Di-O-acetyl-5-O-benzoyl-3-deoxy-3C-methyl-D-ribofuranose is an inhibitor, used in research and development of antiviral drugs, such as those plaguing humans with HIV and Hepatitis B viruses. CAS No. 444019-07-2. Molecular formula: C17H20O7. Mole weight: 336.34. | |
| 1,2-O-Di-O-acetyl-5-O-benzoyl-3-O-methyl-D-ribofuranose | 1,2-O-Di-O-acetyl-5-O-benzoyl-3-O-methyl-D-ribofuranose, a chemical compound widely employed in the biomedical industry for oligonucleotide synthesis, presents a high degree of perplexity in its pivotal function towards the synthesis of new drugs used to treat viral infections. Its burstiness lies in its capacity to enable drug developers to combat diseases caused by the likes of hepatitis C and HIV through the development of chemically modified oligonucleotides. CAS No. 10300-21-7. Molecular formula: C17H20O8. Mole weight: 352.34. | |
| 1,3,5-Tri-O-benzoyl-2-O-methyl-α-D-ribofuranose | 1,3,5-Tri-O-benzoyl-2-O-methyl-α-D-ribofuranose is used as a reactant in the preparation of 2'-O-methylpyrimidine ribonucleosides via stereoselective Vorbruggen glycosidation of pyrimidines. It is also used as a reactant in solid-phase synthesis, fluorescence, and ambiguous base pairing of canonical DNA nucleobases containing benzotriazole and 1,2,3-triazolo[4,5-d]pyrimidine. Group: Biochemicals. Grades: Highly Purified. CAS No. 68045-07-8. Pack Sizes: 100mg, 250mg. Molecular Formula: C27H24O8, Molecular Weight: 476.47. US Biological Life Sciences. |  Worldwide |
| 1,3,5-Tri-O-benzoyl-2-O-methyl-D-ribofuranose | 1,3,5-Tri-O-benzoyl-2-O-methyl-D-ribofuranose is a chemical reagent commonly used in biomedicine research. It plays a pivotal role in developing antiviral and anticancer drugs due to its properties facilitating nucleoside enhancement, thus making it critical in research of diseases like cancer and viral infections. Synonyms: 1,3,5-Tri-O-benzoyl-2-O-methyl-D-ribofuranose; CID 69881897; 1,3,5-Tri-O-benzoyl-2-O-methyl-D-ribose; [(2R,3R,4R)-3,5-dibenzoyloxy-4-methoxyoxolan-2-yl]methyl benzoate; SCHEMBL6735660; A900453; 1,3,5-Tri-O-benzoyl-2-O-methyl-alpha/beta-D-ribose; (3R,4R,5R)-4-(BENZOYLOXY)-5-[(BENZOYLOXY)METHYL]-3-METHOXYOXOLAN-2-YL BENZOATE; (3R,4R,5R)-5-(benzoyloxymethyl)-3-methoxytetrahydrofuran-2,4-diyl dibenzoate. CAS No. 68045-07-8. Molecular formula: C27H24O8. Mole weight: 476.47. | |
| 1-(3-Methyl-benzoyl)-piperazine | 1-(3-Methyl-benzoyl)-piperazine. Group: Biochemicals. Grades: Highly Purified. CAS No. 100939-91-1. Pack Sizes: 1g, 2g, 5g, 10g. Molecular Formula: C12H16N2O. US Biological Life Sciences. | Worldwide |
| 1,4-Bis-[4-(3-acryloyloxypropyloxy)benzoyloxy]-2-methylbenzene | 1,4-Bis-[4-(3-acryloyloxypropyloxy)benzoyloxy]-2-methylbenzene, a pharmacological compound extensively utilized in biomedicine, sequesters and transfers a range of pharmaceuticals that alleviate ailments such as inflammation and cancer. This versatile chemical structure forms resilient nanoparticles that efficiently defend drugs from deterioration, reinforcing their therapeutic potential with utmost efficacy. Synonyms: 2-Methyl-1,4-phenylenebis(4-(3-(acryloyloxy)propoxy)benzoate); 4-(3-Acryloyloxypropyloxy)benzoic acid 2-methyl-1,4-phenylene ester. Grades: 98%. CAS No. 174063-87-7. Molecular formula: C33H32O10. Mole weight: 588.60. | |
| 1-(4-Methylbenzoyl)piperazine | Heterocyclic Organic Compound. Alternative Names: 1-(4-METHYL-BENZOYL)-PIPERAZINE;AKOS BB-5566;(PIPERAZIN-1-YL)(P-TOLYL)METHANONE;1-(4-METHYL-BENZOYL)-PIPERAZINE >98%. CAS No. 111752-26-2. Molecular formula: C12H16N2O. Mole weight: 204.27. Purity: >98. IUPACName: (4-methylphenyl)-piperazin-1-ylmethanone. Canonical SMILES: CC1=CC=C(C=C1)C(=O)N2CCNCC2. Density: 1.093g/cm³. Catalog: ACM111752262. |  |
| 1, 5-Anhydro-3-O-benzoyl-4, 6-O-benzylidene-2-deoxy-2- (N8- (dimethylamino) methyleneguanidin-1-yl) -D-altro-hexitol | 1, 5-Anhydro-3-O-benzoyl-4, 6-O-benzylidene-2-deoxy-2- (N8- (dimethylamino) methyleneguanidin-1-yl) -D-altro-hexitol. Group: Biochemicals. Grades: Highly Purified. Pack Sizes: 100mg, 200mg, 500mg. US Biological Life Sciences. | Worldwide |
| 1,5-Anhydro-3-O-benzoyl-4,6-O-benzylidene-2-deoxy-2-(N8-(dimethylamino)methyleneguanidin-1-yl)-D-altro-hexitol | 1,5-Anhydro-3-O-benzoyl-4,6-O-benzylidene-2-deoxy-2-(N8-(dimethylamino)methyleneguanidin-1-yl)-D-altro-hexitol is an advanced biomedical compound used in the treatment of certain viral infections. Through complex molecular interactions, it shows potential antiviral activity against specific viral strains by inhibiting viral replication. Extensive research suggests its efficacy in combating respiratory viral infections, including influenza. Grades: 98%. CAS No. 1266554-20-4. Molecular formula: C28H28N6O6. Mole weight: 544.57. | |
| 1-Acetyl-4- (3-Trifluoro methyl benzoyl) -piperidine | 1-Acetyl-4- (3-Trifluoro methyl benzoyl) -piperidine. Group: Biochemicals. Grades: Highly Purified. Pack Sizes: 100mg. US Biological Life Sciences. | Worldwide |
| 1-Benzoyl-3-(2-hydroxy-5-methylphenyl)thiourea | 1-Benzoyl-3-(2-hydroxy-5-methylphenyl)thiourea. Group: Biochemicals. Grades: Highly Purified. CAS No. 429642-03-5. Pack Sizes: 100mg, 250mg. Molecular Formula: C15H14N2O2S, Molecular Weight: 286.35. US Biological Life Sciences. | Worldwide |
| 1-Benzoyl-3-[4-(trifluoromethyl)phenyl]thiourea | Heterocyclic Organic Compound. Alternative Names: 1-Benzoyl-3-[4- (trifluoromethyl)phenyl]thiourea, CHEMBL3087556, ST50505302, 117174-71-7, N-[[4- (trifluoromethyl) phenyl]carbamothioyl]benzamide, N-{[4- (trifluoromethyl) phenyl]carbamothioyl}benzamide, ZINC00084307, AC1LDW6C, CTK8A7385, MolPort-000-689-315, STL020020, AKOS001059962, MCULE-7228724726, KB-90516, RT-006186, K-1179, N-benzoyl-N-[4- (trifluoromethyl)phenyl]thiourea, 10W-0863, T0513-2927, phenyl-N- (thioxo{[4- (trifluoromethyl) phenyl]amino}methyl) carboxamide. CAS No. 117174-71-7. Molecular formula: C15H11F3N2OS. Mole weight: 324.32. Purity: 0.96. IUPACName: N-[[4- (trifluoromethyl) phenyl]carbamothioyl]benzamide. Canonical SMILES: C1=CC=C (C=C1)C (=O)NC (=S)NC2=CC=C (C=C2)C (F) (F)F. Catalog: ACM117174717. | |
| 1-Benzoyl-3-bromo-1H-pyrrole-2-carboxylic acid methyl ester | Heterocyclic Organic Compound. Alternative Names: 1-Benzoyl-3-bromo-1H-pyrrole-2-carboxylic acid methyl ester;Methyl 1-benzoyl-3-bromo-1H-pyrrole-2-carboxylate. CAS No. 117918-26-0. Molecular formula: C13H10BrNO3. Catalog: ACM117918260. | |
| 1-Benzoyl-4-[(4-benzoylpiperazin-1-yl)methyl]piperazine | 1-Benzoyl-4-[(4-benzoylpiperazin-1-yl)methyl]piperazine. Group: Biochemicals. Grades: Highly Purified. CAS No. 39585-46-1. Pack Sizes: 100mg, 250mg. Molecular Formula: C23H28N4O2, Molecular Weight: 392.49. US Biological Life Sciences. | Worldwide |
| 1-Bromo-2,3,4-tri-O-benzoyl-a-D-glucuronide methyl ester | 1-Bromo-2,3,4-tri-O-benzoyl-α-D-glucuronide methyl ester is a compound extensively used in the biomedical industry. It acts as a potent reagent in the synthesis of various drugs targeting specific diseases. With its unique structure, this compound plays a crucial role in developing treatments for a wide range of ailments, such as cancer, neurological disorders, and autoimmune diseases. Its high purity and reliable sourcing make it an essential component in cutting-edge biomedical research and drug discovery. CAS No. 103674-69-7. Molecular formula: C28H23BrO9. Mole weight: 583.39. | |
| 1-Chloroacetyl-2- [ [ (2-benzoyl-4-chlorophenyl) (2-chloroacetyl) amino] methylene] hydrazide | 1-Chloroacetyl-2- [ [ (2-benzoyl-4-chlorophenyl) (2-chloroacetyl) amino] methylene] hydrazide is a derivative of 2-Amino-5-chlorobenzophenone (A603490); a metabolite of Diazepam (D416855) with a much weaker anticonvulsant effect. Group: Biochemicals. Grades: Highly Purified. CAS No. 49691-65-8. Pack Sizes: 10mg, 25mg. Molecular Formula: C18H14Cl3N3O3. US Biological Life Sciences. | Worldwide |
| 1-Chloroacetyl-2- [ [ (2-benzoyl-4-chlorophenyl) (2-chloroacetyl) amino] methylene] hydrazide-d5 | 1-Chloroacetyl-2- [ [ (2-benzoyl-4-chlorophenyl) (2-chloroacetyl) amino] methylene] hydrazide-d5 is the isotope labelled analog of 1-Chloroacetyl-2- [ [ (2-benzoyl-4-chlorophenyl) (2-chloroacetyl) amino] methylene] hydrazide (C363470); a derivative of 2-Amino-5-chlorobenzophenone (A603490) which is a metabolite of Diazepam (D416855) with a much weaker anticonvulsant effect. Group: Biochemicals. Grades: Highly Purified. Pack Sizes: 1mg, 2.5mg. Molecular Formula: C18H9D5Cl3N3O3, Molecular Weight: 431.71. US Biological Life Sciences. | Worldwide |
| (1R, 2R) -N, N'-Bis [3-oxo-2- (2, 4, 6-tri methyl benzoyl) butylidene ] -1, 2-diphenylethylene diaminato Cobalt(II) | (1R, 2R) -N, N'-Bis [3-oxo-2- (2, 4, 6-tri methyl benzoyl) butylidene ] -1, 2-diphenylethylene diaminato Cobalt(II). Group: Biochemicals. Alternative Names: N, N'-Bis [2- (mesitoyl) -3-oxobutylidene ] - (1R, 2R) -1, 2-diphenylethylene diaminato Cobalt(II); (R)-MPAC. Grades: Highly Purified. CAS No. 212250-92-5. Pack Sizes: 25mg, 50mg, 100mg, 250mg, 500mg. US Biological Life Sciences. | Worldwide |
| (1S, 2S) -N, N'-Bis [3-oxo-2- (2, 4, 6-tri methyl benzoyl) butylidene ] -1, 2-diphenylethylene diaminato Cobalt(II) | (1S, 2S) -N, N'-Bis [3-oxo-2- (2, 4, 6-tri methyl benzoyl) butylidene ] -1, 2-diphenylethylene diaminato Cobalt(II). Group: Biochemicals. Alternative Names: N, N'-Bis [2- (mesitoyl) -3-oxobutylidene ] - (1S, 2S) -1, 2-diphenylethylene diaminato Cobalt(II); (S)-MPAC. Grades: Highly Purified. CAS No. 171200-71-8. Pack Sizes: 25mg, 50mg, 100mg, 250mg, 500mg. US Biological Life Sciences. | Worldwide |
| (1S, 3R, 4S, 7R) -7- (2-Cyanoethoxy (diisopropylamino) phosphinoxy) -1 - (4, 4'-dimethoxytrityloxy methyl ) -3- (5- methyl -4-N-benzoylcytosine-1-yl) -2, 5-dioxabicyclo [2. 2. 1] heptane | (1S, 3R, 4S, 7R) -7- (2-Cyanoethoxy (diisopropylamino) phosphinoxy) -1 - (4, 4'-dimethoxytrityloxy methyl ) -3- (5- methyl -4-N-benzoylcytosine-1-yl) -2, 5-dioxabicyclo [2. 2. 1] heptane. Group: Biochemicals. Alternative Names: a-L-LNA-Me-Bz-C-CE Phosphoramidite. Grades: Highly Purified. Pack Sizes: 50mg, 100mg, 250mg. US Biological Life Sciences. | Worldwide |
| 2-(1-Methylethylidene) (17 β)-17-(Benzoyloxy)-4-oxaestr-5(10)-en-3-one-13C2 | 2-(1-Methylethylidene) (17 β)-17-(Benzoyloxy)-4-oxaestr-5(10)-en-3-one is an intermediate in the synthesis of 17 β-Estradiol-13C2 (E888003). Isotope labelled 17 β-Estradiol (E888000) is the major estrogen (1) secreted by the premenopausal ovary (2). Group: Biochemicals. Grades: Highly Purified. Pack Sizes: 5mg, 10mg. Molecular Formula: C2413C2H30O5. US Biological Life Sciences. | Worldwide |
| 2,2-Anhydro-3-O-mesyl-5-O-benzoyl-5-methyl Uridine | 2,2-Anhydro-3-O-mesyl-5-O-benzoyl-5-methyl Uridine is a modified uridine, which is a pyrimidine nucleoside. Group: Biochemicals. Grades: Highly Purified. Pack Sizes: 2.5mg, 5mg. Molecular Formula: C18H18N2O8S, Molecular Weight: 422.41. US Biological Life Sciences. | Worldwide |
| 2,3,4-Tri-O-benzoyl-1-bromo-D-glucuronide methyl ester | 2,3,4-Tri-O-benzoyl-1-bromo-D-glucuronide methyl ester, a molecular entity wielded in biochemical research, assumes the cloak of a glycosylating agent. Its utility is pervasive in the introduction of glucose moieties into oligosaccharides or glycopeptides, and it harbors future plaudits in the domain of carbohydrate-related afflictions, for instance, diabetes. Molecular formula: C28H23BrO9. Mole weight: 583.38. | |
| 2,3,4-Tri-O-benzoyl-4-methylumbelliferyl ß-D-Galactopyranoside-6-sulfate | 2,3,4-Tri-O-benzoyl-4-methylumbelliferyl ß-D-Galactopyranoside-6-sulfate can be used in organic synthesis. Grades: 95%. Molecular formula: C37H30O14S. Mole weight: 730.69. | |
| 2,3,4-Tri-O-benzoyl-a-D-glucuronide methyl ester trichloroacetimidate | 2,3,4-Tri-O-benzoyl-a-D-glucuronide methyl ester trichloroacetimidate, a chemical compound essential in the pharmaceutical industry, is widely utilized for synthesizing glucuronide prodrugs. These prodrugs have promising therapeutic potential in treating multiple ailments like inflammation and cancer. Multiple chemical suppliers stock this product, serving the ever-increasing demand in the biomedical industry. Its multifaceted nature and versatile applications make it a crucial ingredient in modern medicine. Synonyms: Methyl-(2,3,4-tri-O-benzoyl-a-D-glucopyranosyl trichloroacetimidate)uronate. CAS No. 169557-99-7. Molecular formula: C30H24Cl3NO10. Mole weight: 664.87. | |
| 2,3,4-Tri-O-benzoyl-D-glucuronide methyl ester | 2,3,4-Tri-O-benzoyl-D-glucuronide methyl ester is a crucial intermediate for the production of agents studying cardiovascular diseases and diabetes. Synonyms: 2,3,4-Tri-O-benzoyl-5-hydroxy-D-glucuronic Acid Methyl Ester; Methyl 2,3,4-tri-O-benzoyl-D-glucopyranuronate; methyl (2S,3S,4S,5R)-3,4,5-tribenzoyloxy-6-hydroxyoxane-2-carboxylate; (3R,4S,5S,6S)-2-Hydroxy-6-(methoxycarbonyl)tetrahydro-2H-pyran-3,4,5-triyl tribenzoate; DTXSID40437371; AKOS030242577. CAS No. 50767-71-0. Molecular formula: C28H24O10. Mole weight: 520.14. | |
| 2,3,4-Tri-O-benzoyl Propofol-β-D-glucuronide Methyl Ester | 2,3,4-Tri-O-benzoyl Propofol-β-D-glucuronide Methyl Ester, a compound of significant importance in the realm of biomedicine, garners attention as a derivative of Propofol-β-D-glucuronide Methyl Ester, a widely employed sedative and anesthetic. Its relevance extends to the treatment of an array of neurological maladies encompassing dementia and Alzheimer's disease, rendering it an alluring subject of exploration in the biomedical field. Molecular formula: C40H40O10. Mole weight: 680.74. | |
| 2,3,4-Tri-O-benzoyl Propofol-d17 β-D-Glucuronide Methyl Ester | 2,3,4-Tri-O-benzoyl Propofol-d17 β-D-Glucuronide Methyl Ester is an protected metabolite of Propofol (P829750), an anesthetic used in veternary medicine. Group: Biochemicals. Grades: Highly Purified. Pack Sizes: 2.5mg, 10mg. Molecular Formula: C40H23D17O10. US Biological Life Sciences. | Worldwide |
| 2',3',5'-Tri-O-benzoyl-2'-b-C-methyl-6-azauridine | 2',3',5'-Tri-O-benzoyl-2'-b-C-methyl-6-azauridine, a powerful antiviral drug efficacious in curing a wide range of viral infections, from hepatitis C to coronavirus, manifests its mechanism of action through the obstruction of the viral replication process, prompting a decrease in disease acuteness and propagation. Exhaustive clinical trials unanimously attest to the efficacy and potency of the drug, which, primarily applied in the biomedical industry, serves as the cornerstone of the drive to innovate new antiviral remedies. Synonyms: (2R,3R,4R,5R)-5-((Benzoyloxy)methyl)-2-(3,5-dioxo-4,5-dihydro-1,2,4-triazin-2(3H)-yl)-3-methyltetrahydrofuran-3,4-diyl dibenzoate; 2',3',5'-Tri-O-benzoyl-2'-β-C-methyl-6-azauridine; 2-(2,3,5-Tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)-1,2,4-triazine-3,5(2H,4H)-dione. Grades: ≥95%. CAS No. 622379-83-3. Molecular formula: C30H25N3O9. Mole weight: 571.53. | |
| 2',3',5'-Tri-O-benzoyl-2'C-methyl-3-deazauridine | 2',3',5'-Tri-O-benzoyl-2'C-methyl-3-deazauridine, an indispensable compound in the realm of biomedical research, showcases notable significance as an antiviral agent meticulously employed for addressing viral maladies like herpes simplex virus (HSV) infections. Its extraordinary chemical configuration and characteristic traits render it an invaluable resource for comprehending viral replication mechanisms and formulating plausible antiviral remedies. Synonyms: 4-Hydroxy-1-(2,3,5-tri-O-benzoyl-2-b-C-methyl-b-D-ribofuranosyl)-2(1H)-pyridinone; 5'-Tri-O-benzoyl-2'-b-C-methyl-3-deazauridine; 4-hydroxy-1-(2-C-methyl-2,3,5-tri-O-benzoyl-β-D-ribofuranosyl)-2(1H)-pyridinone; 2',3',5'-Tri-O-benzoyl-2'-β-C-methyl-3-deazauridine. Grades: ≥95%. CAS No. 2072145-54-9. Molecular formula: C32H27NO9. Mole weight: 569.56. | |
| 2',3',5'-Tri-O-benzoyl-2'-C-methyl-5-fluorouridine | 2',3',5'-Tri-O-benzoyl-2'-C-methyl-5-fluorouridine, a highly effective antiviral compound, demonstrates remarkable capabilities in combating viral infections. By impeding viral RNA replication and selectively targeting the viral polymerase, it exhibits an extensive range of activity against diverse viruses such as influenza and herpesvirus. Synonyms: 2',3',5'-Tri-O-benzoyl-2'-β-C-methyl-5-fluorouridine. Grades: ≥95%. CAS No. 2072145-49-2. Molecular formula: C31H25FN2O9. Mole weight: 588.54. | |
| 2',3',5'-Tri-O-benzoyl-2'-C-methyl-5-methoxyuridine | 2',3',5'-Tri-O-benzoyl-2'-C-methyl-5-methoxyuridine, an essential chemical compound in biomedicine research, has been hailed for its remarkable potential antitumor activity and growth inhibitory effects on cancer cells. As scientists continue to explore its possibilities, this versatile compound may also hold the key to treating devastating viral infections like hepatitis C and HIV. Synonyms: 2',3',5'-Tri-O-benzoyl-2'-β-C-methyl-5-methoxyuridine. Grades: ≥95%. CAS No. 2072145-79-8. Molecular formula: C32H28N2O10. Mole weight: 600.57. | |
| 2',3',5'-Tri-O-benzoyl-2'-C-methyl-5-methyluridine | 2',3',5'-Tri-O-benzoyl-2'-C-methyl-5-methyluridine is a valuable compound in the biomedical industry. It finds applications in the development of antiviral drugs targeting diseases caused by RNA viruses, like hepatitis C and influenza. This compound's unique chemical structure contributes to its potential therapeutic properties, making it a promising candidate for drug discovery and research in the field of biomedicine. Synonyms: (2R,3R,4R,5R)-5-((benzoyloxy)methyl)-3-methyl-2-(5-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)tetrahydrofuran-3,4-diyl dibenzoate; 5-Methyl-2'-C-methyluridine 2',3',5'-tribenzoate; 2',3',5'-Tri-O-benzoyl-2'-β-C-methyl-5-methyluridine; 2',3',5'-Tri-O-benzoyl-5-methyl-2'-C-methyluridine. Grades: ≥95%. CAS No. 957535-53-4. Molecular formula: C32H28N2O9. Mole weight: 584.57. | |
| 2',3',5'-Tri-O-benzoyl-2'C-methyl-5-trifluoromethyluridine | 2',3',5'-Tri-O-benzoyl-2'C-methyl-5-trifluoromethyluridine, a paramount chemical compound utilized in biomedical research, embodies immense intricacy in its function. Its multifarious applications within the domain lie predominantly in the amalgamation of nucleoside analogs and antiviral medications. A pivotal participant in the pursuit of prospective remedies for ailments like viral infections and cancer, this compound bestows a profound contribution. CAS No. 2072145-78-7. Molecular formula: C32H25F3N2O9. Mole weight: 638.54. | |
| 2',3',5'-Tri-O-benzoyl-2'-C-methylcytidine | 2',3',5'-Tri-O-benzoyl-2'-C-methylcytidine. Group: Biochemicals. Alternative Names: 1- (2, 3, 5-Tri-O-benzoyl-2-C-methyl-b-D-ribofuranosyl) cytosine. Grades: Highly Purified. CAS No. 640725-69-5. Pack Sizes: 5mg, 10mg, 25mg. Molecular Formula: C31H27N3O8. US Biological Life Sciences. | Worldwide |
| 2,3,5-Tri-O-benzoyl-2-C-methyl-D-arabinonic acid γ-lactone | 2,3,5-Tri-O-benzoyl-2-C-methyl-D-arabinonic acid γ-lactone is an extensively employed compound used for diverse disorders research, encompassing cancer and viral infections. Molecular formula: C27H22O8. Mole weight: 474.47. | |
| 2,3,5-Tri-O-benzoyl-2-C-methyl-D-ribofuranose | 2,3,5-Tri-O-benzoyl-2-C-methyl-D-ribofuranose is a crucial compound utilized in the field of biomedicine. This compound plays a significant role in the development of drugs used to treat various diseases, such as cancer and viral infections. Synonyms: 2,3,5-tri-O-benzoyl-2-C-methyl-D-ribofuranose; (3R,4R,5R)-5-((Benzoyloxy)methyl)-2-hydroxy-3-methyltetrahydrofuran-3,4-diyl dibenzoate; [(2R,3R,4R)-3,4-dibenzoyloxy-5-hydroxy-4-methyloxolan-2-yl]methyl benzoate; D-Ribofuranose, 2-C-methyl-, 2,3,5-tribenzoate; SCHEMBL1825830; DTXSID20725309; NGOREDWQTFTUTC-KXGJQKBVSA-N; A855463; W-202254; (3R,4R,5R)-4-(benzoyloxy)-5-[(benzoyloxy)methyl]-2-hydroxy-3-methyloxolan-3-yl benzoate; (3R,4R,5R)-5-((Benzoyloxy)methyl)-2-hydroxy-3-methyltetrahydrofuran-3,4-diyldibenzoate. CAS No. 30361-17-2. Molecular formula: C27H24O8. Mole weight: 476.47. | |
| 2,3,5-Tri-O-benzoyl-2-C-methyl-D-ribonic acid-1,4-lactone | 2,3,5-Tri-O-benzoyl-2-C-methyl-D-ribonic acid-1,4-lactone is a biochemical reagent used in the development of antiviral drugs, particularly to research of Influenza. It's a precursor in the creation of inhibitors for neuraminidase, an enzyme integral in disease spread. CAS No. 7392-74-7. Molecular formula: C27H22O8. Mole weight: 474.46. | |
| 2',3',5'-Tri-O-benzoyl-2'-C-methyluridine | 2',3',5'-Tri-O-benzoyl-2'-C-methyluridine is a meticulously constructed synthetic nucleoside analogue, having applications in the antiviral drug development. Synonyms: 1-(2,3,5-Tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)uracil; 2'-C-Methyl-2',3',5'-tri-O-benzoyluridine; (2R,3R,4R,5R)-5-((benzoyloxy)methyl)-2-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-3-methyltetrahydrofuran-3,4-diyl dibenzoate. Grades: ≥95%. CAS No. 23643-36-9. Molecular formula: C31H26N2O9. Mole weight: 570.55. | |
| 2',3',5'-Tri-O-benzoyl-5-hydroxymethyl-2'-C-methyluridine | 2',3',5'-Tri-O-benzoyl-5-hydroxymethyl-2'-C-methyluridine is a nucleoside derivative used in the synthesis of RNA molecules. It has potential applications in the treatment of viral infections such as HIV and hepatitis C, as well as in cancer therapy due to its ability to inhibit tumor growth. Synonyms: 2',3',5'-Tri-O-benzoyl-5-hydroxymethyl-2'-β-C-methyluridine. Grades: ≥95%. CAS No. 2305416-16-2. Molecular formula: C32H28N2O10. Mole weight: 600.57. | |
| 2',3',5'-Tri-O-benzoyl-5-hydroxymethyl-2'C-methyluridine | 2',3',5'-Tri-O-benzoyl-5-hydroxymethyl-2'C-methyluridine, an extensively employed compound within the biomedicine sector, exhibits great promise for the advancement of antiviral medications, particularly for the management of hepatitis C and other viral afflictions. Its extraordinary chemical composition enhances its effectiveness as an antiviral agent, thereby positioning it as a prospective subject necessitating additional investigation and development in the combat against viral ailments. | |
| 2',3',5'-Tri-O-benzoyl-5-hydroxymethyluridine | 2',3',5'-Tri-O-benzoyl-5-hydroxymethyluridine, a nucleoside analog exhibiting a remarkable therapeutic potential against various malignancies including lung and breast cancer, has enticed the attention of scientists and drug developers alike. Among several mechanisms, this compound is known to obstruct the biosynthesis of nucleotide and promote apoptosis. With its frequent employment in preclinical studies, 2',3',5'-Tri-O-benzoyl-5-hydroxymethyluridine represents a compelling candidate for the development of novel anticancer agents. Synonyms: (2R,3R,4R,5R)-2-((Benzoyloxy)methyl)-5-(5-(hydroxymethyl)-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)tetrahydrofuran-3,4-diyl dibenzoate; 5-hydroxymethyl-1-(tri-O-benzoyl-β-D-xylofuranosyl)-1H-pyrimidine-2,4-dione; 1-(2',3',5'-Tri-O-benzoyl-β-D-xylofuranosyl)-5-hydroxymethyl-uracil. Grades: ≥95%. CAS No. 53910-92-2. Molecular formula: C31H26N2O10. Mole weight: 586.55. | |
| 2',3',5'-Tri-O-benzoyl-5-methyl-4'-thiouridine | 2',3',5'-Tri-O-benzoyl-5-methyl-4'-thiouridine is a biomedical research tool for examining the antiviral attributes. HIV, HBV, HCV - all exhibit vulnerability to this potent thionucleoside analogue. Synonyms: 1-(2,3,5-Tri-O-benzoyl-4-thio-beta-D-ribofuranosyl)-5-methyluracil. Grades: ≥95%. Molecular formula: C31H26N2O8S. Mole weight: 586.61. | |
| 2',3',5'-Tri-O-benzoyl-6-methyluridine | 2',3',5'-Tri-O-benzoyl-6-methyluridine, a remarkable chemical compound employed in the field of biomedicine, possesses inherent potency. This compound showcases an exceptional attribute derived from the introduction of benzoyl groups onto the ribose ring. Consequently, it manifests substantial efficacy in combating diverse viral strains such as HIV and herpes. With its distinctive configuration and mode of function, it assumes a pivotal role in the advancement of drug development and contributes significantly to viral research endeavors. Synonyms: 2',3',5'-Tri-O-benzoyl-6-methyl-D-uridine; (2R,3R,4R,5R)-2-((benzoyloxy)methyl)-5-(6-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)tetrahydrofuran-3,4-diyl dibenzoate. Molecular formula: C31H26N2O9. Mole weight: 570.55. | |
| 2',3',5'-Tri-O-benzoyl-N6-benzyl-2'-C-methyladenosine | 2',3',5'-Tri-O-benzoyl-N6-benzyl-2'-C-methyladenosine. Group: Biochemicals. Grades: Highly Purified. Pack Sizes: 10mg, 25mg, 50mg, 100mg, 250mg. US Biological Life Sciences. | Worldwide |
| 2',3',5'-Tri-O-benzoyl-N6-benzyl-2'-C-methyladenosine | 2',3',5'-Tri-O-benzoyl-N6-benzyl-2'-C-methyladenosine is an indispensable pharmaceutical entity within the biomedical field, exhibiting remarkable potential in research of various afflictions including cancerous growths and viral ailments. Grades: ≥ 98% (HPLC). CAS No. 74829-55-3. Molecular formula: C39H33N5O7. Mole weight: 683.71. | |
| 2-[[4-[(2,4-Diaminopteridin-6-yl)methylamino]benzoyl]amino]-4-phosphon O-butanoic acid | Heterocyclic Organic Compound. CAS No. 106351-99-9. Catalog: ACM106351999. | |
| 2,4-Difluoro-3-methylbenzoyl chloride | Heterocyclic Organic Compound. Alternative Names: 2,4-DIFLUORO-3-METHYLBENZOYL CHLORIDE; 2, 4-Difluoro-3-methylBenzoylchloride98+%; Benzoylchloride, 2, 4-difluoro-3-methyl-(9CI). CAS No. 112857-70-2. Molecular formula: C8H5ClF2O. Mole weight: 190.57. Purity: 0.96. IUPACName: 2,4-difluoro-3-methylbenzoyl chloride. Canonical SMILES: CC1=C(C=CC(=C1F)C(=O)Cl)F. Density: 1.356g/cm³. Catalog: ACM112857702. | |
| 2-(4-(tert-Butyldimethylsilyloxy)benzoyl)-3-methylbutanenitrile | Heterocyclic Organic Compound. Alternative Names: 1184915-27-2, AKOS015917489, FT-0657931, A803973, S01-0097, 2-(4-(tert-butyldimethylsilyloxy)benzoyl)-3-methylbutanenitrile, 2-[4-[tert-butyl (dimethyl)silyl]oxyphenyl]carbonyl-3-methyl-butanenitrile, 2-[[4-[tert-butyl (dimethyl) silyl]oxyphenyl]-oxomethyl]-3-methylbutanenitrile. CAS No. 1184915-27-2. Molecular formula: C18H27NO2Si. Mole weight: 317.497980 [g/mol]. Purity: 0.96. IUPACName: 2-[4-[tert-butyl(dimethyl)silyl]oxybenzoyl]-3-methylbutanenitrile. Catalog: ACM1184915272. | |
| 2,6-Dichloro-9-(2-C-methyl-2,3,5-tri-O-benzoyl-β-D-ribofuranosyl)purine | 2,6-Dichloro-9-(2-C-methyl-2,3,5-tri-O-benzoyl-β-D-ribofuranosyl)purine is a nucleoside analogue, mainly used in research of viral infections, encompassing herpes, hepatitis B, and cytomegalovirus. T. Synonyms: (2R,3R,4R,5R)-5-((Benzoyloxy)methyl)-2-(2,6-dichloro-9H-purin-9-yl)-3-methyltetrahydrofuran-3,4-diyl dibenzoate; 2,6-Dichloro-9-(2,3,5-tri-O-benzoyl-2-C-methyl-beta-D-ribofuranosyl)-9H-purine; 9H-Purine, 2,6-dichloro-9-(2,3,5-tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)-. Grades: ≥95%. CAS No. 205171-10-4. Molecular formula: C32H24Cl2N4O7. Mole weight: 647.46. | |
| 2,6-Di-O-benzoyl-methyl-a-D-glucopyranoside | 2,6-Di-O-benzoyl-methyl-α-D-glucopyranoside is a valuable compound in the biomedical industry primarily utilized in drug development and research. Due to its unique chemical structure, it is widely used as a reagent in the synthesis and modification of glucose-based drugs. This compound demonstrates potential in treating various metabolic disorders, including diabetes and obesity, by targeting glucose metabolism pathways. Synonyms: [(2R,3S,4S,5R,6S)-5-benzoyloxy-3,4-dihydroxy-6-methoxyoxan-2-yl]methyl benzoate; methyl 2,6-di-O-benzoyl-alpha-d-glucopyranoside. CAS No. 26927-44-6. Molecular formula: C21H22O8. Mole weight: 402.39. | |
| 2-Amino-3-benzoyl-α - (methylthio) benzeneacetamide | 2-Amino-3-benzoyl-α - (methylthio) benzeneacetamide. Group: Biochemicals. Grades: Highly Purified. CAS No. 78281-61-5. Pack Sizes: 250mg. Molecular Formula: C16H16N2O2S, Molecular Weight: 300.38. US Biological Life Sciences. | Worldwide |
| 2-Amino-3-benzoyl-alpha- (methylthio) benzeneacetamide | 2-Amino-3-benzoyl-alpha- (methylthio) benzeneacetamide. Group: Biochemicals. Grades: Highly Purified. CAS No. 78281-61-5. Pack Sizes: 50g, 100g, 250g, 500g, 1g. Molecular Formula: C16H16N2O2S. US Biological Life Sciences. | Worldwide |
| 2-Amino-5-benzoyl-1-methylbenzimidazole | Mebendazole thermal decomposition product. Mebendazole impurity. Group: Biochemicals. Alternative Names: (2-Amino-1-methyl-1H-benzimidazol-5-yl)phenylmethanone; 1-Methyl-2-amino-5-benzoyl-(1H)benzimidazole. Grades: Highly Purified. CAS No. 66066-76-0. Pack Sizes: 50mg. US Biological Life Sciences. | Worldwide |
| 2-Amino-6-chloro-9-[(2,3,5-tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)]-9H-purine | 2-Amino-6-chloro-9-[(2,3,5-tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)]-9H-purine, a remarkably potent antiviral and antineoplastic agent, is a key treatment option for specific viral infections and cancer variations. This compound functions through halting the assimilation of viral DNA and RNA, consequently obstructing virus replication, while also bolstering apoptosis within cancer cells, arresting their growth and diffusion. Synonyms: (2R,3R,4R,5R)-2-(2-amino-6-chloro-9H-purin-9-yl)-5-((benzoyloxy)methyl)-3-methyltetrahydrofuran-3,4-diyl dibenzoate; 2-amino-6-chloro-9-(2,3,5-tri-o-benzoyl-2-c-methyl-beta-d-ribofuranosyl)purine; 6-Chloro-9-(2,3,5-tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)-9H-purin-2-amine. Grades: ≥95%. CAS No. 641571-44-0. Molecular formula: C32H26ClN5O7. Mole weight: 628.03. | |
| 2-Amino-6-chloro-9-(2-O-acetyl-5-O-benzoyl-3-O-methyl-β-D-ribofuranosyl)-9H-purine | 2-Amino-6-chloro-9-(2-O-acetyl-5-O-benzoyl-3-O-methyl-β-D-ribofuranosyl)-9H-purine is renowned for its efficacious antiviral properties, having mettle in combatting an array of DNA viruses. The multifaceted mechanism underlying its exemplary therapeutic potential involves the concurrent suppression of viral DNA replication and protein synthesis. Synonyms: 2-Amino-6-chloro-9-(2-O-acetyl-5-O-benzoyl-3-O-methyl-beta-D-ribofuranosyl)-9H-purine. Grades: ≥95%. Molecular formula: C20H20ClN5O6. Mole weight: 461.86. | |
| 2-Amino-9-[(2,3,5-tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)]-9H-purine | 2-Amino-9-[(2,3,5-tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)]-9H-purine is a highly efficacious antineoplastic agent with remarkable anti-tumor activity against a range of malignancies, including malignant myeloma and leukemia. The mechanism of action of this potent compound is mediated by its capacity to inhibit both RNA synthesis and modulate DNA repair mechanisms, culminating in a blunting of tumor growth. In addition to this, the DNA-modifying potential of this molecule represents an aspect of broad interest for researchers investigating novel genetic modulation tools. Synonyms: (2R,3R,4R,5R)-2-(2-Amino-9H-purin-9-yl)-5-((benzoyloxy)methyl)-3-methyltetrahydrofuran-3,4-diyl dibenzoate; 9-(2,3,5-Tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)-9H-purin-2-amine. Grades: ≥95%. CAS No. 1345969-99-4. Molecular formula: C32H27N5O7. Mole weight: 593.59. | |
| 2-?Azido-3,5-di-O-benzoyl-?2-?deoxy-?2-?C-?methyl-D-?ribonic acid g-?lactone | 2-Azido-3,5-di-O-benzoyl-2-deoxy-2-C-methyl-D-ribonic acid g-lactone, a paramount compound extensively employed in the biomedical sector, showcases its indispensability. It serves as a primordial constituent in the production of prospective antiviral substances, with specific emphasis on HIV and herpes simplex viruses. Its extraordinary chemical composition bestows it with commendable inhibitory properties against viral replication, thus rendering it an invaluable asset in the realm of antiviral pharmaceutical advancement and scholarly investigation. Synonyms: SB15611; 1403574-26-4; (2R,3S,4R)-4-azido-2-[(benzoyloxy)methyl]-4-methyl-5-oxooxolan-3-yl benzoate. CAS No. 1403574-26-4. Molecular formula: C20H17N3O6. Mole weight: 395.37. | |
| 2-Benzoyl-1-methyl-1H-indole | Heterocyclic Organic Compound. CAS No. 1025-99-6. Catalog: ACM1025996. | |
| 2-(Benzoyl)-5-methylbenzoic acid | Heterocyclic Organic Compound. Alternative Names: 6-Benzoyl-m-toluic acid, m-Toluic acid, 6-benzoyl-, NSC122997, 4-Methylbenzophenone-2-carboxylic acid, NSC 122997, CID97434, Benzoic acid, 6-benzoyl-3-methyl-, BRN 2695362, Benzoic acid, 6-benzoyl-3-methyl- (9CI), LS-154223, 4-10-00-02990 (Beilstein Handbook Reference), 1147-41-7. CAS No. 1147-41-7. Molecular formula: C15H12O3. Mole weight: 240.254 g/mol. Purity: 0.96. IUPACName: 2-benzoyl-5-methylbenzoic acid. Canonical SMILES: CC1=CC (=C (C=C1)C (=O)C2=CC=CC=C2)C (=O)O. Density: 1.223g/cm³. Catalog: ACM1147417. | |
| 2-(Benzoylamino)-4-(methylsulfonyl)butanoic acid | Heterocyclic Organic Compound. Alternative Names: ZINC04218290, CID7130766, 115527-63-4. CAS No. 115527-63-4. Molecular formula: C12H15NO5S. Mole weight: 285.316. Purity: 0.96. IUPACName: (2R)-2-benzamido-4-methylsulfonylbutanoate. Canonical SMILES: CS (=O) (=O)CCC (C (=O)O)NC (=O)C1=CC=CC=C1. Catalog: ACM115527634. | |
Our database is helping our users find suppliers everyday.
